{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "19337c9e-1735-4b65-92c6-962dc2155641",
          "code": "1232137-75-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1232137-75-5",
          "code_system": "CAS",
          "references": [
            "30fba613-a404-4523-8e47-36d77c0c2bc9",
            "71cb65e0-fc84-4e41-a83a-e9039f837360"
          ]
        },
        {
          "uuid": "057dfdab-f80f-4674-99b7-7ee3fcb2e790",
          "code": "1875949",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1875949/allProperties.xml?prop=all",
          "code_system": "RXCUI"
        },
        {
          "uuid": "b7f0209e-ba28-7e89-7b67-f5c169db4b80",
          "code": "131801094",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/131801094",
          "code_system": "PUBCHEM",
          "references": [
            "e98c7883-fc97-0f8f-abff-fcd8e731fec6"
          ]
        },
        {
          "uuid": "013e737e-41d8-41e8-87e1-307b1cbaa9b0",
          "code": "51150VET6K",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "64ffd0ef-bddb-f59c-a671-9907ab3fc5e5",
          "code": "51150VET6K",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=51150VET6K",
          "code_system": "DAILYMED",
          "references": [
            "6d8ea0cc-3a6f-c468-9612-3eb12dd66d6e"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e0d1b498-c939-434e-b8e5-c2342d4de8b5",
          "name": "PENTAPEPTIDE-31",
          "stdName": "PENTAPEPTIDE-31",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "84e388b8-aaa8-4efd-86c9-5e5b79989b25",
            "c22c3363-7c21-4148-b0b2-ac7a52f46ac3"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "0a3399f3-09b3-4a38-a819-3e7cecfe7735",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "c22c3363-7c21-4148-b0b2-ac7a52f46ac3",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "84e388b8-aaa8-4efd-86c9-5e5b79989b25",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "30fba613-a404-4523-8e47-36d77c0c2bc9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393218000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c13dc6ce-5de1-4312-9355-15d68e817633",
          "citation": "SRS import [51150VET6K]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=51150VET6K",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393218000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e98c7883-fc97-0f8f-abff-fcd8e731fec6",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "71cb65e0-fc84-4e41-a83a-e9039f837360",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6d8ea0cc-3a6f-c468-9612-3eb12dd66d6e",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "16c4a01d-0875-440c-b9af-502e2fa0eb64",
          "id": "16c4a01d-0875-440c-b9af-502e2fa0eb64",
          "molfile": "\n  Marvin  01132101232D          \n\n 33 32  0  0  1  0            999 V2000\n    8.1048   -7.3549    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.3904   -7.7674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1048   -6.5299    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8193   -7.7674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8193   -8.5924    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5338   -7.3549    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2483   -7.7674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9627   -7.3549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9627   -6.5299    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6772   -7.7674    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3917   -7.3549    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   12.3917   -6.5299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6772   -6.1174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6772   -5.2924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3917   -4.8799    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9627   -4.8799    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1061   -7.7674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1061   -8.5924    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8206   -7.3549    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5351   -7.7674    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   14.5351   -8.5924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2495   -9.0049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9640   -8.5924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2495   -9.8299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2495   -7.3549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2495   -6.5299    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9640   -7.7674    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6785   -7.3549    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   16.6785   -6.5299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3930   -6.1174    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3930   -7.7674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1074   -7.3549    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3930   -8.5924    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  6  0  0  0\n  1  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 11 10  1  1  0  0  0\n 11 12  1  0  0  0  0\n 17 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n 20 19  1  6  0  0  0\n 20 21  1  0  0  0  0\n 20 25  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 25 26  2  0  0  0  0\n 25 27  1  0  0  0  0\n 28 27  1  1  0  0  0\n 28 29  1  0  0  0  0\n 31 28  1  0  0  0  0\n 29 30  1  0  0  0  0\n 32 31  1  0  0  0  0\n 31 33  2  0  0  0  0\nM  END",
          "smiles": "CC(C)C[C@@H](C(=O)N[C@@H](CO)C(=O)N)NC(=O)[C@H](CCC(=O)O)NC(=O)CNC(=O)[C@H](C)N",
          "formula": "C19H34N6O8",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "072cac4c-1fe3-4b0a-a8b5-7a8b9a02c55a"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "474.5094",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a94fafd3-1394-4eb8-be0d-0142e5bfa109",
      "version": "11",
      "structure": {
        "id": "7f789a26-4b4b-45c4-9836-227442a6dede",
        "molfile": "\n  Marvin  01132106372D          \n\n 33 32  0  0  1  0            999 V2000\n    8.8193   -7.7674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8193   -8.5924    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1048   -6.5299    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1048   -7.3549    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.3904   -7.7674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9627   -7.3549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9627   -6.5299    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5338   -7.3549    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2483   -7.7674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1061   -7.7674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1061   -8.5924    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6772   -7.7674    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3917   -7.3549    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.3917   -6.5299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6772   -6.1174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6772   -5.2924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3917   -4.8799    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9627   -4.8799    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2495   -7.3549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2495   -6.5299    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8206   -7.3549    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5351   -7.7674    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.5351   -8.5924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2495   -9.0049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9640   -8.5924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2495   -9.8299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3930   -7.7674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3930   -8.5924    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9640   -7.7674    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6785   -7.3549    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   16.6785   -6.5299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3930   -6.1174    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1074   -7.3549    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  4  3  1  6  0  0  0\n  1  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n  6  9  1  0  0  0  0\n  1  8  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 10 13  1  0  0  0  0\n 13 14  1  1  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n  6 12  1  0  0  0  0\n 19 20  2  0  0  0  0\n 21 22  1  0  0  0  0\n 19 22  1  0  0  0  0\n 22 23  1  6  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 10 21  1  0  0  0  0\n 27 28  2  0  0  0  0\n 29 30  1  0  0  0  0\n 27 30  1  0  0  0  0\n 30 31  1  1  0  0  0\n 31 32  1  0  0  0  0\n 19 29  1  0  0  0  0\n 33 27  1  0  0  0  0\nM  END",
        "smiles": "CC(C)C[C@@H](C(=O)N[C@@H](CO)C(=O)N)NC(=O)[C@H](CCC(=O)O)NC(=O)CNC(=O)[C@H](C)N",
        "formula": "C19H34N6O8",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "474.5094",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "c13dc6ce-5de1-4312-9355-15d68e817633",
          "84e388b8-aaa8-4efd-86c9-5e5b79989b25",
          "c22c3363-7c21-4148-b0b2-ac7a52f46ac3"
        ],
        "stereo_centers": 4
      },
      "unii": "51150VET6K"
    }
  ]
}