{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0109589c-851e-4c09-9178-79f9c68f3087",
          "code": "41621-49-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=41621-49-2",
          "code_system": "CAS",
          "references": [
            "6dff6b6e-ca8d-4965-9e09-0abdc567e97f",
            "ef3ef6e0-9def-465a-a964-5075d54afa46"
          ]
        },
        {
          "uuid": "37965025-1295-4da7-93fe-a2b1bea98fc5",
          "code": "C65327",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C65327",
          "code_system": "NCI_THESAURUS",
          "references": [
            "6dff6b6e-ca8d-4965-9e09-0abdc567e97f"
          ]
        },
        {
          "uuid": "9e53c407-64c4-496f-acce-6762800d9d63",
          "code": "52172",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/52172/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "6dff6b6e-ca8d-4965-9e09-0abdc567e97f"
          ]
        },
        {
          "uuid": "7289ed4b-ca41-4c96-857c-32be3931a49a",
          "code": "m3539",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3539?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "6dff6b6e-ca8d-4965-9e09-0abdc567e97f"
          ]
        },
        {
          "uuid": "a3cb9727-f027-4602-9d62-fcd26853153f",
          "code": "SUB01294MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "6dff6b6e-ca8d-4965-9e09-0abdc567e97f"
          ]
        },
        {
          "uuid": "777c1136-d599-46da-8b97-06dbf6a2dffa",
          "code": "CHEMBL1413",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1413",
          "code_system": "ChEMBL",
          "references": [
            "6dff6b6e-ca8d-4965-9e09-0abdc567e97f"
          ]
        },
        {
          "uuid": "0774281a-2a84-400f-af02-3491d90d737f",
          "code": "255-464-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.050.405",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "6dff6b6e-ca8d-4965-9e09-0abdc567e97f"
          ]
        },
        {
          "uuid": "b34f27f2-e26e-4e54-91ea-b0768942cb05",
          "code": "38911",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/38911",
          "code_system": "PUBCHEM",
          "references": [
            "6dff6b6e-ca8d-4965-9e09-0abdc567e97f"
          ]
        },
        {
          "uuid": "4db6609e-f0d0-dbea-8b6a-d35ebbf71feb",
          "code": "DTXSID6045583",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6045583",
          "code_system": "EPA CompTox",
          "references": [
            "8580c12e-5871-1a35-5410-b14e0eb3c24d"
          ]
        },
        {
          "uuid": "365069cc-9c06-22e0-37c2-ebcda0fb572f",
          "code": "C514",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Antifungal Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C514",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7fb66c07-fe2b-d6c0-5a0c-7f59d076df2a"
          ]
        },
        {
          "uuid": "9e299a56-bcc2-425b-8676-4ae71505f031",
          "code": "50MD4SB4AP",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5fe784bd-0f0b-3131-63e8-4251bc82a092",
          "code": "DBSALT001147",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DBSALT001147",
          "code_system": "DRUG BANK",
          "references": [
            "7fb66c07-fe2b-d6c0-5a0c-7f59d076df2a"
          ]
        },
        {
          "uuid": "78bee1bc-1e95-179b-c979-17c7a2cbd311",
          "code": "1134030",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1134030",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "7fb66c07-fe2b-d6c0-5a0c-7f59d076df2a"
          ]
        },
        {
          "uuid": "16e804ab-bea5-2964-f66a-4c40fc8a64bf",
          "code": "100000084827",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "0d133e69-8d1e-fa81-e2a1-76def0c4504d"
          ]
        },
        {
          "uuid": "20eab1b9-dfa1-a079-25ef-cfd386a05a18",
          "code": "50MD4SB4AP",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=50MD4SB4AP",
          "code_system": "DAILYMED",
          "references": [
            "cc4bfe50-a05f-0324-7200-1951467b2829"
          ]
        },
        {
          "uuid": "fda79318-8130-6753-0b0d-cb9d45aae321",
