{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "7ee856a7-2fef-4120-bc2d-3b8820819961", "code": "1709-70-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1709-70-2", "code_system": "CAS", "references": [ "f51ed503-da30-4530-863a-5ef3bd4f9b78", "94f9fc50-b703-4db4-b755-750751909c57" ] }, { "uuid": "6e6b974a-780b-48d1-803f-b36481d2452a", "code": "1428857", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1428857/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "f51ed503-da30-4530-863a-5ef3bd4f9b78" ] }, { "uuid": "dfa4f92b-8a3d-472d-b53b-709e30365d38", "code": "74370", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/74370", "code_system": "PUBCHEM", "references": [ "f51ed503-da30-4530-863a-5ef3bd4f9b78" ] }, { "uuid": "b9076eac-4e56-4e9b-9389-361268f594f1", "code": "216-971-0", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.015.428", "code_system": "ECHA (EC/EINECS)", "references": [ "f51ed503-da30-4530-863a-5ef3bd4f9b78" ] }, { "uuid": "af674ccd-88f5-8640-01b9-a807fb362001", "code": "DTXSID6027428", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6027428", "code_system": "EPA CompTox", "references": [ "d2b3a50c-dba0-ceb5-6b6a-b7f0c4e12edf" ] }, { "uuid": "b749bdb0-9a16-6c26-adc9-dd7c187eced0", "code": "1544949", "type": "PRIMARY", "url": "https://store.usp.org/product/1544949", "code_system": "RS_ITEM_NUM", "references": [ "36309472-db82-6cc7-bcee-041bd915d32d" ] }, { "uuid": "75747deb-0c4a-4b88-aeff-d6546383ba4e", "code": "51DM34B894", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "53464923-e3a8-ec72-7a8b-0bef84ae9b9a", "code": "85846", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=85846", "code_system": "NSC", "references": [ "3b5cdede-ed08-5d25-ba67-190eb6a8ac76" ] }, { "uuid": "3f476e4a-737e-ba3d-1d20-dd323eaba76c", "code": "51DM34B894", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=51DM34B894", "code_system": "DAILYMED", "references": [ "2e3861bc-8152-756a-6cfc-1874a1fcfbf4" ] } ], "substance_class": "chemical", "names": [ { "uuid": "e2490720-0729-49ee-b6dc-1a78c7e3972b", "name": "2,4,6-TRIS(3,5-DI-TERT-BUTYL-4-HYDROXYBENZYL)MESITYLENE", "stdName": "2,4,6-TRIS(3,5-DI-TERT-BUTYL-4-HYDROXYBENZYL)MESITYLENE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "bedda688-7f8c-429e-a891-82d70d53635b" ], "display_name": false }, { "uuid": "e14ff665-7dbe-429f-a208-5c6b751e7857", "name": "IRGANOX 1330", "stdName": "IRGANOX 1330", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "753806ee-048a-488e-9f93-c7ceb9ba4800", "870d00bf-df60-435d-b086-43bb31e49e97" ], "display_name": false }, { "uuid": "baa978cf-8894-45e4-bb98-6c36cf807131", "name": "NSC-85846", "stdName": "NSC-85846", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "da7051c0-439b-4786-bb43-0e6615ead4b1", "870d00bf-df60-435d-b086-43bb31e49e97" ], "display_name": false }, { "uuid": "2636fac8-7368-49b5-952a-7728c859cce1", "name": "PLASTIC ADDITIVE 3", "stdName": "PLASTIC ADDITIVE 3", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1d0bac90-4f76-4adf-9704-7c63219b6a14", "125cdbd7-77a0-414d-bd57-9c0e3f5933c2", "870d00bf-df60-435d-b086-43bb31e49e97" ], "display_name": false }, { "uuid": "2e256bf4-4105-4527-a013-24acae4d097a", "name": "PLASTIC ADDITIVE 3 [USP-RS]", "stdName": "PLASTIC ADDITIVE 3 [USP-RS]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "125cdbd7-77a0-414d-bd57-9c0e3f5933c2", "870d00bf-df60-435d-b086-43bb31e49e97" ], "display_name": false }, { "uuid": "c1ce7c49-1845-45e0-86df-b7727d31d3eb", "name": "TRIS-BHT MESITYLENE", "stdName": "TRIS-BHT MESITYLENE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "753806ee-048a-488e-9f93-c7ceb9ba4800", "870d00bf-df60-435d-b086-43bb31e49e97", "a8f52f82-dc54-4a55-bb53-f5b454df4255", "c328dd76-306f-49eb-b3a5-0adbe4fe4b84" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "b7240c40-0f5c-4c91-ae47-e704ca8325ef", "name_org": "INCI" } ] } ], "references": [ { "uuid": "bedda688-7f8c-429e-a891-82d70d53635b", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "753806ee-048a-488e-9f93-c7ceb9ba4800", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "870d00bf-df60-435d-b086-43bb31e49e97", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a8f52f82-dc54-4a55-bb53-f5b454df4255", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "125cdbd7-77a0-414d-bd57-9c0e3f5933c2", "citation": "USP-RS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "da7051c0-439b-4786-bb43-0e6615ead4b1", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f51ed503-da30-4530-863a-5ef3bd4f9b78", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391004000, "tags": [ "NOMEN" ] }, { "uuid": "853784b3-3833-45ca-bd4f-2a1161fd9abd", "citation": "SRS import [51DM34B894]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=51DM34B894", "doc_type": "SRS", "public_domain": true, "document_date": 1493391004000, "tags": [ "NOMEN" ] }, { "uuid": "260846b4-48d5-42d1-9c5f-6bc45c2501a0", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c328dd76-306f-49eb-b3a5-0adbe4fe4b84", "citation": "TRIS-BHT MESITYLENE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "1d0bac90-4f76-4adf-9704-7c63219b6a14", "citation": "PLASTIC ADDITIVE 3 [USP-RS]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "d2b3a50c-dba0-ceb5-6b6a-b7f0c4e12edf", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1709-70-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "94f9fc50-b703-4db4-b755-750751909c57", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "36309472-db82-6cc7-bcee-041bd915d32d", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "3b5cdede-ed08-5d25-ba67-190eb6a8ac76", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "2e3861bc-8152-756a-6cfc-1874a1fcfbf4", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "a5f434fd-75e0-4518-ac69-c3250b546b08", "id": "a5f434fd-75e0-4518-ac69-c3250b546b08", "molfile": "\n Marvin 01132108372D \n\n 57 60 0 0 0 0 999 V2000\n 6.6855 -5.1077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1143 -5.3566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1143 -6.