{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "40dddbfb-a127-4b16-ae42-d1513fc91f06",
          "code": "115-79-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=115-79-7",
          "code_system": "CAS",
          "references": [
            "ddf9d943-1bc5-4742-88b9-6800e5962393",
            "43222c9b-ff9a-4862-bdc2-77e27027be2b"
          ]
        },
        {
          "uuid": "68440960-37fd-4675-8537-ff5466ad96bb",
          "code": "C47388",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47388",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ddf9d943-1bc5-4742-88b9-6800e5962393"
          ]
        },
        {
          "uuid": "028f805b-2819-483c-8531-60805cd45859",
          "code": "D000549",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68000549",
          "code_system": "MESH",
          "references": [
            "ddf9d943-1bc5-4742-88b9-6800e5962393"
          ]
        },
        {
          "uuid": "12bc64e4-af5a-4df5-9a2d-818e050e7eaf",
          "code": "AMBENONIUM CHLORIDE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Ambenonium_chloride",
          "code_system": "WIKIPEDIA",
          "references": [
            "ddf9d943-1bc5-4742-88b9-6800e5962393"
          ]
        },
        {
          "uuid": "b4e0df5e-ce86-4a95-b35b-b64f4857235c",
          "code": "SUB05394MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "ddf9d943-1bc5-4742-88b9-6800e5962393"
          ]
        },
        {
          "uuid": "f4b7b351-6075-4ec3-9a07-bf01c51d6980",
          "code": "552",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=552",
          "code_system": "INN",
          "references": [
            "ddf9d943-1bc5-4742-88b9-6800e5962393"
          ]
        },
        {
          "uuid": "3be179e8-d6af-4047-86e0-305a16888af0",
          "code": "624",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/624/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "ddf9d943-1bc5-4742-88b9-6800e5962393"
          ]
        },
        {
          "uuid": "aa2452b6-7adf-42d0-846e-926ab099fbeb",
          "code": "m1643",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1643?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "ddf9d943-1bc5-4742-88b9-6800e5962393"
          ]
        },
        {
          "uuid": "03163af6-ea2d-4d47-9541-0ad2b4ac1c90",
          "code": "CHEMBL1652",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1652",
          "code_system": "ChEMBL",
          "references": [
            "ddf9d943-1bc5-4742-88b9-6800e5962393"
          ]
        },
        {
          "uuid": "55f0d1dd-56b1-45b7-9355-2283ed39b828",
          "code": "204-107-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.003.734",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ddf9d943-1bc5-4742-88b9-6800e5962393"
          ]
        },
        {
          "uuid": "7076fa86-cf66-4fc6-8ff7-af37707b94e8",
          "code": "8288",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/8288",
          "code_system": "PUBCHEM",
          "references": [
            "ddf9d943-1bc5-4742-88b9-6800e5962393"
          ]
        },
        {
          "uuid": "23549012-a3ca-74e9-0dbb-6be1c1e88a29",
          "code": "DTXSID3022582",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3022582",
          "code_system": "EPA CompTox",
          "references": [
            "6e50f4ee-10fa-e625-3988-fc6c94f48d37"
          ]
        },
        {
          "uuid": "34ef07a9-3548-c64a-9ef9-b7edf0d130f0",
          "code": "C47792",
          "comments": "Pharmacologic Substance[C1909]|Enzyme Inhibitor[C471]|Acetylcholinesterase Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47792",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5c4a73f9-cf75-2cc2-afbb-b3861b1afa02"
          ]
        },
        {
          "uuid": "5256df20-acd7-4d15-8dc0-f7dc68fdfef5",
          "code": "51FOB87G3I",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ae94d605-f1e8-dc0a-c3e5-94c27d7be170",
          "code": "DBSALT001309",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DBSALT001309",
          "code_system": "DRUG BANK",
          "references": [
            "5c4a73f9-cf75-2cc2-afbb-b3861b1afa02"
          ]
        },
        {
          "uuid": "f21db679-4749-57cc-467c-d76790cb68e6",
          "code": "2628",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:2628",
          "code_system": "CHEBI",
          "references": [
            "5c4a73f9-cf75-2cc2-afbb-b3861b1afa02"
          ]
        },
        {
          "uuid": "58ee4490-59f7-06b2-7823-609f02e4d2c4",
          "code": "100000087666",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "5831df93-a8f8-be80-79b4-630a32985622"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "3f290afe-a2b5-4bd3-b1f7-cdb89a0ad458",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "4366260f-4652-44c9-89c2-05ef16a77d4b",
            "refuuid": "1b8caebf-ee2b-4eab-b758-1e797fc66ed0",
            "name": "AMBENONIUM",
            "unii": "L16PUN799N",
            "linking_id": "L16PUN799N",
            "ref_pname": "AMBENONIUM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "263bfaa7-a2d2-4272-9bb1-061026553ee8",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "2855aebd-7d93-457c-972e-33112f224642",
