{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4ea9983e-ce99-4c12-97dc-14d3b275439a",
          "code": "17796-82-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=17796-82-6",
          "code_system": "CAS",
          "references": [
            "16da6691-4bc5-47b0-a0d4-532588972660",
            "f5030733-5a32-415f-aa6b-f853c6e96b62"
          ]
        },
        {
          "uuid": "904a9cdc-5900-40cb-a7ba-7f9906a3d717",
          "code": "241-774-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.037.961",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "16da6691-4bc5-47b0-a0d4-532588972660"
          ]
        },
        {
          "uuid": "ae76b2f9-587e-42ee-9fdc-86d1e0829344",
          "code": "SUB33604",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "16da6691-4bc5-47b0-a0d4-532588972660"
          ]
        },
        {
          "uuid": "8d40e2ab-fceb-4455-b7a8-acb7dcd6ecd4",
          "code": "28777",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/28777",
          "code_system": "PUBCHEM",
          "references": [
            "16da6691-4bc5-47b0-a0d4-532588972660"
          ]
        },
        {
          "uuid": "525bf208-b6ef-dfc0-ea18-4f5772b1a650",
          "code": "7259",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7259",
          "code_system": "HSDB",
          "references": [
            "741a7feb-51e5-8d3f-ec78-94c8428cef6d"
          ]
        },
        {
          "uuid": "d7ba3729-9e0c-21ec-b678-e65c14e400d7",
          "code": "DTXSID8027793",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8027793",
          "code_system": "EPA CompTox",
          "references": [
            "3db7e4d1-1406-ddb0-5d17-a2805912f0ba"
          ]
        },
        {
          "uuid": "bbb48443-425d-4649-8e2d-214363cb63d7",
          "code": "50Z9596NJ3",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "36820bb1-0fd4-7f07-6d09-844e8d1b6028",
          "code": "Cyclohexylthiophthalimide",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Cyclohexylthiophthalimide",
          "code_system": "WIKIPEDIA",
          "references": [
            "9e8876d0-46f2-7a7a-c1b5-0ef298ac6ad1"
          ]
        },
        {
          "uuid": "60171550-ff16-40fc-de7e-4726c2b53801",
          "code": "100000127532",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "dff69169-e2fc-2f44-09c2-427cd9c901c5"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b7eb30c3-992f-4fd3-9908-8fa9dfa0b434",
          "name": "1H-ISOINDOLE-1,3(2H)-DIONE, 2-(CYCLOHEXYLTHIO)-",
          "stdName": "1H-ISOINDOLE-1,3(2H)-DIONE, 2-(CYCLOHEXYLTHIO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "12b13430-7686-4040-82ed-34d2fb7b0e78",
            "629bb14f-a652-4cd1-bbcb-0f58c67611fe"
          ],
          "display_name": false
        },
        {
          "uuid": "a53b3a40-5bd5-4d5c-9d62-75b711b81ed1",
          "name": "2-(CYCLOHEXYLTHIO)ISOINDOLINE-1,3-DIONE",
          "stdName": "2-(CYCLOHEXYLTHIO)ISOINDOLINE-1,3-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "12b13430-7686-4040-82ed-34d2fb7b0e78",
            "e048b835-aab8-4b0a-a68c-8bdbd2f4621e"
          ],
          "display_name": false
        },
        {
          "uuid": "bf38ea83-a492-431e-8d9f-a66c885e0b6f",
          "name": "CYCLOHEXYLTHIOPHTHALIMIDE",
          "stdName": "CYCLOHEXYLTHIOPHTHALIMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "12b13430-7686-4040-82ed-34d2fb7b0e78",
            "629bb14f-a652-4cd1-bbcb-0f58c67611fe"
          ],
          "display_name": false
        },
        {
          "uuid": "b69b2be2-676c-4631-b868-e2839069dfc3",
          "name": "N-(CYCLOHEXYLTHIO)PHTHALIMIDE",
          "stdName": "N-(CYCLOHEXYLTHIO)PHTHALIMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "038e9cd5-c236-4cf9-a6c9-37f29371f8d8",
            "12b13430-7686-4040-82ed-34d2fb7b0e78",
            "22b8b799-e6a4-42ff-8838-234475100898",
            "8782b17b-ada2-4153-a13b-ebc06a25cf98"
          ],
          "display_name": true
        },
        {
          "uuid": "f9344752-43ee-4985-9539-9b7e76753217",
          "name": "N-(CYCLOHEXYLTHIO)PHTHALIMIDE [HSDB]",
          "stdName": "N-(CYCLOHEXYLTHIO)PHTHALIMIDE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "038e9cd5-c236-4cf9-a6c9-37f29371f8d8",
            "12b13430-7686-4040-82ed-34d2fb7b0e78"
          ],
          "display_name": false
        },
        {
          "uuid": "27f51640-a054-4779-abea-83e2b165ae96",
          "name": "N-CYCLOHEXYLSULFENYLPHTHALIMIDE",
          "stdName": "N-CYCLOHEXYLSULFENYLPHTHALIMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "12b13430-7686-4040-82ed-34d2fb7b0e78",
            "629bb14f-a652-4cd1-bbcb-0f58c67611fe"
          ],
          "display_name": false
        },
        {
          "uuid": "119fa93e-030b-4921-b8e6-99d792d3859d",
          "name": "PHTHALIMIDE, N-(CYCLOHEXYLTHIO)-",
          "stdName": "PHTHALIMIDE, N-(CYCLOHEXYLTHIO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "12b13430-7686-4040-82ed-34d2fb7b0e78",
            "629bb14f-a652-4cd1-bbcb-0f58c67611fe"
          ],
          "display_name": false
        },
        {
          "uuid": "6fac03ab-ae9f-4664-bd7f-68fdf3e5783c",
          "name": "SANTOGARD PVI",
          "stdName": "SANTOGARD PVI",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "12b13430-7686-4040-82ed-34d2fb7b0e78",
            "629bb14f-a652-4cd1-bbcb-0f58c67611fe"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8782b17b-ada2-4153-a13b-ebc06a25cf98",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "038e9cd5-c236-4cf9-a6c9-37f29371f8d8",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "12b13430-7686-4040-82ed-34d2fb7b0e78",
