{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "30994c54-150d-4ee1-acfe-255ccab046c1", "code": "125590-73-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=125590-73-0", "code_system": "CAS", "references": [ "033cc95b-21c5-4ca7-97c5-217f5ef4b9d8", "2ddf0e46-a350-4891-bd40-4ed22a2ff7a4" ] }, { "uuid": "462ee59f-e9bd-4ed5-95ee-63d5da2e5a95", "code": "24848590", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/24848590", "code_system": "PUBCHEM", "references": [ "033cc95b-21c5-4ca7-97c5-217f5ef4b9d8" ] }, { "uuid": "f1ca342b-20c9-add7-1a36-3bda1dfafb0b", "code": "DTXSID2041202", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2041202", "code_system": "EPA CompTox", "references": [ "939b7f74-81e8-e676-6c7d-c09affdfdcde" ] }, { "uuid": "71a88b09-f8f6-40f1-9138-f6f0ccee5c95", "code": "4ZR53A8AKE", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "015743ab-50d5-4991-abd6-9e00d11125f5", "name": ".ALPHA.-D-GLUCOPYRANOSIDE, 2-ETHYLHEXYL", "stdName": ".ALPHA.-D-GLUCOPYRANOSIDE, 2-ETHYLHEXYL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "bbf4c373-33cf-4f09-bc4b-f59cd12f8c8f" ], "display_name": false }, { "uuid": "90802ee5-27b4-436a-9b28-721e813de72a", "name": "2-ETHYLHEXYL .ALPHA.-D-GLUCOPYRANOSIDE", "stdName": "2-ETHYLHEXYL .ALPHA.-D-GLUCOPYRANOSIDE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "bbf4c373-33cf-4f09-bc4b-f59cd12f8c8f" ], "display_name": true }, { "uuid": "8f54127f-2111-46da-9d17-41bff05ddf6d", "name": "ALPHA-D-GLUCOPYRANOSIDE, 2-ETHYLHEXYL", "stdName": "ALPHA-D-GLUCOPYRANOSIDE, 2-ETHYLHEXYL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d1fe6545-c51c-4597-9fa7-ecae465b4dbb" ], "display_name": false } ], "references": [ { "uuid": "d1fe6545-c51c-4597-9fa7-ecae465b4dbb", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "bbf4c373-33cf-4f09-bc4b-f59cd12f8c8f", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "033cc95b-21c5-4ca7-97c5-217f5ef4b9d8", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392175000, "tags": [ "NOMEN" ] }, { "uuid": "1a0ff89a-a0ea-492e-9766-60bfc43bd509", "citation": "SRS import [4ZR53A8AKE]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4ZR53A8AKE", "doc_type": "SRS", "public_domain": true, "document_date": 1493392175000, "tags": [ "NOMEN" ] }, { "uuid": "939b7f74-81e8-e676-6c7d-c09affdfdcde", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=125590-73-0", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "2ddf0e46-a350-4891-bd40-4ed22a2ff7a4", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "d355a942-207b-4a87-8884-f4f7e9f292cd", "id": "d355a942-207b-4a87-8884-f4f7e9f292cd", "molfile": "\n Marvin 01132110552D \n\n 20 20 0 0 1 0 999 V2000\n 1.2393 -0.7071 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 0.8262 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0654 -0.7071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4715 -1.4213 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 3.2907 -1.4213 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7108 -2.1355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5299 -2.1355 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 4.9360 -1.4213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7622 -1.4213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9360 -2.8496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7622 -2.8496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1752 -3.5637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0014 -3.5637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0654 -2.1355 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 2.4715 -2.8496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2393 -2.1355 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 0.8262 -2.8496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8262 -1.4213 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 0.0000 -1.4213 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 4 1 0 0 0 0\n 19 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 6 0 0 0\n 15 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 11 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 16 1 6 0 0 0\n 17 15 1 0 0 0 0\n 17 18 1 1 0 0 0\n 19 17 1 0 0 0 0\n 19 20 1 6 0 0 0\nM END", "smiles": "CCCCC(CC)CO[C@@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O", "formula": "C14H28O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "EPIMERIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "72fe8c54-4ebd-47b2-b032-bb3bf067c7e1" }, "defined_stereo": 5, "ez_centers": 0, "molecular_weight": "292.3691", "optical_activity": "UNSPECIFIED", "stereo_centers": 6 } ], "definition_level": "COMPLETE", "uuid": "ed28f1dc-9667-4a30-ac49-90e9f9cc4118", "version": "5", "structure": { "id": "52a8e096-7b2e-4b36-a42e-7755872afe54", "molfile": "\n Marvin 01132104182D \n\n 20 20 0 0 1 0 999 V2000\n 2.4715 -1.4213 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 2.0654 -2.1355 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 2.0654 -0.7071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2393 -2.1355 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 1.2393 -0.7071 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 0.8262 -1.4213 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 3.2907 -1.4213 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4715 -2.8496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8262 -2.8496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.4213 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8262 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7108 -2.1355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5299 -2.1355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9360 -2.8496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7622 -2.8496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1752 -3.5637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0014 -3.5637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9360 -1.4213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7622 -1.4213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 0 0 0 0\n 1 7 1 6 0 0 0\n 2 4 1 0 0 0 0\n 2 8 1 6 0 0 0\n 3 5 1 0 0 0 0\n 4 6 1 0 0 0 0\n 4 9 1 1 0 0 0\n 5 6 1 0 0 0 0\n 5 11 1 1 0 0 0\n 6 10 1 6 0 0 0\n 7 13 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 19 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 19 20 1 0 0 0 0\nM END", "smiles": "CCCCC(CC)CO[C@@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O", "formula": "C14H28O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "EPIMERIC", "defined_stereo": 5, "ez_centers": 0, "molecular_weight": "292.3691", "optical_activity": "UNSPECIFIED", "references": [ "1a0ff89a-a0ea-492e-9766-60bfc43bd509", "d1fe6545-c51c-4597-9fa7-ecae465b4dbb" ], "stereo_centers": 6 }, "unii": "4ZR53A8AKE" } ] }