{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "91979d0d-0c7e-461a-b44f-b3096c776992",
          "code": "1639-66-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1639-66-3",
          "code_system": "CAS",
          "references": [
            "a8cffe52-6507-4ff0-bc8f-b6be012069ef",
            "81daf834-3062-4711-b8bc-132c4cbfc00d"
          ]
        },
        {
          "uuid": "35978804-f6bd-4c95-ae56-36ab966f31d9",
          "code": "79027",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1614",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "a8cffe52-6507-4ff0-bc8f-b6be012069ef"
          ]
        },
        {
          "uuid": "1aaea5ef-9fe9-4146-ab1f-45e867e8cc86",
          "code": "1534779",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1534779/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "a8cffe52-6507-4ff0-bc8f-b6be012069ef"
          ]
        },
        {
          "uuid": "3f319791-0b82-4217-aa4f-9e903ac8646d",
          "code": "SUB06348MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "a8cffe52-6507-4ff0-bc8f-b6be012069ef"
          ]
        },
        {
          "uuid": "a22117cf-7ad2-44c5-9b41-59263b1579c3",
          "code": "216-684-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.015.168",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a8cffe52-6507-4ff0-bc8f-b6be012069ef"
          ]
        },
        {
          "uuid": "c1ad6e7b-4022-411e-9ebd-ee7aee5e516b",
          "code": "517065",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/517065",
          "code_system": "PUBCHEM",
          "references": [
            "a8cffe52-6507-4ff0-bc8f-b6be012069ef"
          ]
        },
        {
          "uuid": "f97e2f39-dc42-bc7b-88f2-ea64650fe1db",
          "code": "4086",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/4086",
          "code_system": "HSDB",
          "references": [
            "f3d45a38-1d7e-e0bd-33fe-94806a087924"
          ]
        },
        {
          "uuid": "bc7de2d1-10a5-145a-d8ba-b722180d3f0d",
          "code": "DTXSID7041881",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7041881",
          "code_system": "EPA CompTox",
          "references": [
            "20e9b2ae-a15f-8b5b-51aa-995218d9567d"
          ]
        },
        {
          "uuid": "9ace61bf-3324-4922-8715-bb7c968f7f97",
          "code": "4YLY5570Y0",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5bd61749-ff81-e357-9ed2-307dc77d3212",
          "code": "7779",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=7779",
          "code_system": "NSC",
          "references": [
            "ea9922c7-67b2-4835-dcc1-7aca5ef1c1e9"
          ]
        },
        {
          "uuid": "6cd387f0-9204-ba8e-04d6-96f4f9a9ab71",
          "code": "4YLY5570Y0",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=4YLY5570Y0",
          "code_system": "DAILYMED",
          "references": [
            "6d350eaa-a217-18ae-1028-c9e55ede89d1"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "db9c8577-0f74-479f-8283-39953d4bd92b",
          "name": "1,4-BIS(N-OCTYL) SULFOBUTANEDIOATE, SODIUM SALT",
          "stdName": "1,4-BIS(N-OCTYL) SULFOBUTANEDIOATE, SODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ba65ad2b-5afe-4a28-8b71-2db0eaebd48d",
            "d10410bf-d37a-4723-949f-53634f8d2eb8"
          ],
          "display_name": false
        },
        {
          "uuid": "1919ea39-67bb-4bb4-a2d0-a3f78cc24ba0",
          "name": "BUTANEDIOIC ACID, 2-SULFO-, 1,4-DIOCTYL ESTER, SODIUM SALT (1:1)",
          "stdName": "BUTANEDIOIC ACID, 2-SULFO-, 1,4-DIOCTYL ESTER, SODIUM SALT (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ba65ad2b-5afe-4a28-8b71-2db0eaebd48d",
            "d10410bf-d37a-4723-949f-53634f8d2eb8"
          ],
          "display_name": false
        },
        {
          "uuid": "5f248cc9-b5b8-4293-96c6-7c697cf65ba6",
          "name": "BUTANEDIOIC ACID, SULFO-, 1,4-DIOCTYL ESTER, SODIUM SALT",
          "stdName": "BUTANEDIOIC ACID, SULFO-, 1,4-DIOCTYL ESTER, SODIUM SALT",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ba65ad2b-5afe-4a28-8b71-2db0eaebd48d",
            "d10410bf-d37a-4723-949f-53634f8d2eb8"
          ],
          "display_name": false
        },
        {
          "uuid": "68bd6fc3-b847-428c-b481-c75ebd3004e0",
          "name": "BUTYL-CERUMEN",
          "stdName": "BUTYL-CERUMEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ba65ad2b-5afe-4a28-8b71-2db0eaebd48d",
            "d10410bf-d37a-4723-949f-53634f8d2eb8"
          ],
          "display_name": false
        },
        {
          "uuid": "e4de3b00-cae7-4d8a-943e-93de55ec0783",
          "name": "DI-N-OCTYL SODIUM SULFOSUCCINATE",
          "stdName": "DI-N-OCTYL SODIUM SULFOSUCCINATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ba65ad2b-5afe-4a28-8b71-2db0eaebd48d",
            "d10410bf-d37a-4723-949f-53634f8d2eb8"
          ],
          "display_name": true
        },
        {
          "uuid": "06ee7a1f-9f68-47c7-af2a-3c59281e9e2e",
          "name": "DICAPRYL SODIUM SULFOSUCCINATE",
          "stdName": "DICAPRYL SODIUM SULFOSUCCINATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "678aeb01-8d52-4112-aa1a-4a9121f566d6",
            "d10410bf-d37a-4723-949f-53634f8d2eb8",
            "37ab7297-8440-4d03-bf7b-17942f858130"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "461ca7ab-2ee4-45f4-8645-9faef6389642",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "a6ccff19-e47b-4c12-abd2-cd88111f6bd5",