          "code": "336278",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=336278",
          "code_system": "NSC",
          "references": [
            "b795950e-fbd0-eda0-790b-4239f64b5983"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "ba4427cc-57b2-4ac1-a01e-6025c85aba2c",
          "amount": {
            "uuid": "210c3c85-c856-4e52-8863-3cfd758f8d38"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "6d0383b1-ea2a-490c-be1b-85016243c134",
            "refuuid": "73137b47-81dc-4bd5-a5f2-350622f68464",
            "name": "CICLOPIROX",
            "unii": "19W019ZDRJ",
            "linking_id": "19W019ZDRJ",
            "ref_pname": "CICLOPIROX",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "703bf297-8d72-43bd-a179-82b390d76bf5",
          "amount": {
            "uuid": "3c435f1e-8358-47f7-a9e6-22af0165a450"
          },
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "e80df2f5-3c33-4ee7-9d91-8d8d17a6e320",
            "refuuid": "73137b47-81dc-4bd5-a5f2-350622f68464",
            "name": "CICLOPIROX",
            "unii": "19W019ZDRJ",
            "linking_id": "19W019ZDRJ",
            "ref_pname": "CICLOPIROX",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a1917ba0-3123-4619-9616-8dd26e356e6e",
          "amount": {
            "uuid": "922b380c-664b-4a73-afe0-62088ac82065"
          },
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "a3597343-26fd-4a72-b5ce-1caa0d667771",
            "refuuid": "7bd621c0-0d60-4379-976d-e2bfbce64435",
            "name": "2-Aminoethanol",
            "unii": "5KV86114PT",
            "linking_id": "5KV86114PT",
            "ref_pname": "2-Aminoethanol",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "46df6d2d-0981-467e-850d-4a012ea29bb4",
          "amount": {
            "uuid": "be535bcb-255c-4402-aad3-1f0f689fbd1c",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 23.3,
            "low_limit": 22.2
          },
          "qualification": "EP",
          "type": "CONSTITUENT ALWAYS PRESENT->PARENT",
          "interaction_type": "ASSAY (TITRATION)",
          "references": [
            "01bf96d7-88c9-45a9-a6e5-d4cff628989b"
          ],
          "related_substance": {
            "uuid": "bb217035-b381-4cba-9968-93a3e73131b5",
            "refuuid": "7bd621c0-0d60-4379-976d-e2bfbce64435",
            "name": "2-Aminoethanol",
            "unii": "5KV86114PT",
            "linking_id": "5KV86114PT",
            "ref_pname": "2-Aminoethanol",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e6ee03eb-a06a-46a2-9c7b-f2e399e4090d",
          "amount": {
            "uuid": "9fe8d0ea-13ad-4025-974b-7ded4eb43a0b",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.5
          },
          "comments": "at 220 nm",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "01bf96d7-88c9-45a9-a6e5-d4cff628989b"
          ],
          "related_substance": {
            "uuid": "ca5ba0c4-4cb8-40b7-84b1-8b4b9f8989ad",
            "refuuid": "0319c200-b3ff-432c-86fa-ba8688c431e4",
            "name": "3-CYCLOHEXYL-5-METHYL-4,5-DIHYDRO-1,2-OXAZOL-5-YL)ACETIC ACID",
            "unii": "S44N0Y1BB8",
            "linking_id": "S44N0Y1BB8",
            "ref_pname": "3-CYCLOHEXYL-5-METHYL-4,5-DIHYDRO-1,2-OXAZOL-5-YL)ACETIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6ac55646-4172-40a2-a200-f5ff35ab46df",
          "amount": {
            "uuid": "407c7f85-26c5-4e15-a599-4b0bbef26f50",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 101.5,
            "low_limit": 97.5
          },
          "qualification": "USP",
          "type": "BASIS OF STRENGTH->SUBSTANCE",
          "interaction_type": "ASSAY (TITRATION)",
          "references": [
            "e54f0682-deb1-4ee3-b421-c93086ec7253"
          ],
          "related_substance": {
            "uuid": "8707d58c-aacb-4b08-99b8-9ce8de73468c",
            "refuuid": "0efa70a3-6a8c-4b29-a031-538cca82635c",
            "name": "CICLOPIROX OLAMINE",
            "unii": "50MD4SB4AP",
            "linking_id": "50MD4SB4AP",
            "ref_pname": "CICLOPIROX OLAMINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "28f971c6-a2a5-4de2-82d2-bfb1093af362",
          "name": "2(1H)-PYRIDINONE, 6-CYCLOHEXYL-1-HYDROXY-4-METHYL-, COMPOUND WITH 2-AMINOETHANOL (1:1)",