          "citation": "NLM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "629bb14f-a652-4cd1-bbcb-0f58c67611fe",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e048b835-aab8-4b0a-a68c-8bdbd2f4621e",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "16da6691-4bc5-47b0-a0d4-532588972660",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390894000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a2836dd-4bf3-430c-9b73-cf98f65aa945",
          "citation": "SRS import [50Z9596NJ3]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=50Z9596NJ3",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390894000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "90f97e83-b1c8-4c85-a09e-048ae97b8be3",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22b8b799-e6a4-42ff-8838-234475100898",
          "citation": "N-(CYCLOHEXYLTHIO)PHTHALIMIDE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "741a7feb-51e5-8d3f-ec78-94c8428cef6d",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+17796-82-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3db7e4d1-1406-ddb0-5d17-a2805912f0ba",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=17796-82-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dff69169-e2fc-2f44-09c2-427cd9c901c5",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "9e8876d0-46f2-7a7a-c1b5-0ef298ac6ad1",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "f5030733-5a32-415f-aa6b-f853c6e96b62",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "35956954-8796-4e4f-b142-c76209f51aa8",
          "id": "35956954-8796-4e4f-b142-c76209f51aa8",
          "molfile": "\n  Marvin  01132102512D          \n\n 18 20  0  0  0  0            999 V2000\n    6.4198   -6.5427    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1348   -5.7445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5959   -5.1147    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4567   -5.1147    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3213   -5.1147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7491   -4.4093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5673   -4.4093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9689   -5.1175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5673   -5.8429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7491   -5.8429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1348   -4.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4198   -3.6451    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3394   -4.7009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6340   -4.2804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9181   -4.7009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9181   -5.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6340   -5.9185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3394   -5.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  2  3  1  0  0  0  0\n 18  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n 11  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 10  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 11  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 18  2  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\nM  END",
          "smiles": "C1CCC(CC1)SN2C(=O)c3ccccc3C2=O",
          "formula": "C14H15NO2S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "13833ae2-01d4-43bc-8640-dffb205d8545"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "261.341",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5f1e7a78-77f1-4a0e-8e9a-40c5ed1eca50",
      "version": "6",
      "structure": {
        "id": "40e83923-39e5-4d8d-b904-d19405d822c4",
        "molfile": "\n  Marvin  01132103262D          \n\n 18 20  0  0  0  0            999 V2000\n    5.3394   -4.7009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3394   -5.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1348   -5.7445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4198   -6.5427    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5959   -5.1147    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1348   -4.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4198   -3.6451    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4567   -5.1147    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3213   -5.1147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7491   -4.4093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5673   -4.4093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9689   -5.1175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5673   -5.8429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7491   -5.8429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6340   -5.9185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9181   -5.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9181   -4.7009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6340   -4.2804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  5  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n  9 14  1  0  0  0  0\n  2 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n  1 18  1  0  0  0  0\nM  END",
        "smiles": "C1CCC(CC1)SN2C(=O)c3ccccc3C2=O",
        "formula": "C14H15NO2S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "261.341",
        "optical_activity": "NONE",
        "references": [
          "90f97e83-b1c8-4c85-a09e-048ae97b8be3",
          "4a2836dd-4bf3-430c-9b73-cf98f65aa945"
        ],
        "stereo_centers": 0
      },
      "unii": "50Z9596NJ3"
    }
  ]
}