{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5670d479-39e0-4488-af40-e35c03571294",
          "code": "10081-67-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=10081-67-1",
          "code_system": "CAS",
          "references": [
            "bd600969-431f-4353-b4a8-7125449ed52e",
            "50bc6a8c-1b56-4cc1-8b0d-5fb15298c976"
          ]
        },
        {
          "uuid": "85af2f74-d151-4a34-b6be-eafcabe7e147",
          "code": "233-215-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.030.182",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "bd600969-431f-4353-b4a8-7125449ed52e"
          ]
        },
        {
          "uuid": "9e431f84-3010-423d-8223-94f5e7627958",
          "code": "82343",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/82343",
          "code_system": "PUBCHEM",
          "references": [
            "bd600969-431f-4353-b4a8-7125449ed52e"
          ]
        },
        {
          "uuid": "e80e37d6-a51c-bc97-69ed-083a948de216",
          "code": "DTXSID0027721",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0027721",
          "code_system": "EPA CompTox",
          "references": [
            "e48ef823-0a32-fe05-c30a-94c3e5bb03c4"
          ]
        },
        {
          "uuid": "f1078c0d-5036-4646-af22-bc37f9d3132e",
          "code": "4Y29EDV7KQ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9606602c-907d-45d1-bef0-dd74ca1be399",
          "name": "4,4′-Bis(1,1-dimethylbenzyl)diphenylamine",
          "stdName": "4,4'-BIS(1,1-DIMETHYLBENZYL)DIPHENYLAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2ba70bd-5ee6-41dd-8b7e-2c20191fad4f",
            "7d9e3db0-91e0-40e2-b3e7-4b0db2e4fbdc"
          ],
          "display_name": false
        },
        {
          "uuid": "4e226a4a-6736-4c2a-80ea-93ef5c26a80c",
          "name": "4,4′-Bis(dimethylbenzyl)diphenylamine",
          "stdName": "4,4'-BIS(DIMETHYLBENZYL)DIPHENYLAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2ba70bd-5ee6-41dd-8b7e-2c20191fad4f",
            "7d9e3db0-91e0-40e2-b3e7-4b0db2e4fbdc"
          ],
          "display_name": false
        },
        {
          "uuid": "9f82df89-daf6-4b9e-818d-d9386ba8ff57",
          "name": "4,4′-Bis(α,α-dimethylbenzyl)diphenylamine",
          "stdName": "4,4'-BIS(.ALPHA.,.ALPHA.-DIMETHYLBENZYL)DIPHENYLAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2ba70bd-5ee6-41dd-8b7e-2c20191fad4f",
            "7d9e3db0-91e0-40e2-b3e7-4b0db2e4fbdc"
          ],
          "display_name": false
        },
        {
          "uuid": "d8f0d832-7e9b-4624-877e-81b842428f19",
          "name": "4,4′-Bis(α,α′-dimethylbenzyl)diphenylamine",
          "stdName": "4,4'-BIS(.ALPHA.,.ALPHA.'-DIMETHYLBENZYL)DIPHENYLAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2ba70bd-5ee6-41dd-8b7e-2c20191fad4f",
            "7d9e3db0-91e0-40e2-b3e7-4b0db2e4fbdc"
          ],
          "display_name": false
        },
        {
          "uuid": "106cd89b-2f9c-416c-bfed-6ce772153789",
          "name": "4-(1-Methyl-1-phenylethyl)-N-[4-(1-methyl-1-phenylethyl)phenyl]aniline",
          "stdName": "4-(1-METHYL-1-PHENYLETHYL)-N-(4-(1-METHYL-1-PHENYLETHYL)PHENYL)ANILINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2ba70bd-5ee6-41dd-8b7e-2c20191fad4f",
            "7d9e3db0-91e0-40e2-b3e7-4b0db2e4fbdc"
          ],
          "display_name": false
        },
        {
          "uuid": "0ff11a1a-f4cc-4a35-a8e3-a419f9d6d4ee",
          "name": "4-(1-Methyl-1-phenylethyl)-N-[4-(1-methyl-1-phenylethyl)phenyl]benzenamine",
          "stdName": "4-(1-METHYL-1-PHENYLETHYL)-N-(4-(1-METHYL-1-PHENYLETHYL)PHENYL)BENZENAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2ba70bd-5ee6-41dd-8b7e-2c20191fad4f",
            "7d9e3db0-91e0-40e2-b3e7-4b0db2e4fbdc"
          ],
          "display_name": false
        },
        {
          "uuid": "4bf6f09e-884d-4edd-9a4e-344277a4d2e7",
          "name": "ANTIOXIDANT 445",
          "stdName": "ANTIOXIDANT 445",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2ba70bd-5ee6-41dd-8b7e-2c20191fad4f",
            "7d9e3db0-91e0-40e2-b3e7-4b0db2e4fbdc"
          ],
          "display_name": false
        },
        {
          "uuid": "d2dc27b5-0b2a-4080-8404-6276a785135f",
          "name": "AO-445",
          "stdName": "AO-445",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2ba70bd-5ee6-41dd-8b7e-2c20191fad4f",
            "7d9e3db0-91e0-40e2-b3e7-4b0db2e4fbdc"
          ],
          "display_name": false
        },
        {
          "uuid": "3ee87662-dc9f-43b8-be51-7afee78e4aa0",
          "name": "Benzenamine, 4-(1-methyl-1-phenylethyl)-N-[4-(1-methyl-1-phenylethyl)phenyl]-",
