{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f2c822f3-4e87-4f01-b7cf-5c1df25b1e4e",
          "code": "745047-94-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=745047-94-3",
          "code_system": "CAS",
          "references": [
            "d1b7b43c-9647-4b8a-a466-9a779c41d102",
            "8276de44-7c6b-4b41-8665-d7e93b5284c2"
          ]
        },
        {
          "uuid": "bb4edb66-ed1b-4a33-bdf4-41e4841092d6",
          "code": "11210019",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11210019",
          "code_system": "PUBCHEM",
          "references": [
            "d1b7b43c-9647-4b8a-a466-9a779c41d102"
          ]
        },
        {
          "uuid": "27eb4a38-ff64-45ed-29d5-2d8c81c62aae",
          "code": "DTXSID10225505",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10225505",
          "code_system": "EPA CompTox",
          "references": [
            "44d08345-212d-c164-0752-99152922602a"
          ]
        },
        {
          "uuid": "8729cce0-e8b5-4fb2-88c0-32f5464d3129",
          "code": "50H0N03SQU",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "316d5edf-b3de-7ac7-53c3-c0f3c53edfd3",
          "code": "1747",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1747/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "78c7fc70-3cdb-6294-f58c-2ef1c504ba7f"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7112dc24-6453-43a1-8d62-fc0b76fd3fb5",
          "name": "ETHANEDIAMIDE, N-((2-METHOXY-4-METHYLPHENYL)METHYL)-N'-(2-(5-METHYL-2-PYRIDINYL)ETHYL)-",
          "stdName": "ETHANEDIAMIDE, N-((2-METHOXY-4-METHYLPHENYL)METHYL)-N'-(2-(5-METHYL-2-PYRIDINYL)ETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d9140979-c205-4a29-aca2-d900887872a4",
            "2a201694-2607-4927-aff7-66bef555fb6a"
          ],
          "display_name": false
        },
        {
          "uuid": "6495e9f3-7059-44c2-9182-4aef11041387",
          "name": "ETHANEDIAMIDE, N1-((2-METHOXY-4-METHYLPHENYL)METHYL)-N2-(2-(5-METHYL-2-PYRIDINYL)ETHYL)-",
          "stdName": "ETHANEDIAMIDE, N1-((2-METHOXY-4-METHYLPHENYL)METHYL)-N2-(2-(5-METHYL-2-PYRIDINYL)ETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d9140979-c205-4a29-aca2-d900887872a4",
            "2a201694-2607-4927-aff7-66bef555fb6a"
          ],
          "display_name": false
        },
        {
          "uuid": "c8ec2788-ac43-47dd-a074-0f9fd43fa65f",
          "name": "FEMA NO. 4234",
          "stdName": "FEMA NO. 4234",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d9140979-c205-4a29-aca2-d900887872a4",
            "017e940f-b517-4d38-a935-968e1c7769c5"
          ],
          "display_name": false
        },
        {
          "uuid": "c917e7a3-b824-4e3a-afc5-9fb35021ecf5",
          "name": "N'-((2-METHOXY-4-METHYL-PHENYL)METHYL)-N-(2-(5-METHYL-2-PYRIDYL)ETHYL)OXAMIDE",
          "stdName": "N'-((2-METHOXY-4-METHYL-PHENYL)METHYL)-N-(2-(5-METHYL-2-PYRIDYL)ETHYL)OXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d9140979-c205-4a29-aca2-d900887872a4",
            "31f2d889-e761-4d87-a980-f7bf595b0792"
          ],
          "display_name": false
        },
        {
          "uuid": "86734f11-b2e6-44e5-bf1c-84712d8f8d7a",
          "name": "N-((2-METHOXY-4-METHYLPHENYL)METHYL)-N'-(2-(5-METHYL-2-PYRIDINYL)ETHYL)ETHANEDIAMIDE",
          "stdName": "N-((2-METHOXY-4-METHYLPHENYL)METHYL)-N'-(2-(5-METHYL-2-PYRIDINYL)ETHYL)ETHANEDIAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d9140979-c205-4a29-aca2-d900887872a4",
            "3a9702a6-3085-40c9-aaaf-c406887cd78a"
          ],
          "display_name": false
        },
        {
          "uuid": "ee61741f-7d02-48fb-9bea-26953ba09550",
          "name": "N1-(2-METHOXY-4-METHYLBENZYL)-N2-(2-(5-METHYLPYRIDIN-2-YL)ETHYL)OXALAMIDE",
          "stdName": "N1-(2-METHOXY-4-METHYLBENZYL)-N2-(2-(5-METHYLPYRIDIN-2-YL)ETHYL)OXALAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d9140979-c205-4a29-aca2-d900887872a4",
            "017e940f-b517-4d38-a935-968e1c7769c5",
            "df17f066-6ef0-4b10-9796-f076339cb3f7",
            "512d815d-f4fd-48b2-8ae1-1d48029f0aa2"
          ],
          "display_name": true
        },
        {
          "uuid": "f6c79338-6a2f-4a84-aa4e-4d4bcd6b79e4",
          "name": "N1-(2-METHOXY-4-METHYLBENZYL)-N2-(2-(5-METHYLPYRIDIN-2-YL)ETHYL)OXALAMIDE [FHFI]",
          "stdName": "N1-(2-METHOXY-4-METHYLBENZYL)-N2-(2-(5-METHYLPYRIDIN-2-YL)ETHYL)OXALAMIDE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d9140979-c205-4a29-aca2-d900887872a4",
            "017e940f-b517-4d38-a935-968e1c7769c5"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "512d815d-f4fd-48b2-8ae1-1d48029f0aa2",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d9140979-c205-4a29-aca2-d900887872a4",
          "citation": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "doc_type": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2a201694-2607-4927-aff7-66bef555fb6a",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "31f2d889-e761-4d87-a980-f7bf595b0792",
          "citation": "CHEMDRAW",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "017e940f-b517-4d38-a935-968e1c7769c5",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3a9702a6-3085-40c9-aaaf-c406887cd78a",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d1b7b43c-9647-4b8a-a466-9a779c41d102",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391330000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6cf6c79a-4469-4881-969a-eff6784684ca",
          "citation": "SRS import [50H0N03SQU]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=50H0N03SQU",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391330000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "df17f066-6ef0-4b10-9796-f076339cb3f7",
