{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1fb3242f-7ecd-4970-bf0d-7fa39bc55070",
          "code": "4712-55-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4712-55-4",
          "code_system": "CAS",
          "references": [
            "9526168c-8fe0-43e7-837c-2fe1a75147fc",
            "2cba9471-3eab-438d-bef6-ec0b1df057da"
          ]
        },
        {
          "uuid": "edd36d9b-ed29-4fb9-b04f-a4a46d99c83e",
          "code": "225-202-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.022.911",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "9526168c-8fe0-43e7-837c-2fe1a75147fc"
          ]
        },
        {
          "uuid": "f8c89f46-414c-4053-bbde-8d628b960281",
          "code": "62550",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/62550",
          "code_system": "PUBCHEM",
          "references": [
            "9526168c-8fe0-43e7-837c-2fe1a75147fc"
          ]
        },
        {
          "uuid": "07c2f91f-f803-44af-bd0d-2f68e939b23d",
          "code": "5144JS6XUM",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "2ed54fcf-6463-4a53-a8bb-586b6821d84e",
          "code": "DTXSID7041889",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7041889",
          "code_system": "EPA CompTox",
          "references": [
            "caa09a7e-01f1-45a2-25de-22f1b6773201"
          ]
        },
        {
          "uuid": "411d8b7c-6196-04a7-02ce-5bab7dc158f2",
          "code": "Diphenylphosphite",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Diphenylphosphite",
          "code_system": "WIKIPEDIA",
          "references": [
            "1cd9ace0-b967-3e91-793d-334a5aaf0111"
          ]
        },
        {
          "uuid": "9225d845-b104-bb7b-e2d8-a73dd742b850",
          "code": "43786",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=43786",
          "code_system": "NSC",
          "references": [
            "04836616-c92b-3e1f-5616-14307832032d"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4b9bcd99-9790-4652-b00f-b661458fa6c1",
          "name": "DIPHENYL PHOSPHITE",
          "stdName": "DIPHENYL PHOSPHITE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b4aaec3-f7f0-4ed9-852d-d3c936aa1b71"
          ],
          "display_name": true
        },
        {
          "uuid": "c48fe637-2a06-42f6-9ba5-f8281cb84fc6",
          "name": "DOVERPHOS 213",
          "stdName": "DOVERPHOS 213",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57cc2cd4-595d-4981-97be-4cf7415a7693",
            "628f4bc8-6dad-468e-9023-6f00334508f2"
          ],
          "display_name": false
        },
        {
          "uuid": "ff514d60-6da7-4826-a125-2f8fd2b1ef3d",
          "name": "NSC-43786",
          "stdName": "NSC-43786",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "960c9d79-1069-4fa8-b0b8-63ad89a2b6aa",
            "628f4bc8-6dad-468e-9023-6f00334508f2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4b4aaec3-f7f0-4ed9-852d-d3c936aa1b71",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "57cc2cd4-595d-4981-97be-4cf7415a7693",
          "citation": "http://www.doverchem.com/Products/Doverphos%C2%AELiquidPhosphites.aspx",
          "url": "http://www.doverchem.com/Products/Doverphos%C2%AELiquidPhosphites.aspx",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "628f4bc8-6dad-468e-9023-6f00334508f2",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "960c9d79-1069-4fa8-b0b8-63ad89a2b6aa",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9526168c-8fe0-43e7-837c-2fe1a75147fc",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391083000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "260332f2-3f32-49b0-b478-32a45fa854bb",
          "citation": "SRS import [5144JS6XUM]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5144JS6XUM",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391083000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e4ffd87a-2f90-4274-ae97-78eb7f6a73d6",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "caa09a7e-01f1-45a2-25de-22f1b6773201",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4712-55-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1cd9ace0-b967-3e91-793d-334a5aaf0111",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "2cba9471-3eab-438d-bef6-ec0b1df057da",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "04836616-c92b-3e1f-5616-14307832032d",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6afed355-9cb7-4708-a4dd-30b8147be74d",
          "id": "6afed355-9cb7-4708-a4dd-30b8147be74d",
          "molfile": "\n  Marvin  01132105342D          \n\n 16 17  0  0  0  0            999 V2000\n    7.0616   -4.6818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0616   -5.5011    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3489   -5.9172    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6314   -5.5092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9246   -5.9281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2046   -5.5243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2046   -4.6957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9138   -4.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6314   -4.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7789   -5.9091    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4917   -5.4931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2077   -5.9082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9153   -5.4883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9153   -4.6633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1927   -4.2556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4917   -4.6734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  2  3  1  0  0  0  0\n  2 10  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  9  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 16 11  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)OP(=O)Oc2ccccc2",
          "formula": "C12H11O3P",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fbc173a4-1e72-4573-bdee-84506c2f8b29"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "234.1882",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c56562f7-24b9-4e53-9fa0-2a7ed9c07ba4",
      "version": "5",
      "structure": {
        "id": "f09a7442-fcc8-4387-94d8-68baa2f645e0",
        "molfile": "\n  Marvin  01132112292D          \n\n 16 17  0  0  0  0            999 V2000\n    7.0616   -5.5011    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3489   -5.9172    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6314   -5.5092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9246   -5.9281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2046   -5.5243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2046   -4.6957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9138   -4.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6314   -4.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0616   -4.6818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7789   -5.9091    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4917   -5.4931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2077   -5.9082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9153   -5.4883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9153   -4.6633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1927   -4.2556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4917   -4.6734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  3  8  2  0  0  0  0\n  1  9  2  0  0  0  0\n  1 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 11  1  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)OP(=O)Oc2ccccc2",
        "formula": "C12H11O3P",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "234.1882",
        "optical_activity": "NONE",
        "references": [
          "260332f2-3f32-49b0-b478-32a45fa854bb",
          "e4ffd87a-2f90-4274-ae97-78eb7f6a73d6"
        ],
        "stereo_centers": 0
      },
      "unii": "5144JS6XUM"
    }
  ]
}