{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6e656a32-bb24-43b6-bb73-0275c68a8461",
          "code": "469-61-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=469-61-4",
          "code_system": "CAS",
          "references": [
            "b48811fe-970c-4c77-9b6b-d9b7d5c82322",
            "f861a6c4-0cf6-4af4-af3a-9bdaf61e3d46"
          ]
        },
        {
          "uuid": "a5b6f195-91f3-4f42-b351-655b3d6721f9",
          "code": "207-418-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.746",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b48811fe-970c-4c77-9b6b-d9b7d5c82322"
          ]
        },
        {
          "uuid": "73c330a6-d881-4b49-8d03-72e0ccc9c870",
          "code": "Cedrene",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Cedrene",
          "code_system": "WIKIPEDIA",
          "references": [
            "09fd561a-1925-290b-e57c-b874bc50dd8b"
          ]
        },
        {
          "uuid": "0f360a8c-bfff-444c-8e22-5d3713fab6e0",
          "code": "6431015",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6431015",
          "code_system": "PUBCHEM",
          "references": [
            "b48811fe-970c-4c77-9b6b-d9b7d5c82322"
          ]
        },
        {
          "uuid": "5008217b-105c-9f43-eb10-902818b63c37",
          "code": "DTXSID0047032",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0047032",
          "code_system": "EPA CompTox",
          "references": [
            "542d4b81-3ead-b96e-7bd5-98a0134797e1"
          ]
        },
        {
          "uuid": "f32e1809-8c59-495d-958a-d6f14f028b85",
          "code": "50D4A81G8T",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1c98ad25-1fe4-e427-bcbc-57136ba34ae7",
          "code": "10216",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:10216",
          "code_system": "CHEBI",
          "references": [
            "9f28f20f-6de2-3860-da78-8af092d97a3a"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f5b92528-d2b0-41e2-a4dd-80e8cb302631",
          "name": "(-)-.ALPHA.-CEDRENE",
          "stdName": "(-)-.ALPHA.-CEDRENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca16bdd1-bd45-40f3-9d5f-a04af0f83615"
          ],
          "display_name": false
        },
        {
          "uuid": "2a6b0dd6-56c1-4282-8294-0e9e361d7781",
          "name": "(3R,3AS,7S,8AS)-2,3,4,7,8,8A-HEXAHYDRO-3,6,8,8-TETRAMETHYL-1H-3A,7-METHANOAZULENE",
          "stdName": "(3R,3AS,7S,8AS)-2,3,4,7,8,8A-HEXAHYDRO-3,6,8,8-TETRAMETHYL-1H-3A,7-METHANOAZULENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca16bdd1-bd45-40f3-9d5f-a04af0f83615"
          ],
          "display_name": false
        },
        {
          "uuid": "28b1a8e3-2735-4c82-97f4-6689b66782a3",
          "name": "(3R-(3.ALPHA.,3A.BETA.,7.BETA.,8A.ALPHA.))-2,3,4,7,8,8A-HEXAHYDRO-3,6,8,8-TETRAMETHYL-1H-3A,7-METHANOAZULENE",
          "stdName": "(3R-(3.ALPHA.,3A.BETA.,7.BETA.,8A.ALPHA.))-2,3,4,7,8,8A-HEXAHYDRO-3,6,8,8-TETRAMETHYL-1H-3A,7-METHANOAZULENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca16bdd1-bd45-40f3-9d5f-a04af0f83615"
          ],
          "display_name": false
        },
        {
          "uuid": "80549c93-83af-48ee-a17e-1c247611501a",
          "name": ".ALPHA.-CEDRENE",
          "stdName": ".ALPHA.-CEDRENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca16bdd1-bd45-40f3-9d5f-a04af0f83615"
          ],
          "display_name": true
        },
        {
          "uuid": "b57d7120-003d-4b8e-8013-ae52dc884a9c",
          "name": "1H-3A,7-METHANOAZULENE, 2,3,4,7,8,8A-HEXAHYDRO-3,6,8,8-TETRAMETHYL-, (3R,3AS,7S,8AS)-",
          "stdName": "1H-3A,7-METHANOAZULENE, 2,3,4,7,8,8A-HEXAHYDRO-3,6,8,8-TETRAMETHYL-, (3R,3AS,7S,8AS)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca16bdd1-bd45-40f3-9d5f-a04af0f83615"
          ],
          "display_name": false
        },
        {
          "uuid": "fe31cd3c-a844-4b5f-831b-5e8b42b259ea",
          "name": "ALPHA-CEDRENE",
          "stdName": "ALPHA-CEDRENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "32352d4c-08ba-4ee4-b99b-463bf8187c30"
          ],
          "display_name": false
        },
        {
          "uuid": "e772d76a-33b7-4d2b-9f59-a6285b5022cd",
          "name": "J5.927G",
          "stdName": "J5.927G",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f06c38f7-84cc-4b9e-8e54-86092d3f2ba3"
          ],
          "display_name": false
        },
        {
          "uuid": "a37fa529-65ba-4b77-8723-765eb3c316d8",
          "name": "LEVO-.ALPHA.-CEDRENE",
          "stdName": "LEVO-.ALPHA.-CEDRENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca16bdd1-bd45-40f3-9d5f-a04af0f83615"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9535b224-52d0-4bcc-a293-ce58252e864b",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ca16bdd1-bd45-40f3-9d5f-a04af0f83615",
