{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "703bfe8a-cf8b-4355-a014-29465e58586d", "code": "4986-89-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=4986-89-4", "code_system": "CAS", "references": [ "f3830494-161d-472a-bc14-b1d6a58693b6", "fe9319c9-a125-438f-9a2f-23a21e567ab7" ] }, { "uuid": "2af9a5bf-1d75-4d59-b15a-4fd8fa1b0359", "code": "C531365", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67531365", "code_system": "MESH", "references": [ "f3830494-161d-472a-bc14-b1d6a58693b6" ] }, { "uuid": "68bd784d-44ae-4dd3-aa97-11a13de8598d", "code": "225-644-1", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.023.313", "code_system": "ECHA (EC/EINECS)", "references": [ "f3830494-161d-472a-bc14-b1d6a58693b6" ] }, { "uuid": "7ff14c0c-1226-41e8-a0a8-4452a3bd40be", "code": "62556", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/62556", "code_system": "PUBCHEM", "references": [ "f3830494-161d-472a-bc14-b1d6a58693b6" ] }, { "uuid": "a6863c6d-5319-bb42-abcf-8e4a41388a43", "code": "DTXSID8042264", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8042264", "code_system": "EPA CompTox", "references": [ "97c74728-e778-ac08-4d51-adaa330c5656" ] }, { "uuid": "bafb3681-3cef-494e-bfdb-46dbc78d19cc", "code": "50LIA3DGN1", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "5dc450c6-561a-64ac-4348-600d2b7350e8", "code": "Pentaerythritol tetraacrylate", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Pentaerythritol_tetraacrylate", "code_system": "WIKIPEDIA", "references": [ "200d2c72-fee3-6703-9c6f-b503d4e93aae" ] } ], "substance_class": "chemical", "names": [ { "uuid": "c2a2243b-a3ae-463c-aec3-da30d10ccf82", "name": "PENTAERYTHRITOL TETRAACRYLATE", "stdName": "PENTAERYTHRITOL TETRAACRYLATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "2bcad244-fd58-499d-a688-02036ae19571", "a42f1613-4094-4f46-8b4a-dc8bce07d719" ], "display_name": false }, { "uuid": "46205ff6-e402-46aa-b5ae-e2f22aa10f46", "name": "PENTAERYTHRITYL TETRAACRYLATE", "stdName": "PENTAERYTHRITYL TETRAACRYLATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "18cd699d-61df-4bce-be9f-78e727b7abfa", "f7fab3bb-9143-4528-9779-94043038f777", "a42f1613-4094-4f46-8b4a-dc8bce07d719", "d0588b40-68a4-4d74-bd6f-ddd9ef5f5364" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "39269b97-0f6d-41ae-aae4-61477c580016", "name_org": "INCI" } ] } ], "references": [ { "uuid": "18cd699d-61df-4bce-be9f-78e727b7abfa", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "2bcad244-fd58-499d-a688-02036ae19571", "citation": "SIGMA-ALDRICH", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a42f1613-4094-4f46-8b4a-dc8bce07d719", "citation": "SIGMA-ALDRICH", "doc_type": "SIGMA-ALDRICH", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f7fab3bb-9143-4528-9779-94043038f777", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f3830494-161d-472a-bc14-b1d6a58693b6", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391048000, "tags": [ "NOMEN" ] }, { "uuid": "658f9fdb-d59f-4def-9d97-ce341b1389fd", "citation": "SRS import [50LIA3DGN1]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=50LIA3DGN1", "doc_type": "SRS", "public_domain": true, "document_date": 1493391048000, "tags": [ "NOMEN" ] }, { "uuid": "38671616-03e0-45a6-986e-9e38e11a897a", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d0588b40-68a4-4d74-bd6f-ddd9ef5f5364", "citation": "PENTAERYTHRITYL TETRAACRYLATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "97c74728-e778-ac08-4d51-adaa330c5656", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4986-89-4", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "200d2c72-fee3-6703-9c6f-b503d4e93aae", "citation": "WIKI", "doc_type": "WIKI", "public_domain": true }, { "uuid": "fe9319c9-a125-438f-9a2f-23a21e567ab7", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "1d03b6f9-f912-44f1-945d-e49bae7c9f80", "id": "1d03b6f9-f912-44f1-945d-e49bae7c9f80", "molfile": "\n Marvin 01132101402D \n\n 25 24 0 0 0 0 999 V2000\n 3.5557 -5.6740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2699 -5.2612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9841 -5.6740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9841 -6.4995 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6983 -5.2612 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4124 -5.6740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1267 -5.2612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1267 -4.4357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8364 -4.0231 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8364 -3.1884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1165 -2.7814 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5493 -2.7696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2601 -3.1836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8409 -5.6740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5551 -5.2612 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2692 -5.6740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2692 -6.4995 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9835 -5.2612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6977 -5.6740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1267 -6.0866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3986 -6.4954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3986 -7.3204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1125 -7.7420 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6799 -7.7336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9657 -7.3203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 3 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 14 1 0 0 0 0\n 7 20 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 10 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 16 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 2 0 0 0 0\n 22 24 1 0 0 0 0\n 24 25 2 0 0 0 0\nM END", "smiles": "C=CC(=O)OCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C", "formula": "C17H20O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "3b544c60-c1b4-47ba-a909-6a599fce916a" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "352.3366", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "3dc56425-84bc-4e1f-82d7-a3e82cc6f66a", "version": "5", "structure": { "id": "73ad8011-0b5b-4d19-8259-7af7cfce3bbf", "molfile": "\n Marvin 01132106002D \n\n 25 24 0 0 0 0 999 V2000\n 3.5557 -5.6740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2699 -5.2612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9841 -5.6740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6983 -5.2612 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4124 -5.6740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1267 -5.2612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1267 -4.4357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8364 -4.0231 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8364 -3.1884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1165 -2.7814 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5493 -2.7696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2601 -3.1836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8409 -5.6740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5551 -5.2612 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2692 -5.6740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9835 -5.2612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6977 -5.6740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2692 -6.4995 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1267 -6.0866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3986 -6.4954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3986 -7.3204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6799 -7.7336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9657 -7.3203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1125 -7.7420 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9841 -6.4995 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 9 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 6 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 15 18 2 0 0 0 0\n 6 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 2 0 0 0 0\n 21 24 2 0 0 0 0\n 3 25 2 0 0 0 0\nM END", "smiles": "C=CC(=O)OCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C", "formula": "C17H20O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "352.3366", "optical_activity": "NONE", "references": [ "38671616-03e0-45a6-986e-9e38e11a897a", "658f9fdb-d59f-4def-9d97-ce341b1389fd" ], "stereo_centers": 0 }, "unii": "50LIA3DGN1" } ] }