          "name": "DIOCTYL SODIUM SULPHOSUCCINATE",
          "stdName": "DIOCTYL SODIUM SULPHOSUCCINATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ba65ad2b-5afe-4a28-8b71-2db0eaebd48d",
            "d10410bf-d37a-4723-949f-53634f8d2eb8"
          ],
          "display_name": false
        },
        {
          "uuid": "730557b2-c38c-4049-9436-9968dfa869cc",
          "name": "NEOCOL SW 30",
          "stdName": "NEOCOL SW 30",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d10410bf-d37a-4723-949f-53634f8d2eb8",
            "a6586dfd-e4a2-4641-8f21-baf61dc8c7e1"
          ],
          "display_name": false
        },
        {
          "uuid": "bc2d00cc-28f9-4049-89ac-9c5d5e118c5a",
          "name": "NSC-7779",
          "stdName": "NSC-7779",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ba65ad2b-5afe-4a28-8b71-2db0eaebd48d",
            "d10410bf-d37a-4723-949f-53634f8d2eb8"
          ],
          "display_name": false
        },
        {
          "uuid": "f7e0e5f4-5a9c-44ac-8dc8-968c84cd018d",
          "name": "SODIUM 1,2-BIS(OCTYLOXYCARBONYL)-1-ETHANESULFONATE",
          "stdName": "SODIUM 1,2-BIS(OCTYLOXYCARBONYL)-1-ETHANESULFONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d10410bf-d37a-4723-949f-53634f8d2eb8",
            "a6586dfd-e4a2-4641-8f21-baf61dc8c7e1"
          ],
          "display_name": false
        },
        {
          "uuid": "1b14f47c-80c4-4d99-9ad8-2cdaf2d10944",
          "name": "SODIUM DI-N-OCTYL SULFOSUCCINATE",
          "stdName": "SODIUM DI-N-OCTYL SULFOSUCCINATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ba65ad2b-5afe-4a28-8b71-2db0eaebd48d",
            "d10410bf-d37a-4723-949f-53634f8d2eb8"
          ],
          "display_name": false
        },
        {
          "uuid": "08579c1a-abe6-4d11-860a-f39f03d627e4",
          "name": "SODIUM DIOCTYL SULFOSUCCINATE [HSDB]",
          "stdName": "SODIUM DIOCTYL SULFOSUCCINATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ba65ad2b-5afe-4a28-8b71-2db0eaebd48d",
            "d10410bf-d37a-4723-949f-53634f8d2eb8"
          ],
          "display_name": false
        },
        {
          "uuid": "33d2162a-26df-435c-a5e7-04fe46c7bf7c",
          "name": "SUCCINIC ACID, SULFO-, 1,4-DIOCTYL ESTER, SODIUM SALT",
          "stdName": "SUCCINIC ACID, SULFO-, 1,4-DIOCTYL ESTER, SODIUM SALT",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ba65ad2b-5afe-4a28-8b71-2db0eaebd48d",
            "d10410bf-d37a-4723-949f-53634f8d2eb8"
          ],
          "display_name": false
        },
        {
          "uuid": "c961840c-1447-48b6-b72f-4bc3a7e1aeb8",
          "name": "SULFOBUTANEDIOIC ACID, 1,4-DI(N-OCTYL) ESTER, SODIUM SALT",
          "stdName": "SULFOBUTANEDIOIC ACID, 1,4-DI(N-OCTYL) ESTER, SODIUM SALT",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ba65ad2b-5afe-4a28-8b71-2db0eaebd48d",
            "d10410bf-d37a-4723-949f-53634f8d2eb8"
          ],
          "display_name": false
        },
        {
          "uuid": "a6b84335-0284-4e69-a643-b913af298200",
          "name": "TEXAPON DOS",
          "stdName": "TEXAPON DOS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d10410bf-d37a-4723-949f-53634f8d2eb8",
            "a6586dfd-e4a2-4641-8f21-baf61dc8c7e1"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d10410bf-d37a-4723-949f-53634f8d2eb8",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba65ad2b-5afe-4a28-8b71-2db0eaebd48d",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a6586dfd-e4a2-4641-8f21-baf61dc8c7e1",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a8cffe52-6507-4ff0-bc8f-b6be012069ef",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392183000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bdad9dbc-8e6a-47fe-b3fe-43535b0147d8",
          "citation": "SRS import [4YLY5570Y0]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4YLY5570Y0",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392183000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "37ab7297-8440-4d03-bf7b-17942f858130",
          "citation": "DICAPRYL SODIUM SULFOSUCCINATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "678aeb01-8d52-4112-aa1a-4a9121f566d6",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f3d45a38-1d7e-e0bd-33fe-94806a087924",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+1639-66-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "20e9b2ae-a15f-8b5b-51aa-995218d9567d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1639-66-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "81daf834-3062-4711-b8bc-132c4cbfc00d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ea9922c7-67b2-4835-dcc1-7aca5ef1c1e9",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6d350eaa-a217-18ae-1028-c9e55ede89d1",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "247dd707-78a0-429c-8d00-8c397be301ce",
          "id": "247dd707-78a0-429c-8d00-8c397be301ce",
          "molfile": "\n  Marvin  01132102022D          \n\n  1  0  0  0  0  0            999 V2000\n    2.5947   -1.8855    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "599d611b-d87c-47c3-a86c-9d12bebfd408"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "fe483afd-88e8-4875-ab2f-c40293556e82",
          "id": "fe483afd-88e8-4875-ab2f-c40293556e82",
