{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "8cf2246f-801c-4a0f-ba2d-20ff808e88ec", "code": "96030-94-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=96030-94-3", "code_system": "CAS", "references": [ "4cf99a09-9fa2-4754-843c-dff9f25ddbb3", "e1bf0e16-ca24-415e-999e-ee85d7a7be37" ] }, { "uuid": "f5111451-0167-4a82-9bcf-f1ee5fb0dceb", "code": "21 CFR 184.1449", "comments": "PART 184 -- DIRECT FOOD SUBSTANCES AFFIRMED AS GENERALLY RECOGNIZED AS SAFE|Subpart B--Listing of Specific Substances Affirmed as GRAS|Sec. 184.1449 Manganese citrate", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=184.1449", "code_system": "CFR", "references": [ "4cf99a09-9fa2-4754-843c-dff9f25ddbb3" ] }, { "uuid": "bce31cf3-81bd-4037-b61a-dc2bc4cffdb4", "code": "283767", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/283767/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "4cf99a09-9fa2-4754-843c-dff9f25ddbb3" ] }, { "uuid": "2b8071f7-74dc-4bc8-998d-a99de895dac7", "code": "1791698", "type": "ALTERNATIVE", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1791698/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "4cf99a09-9fa2-4754-843c-dff9f25ddbb3" ] }, { "uuid": "f7e79f7c-9181-44a5-9763-11e44616a49c", "code": "SUB14469MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "4cf99a09-9fa2-4754-843c-dff9f25ddbb3" ] }, { "uuid": "caafced9-31bd-49ad-9299-d0d867398dda", "code": "71587363", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587363", "code_system": "PUBCHEM", "references": [ "4cf99a09-9fa2-4754-843c-dff9f25ddbb3" ] }, { "uuid": "d8454363-fd89-6da0-db74-656f6b2301c4", "code": "DTXSID60242101", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60242101", "code_system": "EPA CompTox", "references": [ "29af7032-8572-f749-42ff-eec9fa3929d1" ] }, { "uuid": "330e0d9b-f26a-13c1-c4e0-489ec6b4a41f", "code": "DB14495", "type": "PRIMARY", "url": "https://go.drugbank.com/drugs/DB14495", "code_system": "DRUG BANK", "references": [ "ab812baf-00a5-6e0e-7bad-e4a7f23ab063" ] }, { "uuid": "4f81413e-e87b-4281-b232-3c0b6fbb41ca", "code": "4Z2OA6A13N", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "38282bf1-52ee-1bfb-59c0-1b73d231b43f", "code": "4Z2OA6A13N", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=4Z2OA6A13N", "code_system": "DAILYMED", "references": [ "1d9e3272-eebf-00f1-6848-1e0fde6833b3" ] }, { "uuid": "5f40b045-cb16-ef52-3489-90ada4a0c73c", "code": "300000030951", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "04bb1433-aeb4-3378-5ee6-bba698ca2341" ] } ], "relationships": [ { "uuid": "de859ec7-d712-4918-b93d-0cc45b8c6a90", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "dea27683-404b-4314-979a-c2848da37519", "refuuid": "8248332c-8739-4872-8639-9ac1fb9d7f19", "name": "MANGANOUS CATION", "unii": "H6EP7W5457", "linking_id": "H6EP7W5457", "ref_pname": "MANGANOUS CATION", "substance_class": "reference" } }, { "uuid": "84be97c6-c5e2-4368-a67d-f1b1a8ccbe14", "type": "PARENT->SALT/SOLVATE", "related_substance": { "uuid": "56162cb3-4105-49fd-be36-f0ccc07294ca", "refuuid": "7495c063-0afe-4404-b6dc-1327ce06fa4e", "name": "Anhydrous citric acid", "unii": "XF417D3PSL", "linking_id": "XF417D3PSL", "ref_pname": "Anhydrous citric acid", "substance_class": "reference" } }, { "uuid": "e28d08f9-f85a-47c1-a4e5-12755fff0275", "type": "PARENT->SALT/SOLVATE", "related_substance": { "uuid": "c5c4918b-9c99-40f4-9d6d-d221511aa562", "refuuid": "8248332c-8739-4872-8639-9ac1fb9d7f19", "name": "MANGANOUS CATION", "unii": "H6EP7W5457", "linking_id": "H6EP7W5457", "ref_pname": "MANGANOUS CATION", "substance_class": "reference" } }, { "uuid": "14c41a29-831a-4f9f-912b-c63a60f05961", "type": "ANHYDROUS->SOLVATE", "references": [ "610be60a-f2ad-4d2a-9e76-14fd82100297" ], "related_substance": { "uuid": "1fc79ba4-518e-4ae6-ba62-01017bf6a939", "refuuid": "7c317b82-b24e-4936-a107-4f5139bab6d7", "name": "MANGANESE CITRATE ANHYDROUS", "unii": "74NE0422XH", "linking_id": "74NE0422XH", "ref_pname": "MANGANESE CITRATE ANHYDROUS", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "592ee0fb-cf67-40a4-a831-bc562895c00f", "name": "1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, MANGANESE(2+) SALT, HYDRATE (2:3:10)", "stdName": "1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, MANGANESE(2+) SALT, HYDRATE (2:3:10)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3b704110-2459-4b27-8cd2-af2b3fb6d096", "b9c6c0b6-9e2b-4fe3-8a03-de6b43bb2867" ], "display_name": false }, { "uuid": "333b7dbe-b59d-4077-9846-a7a10f950582", "name": "MANGANESE CITRATE", "stdName": "MANGANESE CITRATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "5b2e7ef3-c6a7-4c21-a861-a935792ef57e", "0f1e4acf-ec22-49fd-af65-802f03a407de", "ba132d86-a3d8-44eb-812f-e5f57c544103", "3b704110-2459-4b27-8cd2-af2b3fb6d096", "95e3a360-00be-4675-b977-ef12ef9b0250", "84e1b96a-8961-480c-b1f2-22164ccd7b4d" ], "display_name": false }, { "uuid": "33cc0652-9f5f-4e28-b1cf-6e83b1c30a9f", "name": "MANGANESE