          "stdName": "2(1H)-PYRIDINONE, 6-CYCLOHEXYL-1-HYDROXY-4-METHYL-, COMPOUND WITH 2-AMINOETHANOL (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "44c37b31-74bf-466b-9cb0-9a7e30f9b642"
          ],
          "display_name": false
        },
        {
          "uuid": "f64fe424-fe1f-4ab4-995b-e31918baa466",
          "name": "6-CYCLOHEXYL-1-HYDROXY-4-METHYL-2(1H)-PYRIDONE COMPOUND WITH 2-AMINOETHANOL",
          "stdName": "6-CYCLOHEXYL-1-HYDROXY-4-METHYL-2(1H)-PYRIDONE COMPOUND WITH 2-AMINOETHANOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "44c37b31-74bf-466b-9cb0-9a7e30f9b642"
          ],
          "display_name": false
        },
        {
          "uuid": "fd804b5c-ca41-40bb-a8e8-d48a860d201c",
          "name": "BATRAFEN",
          "stdName": "BATRAFEN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff9566a7-964e-4d8e-97d1-3955acd7298c"
          ],
          "display_name": false
        },
        {
          "uuid": "994c1c56-c703-4e06-b615-e681cb182a99",
          "name": "BRUMIXOL",
          "stdName": "BRUMIXOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff9566a7-964e-4d8e-97d1-3955acd7298c"
          ],
          "display_name": false
        },
        {
          "uuid": "623c4aae-09ce-47a1-a7b1-abaa3b63ece9",
          "name": "CICLOCHEM",
          "stdName": "CICLOCHEM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff9566a7-964e-4d8e-97d1-3955acd7298c"
          ],
          "display_name": false
        },
        {
          "uuid": "c8845cc9-85f6-47ae-ba06-0e0ccc068656",
          "name": "CICLOPIROX ETHANOLAMINE SALT (1:1) [MI]",
          "stdName": "CICLOPIROX ETHANOLAMINE SALT (1:1) [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff9566a7-964e-4d8e-97d1-3955acd7298c"
          ],
          "display_name": false
        },
        {
          "uuid": "ebdbe240-1fa0-4ccf-b66c-1ccf5bdc4a25",
          "name": "CICLOPIROX OLAMINE",
          "stdName": "CICLOPIROX OLAMINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4e9f29b-b18a-4f61-a8e9-0a61d83a2d3a",
            "bdc5d00f-17d9-4667-8f04-73fa6dbe2469",
            "67c03605-ec19-4c93-8182-2a440f32d1c3",
            "75b01b7b-a069-4590-a482-73c11b14fe92",
            "ca4e9dfb-1bb6-442c-a95e-de40a91361f2",
            "3ba26fff-df72-4141-abab-77c1cbcf6e3b",
            "45f62035-efd9-4ae9-9891-f32c3d49f54a",
            "18f3217c-635e-4881-ae82-fb4f76a7d546",
            "9c038b73-0fae-4838-94be-4f5d5596cd83",
            "68e88730-00b3-4942-aa93-1d48bb07835c",
            "e66ed807-70ca-4166-9f5f-da6e58053b09",
            "dc771dd3-31e0-4835-a039-29706545ae6f",
            "9d55aad5-eea8-48f8-b4cd-52c7857500ca",
            "583e9bec-03b1-4627-9027-738bf45befa0",
            "d51a1fd4-8ee8-4a68-bbda-83624d57e5c3",
            "4c3a72ec-054b-4d05-890e-573a897bebfa",
            "0821de40-e373-4dce-8b9f-d4658f323399",
            "496f0ef3-5336-4944-9fd1-9dc3b8b66f9c",
            "c0c0f619-8b2b-41a4-a18c-c633684b0db3"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "6550d80c-d8a7-48a3-b6d0-5a2eafd5e08a",
              "name_org": "USAN"
            },
            {
              "uuid": "6600090a-ee82-4614-8b81-2ba143356393",
              "name_org": "INCI"
            },
            {
              "uuid": "e71524c8-1a3d-49ec-99fd-dfbcedd89f62",
              "name_org": "EP"
            }
          ]
        },
        {
          "uuid": "06a7c7af-6583-39aa-ffcb-317b193ff1b9",
          "name": "CICLOPIROX OLAMINE [EP IMPURITY]",
          "stdName": "CICLOPIROX OLAMINE [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4e9f29b-b18a-4f61-a8e9-0a61d83a2d3a"
          ],
          "display_name": false
        },
        {
          "uuid": "dab97baa-1a21-fe6b-a55c-3582f8c148f2",
          "name": "CICLOPIROX OLAMINE [EP MONOGRAPH]",
          "stdName": "CICLOPIROX OLAMINE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "875bd074-a6d4-7995-f7db-37bbb17fc345"
          ],
          "display_name": false
        },
        {
          "uuid": "18da4e95-1b8f-4568-a299-45ccc3c820c2",
          "name": "CICLOPIROX OLAMINE [JAN]",