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2566 -6.6719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5380 -6.2590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5380 -5.4305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8207 -5.0184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1108 -5.4305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6815 -5.1867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1108 -6.2590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8189 -6.6710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3953 -6.6695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9847 -5.9541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8059 -7.3851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6797 -7.0801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8207 -4.1944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6448 -4.1944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9922 -4.1944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8207 -3.3658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8282 -6.5894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8282 -7.0874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5409 -6.1854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3943 -6.6846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3943 -7.5086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6753 -7.9213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6753 -8.7491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3846 -9.1592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3846 -9.6574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1013 -8.7510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1013 -7.9281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8131 -9.1683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3959 -9.8799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2302 -8.4566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5292 -9.5854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9552 -9.1597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5446 -8.4442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3703 -9.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2397 -9.5748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5409 -5.3576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9757 -5.1106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8280 -4.9432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8280 -3.9517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5455 -3.5365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2581 -3.9531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9772 -3.5365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9772 -2.7124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6912 -2.2995 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2554 -2.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5455 -2.7124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2554 -1.4726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4314 -1.4726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0795 -1.4726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2554 -0.6478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6912 -3.9495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1042 -3.2353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2782 -4.6681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4054 -4.3670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 41 2 2 0 0 0 0\n 3 4 1 0 0 0 0\n 3 20 2 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 1 0 0 0 0\n 5 11 2 0 0 0 0\n 7 6 2 0 0 0 0\n 8 7 1 0 0 0 0\n 7 16 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 8 2 0 0 0 0\n 11 10 1 0 0 0 0\n 10 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 1 0 0 0 0\n 12 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 16 19 1 0 0 0 0\n 20 21 1 0 0 0 0\n 20 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 22 39 2 0 0 0 0\n 23 24 1 0 0 0 0\n 25 24 1 0 0 0 0\n 24 30 2 0 0 0 0\n 26 25 2 0 0 0 0\n 27 26 1 0 0 0 0\n 26 35 1 0 0 0 0\n 27 28 1 0 0 0 0\n 29 27 2 0 0 0 0\n 30 29 1 0 0 0 0\n 29 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 31 33 1 0 0 0 0\n 31 34 1 0 0 0 0\n 35 36 1 0 0 0 0\n 35 37 1 0 0 0 0\n 35 38 1 0 0 0 0\n 39 40 1 0 0 0 0\n 39 41 1 0 0 0 0\n 42 41 1 0 0 0 0\n 43 42 1 0 0 0 0\n 43 44 1 0 0 0 0\n 49 43 2 0 0 0 0\n 44 45 2 0 0 0 0\n 45 46 1 0 0 0 0\n 45 54 1 0 0 0 0\n 47 46 1 0 0 0 0\n 46 48 2 0 0 0 0\n 48 49 1 0 0 0 0\n 48 50 1 0 0 0 0\n 50 51 1 0 0 0 0\n 50 52 1 0 0 0 0\n 50 53 1 0 0 0 0\n 54 55 1 0 0 0 0\n 54 56 1 0 0 0 0\n 54 57 1 0 0 0 0\nM END", "smiles": "Cc1c(Cc2cc(c(c(c2)C(C)(C)C)O)C(C)(C)C)c(C)c(Cc3cc(c(c(c3)C(C)(C)C)O)C(C)(C)C)c(C)c1Cc4cc(c(c(c4)C(C)(C)C)O)C(C)(C)C", "formula": "C54H78O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "e59ae02d-1454-4e46-a659-23ce0df84dbc" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "775.1973", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "991ed580-7edf-459d-b6f0-bc45be22a369", "version": "10", "structure": { "id": "cba2346b-2408-4b06-a381-0f4b62d2c635", "molfile": "\n Marvin 01132110312D \n\n 57 60 0 0 0 0 999 V2000\n 10.6912 -2.2995 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9772 -2.7124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2554 -2.