          "stdName": "BENZENAMINE, 4-(1-METHYL-1-PHENYLETHYL)-N-(4-(1-METHYL-1-PHENYLETHYL)PHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2ba70bd-5ee6-41dd-8b7e-2c20191fad4f",
            "7d9e3db0-91e0-40e2-b3e7-4b0db2e4fbdc"
          ],
          "display_name": false
        },
        {
          "uuid": "568735b5-2dfa-4e32-90ab-5bdd3116960a",
          "name": "Bis(p-cumylphenyl)amine",
          "stdName": "BIS(P-CUMYLPHENYL)AMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2ba70bd-5ee6-41dd-8b7e-2c20191fad4f",
            "7d9e3db0-91e0-40e2-b3e7-4b0db2e4fbdc"
          ],
          "display_name": false
        },
        {
          "uuid": "42933d34-72c6-4e21-b3ab-4958185a6ed0",
          "name": "Bis(phenylisopropylidene)-4,4′-diphenylamine",
          "stdName": "BIS(PHENYLISOPROPYLIDENE)-4,4'-DIPHENYLAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2ba70bd-5ee6-41dd-8b7e-2c20191fad4f",
            "7d9e3db0-91e0-40e2-b3e7-4b0db2e4fbdc"
          ],
          "display_name": false
        },
        {
          "uuid": "b63c3835-a217-4cd4-b26b-2be96fbd0a5c",
          "name": "Bis[4-(2-phenyl-2-propyl)phenyl]amine",
          "stdName": "BIS(4-(2-PHENYL-2-PROPYL)PHENYL)AMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "24fc1e33-b2d9-4b54-9b67-2b1eba986a95"
          ],
          "display_name": true
        },
        {
          "uuid": "67ba50be-86a1-461a-8cd4-5b584779b627",
          "name": "Diphenylamine, 4,4′-bis(α,α-dimethylbenzyl)-",
          "stdName": "DIPHENYLAMINE, 4,4'-BIS(.ALPHA.,.ALPHA.-DIMETHYLBENZYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2ba70bd-5ee6-41dd-8b7e-2c20191fad4f",
            "7d9e3db0-91e0-40e2-b3e7-4b0db2e4fbdc"
          ],
          "display_name": false
        },
        {
          "uuid": "6a96f7c4-75f6-4182-86f6-f6fe38b474e2",
          "name": "N,N-Bis[4-(2-phenylpropan-2-yl)phenyl]amine",
          "stdName": "N,N-BIS(4-(2-PHENYLPROPAN-2-YL)PHENYL)AMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2ba70bd-5ee6-41dd-8b7e-2c20191fad4f",
            "7d9e3db0-91e0-40e2-b3e7-4b0db2e4fbdc"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "24fc1e33-b2d9-4b54-9b67-2b1eba986a95",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7d9e3db0-91e0-40e2-b3e7-4b0db2e4fbdc",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e2ba70bd-5ee6-41dd-8b7e-2c20191fad4f",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bd600969-431f-4353-b4a8-7125449ed52e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390993000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3dfbba7f-9820-4fac-89df-b4eb74d26d92",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e48ef823-0a32-fe05-c30a-94c3e5bb03c4",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=10081-67-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "50bc6a8c-1b56-4cc1-8b0d-5fb15298c976",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8d42c5b4-131b-45a8-8a13-476a1bff3e63",
          "id": "8d42c5b4-131b-45a8-8a13-476a1bff3e63",
          "molfile": "\n  Marvin  01132107202D          \n\n 31 34  0  0  0  0            999 V2000\n    3.6729   -4.6662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6729   -5.4908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8484   -5.4908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6729   -6.3155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9826   -6.7452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9826   -7.5686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7277   -7.9627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4281   -7.5429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4281   -6.7143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8274   -5.4908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2238   -4.7161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0472   -4.7161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4794   -5.4252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3038   -5.3913    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1278   -5.3913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5549   -6.1064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3738   -6.1064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7802   -5.3559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3632   -4.6649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5297   -4.6649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9295   -5.3559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9295   -6.1807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7544   -5.3559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9295   -4.5311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6330   -4.1066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6330   -3.2877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9019   -2.8834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1995   -3.2979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1995   -4.1267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0831   -6.1690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2546   -6.1690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n 10  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  9  4  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 31  2  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 30 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 20 15  2  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 18 21  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 21 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 29 24  2  0  0  0  0\n 25 26  2  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  2  0  0  0  0\n 28 29  1  0  0  0  0\n 31 30  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(c1ccccc1)c2ccc(cc2)Nc3ccc(cc3)C(C)(C)c4ccccc4",
          "formula": "C30H31N",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0b0eb01c-cd9e-4cf0-849b-b880ea7b3b9d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "405.5749",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b6862624-f972-44de-ae27-553634b698de",
      "version": "5",
      "structure": {
        "id": "d20a674b-3970-44fa-9281-230f1e3c0513",
        "molfile": "\n  Marvin  01132110512D          \n\n 31 34  0  0  0  0            999 V2000\n    7.3038   -5.3913    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4794   -5.4252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0472   -4.7161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2238   -4.7161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8274   -5.4908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2546   -6.1690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0831   -6.1690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6729   -5.4908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6729   -6.3155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9826   -6.7452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9826   -7.5686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7277   -7.9627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4281   -7.5429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4281   -6.7143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6729   -4.6662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8484   -5.4908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1278   -5.3913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5549   -6.1064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3738   -6.1064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7802   -5.3559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3632   -4.6649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5297   -4.6649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9295   -5.3559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9295   -4.5311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6330   -4.1066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6330   -3.2877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9019   -2.8834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1995   -3.2979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1995   -4.1267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9295   -6.1807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7544   -5.3559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  2  2  0  0  0  0\n  5  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14  9  2  0  0  0  0\n  8 15  1  0  0  0  0\n  8 16  1  0  0  0  0\n  1 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 17  2  0  0  0  0\n 20 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  2  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  2  0  0  0  0\n 28 29  1  0  0  0  0\n 29 24  2  0  0  0  0\n 23 30  1  0  0  0  0\n 23 31  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(c1ccccc1)c2ccc(cc2)Nc3ccc(cc3)C(C)(C)c4ccccc4",
        "formula": "C30H31N",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "405.5749",
        "optical_activity": "NONE",
        "references": [
          "3dfbba7f-9820-4fac-89df-b4eb74d26d92"
        ],
        "stereo_centers": 0
      },
      "unii": "4Y29EDV7KQ"
    }
  ]
}