          "stdName": "CICLOPIROX OLAMINE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "583e9bec-03b1-4627-9027-738bf45befa0"
          ],
          "display_name": false
        },
        {
          "uuid": "d5491859-521f-4fa0-b5ab-5a5498036089",
          "name": "CICLOPIROX OLAMINE [MART.]",
          "stdName": "CICLOPIROX OLAMINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ba26fff-df72-4141-abab-77c1cbcf6e3b"
          ],
          "display_name": false
        },
        {
          "uuid": "e76a8174-e69f-44a4-b529-4f5e4d8fe333",
          "name": "CICLOPIROX OLAMINE [USAN]",
          "stdName": "CICLOPIROX OLAMINE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68e88730-00b3-4942-aa93-1d48bb07835c"
          ],
          "display_name": false
        },
        {
          "uuid": "f17e8e37-5955-bc07-6c10-a1cf58ff85e5",
          "name": "CICLOPIROX OLAMINE [USP MONOGRAPH]",
          "stdName": "CICLOPIROX OLAMINE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4c71464-e903-6231-c3b8-eec29521029e"
          ],
          "display_name": false
        },
        {
          "uuid": "1789f780-c235-42f7-892d-0588993014c8",
          "name": "CICLOPIROX OLAMINE [USP-RS]",
          "stdName": "CICLOPIROX OLAMINE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9d55aad5-eea8-48f8-b4cd-52c7857500ca"
          ],
          "display_name": false
        },
        {
          "uuid": "a4e6f8ce-b28e-4e01-a4c0-a43b68d0c667",
          "name": "CICLOPIROX OLAMINE [VANDF]",
          "stdName": "CICLOPIROX OLAMINE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "18f3217c-635e-4881-ae82-fb4f76a7d546"
          ],
          "display_name": false
        },
        {
          "uuid": "cc58eeec-cebf-8845-bc65-60d234e8dfee",
          "name": "Ciclopirox olamine [WHO-DD]",
          "stdName": "CICLOPIROX OLAMINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "18de9adb-1f04-4abb-4fc2-ee0fb07f1648"
          ],
          "display_name": false
        },
        {
          "uuid": "76c3e126-7336-434b-91b0-0408c5a3bf9f",
          "name": "DAFNEGIN",
          "stdName": "DAFNEGIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff9566a7-964e-4d8e-97d1-3955acd7298c"
          ],
          "display_name": false
        },
        {
          "uuid": "33c4ba03-5fc1-4bc4-be9b-3116ef03cb95",
          "name": "HOE 296",
          "stdName": "HOE 296",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "44c37b31-74bf-466b-9cb0-9a7e30f9b642"
          ],
          "display_name": false
        },
        {
          "uuid": "6e8613e4-9316-4095-a215-dd667be35683",
          "name": "HOE-296",
          "stdName": "HOE-296",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff9566a7-964e-4d8e-97d1-3955acd7298c"
          ],
          "display_name": false
        },
        {
          "uuid": "6b840e97-8bef-49e9-a4f2-4b442e2a92e9",
          "name": "MICOXOLAMINA",
          "stdName": "MICOXOLAMINA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff9566a7-964e-4d8e-97d1-3955acd7298c"
          ],
          "display_name": false
        },
        {
          "uuid": "fe9e956c-dac4-48e2-9bd1-039698af03a7",
          "name": "MYCOSTER",
          "stdName": "MYCOSTER",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff9566a7-964e-4d8e-97d1-3955acd7298c"
          ],
          "display_name": false
        },
        {
          "uuid": "8046d549-61da-4364-8147-5e66a2d796d9",
          "name": "NSC-336278",
          "stdName": "NSC-336278",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "31f46b25-16af-4744-86a2-141567d1024f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9c038b73-0fae-4838-94be-4f5d5596cd83",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "44c37b31-74bf-466b-9cb0-9a7e30f9b642",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "68e88730-00b3-4942-aa93-1d48bb07835c",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "67c03605-ec19-4c93-8182-2a440f32d1c3",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b4e9f29b-b18a-4f61-a8e9-0a61d83a2d3a",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "583e9bec-03b1-4627-9027-738bf45befa0",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3ba26fff-df72-4141-abab-77c1cbcf6e3b",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e66ed807-70ca-4166-9f5f-da6e58053b09",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9d55aad5-eea8-48f8-b4cd-52c7857500ca",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4c3a72ec-054b-4d05-890e-573a897bebfa",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "18f3217c-635e-4881-ae82-fb4f76a7d546",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff9566a7-964e-4d8e-97d1-3955acd7298c",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a233c159-541e-4dbd-8082-4c41d8cccffe",