            "refuuid": "1b8caebf-ee2b-4eab-b758-1e797fc66ed0",
            "name": "AMBENONIUM",
            "unii": "L16PUN799N",
            "linking_id": "L16PUN799N",
            "ref_pname": "AMBENONIUM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b70bf7b9-3b08-4999-ab72-b378ea8e5ba0",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "23b5bafb-9a18-49d5-bbae-d535e44d99e3"
          ],
          "related_substance": {
            "uuid": "1ce564d0-457a-438d-828d-57739bc51b14",
            "refuuid": "fe8f0349-e023-4e62-a74f-fd1baf86bf9c",
            "name": "AMBENONIUM CHLORIDE TETRAHYDRATE",
            "unii": "9T1OT01KW1",
            "linking_id": "9T1OT01KW1",
            "ref_pname": "AMBENONIUM CHLORIDE TETRAHYDRATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fbb33ca3-2cc1-435a-a552-5769e03c0bad",
          "name": "AMBENONIUM CHLORIDE",
          "stdName": "AMBENONIUM CHLORIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "21b796c9-6627-482c-b7f6-ab1e536981c8",
            "16f762e6-9396-4335-8b2c-3c0b91ea30f7",
            "786484ff-f9e1-466c-89b8-5f15660e4fb4",
            "af3e2431-af78-4a51-bf1a-3ca42e61d523",
            "604c944e-720a-40e6-a2c1-1601836aafb5",
            "392057ca-1a69-4fe5-ab8b-59a67552d92b",
            "700b0dca-7b35-442a-8a7f-5b7381278bc1",
            "9daad0b4-3bb0-48e4-b643-19fb0bb680f6",
            "8609c73d-b06c-4119-86ef-29acffc89b6e",
            "34b2767a-1b8b-4e9b-92e3-6fe745f0668f",
            "cc38eaf5-0320-4313-9ab9-0d3721d4fcd7"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "7487a410-7c2d-4222-9387-3b860089c95d",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "e60c5f7d-f2a7-4584-b60e-3b55801ceddb",
          "name": "AMBENONIUM CHLORIDE [JAN]",
          "stdName": "AMBENONIUM CHLORIDE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71c7c2fd-1cca-d345-c585-5a55f1f561ee"
          ],
          "display_name": false
        },
        {
          "uuid": "3d61e6db-65fe-4cf2-8a9e-d304c564d37d",
          "name": "AMBENONIUM CHLORIDE [MI]",
          "stdName": "AMBENONIUM CHLORIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "34b2767a-1b8b-4e9b-92e3-6fe745f0668f"
          ],
          "display_name": false
        },
        {
          "uuid": "9bdde4e0-74e3-4152-a30e-95bf9b5a7032",
          "name": "AMBENONIUM CHLORIDE [ORANGE BOOK]",
          "stdName": "AMBENONIUM CHLORIDE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "21b796c9-6627-482c-b7f6-ab1e536981c8"
          ],
          "display_name": false
        },
        {
          "uuid": "b2de33da-7db2-4703-ac7e-75eeaa3a0f8e",
          "name": "AMBENONIUM CHLORIDE [VANDF]",
          "stdName": "AMBENONIUM CHLORIDE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "786484ff-f9e1-466c-89b8-5f15660e4fb4"
          ],
          "display_name": false
        },
        {
          "uuid": "50fc1722-77c4-c109-55d7-8596e20ce2b5",
          "name": "Ambenonium chloride [WHO-DD]",
          "stdName": "AMBENONIUM CHLORIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15a8edc0-e8ee-0ccd-4ccc-518cd4519632"
          ],
          "display_name": false
        },
        {
          "uuid": "c8b069ea-c58c-44e7-8142-e6fba1e3913a",
          "name": "BENZENEMETHANAMINIUM, N,N'-((1,2-DIOXO-1,2-ETHANEDIYL)BIS(IMINO-2,1-ETHANEDIYL))BIS(2-CHLORO-N,N-DIETHYL-, DICHLORIDE",
          "stdName": "BENZENEMETHANAMINIUM, N,N'-((1,2-DIOXO-1,2-ETHANEDIYL)BIS(IMINO-2,1-ETHANEDIYL))BIS(2-CHLORO-N,N-DIETHYL-, DICHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "455488d8-208e-4eed-bbbb-6a59eb1f6aff"
          ],
          "display_name": false
        },
        {
          "uuid": "375543b9-81a4-4aba-9471-e209808eb709",
          "name": "MYTELASE",
          "stdName": "MYTELASE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "455488d8-208e-4eed-bbbb-6a59eb1f6aff"
          ],
          "display_name": false
        },
        {
          "uuid": "9dd16ee4-ae19-46ff-98c7-a995ff356717",
          "name": "[Oxalylbis(iminoethylene)]bis[(O-chlorobenzyl)diethylammonium] dichloride",
          "stdName": "(OXALYLBIS(IMINOETHYLENE))BIS((O-CHLOROBENZYL)DIETHYLAMMONIUM) DICHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "455488d8-208e-4eed-bbbb-6a59eb1f6aff"
          ],
          "display_name": false
        },
        {
          "uuid": "7302d979-30d3-42db-93d8-48786b3e4781",
          "name": "ambenonium chloride [INN]",
          "stdName": "AMBENONIUM CHLORIDE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af3e2431-af78-4a51-bf1a-3ca42e61d523"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9daad0b4-3bb0-48e4-b643-19fb0bb680f6",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "455488d8-208e-4eed-bbbb-6a59eb1f6aff",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af3e2431-af78-4a51-bf1a-3ca42e61d523",