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5455 -2.7124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5455 -3.5365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8280 -3.9517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8280 -4.9432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1143 -5.3566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6855 -5.1077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1143 -6.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8282 -6.5894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8282 -7.0874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5409 -6.1854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5409 -5.3576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9757 -5.1106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3943 -6.6846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3943 -7.5086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1013 -7.9281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1013 -8.7510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3846 -9.1592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3846 -9.6574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6753 -8.7491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6753 -7.9213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9552 -9.1597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5446 -8.4442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3703 -9.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2397 -9.5748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8131 -9.1683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3959 -9.8799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2302 -8.4566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5292 -9.5854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2566 -6.6719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5380 -6.2590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8189 -6.6710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1108 -6.2590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1108 -5.4305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6815 -5.1867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8207 -5.0184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5380 -5.4305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8207 -4.1944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6448 -4.1944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9922 -4.1944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8207 -3.3658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3953 -6.6695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9847 -5.9541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8059 -7.3851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6797 -7.0801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2581 -3.9531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9772 -3.5365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6912 -3.9495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1042 -3.2353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2782 -4.6681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4054 -4.3670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2554 -1.4726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4314 -1.4726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0795 -1.4726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2554 -0.6478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 7 1 0 0 0 0\n 14 15 1 0 0 0 0\n 13 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 20 22 1 0 0 0 0\n 22 23 2 0 0 0 0\n 23 17 1 0 0 0 0\n 22 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 24 26 1 0 0 0 0\n 24 27 1 0 0 0 0\n 19 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 28 30 1 0 0 0 0\n 28 31 1 0 0 0 0\n 10 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 2 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 2 0 0 0 0\n 36 37 1 0 0 0 0\n 36 38 1 0 0 0 0\n 38 39 2 0 0 0 0\n 39 33 1 0 0 0 0\n 38 40 1 0 0 0 0\n 40 41 1 0 0 0 0\n 40 42 1 0 0 0 0\n 40 43 1 0 0 0 0\n 35 44 1 0 0 0 0\n 44 45 1 0 0 0 0\n 44 46 1 0 0 0 0\n 44 47 1 0 0 0 0\n 5 48 1 0 0 0 0\n 48 49 2 0 0 0 0\n 49 2 1 0 0 0 0\n 49 50 1 0 0 0 0\n 50 51 1 0 0 0 0\n 50 52 1 0 0 0 0\n 50 53 1 0 0 0 0\n 3 54 1 0 0 0 0\n 54 55 1 0 0 0 0\n 54 56 1 0 0 0 0\n 54 57 1 0 0 0 0\nM END", "smiles": "Cc1c(Cc2cc(c(c(c2)C(C)(C)C)O)C(C)(C)C)c(C)c(Cc3cc(c(c(c3)C(C)(C)C)O)C(C)(C)C)c(C)c1Cc4cc(c(c(c4)C(C)(C)C)O)C(C)(C)C", "formula": "C54H78O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "775.1973", "optical_activity": "NONE", "references": [ "853784b3-3833-45ca-bd4f-2a1161fd9abd", "260846b4-48d5-42d1-9c5f-6bc45c2501a0" ], "stereo_centers": 0 }, "unii": "51DM34B894" } ] }