{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a3e5d005-8931-4d64-9c90-cf2f3898b441",
          "code": "5197-80-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5197-80-8",
          "code_system": "CAS",
          "references": [
            "045471c3-8376-4c9f-85aa-b8ec12c45e33",
            "84e75322-ac98-419f-a267-9c7895f2fbb5"
          ]
        },
        {
          "uuid": "a5f7970d-a5ff-4a95-ad3c-0727e8a01eee",
          "code": "225-985-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.023.623",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "045471c3-8376-4c9f-85aa-b8ec12c45e33"
          ]
        },
        {
          "uuid": "98f4f3b1-e925-4fff-8570-829b917b4abe",
          "code": "78872",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/78872",
          "code_system": "PUBCHEM",
          "references": [
            "045471c3-8376-4c9f-85aa-b8ec12c45e33"
          ]
        },
        {
          "uuid": "877f611b-885c-45f2-ac2a-087e6fdcf945",
          "code": "50YXD1YX7G",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "71e6c9d4-dee2-152b-94b7-ceebb7d3ba03",
          "code": "DTXSID10884136",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10884136",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9879e3ad-be65-4e80-b1e6-cd041379555e",
          "name": "BENZENEMETHANAMINIUM, N-ETHYL-N,N-DIMETHYL-, CHLORIDE (1:1)",
          "stdName": "BENZENEMETHANAMINIUM, N-ETHYL-N,N-DIMETHYL-, CHLORIDE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6503f440-5e28-4b4a-8922-91c42ac5935d",
            "c4f39daf-0ccc-481e-9f87-fea96bec5876"
          ],
          "display_name": false
        },
        {
          "uuid": "b9733e0a-905a-4433-8eaf-c25ffe268763",
          "name": "BENZYLETHYLDIMETHYLAMMONIUM CHLORIDE",
          "stdName": "BENZYLETHYLDIMETHYLAMMONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a5abfa9-aedb-4b84-8de4-b2dc1e9906be"
          ],
          "display_name": true
        },
        {
          "uuid": "3e143308-9012-4e2c-97dc-98fe741fbc6e",
          "name": "ETHYLDIMETHYLBENZYLAMMONIUM CHLORIDE",
          "stdName": "ETHYLDIMETHYLBENZYLAMMONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6503f440-5e28-4b4a-8922-91c42ac5935d",
            "c4f39daf-0ccc-481e-9f87-fea96bec5876"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8a5abfa9-aedb-4b84-8de4-b2dc1e9906be",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c4f39daf-0ccc-481e-9f87-fea96bec5876",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6503f440-5e28-4b4a-8922-91c42ac5935d",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "045471c3-8376-4c9f-85aa-b8ec12c45e33",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391016000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "55262151-9777-4a82-bd51-6209dfca6bb9",
          "citation": "SRS import [50YXD1YX7G]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=50YXD1YX7G",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391016000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a73e127-0690-474f-9c90-f5f61f817d21",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "84e75322-ac98-419f-a267-9c7895f2fbb5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fefcdfad-6670-433f-a1cc-70940b0a1b0e",
          "id": "fefcdfad-6670-433f-a1cc-70940b0a1b0e",
          "molfile": "\n  Marvin  01132113122D          \n\n  1  0  0  0  0  0            999 V2000\n    8.8155   -4.9082    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bccd20de-226d-4507-b4ab-8c02e68aee6c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "b7d447a5-50d7-44be-9c66-7c71e136bafa",
          "id": "b7d447a5-50d7-44be-9c66-7c71e136bafa",
          "molfile": "\n  Marvin  01132109312D          \n\n 12 12  0  0  0  0            999 V2000\n    7.6617   -3.7798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0841   -4.4836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6865   -5.2066    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n    8.4093   -5.5996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9635   -4.8089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2930   -5.9597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4588   -5.9597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0363   -5.2657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2127   -5.2657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8089   -5.9904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2354   -6.6966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0549   -6.6966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  3  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n 12  7  2  0  0  0  0\n  9  8  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\nM  CHG  1   3   1\nM  END",
          "smiles": "CC[N+](C)(C)Cc1ccccc1",
          "formula": "C11H18N",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5a4a504e-01e3-4ffc-808e-50b2963aff55"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "164.2677",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "49aedd11-c37e-473b-8c7c-2a1d1ec5f3f5",
      "version": "3",
      "structure": {
        "id": "f0d2b593-d374-42d7-b0a5-103b856ba032",
        "molfile": "\n  Marvin  01132112302D          \n\n 13 12  0  0  0  0            999 V2000\n    8.8155   -4.9082    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\n    7.6865   -5.2066    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    7.2930   -5.9597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4588   -5.9597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0549   -6.6966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2354   -6.6966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8089   -5.9904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2127   -5.2657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0363   -5.2657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0841   -4.4836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6617   -3.7798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4093   -5.5996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9635   -4.8089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9  4  2  0  0  0  0\n 10  2  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12  2  1  0  0  0  0\n 13  2  1  0  0  0  0\nM  CHG  2   1  -1   2   1\nM  END",
        "smiles": "CC[N+](C)(C)Cc1ccccc1.[Cl-]",
        "formula": "C11H18N.Cl",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "199.7207",
        "optical_activity": "NONE",
        "references": [
          "1a73e127-0690-474f-9c90-f5f61f817d21",
          "55262151-9777-4a82-bd51-6209dfca6bb9"
        ],
        "stereo_centers": 0
      },
      "unii": "50YXD1YX7G"
    }
  ]
}