          "citation": "N1-(2-METHOXY-4-METHYLBENZYL)-N2-(2-(5-METHYLPYRIDIN-2-YL)ETHYL)OXALAMIDE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "44d08345-212d-c164-0752-99152922602a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=745047-94-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8276de44-7c6b-4b41-8665-d7e93b5284c2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "78c7fc70-3cdb-6294-f58c-2ef1c504ba7f",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7d6a1a45-ea7b-4700-9085-18b24f0ac297",
          "id": "7d6a1a45-ea7b-4700-9085-18b24f0ac297",
          "molfile": "\n  Marvin  01132106312D          \n\n 25 26  0  0  0  0            999 V2000\n    6.7707   -5.6132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7707   -4.7882    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4851   -4.3756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1996   -4.7882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9141   -4.3756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6286   -4.7882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9141   -3.5506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1996   -3.1382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4851   -3.5506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7707   -3.1382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0562   -3.5506    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3417   -3.1382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3417   -2.3132    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6273   -3.5506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6273   -4.3756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9128   -3.1382    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1983   -3.5506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4839   -3.1382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7694   -3.5506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7694   -4.3756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0549   -4.7882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3404   -4.3756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3740   -4.7882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3404   -3.5506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0549   -3.1382    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  9  3  2  0  0  0  0\n  4  5  2  0  0  0  0\n  6  5  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 16  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 25 19  2  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 23 22  1  0  0  0  0\n 22 24  2  0  0  0  0\n 25 24  1  0  0  0  0\nM  END",
          "smiles": "Cc1ccc(CNC(=O)C(=O)NCCc2ccc(C)cn2)c(c1)OC",
          "formula": "C19H23N3O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e3768472-d560-4299-afea-ccc8ccea600f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "341.4049",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9e79ef94-a1d4-4747-a849-bf204facc5a3",
      "version": "5",
      "structure": {
        "id": "fdcd4c97-4ee4-42f7-a44f-75d8ad69b85a",
        "molfile": "\n  Marvin  01132113082D          \n\n 25 26  0  0  0  0            999 V2000\n    3.9128   -3.1382    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1983   -3.5506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4839   -3.1382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7694   -3.5506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7694   -4.3756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0549   -4.7882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3404   -4.3756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3740   -4.7882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3404   -3.5506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0549   -3.1382    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6273   -3.5506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6273   -4.3756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3417   -3.1382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0562   -3.5506    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7707   -3.1382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4851   -3.5506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1996   -3.1382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9141   -3.5506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9141   -4.3756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6286   -4.7882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1996   -4.7882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4851   -4.3756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7707   -4.7882    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7707   -5.6132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3417   -2.3132    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10  4  2  0  0  0  0\n 11  1  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 11  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 19  2  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 16 22  2  0  0  0  0\n 13 25  2  0  0  0  0\nM  END",
        "smiles": "Cc1ccc(CNC(=O)C(=O)NCCc2ccc(C)cn2)c(c1)OC",
        "formula": "C19H23N3O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "341.4049",
        "optical_activity": "NONE",
        "references": [
          "2a201694-2607-4927-aff7-66bef555fb6a",
          "6cf6c79a-4469-4881-969a-eff6784684ca"
        ],
        "stereo_centers": 0
      },
      "unii": "50H0N03SQU"
    }
  ]
}