{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2a1b7f23-e4bb-4ac4-a4f4-c24be196e8b4",
          "code": "17941-34-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=17941-34-3",
          "code_system": "CAS",
          "references": [
            "d722f84a-db4e-408d-8856-bf2af92f5213",
            "06bae7cd-6fa4-42c4-8f16-3667ac471d45"
          ]
        },
        {
          "uuid": "6e3f0353-9d83-4c2b-aee6-ee3eb06b97a5",
          "code": "C059860",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67059860",
          "code_system": "MESH",
          "references": [
            "d722f84a-db4e-408d-8856-bf2af92f5213"
          ]
        },
        {
          "uuid": "063f44e8-0f4f-4332-a212-2c9cd8ce7a12",
          "code": "ALEURITIC ACID",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Aleuritic_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "d722f84a-db4e-408d-8856-bf2af92f5213"
          ]
        },
        {
          "uuid": "e58b1ff2-d3e3-45af-ac48-139baa486525",
          "code": "6949-98-0",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6949-98-0",
          "code_system": "CAS",
          "references": [
            "d722f84a-db4e-408d-8856-bf2af92f5213",
            "8a32ea8c-a793-42f2-9a52-5a61f5a52f62"
          ]
        },
        {
          "uuid": "b8169783-6dae-48b7-928d-c63af21146e2",
          "code": "m1495",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1495?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d722f84a-db4e-408d-8856-bf2af92f5213"
          ]
        },
        {
          "uuid": "3cc0151d-d601-4c08-8422-0644beed0882",
          "code": "7269318",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7269318",
          "code_system": "PUBCHEM",
          "references": [
            "d722f84a-db4e-408d-8856-bf2af92f5213"
          ]
        },
        {
          "uuid": "82025eb5-94f9-4e6b-992d-6df15a89f8ae",
          "code": "4ZK9T6U1F5",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c70697cb-a67b-4f71-809d-f2c0d23fa880",
          "code": "1012799",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1012799",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "27b929f3-435a-4e52-8409-211919b0eaf2"
          ]
        },
        {
          "uuid": "cdaa5953-fb2a-cdec-574a-91928b29389a",
          "code": "25150",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=25150",
          "code_system": "NSC",
          "references": [
            "75b778b4-165a-0046-7567-adc512ebe6ed"
          ]
        },
        {
          "uuid": "4b50d947-a7d2-479e-acee-807b61239f33",
          "code": "DTXSID001018290",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID001018290",
          "code_system": "EPA CompTox",
          "references": [
            "27b929f3-435a-4e52-8409-211919b0eaf2"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f4b3c223-d59e-4823-8e62-becc2c584599",
          "name": "(±)-THREO-9,10,16-TRIHYDROXYPALMITIC ACID",
          "stdName": "(+/-)-THREO-9,10,16-TRIHYDROXYPALMITIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "251bad14-b6a5-4977-b20d-04e379caefa1",
            "42698aad-1b4e-4984-8e53-9bb09e3f46b5"
          ],
          "display_name": false
        },
        {
          "uuid": "9eb11b9c-9ae7-4abd-84c8-8cc97a40cd8f",
          "name": "ALEURITIC ACID",
          "stdName": "ALEURITIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a5fad7b-2c2d-47e0-a60d-5775440d08a3",
            "2961074b-a941-4e7f-b756-abdcd5ead3cc",
            "251bad14-b6a5-4977-b20d-04e379caefa1",
            "ab9573aa-20de-4932-91fc-90168fbaab98",
            "1bedea8e-bb11-4ece-855f-e15f9dff8f08",
            "42698aad-1b4e-4984-8e53-9bb09e3f46b5"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "da115de0-70f9-4e84-a11d-f2e6d964b87e",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "30d00a4a-1295-4d1c-9ddf-e34b7443d760",
          "name": "ALEURITIC ACID [MI]",
          "stdName": "ALEURITIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "251bad14-b6a5-4977-b20d-04e379caefa1",
            "42698aad-1b4e-4984-8e53-9bb09e3f46b5"
          ],
          "display_name": false
        },
        {
          "uuid": "3ec113c3-d4ad-85ac-2011-f95c8a2fb9e6",
          "name": "ALEURITIC ACID [USP-RS]",
          "stdName": "ALEURITIC ACID [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f7dcb9b-eb2b-fa75-6990-def348ee4d66"
          ],
          "display_name": false
        },
        {
          "uuid": "d8719d9c-f70b-4f3c-b660-e6b74fff299d",
          "name": "ALEURITIC ACID, THREO-",
          "stdName": "ALEURITIC ACID, THREO-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "42698aad-1b4e-4984-8e53-9bb09e3f46b5",
            "c1d0c167-2986-4e96-90e9-66e782fc1e44"
          ],
          "display_name": false
        },
        {
          "uuid": "038887a9-1f0c-ea56-b477-0fe46747a94b",
          "name": "NSC-25150",
          "stdName": "NSC-25150",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "75b778b4-165a-0046-7567-adc512ebe6ed"
          ],
          "display_name": false
        },
        {
          "uuid": "29f798c2-a4a1-4594-989f-6deb583781fb",
          "name": "REL-(9R,10R)-9,10,16-TRIHYDROXYHEXADECANOIC ACID",
          "stdName": "REL-(9R,10R)-9,10,16-TRIHYDROXYHEXADECANOIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "251bad14-b6a5-4977-b20d-04e379caefa1",
            "42698aad-1b4e-4984-8e53-9bb09e3f46b5"
          ],
          "display_name": false
        },
        {
          "uuid": "3ef2c2bd-a146-49fe-8cb7-e98f94e42ad8",
          "name": "THREO-ALEURITIC ACID",
          "stdName": "THREO-ALEURITIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fddbe814-d46d-4fa9-83b5-8671fe8510a2",
            "42698aad-1b4e-4984-8e53-9bb09e3f46b5"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "251bad14-b6a5-4977-b20d-04e379caefa1",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2961074b-a941-4e7f-b756-abdcd5ead3cc",
