{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "acc63a49-f4e1-4f5e-b3a2-0146751cc804", "code": "7779-31-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=7779-31-9", "code_system": "CAS", "references": [ "de04331e-7b84-457d-848a-e1246ba12aae", "f751a4e4-0039-439e-ad34-62eaf66189ca" ] }, { "uuid": "dd209541-8461-e0c1-3d7f-c38dd0a724cb", "code": "111032", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/111032", "code_system": "PUBCHEM", "references": [ "2c176f69-be73-10b1-d8a9-b0b5a8bf1656" ] }, { "uuid": "b1aa41e9-205b-4a93-aed1-e4af93168b4f", "code": "508SPW3T3P", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "c0954654-1335-75e2-02b2-3e529e864f52", "code": "DTXSID5044990", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5044990", "code_system": "EPA CompTox", "references": [ "ccb0db6b-061c-7e2e-cc90-b80bc363eeb5" ] } ], "substance_class": "chemical", "names": [ { "uuid": "e92022d9-0779-466e-8d98-7c03931bd324", "name": "3,3,5-TRIMETHYLCYCLOHEXYL 2-METHYLPROP-2-ENOATE", "stdName": "3,3,5-TRIMETHYLCYCLOHEXYL 2-METHYLPROP-2-ENOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "0f09a3c7-739a-4e4c-bb04-11ba601afc27", "78fec523-dbbf-4fbf-9094-6e01bc3e8142" ], "display_name": false }, { "uuid": "ab1d7e89-b39d-44cd-bb39-2482243557d4", "name": "3,5,5-TRIMETHYLCYCLOHEXYL METHACRYLATE", "stdName": "3,5,5-TRIMETHYLCYCLOHEXYL METHACRYLATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "6d200b20-71e2-4949-9e1d-311aaeb415e5", "78fec523-dbbf-4fbf-9094-6e01bc3e8142" ], "display_name": true } ], "references": [ { "uuid": "6d200b20-71e2-4949-9e1d-311aaeb415e5", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "78fec523-dbbf-4fbf-9094-6e01bc3e8142", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0f09a3c7-739a-4e4c-bb04-11ba601afc27", "citation": "TOX 21", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "de04331e-7b84-457d-848a-e1246ba12aae", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392185000, "tags": [ "NOMEN" ] }, { "uuid": "1286f498-33f7-4773-80f8-6b646543f619", "citation": "SRS import [508SPW3T3P]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=508SPW3T3P", "doc_type": "SRS", "public_domain": true, "document_date": 1493392185000, "tags": [ "NOMEN" ] }, { "uuid": "1995b4f7-0205-4510-802c-d1836b5c537c", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2c176f69-be73-10b1-d8a9-b0b5a8bf1656", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "f751a4e4-0039-439e-ad34-62eaf66189ca", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "ccb0db6b-061c-7e2e-cc90-b80bc363eeb5", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "33debd06-a7a6-414c-b236-ef230a4565fa", "id": "33debd06-a7a6-414c-b236-ef230a4565fa", "molfile": "\n Marvin 01132102462D \n\n 15 15 0 0 0 0 999 V2000\n 1.0164 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0164 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 0.3020 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3020 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 1.0164 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7309 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5559 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -1.1270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7309 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4125 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1270 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1270 0.4125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8414 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5559 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8414 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 9 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 10 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 8 1 0 0 0 0\n 6 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 2 0 0 0 0\n 11 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 2 0 0 0 0\nM END", "smiles": "C=C(C)C(=O)OC1CC(C)CC(C)(C)C1", "formula": "C13H22O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "be0d09e3-aee6-4385-82c7-4aebe596c828" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "210.3131", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "1a12cca0-58d6-477c-b97a-00c12c9d0b3e", "version": "5", "structure": { "id": "26183160-3d40-49a7-883d-b2489f1e9431", "molfile": "\n Marvin 01132102062D \n\n 15 15 0 0 0 0 999 V2000\n -1.1270 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8414 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8414 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1270 0.4125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4125 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5559 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3020 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0164 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7309 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7309 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0164 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3020 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0164 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5559 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -1.1270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 1 4 2 0 0 0 0\n 1 5 1 0 0 0 0\n 2 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 7 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 9 14 1 0 0 0 0\n 9 15 1 0 0 0 0\n 5 7 1 0 0 0 0\nM END", "smiles": "C=C(C)C(=O)OC1CC(C)CC(C)(C)C1", "formula": "C13H22O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "210.3131", "optical_activity": "UNSPECIFIED", "references": [ "1286f498-33f7-4773-80f8-6b646543f619", "1995b4f7-0205-4510-802c-d1836b5c537c" ], "stereo_centers": 2 }, "unii": "508SPW3T3P" } ] }