{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c7087cee-f374-469f-9d33-7aaa51dc2f16",
          "code": "1000617-88-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1000617-88-8",
          "code_system": "CAS",
          "references": [
            "8b37eb65-9952-46bf-a83d-bc97da4bbd7f",
            "4883ca92-539f-4a04-aa7c-4850017985d9"
          ]
        },
        {
          "uuid": "40625e18-5ddd-4eec-bd1a-4cbceaf651b4",
          "code": "42641526",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/42641526",
          "code_system": "PUBCHEM",
          "references": [
            "8b37eb65-9952-46bf-a83d-bc97da4bbd7f"
          ]
        },
        {
          "uuid": "a6c63e71-7c8f-2c96-4179-5259360b5a8a",
          "code": "DTXSID20142895",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20142895",
          "code_system": "EPA CompTox",
          "references": [
            "51221019-39d9-bcef-a723-fb0004ce3982"
          ]
        },
        {
          "uuid": "e918e436-51ca-4190-a187-dccf33339acb",
          "code": "516H2PJA4H",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "4453cf0e-56d2-494e-95d3-8ebaf6fc6e28",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "365f01c2-73fc-4658-ad27-af7384aece78",
            "refuuid": "716bbb3a-95f9-4456-b4ac-873cd9845683",
            "name": "ETHYLARGININOATE ACETAMIDOMETHIONAMIDE HYDROCHLORIDE",
            "unii": "13HE2K52B3",
            "linking_id": "13HE2K52B3",
            "ref_pname": "ETHYLARGININOATE ACETAMIDOMETHIONAMIDE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0b7a1afb-344d-4943-9f8c-7dfb65e486ea",
          "name": "ETHYLARGININOATE ACETAMIDOMETHIONAMIDE",
          "stdName": "ETHYLARGININOATE ACETAMIDOMETHIONAMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1826f643-0fae-4258-a46f-091e87e4e8cd",
            "6b0fd22a-7461-443f-976e-188317b2086e",
            "0702cecf-a415-42db-b56f-794d2fefe09d"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "7d63003b-b61b-40f9-9339-95c6d8da045b",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "7f22ce82-52d3-4c9f-a0fa-5bd47b49c4d2",
          "name": "L-ARGININE, N-ACETYL-L-METHIONYL-, ETHYL ESTER",
          "stdName": "L-ARGININE, N-ACETYL-L-METHIONYL-, ETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1826f643-0fae-4258-a46f-091e87e4e8cd",
            "8321742c-a19d-4a8c-ad4d-8fd6eb9ed353"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6b0fd22a-7461-443f-976e-188317b2086e",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1826f643-0fae-4258-a46f-091e87e4e8cd",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8321742c-a19d-4a8c-ad4d-8fd6eb9ed353",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8b37eb65-9952-46bf-a83d-bc97da4bbd7f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391523000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "31b814c2-f9d1-4d1c-b498-3db7a6e37967",
          "citation": "SRS import [516H2PJA4H]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=516H2PJA4H",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391523000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0702cecf-a415-42db-b56f-794d2fefe09d",
          "citation": "ETHYLARGININOATE ACETAMIDOMETHIONAMIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "51221019-39d9-bcef-a723-fb0004ce3982",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1000617-88-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4883ca92-539f-4a04-aa7c-4850017985d9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b9fd9b29-ea84-462b-980b-8dab9b606a11",
          "id": "b9fd9b29-ea84-462b-980b-8dab9b606a11",
          "molfile": "\n  Marvin  01132109372D          \n\n 25 24  0  0  1  0            999 V2000\n    6.4420   -5.6512    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.4420   -6.4762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1564   -6.8888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1564   -7.7138    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8709   -8.1263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1564   -5.2388    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8709   -5.6512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5854   -5.2388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8709   -6.4762    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7275   -5.2388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7275   -4.4138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0130   -5.6512    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2986   -5.2388    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.2986   -4.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5841   -4.0012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5841   -3.1762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8696   -2.7638    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8696   -1.9388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1552   -1.5262    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5841   -1.5262    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5841   -5.6512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5841   -6.4763    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8696   -5.2388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1552   -5.6513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4407   -5.2388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  6  1  1  0  0  0\n 10  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  6  0  0  0\n 13 14  1  0  0  0  0\n 13 21  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\n 21 22  2  0  0  0  0\n 23 21  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\nM  END",
          "smiles": "CCOC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCSC)NC(=O)C",
          "formula": "C15H29N5O4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "31e2b7cd-c369-4b11-9dd4-1339d8b337dc"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "375.4885",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1ddad715-ee26-4301-b610-699b21989a4a",
      "version": "5",
      "structure": {
        "id": "54385dd6-f44b-416f-9039-5af2e703fa69",
        "molfile": "\n  Marvin  01132104232D          \n\n 25 24  0  0  1  0            999 V2000\n    1.4407   -5.2388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1552   -5.6513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8696   -5.2388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5841   -5.6512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2986   -5.2388    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.0130   -5.6512    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7275   -5.2388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4420   -5.6512    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.1564   -5.2388    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8709   -5.6512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5854   -5.2388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8709   -6.4762    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4420   -6.4762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1564   -6.8888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1564   -7.7138    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8709   -8.1263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7275   -4.4138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2986   -4.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5841   -4.0012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5841   -3.1762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8696   -2.7638    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8696   -1.9388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1552   -1.5262    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5841   -1.5262    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5841   -6.4763    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  6  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  1  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\n  8 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n  7 17  2  0  0  0  0\n  5 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  2  0  0  0  0\n  4 25  2  0  0  0  0\nM  END",
        "smiles": "CCOC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCSC)NC(=O)C",
        "formula": "C15H29N5O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "375.4885",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "31b814c2-f9d1-4d1c-b498-3db7a6e37967",
          "8321742c-a19d-4a8c-ad4d-8fd6eb9ed353"
        ],
        "stereo_centers": 2
      },
      "unii": "516H2PJA4H"
    }
  ]
}