          "citation": "INN Proposed List 6",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL06.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "21b796c9-6627-482c-b7f6-ab1e536981c8",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "34b2767a-1b8b-4e9b-92e3-6fe745f0668f",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "16f762e6-9396-4335-8b2c-3c0b91ea30f7",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "786484ff-f9e1-466c-89b8-5f15660e4fb4",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ddf9d943-1bc5-4742-88b9-6800e5962393",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389702000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6cd8fed7-91e6-4363-b1da-ea91deea6f52",
          "citation": "SRS import [51FOB87G3I]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=51FOB87G3I",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389702000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca9fe8df-2c6c-47c0-8583-75e2db9e6649",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8609c73d-b06c-4119-86ef-29acffc89b6e",
          "citation": "AMBENONIUM CHLORIDE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "700b0dca-7b35-442a-8a7f-5b7381278bc1",
          "citation": "AMBENONIUM CHLORIDE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "604c944e-720a-40e6-a2c1-1601836aafb5",
          "citation": "AMBENONIUM CHLORIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cc38eaf5-0320-4313-9ab9-0d3721d4fcd7",
          "citation": "AMBENONIUM CHLORIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "392057ca-1a69-4fe5-ab8b-59a67552d92b",
          "citation": "AMBENONIUM CHLORIDE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "71c7c2fd-1cca-d345-c585-5a55f1f561ee",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6e50f4ee-10fa-e625-3988-fc6c94f48d37",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=115-79-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5831df93-a8f8-be80-79b4-630a32985622",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "23b5bafb-9a18-49d5-bbae-d535e44d99e3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5c4a73f9-cf75-2cc2-afbb-b3861b1afa02",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "43222c9b-ff9a-4862-bdc2-77e27027be2b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "fe672a47-6840-7ebd-089e-fdfdd29522f4",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "15a8edc0-e8ee-0ccd-4ccc-518cd4519632",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "605eae0d-b177-4b31-bf1b-0209ada14b7f",
          "id": "605eae0d-b177-4b31-bf1b-0209ada14b7f",
          "molfile": "\n  Marvin  01132104592D          \n\n  1  0  0  0  0  0            999 V2000\n    9.1356  -21.3191    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "dc08a142-5a5a-4e1e-854b-07a8b5b591e5"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "02229a74-4bee-47ad-8095-f69a2c10fafc",
          "id": "02229a74-4bee-47ad-8095-f69a2c10fafc",
          "molfile": "\n  Marvin  01132100262D          \n\n 36 37  0  0  0  0            999 V2000\n    8.5802  -18.7638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5845  -19.5905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1732  -20.1792    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n    9.7577  -19.5905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7494  -18.7638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4592  -20.5926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7452  -20.1834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0312  -20.5968    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3173  -20.1834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3131  -19.3567    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6033  -20.5968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5991  -21.4235    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8893  -20.1918    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1753  -20.6051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4614  -20.1960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7474  -20.6093    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n    3.3319  -21.1938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3236  -22.0205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1587  -21.1938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1545  -22.0205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0334  -20.1960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3194  -20.6093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3194  -21.4318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6055  -21.8452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1085  -21.4360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1127  -20.6093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6012  -20.1960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5929  -19.3693    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    9.8871  -20.5843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6011  -20.1709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5969  -19.3525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3026  -18.9392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0249  -19.3442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0291  -20.1709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3151  -20.5843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3109  -21.4110    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3  6  1  0  0  0  0\n 29  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n  9 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 11  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 19 16  1  0  0  0  0\n 21 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 20 19  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 27 22  2  0  0  0  0\n 24 23  2  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  2  0  0  0  0\n 26 27  1  0  0  0  0\n 28 27  1  0  0  0  0\n 30 29  1  0  0  0  0\n 31 30  1  0  0  0  0\n 35 30  2  0  0  0  0\n 32 31  2  0  0  0  0\n 33 32  1  0  0  0  0\n 34 33  2  0  0  0  0\n 34 35  1  0  0  0  0\n 36 35  1  0  0  0  0\nM  CHG  2   3   1  16   1\nM  END",