CITRATE DECAHYDRATE", "stdName": "MANGANESE CITRATE DECAHYDRATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "3b704110-2459-4b27-8cd2-af2b3fb6d096", "114ca872-18ff-461e-9ec7-b4ae7337f162" ], "display_name": true }, { "uuid": "be0433ed-067c-4dcb-88b5-577141f173d6", "name": "MANGANESE CITRATE [FCC]", "stdName": "MANGANESE CITRATE [FCC]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0f1e4acf-ec22-49fd-af65-802f03a407de", "3b704110-2459-4b27-8cd2-af2b3fb6d096" ], "display_name": false }, { "uuid": "7b749bf2-577b-e5cf-44cc-a8524dee17f8", "name": "Manganese citrate [WHO-DD]", "stdName": "MANGANESE CITRATE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b2b59953-3b41-910a-6dd2-a1c17fe69b5b" ], "display_name": false }, { "uuid": "0f29f3ec-3c2b-4280-b48a-c5545b73f513", "name": "TRIMANGANESE DICITRATE DECAHYDRATE", "stdName": "TRIMANGANESE DICITRATE DECAHYDRATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3b704110-2459-4b27-8cd2-af2b3fb6d096", "b9c6c0b6-9e2b-4fe3-8a03-de6b43bb2867" ], "display_name": false } ], "references": [ { "uuid": "95e3a360-00be-4675-b977-ef12ef9b0250", "citation": "SAXS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "3b704110-2459-4b27-8cd2-af2b3fb6d096", "citation": "USP FOOD CHEMICALS CODEX", "doc_type": "USP FOOD CHEMICALS CODEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0f1e4acf-ec22-49fd-af65-802f03a407de", "citation": "FCC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "114ca872-18ff-461e-9ec7-b4ae7337f162", "citation": "CFR", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b9c6c0b6-9e2b-4fe3-8a03-de6b43bb2867", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ba132d86-a3d8-44eb-812f-e5f57c544103", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4cf99a09-9fa2-4754-843c-dff9f25ddbb3", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389681000, "tags": [ "NOMEN" ] }, { "uuid": "bd7bff4c-42c6-453d-af93-1591cd878fc1", "citation": "SRS import [4Z2OA6A13N]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4Z2OA6A13N", "doc_type": "SRS", "public_domain": true, "document_date": 1493389681000, "tags": [ "NOMEN" ] }, { "uuid": "84e1b96a-8961-480c-b1f2-22164ccd7b4d", "citation": "MANGANESE CITRATE [FCC]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "5b2e7ef3-c6a7-4c21-a861-a935792ef57e", "citation": "MANGANESE CITRATE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "29af7032-8572-f749-42ff-eec9fa3929d1", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=96030-94-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "04bb1433-aeb4-3378-5ee6-bba698ca2341", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "ab812baf-00a5-6e0e-7bad-e4a7f23ab063", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "e1bf0e16-ca24-415e-999e-ee85d7a7be37", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "1d9e3272-eebf-00f1-6848-1e0fde6833b3", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "b2b59953-3b41-910a-6dd2-a1c17fe69b5b", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "610be60a-f2ad-4d2a-9e76-14fd82100297", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "8d75c383-8490-4972-a5a1-ad4879d45e84", "id": "8d75c383-8490-4972-a5a1-ad4879d45e84", "molfile": "\n Marvin 01132107202D \n\n 1 0 0 0 0 0 999 V2000\n 17.8407 -3.7812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\nM END", "smiles": "O", "formula": "H2O", "atropisomerism": "No", "charge": 0, "count": 10, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 10, "units": "MOL RATIO", "uuid": "aedf8914-3aee-4ea0-b21e-9c4e97852376" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "18.0153", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "8999a751-3b4b-44ce-828f-fc6fe820ce35", "id": "8999a751-3b4b-44ce-828f-fc6fe820ce35", "molfile": "\n Marvin 01132107092D \n\n 1 0 0 0 0 0 999 V2000\n 10.1647 -4.0484 0.0000 Mn 0 2 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 2\nM END", "smiles": "[Mn+2]", "formula": "Mn", "atropisomerism": "No", "charge": 2, "count": 3, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 3, "units": "MOL RATIO", "uuid": "8dd02353-95c8-401a-aa02-50a1a9a47053" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "54.938", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "ec4b75e1-87c0-4122-bfe9-922aa7d6137a", "id": "ec4b75e1-87c0-4122-bfe9-922aa7d6137a", "molfile": "\n Marvin 01132112132D \n\n 13 12 0 0 0 0 999 V2000\n 3.7572 -4.0484 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4722 -3.6359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4722 -2.8109 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1872 -4.0484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8975 -3.6359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8975 -2.8109 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6125 -4.0484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3275 -3.6359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0380 -4.0484 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3275 -2.8109 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8975 -4.4563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1780 -4.8597 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6079 -4.8688 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 7 1 0 0 0 0\n 5 11 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 2 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 2 0 0 0 0\nM END", "smiles": "C(C(=O)O)C(CC(=O)O)(C(=O)O)O", "formula": "C6H8O7", "atropisomerism": "No", "charge": 0, "count": 2, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "4b4d4d16-1c27-4d44-b363-fbde91ff64b9" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "192.1238", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "93bcfd5b-6576-4c6f-882c-263ad0a9a2ed", "version": "10", "structure": { "id": "2b49e3c4-1c45-4c81-ae8b-9841e7d8d1ec", "molfile": "\n Marvin 01132102212D \n\n 39 24 0 0 0 0 999 V2000\n 10.1647 -4.0484 0.0000 Mn 0 2 0 0 0 0 0 0 0 0 0 0\n 3.7572 -4.0484 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 4.4722 -3.6359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1872 -4.0484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8975 -3.6359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6125 -4.0484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3275 -3.6359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0380 -4.0484 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 7.3275 -2.8109 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8975 -2.8109 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8975 -4.4563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1780 -4.8597 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6079 -4.8688 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 4.4722 -2.8109 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7157 -3.7812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7572 -4.0484 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 4.4722 -3.6359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1872 -4.0484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8975 -3.6359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6125 -4.0484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3275 -3.6359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0380 -4.0484 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 7.3275 -2.8109 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8975 -2.8109 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8975 -4.4563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1780 -4.8597 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6079 -4.8688 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 4.4722 -2.8109 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1647 -4.0484 0.0000 Mn 0 2 0 0 0 0 0 0 0 0 0 0\n 10.1647 -4.0484 0.0000 Mn 0 2 0 0 0 0 0 0 0 0 0 0\n 13.7157 -3.7812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7157 -3.7812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7157 -3.7812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7157 -3.7812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7157 -3.7812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7157 -3.7812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7157 -3.7812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7157 -3.7812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7157 -3.7812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7 9 2 0 0 0 0\n 5 10 1 0 0 0 0\n 5 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 11 13 1 0 0 0 0\n 3 14 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 28 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 24 1 0 0 0 0\n 19 25 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 23 2 0 0 0 0\n 21 22 1 0 0 0 0\n 25 26 2 0 0 0 0\n 25 27 1 0 0 0 0\nM CHG 8 1 2 2 -1 8 -1 13 -1 16 -1 22 -1 27 -1 29 2\nM CHG 1 30 2\nM STY 3 1 MUL 2 MUL 3 MUL\nM SCN 1 1 HT \nM SAL 1 15 2 3 4 5 6 7 8 9 10 11 12 13 14 16 17\nM SAL 1 11 18 19 20 21 22 23 24 25 26 27 28\nM SPA 1 13 2 3 4 5 6 7 8 9 10 11 12 13 14\nM SDI 1 4 3.3372 -5.2888 3.3372 -2.3909\nM SDI 1 4 8.4580 -2.3909 8.4580 -5.2888\nM SMT 1 2\nM SCN 1 2 HT \nM SAL 2 3 1 29 30\nM SPA 2 1 1\nM SDI 2 4 9.7447 -4.4684 9.7447 -3.6284\nM SDI 2 4 10.5847 -3.6284 10.5847 -4.4684\nM SMT 2 3\nM SCN 1 3 HT \nM SAL 3 10 15 31 32 33 34 35 36 37 38 39\nM SPA 3 1 15\nM SDI 3 4 13.2957 -4.2012 13.2957 -3.3612\nM SDI 3 4 14.1357 -3.3612 14.1357 -4.2012\nM SMT 3 10\nM END", "smiles": "C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.[Mn+2].[Mn+2].[Mn+2].O.O.O.O.O.O.O.O.O.O", "formula": "2C6H5O7.3Mn.10H2O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "723.1669", "optical_activity": "NONE", "references": [ "0f1e4acf-ec22-49fd-af65-802f03a407de", "bd7bff4c-42c6-453d-af93-1591cd878fc1" ], "stereo_centers": 0 }, "unii": "4Z2OA6A13N" } ] }