          "molfile": "\n  Marvin  01132113102D          \n\n 28 27  0  0  0  0            999 V2000\n   -7.5547    0.4338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -6.8455    0.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -6.1280    0.4422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.4189    0.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.7056    0.4422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.9797    0.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2705    0.4422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5488    0.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8814    0.5256    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1597    0.0959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1597   -0.6841    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3963    0.5256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1460   -0.0417    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    0.8886    0.3837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9010    1.3057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6144   -0.0417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2902    0.4589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0036    0.0501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7169    0.4631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4260    0.0501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1478    0.4714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8569    0.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5744    0.4714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2836    0.0668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1460   -0.8260    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1418   -1.6436    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -0.6550   -0.8134    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9803   -0.8260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 25  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 27  2  0  0  0  0\n 25 28  2  0  0  0  0\nM  CHG  1  26  -1\nM  END",
          "smiles": "CCCCCCCCOC(=O)CC(C(=O)OCCCCCCCC)S(=O)(=O)[O-]",
          "formula": "C20H37O7S",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "97759e32-fbd2-417c-b5d3-4aced0bb8799"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "421.5704",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1e87a888-8120-4d47-ba06-d152bf43ff44",
      "version": "7",
      "structure": {
        "id": "d4fdaf36-c8c0-4b72-be0c-d2b0dcd677b0",
        "molfile": "\n  Marvin  01132111022D          \n\n 29 27  0  0  0  0            999 V2000\n    0.1460   -0.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3963    0.5256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8886    0.3837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1460   -0.8260    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1597    0.0959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6144   -0.0417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9010    1.3057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6550   -0.8134    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9803   -0.8260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1418   -1.6436    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -1.8814    0.5256    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1597   -0.6841    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2902    0.4589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5488    0.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0036    0.0501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2705    0.4422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7169    0.4631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.9797    0.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4260    0.0501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.7056    0.4422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1478    0.4714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.4189    0.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8569    0.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -6.1280    0.4422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5744    0.4714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -6.8455    0.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2836    0.0668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -7.5547    0.4338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5947   -1.8855    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  3  6  1  0  0  0  0\n  3  7  2  0  0  0  0\n  4  8  2  0  0  0  0\n  4  9  2  0  0  0  0\n  4 10  1  0  0  0  0\n  5 11  1  0  0  0  0\n  5 12  2  0  0  0  0\n  6 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 23 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 25 27  1  0  0  0  0\n 26 28  1  0  0  0  0\nM  CHG  2  10  -1  29   1\nM  END",
        "smiles": "CCCCCCCCOC(=O)CC(C(=O)OCCCCCCCC)S(=O)(=O)[O-].[Na+]",
        "formula": "C20H37O7S.Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "444.5602",
        "optical_activity": "( + / - )",
        "references": [
          "ba65ad2b-5afe-4a28-8b71-2db0eaebd48d",
          "bdad9dbc-8e6a-47fe-b3fe-43535b0147d8"
        ],
        "stereo_centers": 1
      },
      "unii": "4YLY5570Y0"
    }
  ]
}