          "smiles": "CC[N+](CC)(CCNC(=O)C(=O)NCC[N+](CC)(CC)Cc1ccccc1Cl)Cc2ccccc2Cl",
          "formula": "C28H42Cl2N4O2",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3e85e66a-586e-4ecb-81d1-c34e12c99bf3"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "537.5656",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "eb9b48ac-80b2-4b19-bbe5-3fc02f453219",
      "version": "15",
      "structure": {
        "id": "117a59e5-1e96-4312-a361-e4e8e6dc7224",
        "molfile": "\n  Marvin  01132101082D          \n\n 38 37  0  0  0  0            999 V2000\n    5.6033  -20.5968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3173  -20.1834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3194  -20.6093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6011  -20.1709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1732  -20.1792    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    2.7474  -20.6093    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    9.8871  -20.5843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0334  -20.1960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6012  -20.1960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3151  -20.5843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5991  -21.4235    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3131  -19.3567    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8893  -20.1918    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0312  -20.5968    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3109  -21.4110    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.5929  -19.3693    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.1753  -20.6051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7452  -20.1834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4614  -20.1960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4592  -20.5926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5969  -19.3525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3194  -21.4318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3319  -21.1938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5845  -19.5905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7577  -19.5905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1587  -21.1938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1127  -20.6093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0291  -20.1709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5802  -18.7638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3236  -22.0205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7494  -18.7638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1545  -22.0205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6055  -21.8452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3026  -18.9392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0249  -19.3442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1085  -21.4360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1356  -21.3191    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\n    2.7474  -19.4277    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  8  1  0  0  0  0\n  4  7  1  0  0  0  0\n  5 20  1  0  0  0  0\n  6 19  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  3  2  0  0  0  0\n 10  4  2  0  0  0  0\n 11  1  2  0  0  0  0\n 12  2  2  0  0  0  0\n 13  1  1  0  0  0  0\n 14  2  1  0  0  0  0\n 15 10  1  0  0  0  0\n 16  9  1  0  0  0  0\n 17 13  1  0  0  0  0\n 18 14  1  0  0  0  0\n 19 17  1  0  0  0  0\n 20 18  1  0  0  0  0\n 21  4  1  0  0  0  0\n 22  3  1  0  0  0  0\n 23  6  1  0  0  0  0\n 24  5  1  0  0  0  0\n 25  5  1  0  0  0  0\n 26  6  1  0  0  0  0\n 27  9  1  0  0  0  0\n 28 10  1  0  0  0  0\n 29 24  1  0  0  0  0\n 30 23  1  0  0  0  0\n 31 25  1  0  0  0  0\n 32 26  1  0  0  0  0\n 33 22  2  0  0  0  0\n 34 21  2  0  0  0  0\n 35 34  1  0  0  0  0\n 36 33  1  0  0  0  0\n 27 36  2  0  0  0  0\n 28 35  2  0  0  0  0\nM  CHG  4   5   1   6   1  37  -1  38  -1\nM  END",
        "smiles": "CC[N+](CC)(CCNC(=O)C(=O)NCC[N+](CC)(CC)Cc1ccccc1Cl)Cc2ccccc2Cl.[Cl-].[Cl-]",
        "formula": "C28H42Cl2N4O2.2Cl",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "608.4715",
        "optical_activity": "NONE",
        "references": [
          "6cd8fed7-91e6-4363-b1da-ea91deea6f52",
          "ca9fe8df-2c6c-47c0-8583-75e2db9e6649",
          "af3e2431-af78-4a51-bf1a-3ca42e61d523"
        ],
        "stereo_centers": 0
      },
      "unii": "51FOB87G3I"
    }
  ]
}