          "citation": "DMF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "31f46b25-16af-4744-86a2-141567d1024f",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6dff6b6e-ca8d-4965-9e09-0abdc567e97f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389706000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "01bf96d7-88c9-45a9-a6e5-d4cff628989b",
          "citation": "EP 7.8 CICLOPIROX OLAMINE MONOGRAPH",
          "doc_type": "EUROPEAN PHARMACOPEIA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e54f0682-deb1-4ee3-b421-c93086ec7253",
          "citation": "USP 35 CICLOPIROX OLAMINE MONOGRAPH",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a99a1b9a-a276-4444-9871-06bf92f45f9c",
          "citation": "SRS import [50MD4SB4AP]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=50MD4SB4AP",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389706000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "45bccb8f-8fbb-4b7f-a7cb-e2bf61a76b9f",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "496f0ef3-5336-4944-9fd1-9dc3b8b66f9c",
          "citation": "CICLOPIROX OLAMINE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0821de40-e373-4dce-8b9f-d4658f323399",
          "citation": "CICLOPIROX OLAMINE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bdc5d00f-17d9-4667-8f04-73fa6dbe2469",
          "citation": "CICLOPIROX OLAMINE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ca4e9dfb-1bb6-442c-a95e-de40a91361f2",
          "citation": "CICLOPIROX OLAMINE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "75b01b7b-a069-4590-a482-73c11b14fe92",
          "citation": "CICLOPIROX OLAMINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dc771dd3-31e0-4835-a039-29706545ae6f",
          "citation": "CICLOPIROX OLAMINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "45f62035-efd9-4ae9-9891-f32c3d49f54a",
          "citation": "CICLOPIROX OLAMINE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c0c0f619-8b2b-41a4-a18c-c633684b0db3",
          "citation": "CICLOPIROX OLAMINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d51a1fd4-8ee8-4a68-bbda-83624d57e5c3",
          "citation": "CICLOPIROX OLAMINE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8580c12e-5871-1a35-5410-b14e0eb3c24d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=41621-49-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0d133e69-8d1e-fa81-e2a1-76def0c4504d",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "7fb66c07-fe2b-d6c0-5a0c-7f59d076df2a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ef3ef6e0-9def-465a-a964-5075d54afa46",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b4c71464-e903-6231-c3b8-eec29521029e",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "875bd074-a6d4-7995-f7db-37bbb17fc345",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "cc4bfe50-a05f-0324-7200-1951467b2829",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "b795950e-fbd0-eda0-790b-4239f64b5983",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "18de9adb-1f04-4abb-4fc2-ee0fb07f1648",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a692267c-ce50-4ac2-a1c0-2c141132fe37",
          "id": "a692267c-ce50-4ac2-a1c0-2c141132fe37",
          "molfile": "\n  Marvin  01132108392D          \n\n  4  3  0  0  0  0            999 V2000\n    6.8943    0.3215    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6078    0.7368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3241    0.3275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0375    0.7426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\nM  END",
          "smiles": "C(CO)N",
