{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7090df5c-ebc3-4c54-b443-a44ca48eb53e",
          "code": "147-81-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=147-81-9",
          "code_system": "CAS",
          "references": [
            "01e3f70c-c682-41eb-84f0-8728c9d50ae5",
            "083cd7eb-114b-4915-8f6e-55819ca157b7"
          ]
        },
        {
          "uuid": "db6e063b-2bc0-4fd1-bab7-315a9ffa8d6d",
          "code": "205-699-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.182",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "01e3f70c-c682-41eb-84f0-8728c9d50ae5"
          ]
        },
        {
          "uuid": "0a9879c8-43f4-4a1c-9f05-3a80f76ac3df",
          "code": "m2020",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2020?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "01e3f70c-c682-41eb-84f0-8728c9d50ae5"
          ]
        },
        {
          "uuid": "d11c8edb-8a5b-45d2-9963-33993f5a683d",
          "code": "SUB43309",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "01e3f70c-c682-41eb-84f0-8728c9d50ae5"
          ]
        },
        {
          "uuid": "ce70e9d1-f49e-303f-ae92-ff91cf7a9ced",
          "code": "Arabinose",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Arabinose",
          "code_system": "WIKIPEDIA",
          "references": [
            "3e9482fc-2ee7-ff79-ba65-fddc02995eb4"
          ]
        },
        {
          "uuid": "b71da694-0c7a-adb7-f25c-ee61ac1a62d2",
          "code": "DTXSID8041610",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8041610",
          "code_system": "EPA CompTox",
          "references": [
            "bd521125-5bda-3fa8-0fbd-33a0c13796a7"
          ]
        },
        {
          "uuid": "71466307-e8df-5a5e-e907-d077eb36acb8",
          "code": "C68484",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Bioactive Food Component[C54060]|Dietary Carbohydrate[C68470]|Monosaccharide[C68471]|Pentose",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C68484",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ca74228d-88b8-abec-83bd-ecaad7630386"
          ]
        },
        {
          "uuid": "10f231ba-f5e9-2f43-308e-3c510f2bae0d",
          "code": "79281-2",
          "comments": "LOINC|ACTIVE|CHEM|Urine|Arabinose/Creatinine [Molar ratio] in Urine",
          "type": "PRIMARY",
          "url": "https://loinc.org/79281-2/",
          "code_system": "LOINC",
          "references": [
            "ca74228d-88b8-abec-83bd-ecaad7630386"
          ]
        },
        {
          "uuid": "00a854f9-0216-6a05-cde6-3aefc27f2862",
          "code": "3460 (Number of products:4)",
          "comments": "Dietary Supplement Label Database|carbohydrate|Arabinose",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=3460&item=Arabinose",
          "code_system": "DSLD",
          "references": [
            "ca74228d-88b8-abec-83bd-ecaad7630386"
          ]
        },
        {
          "uuid": "6c6b2b2f-c518-4271-bfef-0032b1be7bc7",
          "code": "509X20752R",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d21f0005-a21b-82d0-b03f-b0a76e8d906e",
          "code": "C68485",
          "comments": "NCIT",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C68485",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d98b8bd5-dc09-6f39-c136-60926e884fe8"
          ]
        },
        {
          "uuid": "62a3daaa-9911-5aa1-1168-58e4eb9fe7c2",
          "code": "22599",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:22599",
          "code_system": "CHEBI",
          "references": [
            "ca74228d-88b8-abec-83bd-ecaad7630386"
          ]
        },
        {
          "uuid": "c1b7fff9-ebed-5b75-17f3-841ada4f5819",
          "code": "1042055",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1042055",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "ca74228d-88b8-abec-83bd-ecaad7630386"
          ]
        },
        {
          "uuid": "b7f206e4-6d33-9ece-0db4-448af118a0d6",
          "code": "100000130672",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "0e70014a-1f5b-3ffc-a27f-17a862687e5a"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "3ad0efb3-4fe1-4aa1-b3ef-6550cad102c4",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "58b88dbd-f379-4d1f-a4ca-467f96c84e1f",
            "refuuid": "26aaf31d-d060-4fcf-ba55-ec446585e2af",
            "name": "ARABINOSE, D-",
            "unii": "F0W6ETZ4E5",
            "linking_id": "F0W6ETZ4E5",
            "ref_pname": "ARABINOSE, D-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9daa17fa-c71b-4234-bce8-a85c0876d0a7",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "0f0bcfaa-cbca-4ee2-9873-451971520347",
            "refuuid": "62869b6f-b380-47fc-91c7-95e9d0b55886",
            "name": "ARABINOSE, L-",
            "unii": "B40ROO395Z",
            "linking_id": "B40ROO395Z",
            "ref_pname": "ARABINOSE, L-",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a838fba3-1f29-44bf-a180-54fdc7129335",
          "name": "(±)-ARABINOSE",
          "stdName": "(+/-)-ARABINOSE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "63579ad8-bef1-4ae4-9859-3a13b34c39c7",
            "ebc1772f-d66c-41f8-ab3d-9bbc92173a90"
          ],
          "display_name": false
        },
        {
          "uuid": "b6c1ced6-195b-4302-b469-56bc84c0a51c",
          "name": "ARABINOSE",
          "stdName": "ARABINOSE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "5535048c-33b8-46d9-89b6-f87a2c663b15",
            "63579ad8-bef1-4ae4-9859-3a13b34c39c7",
            "ebc1772f-d66c-41f8-ab3d-9bbc92173a90",
            "b8e69bda-425e-4bcd-bea6-4add4f8b6a3b",
            "ac846d60-782f-41c0-981d-c6a265423d9e",
            "0b546563-a560-4eed-9638-4c1d98f09144"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "64105e60-6af4-49dc-aba3-26e55aed8aca",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "21d9258b-32f6-42fd-b373-9390dd02d3b2",