          "citation": "MERCK DL",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "42698aad-1b4e-4984-8e53-9bb09e3f46b5",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fddbe814-d46d-4fa9-83b5-8671fe8510a2",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c1d0c167-2986-4e96-90e9-66e782fc1e44",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6a5fad7b-2c2d-47e0-a60d-5775440d08a3",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d722f84a-db4e-408d-8856-bf2af92f5213",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390462000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ea1b3646-be03-43f0-ac39-715ce9687d87",
          "citation": "SRS import [4ZK9T6U1F5]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4ZK9T6U1F5",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390462000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1bedea8e-bb11-4ece-855f-e15f9dff8f08",
          "citation": "ALEURITIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ab9573aa-20de-4932-91fc-90168fbaab98",
          "citation": "ALEURITIC ACID [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5f7dcb9b-eb2b-fa75-6990-def348ee4d66",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "8a32ea8c-a793-42f2-9a52-5a61f5a52f62",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "06bae7cd-6fa4-42c4-8f16-3667ac471d45",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "75b778b4-165a-0046-7567-adc512ebe6ed",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "27b929f3-435a-4e52-8409-211919b0eaf2",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8b0445c7-8227-4788-902a-a04f2ad81cad",
          "id": "8b0445c7-8227-4788-902a-a04f2ad81cad",
          "molfile": "\n  Marvin  01132107132D          \n\n 21 20  0  0  0  0            999 V2000\n    8.5447   -4.8208    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.5447   -3.9947    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2602   -5.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9755   -4.8208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6864   -5.2270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4064   -4.8116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1218   -5.2224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8372   -4.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5479   -5.2132    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8340   -5.2362    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.8340   -6.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1139   -4.8301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4078   -5.2454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6923   -4.8347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9769   -5.2501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2615   -4.8440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5462   -5.2501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8353   -4.8440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1199   -5.2593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1199   -6.0855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4045   -4.8532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  1 10  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10 11  1  1  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 19  2  0  0  0  0\nM  END",
          "smiles": "C(CCC[C@@H]([C@H](CCCCCCO)O)O)CCCC(=O)O",
          "formula": "C16H32O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "10f497b4-da13-423b-ae34-984d20a252e2"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "304.4229",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "261fef89-e4eb-4705-8b3f-85beb8278475",
      "version": "14",
      "structure": {
        "id": "33194adb-1b27-4f36-89c5-8bb295b6b8e9",
        "molfile": "\n  Marvin  01132102442D          \n\n 21 20  0  0  0  0            999 V2000\n    2.1199   -5.2593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1199   -6.0855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4045   -4.8532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8353   -4.8440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5462   -5.2501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2615   -4.8440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9769   -5.2501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6923   -4.8347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4078   -5.2454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1139   -4.8301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8340   -5.2362    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.5447   -4.8208    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.5447   -3.9947    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2602   -5.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9755   -4.8208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6864   -5.2270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4064   -4.8116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1218   -5.2224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8372   -4.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5479   -5.2132    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8340   -6.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  1  0  0  0\n 14 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 11 21  1  1  0  0  0\nM  END",
        "smiles": "C(CCC[C@@H]([C@H](CCCCCCO)O)O)CCCC(=O)O",
        "formula": "C16H32O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "304.4229",
        "optical_activity": "( + / - )",
        "references": [
          "ea1b3646-be03-43f0-ac39-715ce9687d87",
          "fddbe814-d46d-4fa9-83b5-8671fe8510a2"
        ],
        "stereo_centers": 2
      },
      "unii": "4ZK9T6U1F5"
    }
  ]
}