          "formula": "C2H7NO",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8500e169-bb35-4433-af59-ac60af43f80d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "61.0832",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "9ad12c65-4aef-4281-83b4-00c89aa54c95",
          "id": "9ad12c65-4aef-4281-83b4-00c89aa54c95",
          "molfile": "\n  Marvin  01132108032D          \n\n 15 16  0  0  0  0            999 V2000\n    4.0088   -1.7404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0110   -0.9154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3030   -0.5044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3030    0.3206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5897    0.7350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5895    1.5610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8780    1.9714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1623    1.5605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1625    0.7346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8785    0.3195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0110    0.7346    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0088    1.5596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7278    0.3206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4423    0.7331    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7278   -0.5044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 15  2  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  4 11  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 10  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 11  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 13  1  0  0  0  0\nM  END",
          "smiles": "Cc1cc(C2CCCCC2)n(c(=O)c1)O",
          "formula": "C12H17NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3fe412c5-3986-4a06-ade2-ee13c7efb351"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "207.2693",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0efa70a3-6a8c-4b29-a031-538cca82635c",
      "version": "35",
      "structure": {
        "id": "23405e87-7189-40eb-abfd-9243616e1766",
        "molfile": "\n  Marvin  01132101582D          \n\n 19 19  0  0  0  0            999 V2000\n    3.3030    0.3206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3030   -0.5044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0110   -0.9154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7278   -0.5044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7278    0.3206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0110    0.7346    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5897    0.7350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5895    1.5610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8780    1.9714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1623    1.5605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1625    0.7346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8785    0.3195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0088    1.5596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4423    0.7331    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0088   -1.7404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8740    0.3206    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5854    0.7346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2996    0.3265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0109    0.7404    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  7 12  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n  1  7  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6 13  1  0  0  0  0\n  7  8  1  0  0  0  0\n  5 14  2  0  0  0  0\n  3 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n  1  2  2  0  0  0  0\n 17 18  1  0  0  0  0\n  1  6  1  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
        "smiles": "Cc1cc(C2CCCCC2)n(c(=O)c1)O.C(CO)N",
        "formula": "C12H17NO2.C2H7NO",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "268.3525",
        "optical_activity": "NONE",
        "references": [
          "45bccb8f-8fbb-4b7f-a7cb-e2bf61a76b9f",
          "a99a1b9a-a276-4444-9871-06bf92f45f9c"
        ],
        "stereo_centers": 0
      },
      "unii": "50MD4SB4AP"
    }
  ]
}