          "name": "ARABINOSE [MI]",
          "stdName": "ARABINOSE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "63579ad8-bef1-4ae4-9859-3a13b34c39c7",
            "ac846d60-782f-41c0-981d-c6a265423d9e"
          ],
          "display_name": false
        },
        {
          "uuid": "8c2019b1-9193-0834-4ce7-108f22ad0434",
          "name": "ARABINOSE [USP-RS]",
          "stdName": "ARABINOSE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6440da9e-873c-bf80-db20-0669a31e576f"
          ],
          "display_name": false
        },
        {
          "uuid": "5cbe6aa0-b5e5-40b8-91d1-c1a9af7cfee1",
          "name": "ARABINOSE, (±)-",
          "stdName": "ARABINOSE, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "63579ad8-bef1-4ae4-9859-3a13b34c39c7",
            "00a7cebe-6e62-4273-bc9a-5815e07e6435"
          ],
          "display_name": false
        },
        {
          "uuid": "83f5ab3e-9d4b-4178-a338-d064b26f8a04",
          "name": "ARABINOSE, DL-",
          "stdName": "ARABINOSE, DL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "63579ad8-bef1-4ae4-9859-3a13b34c39c7",
            "00a7cebe-6e62-4273-bc9a-5815e07e6435"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "0b546563-a560-4eed-9638-4c1d98f09144",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "63579ad8-bef1-4ae4-9859-3a13b34c39c7",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "00a7cebe-6e62-4273-bc9a-5815e07e6435",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ac846d60-782f-41c0-981d-c6a265423d9e",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ebc1772f-d66c-41f8-ab3d-9bbc92173a90",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "01e3f70c-c682-41eb-84f0-8728c9d50ae5",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392171000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae0f720d-8263-461c-b602-b64252711ff9",
          "citation": "SRS import [509X20752R]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=509X20752R",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392171000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b8e69bda-425e-4bcd-bea6-4add4f8b6a3b",
          "citation": "ARABINOSE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5535048c-33b8-46d9-89b6-f87a2c663b15",
          "citation": "ARABINOSE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3e9482fc-2ee7-ff79-ba65-fddc02995eb4",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Arabinose",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "bd521125-5bda-3fa8-0fbd-33a0c13796a7",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=147-81-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0e70014a-1f5b-3ffc-a27f-17a862687e5a",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "ca74228d-88b8-abec-83bd-ecaad7630386",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "083cd7eb-114b-4915-8f6e-55819ca157b7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6440da9e-873c-bf80-db20-0669a31e576f",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "d98b8bd5-dc09-6f39-c136-60926e884fe8",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "39188229-d815-e35f-2eec-e83df356975d",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "09239854-e5d5-4d09-9b2c-9f744b3c3bc1",
          "id": "09239854-e5d5-4d09-9b2c-9f744b3c3bc1",
          "molfile": "\n  Marvin  01132100442D          \n\n 10  9  0  0  0  0            999 V2000\n    7.0841   -5.1176    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.0841   -5.9426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3697   -4.7051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6552   -5.1176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7986   -4.7051    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.7986   -3.8801    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5131   -5.1176    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.5131   -5.9426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2276   -4.7051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2276   -3.8801    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  5  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  1  0  0  0\n  7  9  1  0  0  0  0\n  9 10  2  0  0  0  0\nM  END",
          "smiles": "C(=O)[C@H]([C@@H]([C@@H](CO)O)O)O",
          "formula": "C5H10O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e68573ed-cd00-41f0-8186-9e95d2c865ea"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "150.1301",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a62e4455-db15-4b63-a25a-af270555efe2",
      "version": "22",
      "structure": {
        "id": "655ead43-ece8-4d1e-84d3-bab2711dc8f6",
        "molfile": "\n  Marvin  01132105172D          \n\n 10  9  0  0  0  0            999 V2000\n    6.3697   -4.7051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0841   -5.1176    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.7986   -4.7051    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.5131   -5.1176    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.2276   -4.7051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2276   -3.8801    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5131   -5.9426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7986   -3.8801    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0841   -5.9426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6552   -5.1176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  4  7  1  1  0  0  0\n  3  8  1  1  0  0  0\n  2  9  1  6  0  0  0\n  1 10  1  0  0  0  0\nM  END",
        "smiles": "C(=O)[C@H]([C@@H]([C@@H](CO)O)O)O",
        "formula": "C5H10O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "150.1301",
        "optical_activity": "( + / - )",
        "references": [
          "ebc1772f-d66c-41f8-ab3d-9bbc92173a90",
          "ae0f720d-8263-461c-b602-b64252711ff9"
        ],
        "stereo_centers": 3
      },
      "unii": "509X20752R"
    }
  ]
}