          "citation": "SciFinder",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f06c38f7-84cc-4b9e-8e54-86092d3f2ba3",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J5.927G",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J5.927G",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "32352d4c-08ba-4ee4-b99b-463bf8187c30",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b48811fe-970c-4c77-9b6b-d9b7d5c82322",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392073000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8fda4d28-4f91-4e25-b422-fa6b8f3524af",
          "citation": "SRS import [50D4A81G8T]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=50D4A81G8T",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392073000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "542d4b81-3ead-b96e-7bd5-98a0134797e1",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=469-61-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "09fd561a-1925-290b-e57c-b874bc50dd8b",
          "citation": "Cedrene",
          "url": "https://en.wikipedia.org/wiki/Cedrene",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "9f28f20f-6de2-3860-da78-8af092d97a3a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a33a3784-1210-aff5-8a8e-dd9c3a489498",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "f861a6c4-0cf6-4af4-af3a-9bdaf61e3d46",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f208482f-87ef-49a7-8ea5-c25d75003ff9",
          "id": "f208482f-87ef-49a7-8ea5-c25d75003ff9",
          "molfile": "\n  Marvin  01132112332D          \n\n 15 17  0  0  1  0            999 V2000\n    1.7695   -1.3734    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    1.4908   -0.5771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2819   -2.0218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7695   -2.6974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5549   -2.4511    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.3386   -2.6974    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.0970   -3.0517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0790   -3.4858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8183   -2.0027    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.3211   -1.3638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5549   -1.6260    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    2.6846   -0.7535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4874   -0.5771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0274   -1.2526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7604   -1.2526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 11  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5 11  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  9  6  1  1  0  0  0\n  9 10  1  0  0  0  0\n  9 14  1  0  0  0  0\n 11 10  1  6  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  2  0  0  0  0\n 14 15  1  0  0  0  0\nM  END",
          "smiles": "CC1=CC[C@]23C[C@@H]1C(C)(C)[C@@H]3CC[C@H]2C",
          "formula": "C15H24",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ed43623f-5a0b-4833-9f9b-e4cc35434a11"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "204.3516",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d4cc95c0-2529-4e59-b261-96913075936f",
      "version": "11",
      "structure": {
        "id": "f0e1d6c6-969a-4076-9c93-3ae63b95735a",
        "molfile": "\n  Marvin  01132112302D          \n\n 16 18  0  0  1  0            999 V2000\n    2.5549   -1.6260    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.5549   -2.4511    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.3386   -2.6974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0970   -3.0517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0790   -3.4858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8183   -2.0027    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.3211   -1.3638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0274   -1.2526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4874   -0.5771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6846   -0.7535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7604   -1.2526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7695   -2.6974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2819   -2.0218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7695   -1.3734    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.4908   -0.5771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5549   -3.1170    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  3  6  1  0  0  0  0\n  6  7  1  6  0  0  0\n  1  7  1  6  0  0  0\n  6  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n  1 10  1  0  0  0  0\n  8 11  1  0  0  0  0\n  2 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n  1 14  1  0  0  0  0\n 14 15  1  1  0  0  0\n  2 16  1  1  0  0  0\nM  END",
        "smiles": "CC1=CC[C@]23C[C@@H]1C(C)(C)[C@]3([H])CC[C@H]2C",
        "formula": "C15H24",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "204.3516",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "8fda4d28-4f91-4e25-b422-fa6b8f3524af",
          "9535b224-52d0-4bcc-a293-ce58252e864b"
        ],
        "stereo_centers": 4
      },
      "unii": "50D4A81G8T"
    }
  ]
}