{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2bd867de-3dd6-4286-bab1-6df0439b394c",
          "code": "13405-60-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=13405-60-2",
          "code_system": "CAS",
          "references": [
            "9e0e8c34-007e-4dfd-b943-af53330d1b9e",
            "de6627d2-d6a8-439c-af0a-e9d3e8e1b4a6"
          ]
        },
        {
          "uuid": "fa0411ca-d74b-480f-8301-0c4673812ed5",
          "code": "m5760",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5760?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "9e0e8c34-007e-4dfd-b943-af53330d1b9e"
          ]
        },
        {
          "uuid": "a01e0a69-3048-4217-9f6e-d10e1ec29043",
          "code": "554-37-0",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=554-37-0",
          "code_system": "CAS",
          "references": [
            "9e0e8c34-007e-4dfd-b943-af53330d1b9e",
            "5f78ee50-1afd-4f42-93bd-62cb54693e88"
          ]
        },
        {
          "uuid": "42688524-5549-4e13-8657-cac26dad12d5",
          "code": "GLUCOGALLIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Glucogallin",
          "code_system": "WIKIPEDIA",
          "references": [
            "9e0e8c34-007e-4dfd-b943-af53330d1b9e"
          ]
        },
        {
          "uuid": "ceface56-7bc2-4f49-8301-278a91e0afcf",
          "code": "124021",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/124021",
          "code_system": "PUBCHEM",
          "references": [
            "9e0e8c34-007e-4dfd-b943-af53330d1b9e"
          ]
        },
        {
          "uuid": "13d2d98c-ee7d-4225-ad19-aea78b730202",
          "code": "4X7JGS9BFY",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "386dfdfc-16c2-8c0c-090f-973102c7a413",
          "code": "15834",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:15834",
          "code_system": "CHEBI",
          "references": [
            "528d137c-4ba5-28b1-e275-aaf9a881778a"
          ]
        },
        {
          "uuid": "f1ee1951-a2fc-6a97-f0d9-dbb3f5be8bff",
          "code": "2595941",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2595941/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "97b5c4c5-4bc9-7956-8e47-a89acf0693a1"
          ]
        },
        {
          "uuid": "9d0c9286-17d0-db96-a6a3-c4613926fa26",
          "code": "DTXSID00928396",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00928396",
          "code_system": "EPA CompTox",
          "references": [
            "47fcf7cf-54cd-e9e4-11f3-299d9b543bba"
          ]
        },
        {
          "uuid": "93bc91ad-8e7a-fcae-25e1-a9eca398b40f",
          "code": "4X7JGS9BFY",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=4X7JGS9BFY",
          "code_system": "DAILYMED",
          "references": [
            "321c4259-1cf4-b0cc-0468-fd750008cafc"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a35f76a5-893e-4514-82b5-751466e67b0b",
          "name": ".BETA.-D-GLUCOGALLIN",
          "stdName": ".BETA.-D-GLUCOGALLIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "614b0240-b3f1-4776-a5d9-f8109c0120df",
            "93d3c34b-1772-44e9-98f9-9af9c68c9fdb"
          ],
          "display_name": false
        },
        {
          "uuid": "7af66433-811c-4a0e-863a-15283d416863",
          "name": ".BETA.-D-GLUCOPYRANOSE, 1-(3,4,5-TRIHYDROXYBENZOATE)",
          "stdName": ".BETA.-D-GLUCOPYRANOSE, 1-(3,4,5-TRIHYDROXYBENZOATE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "614b0240-b3f1-4776-a5d9-f8109c0120df",
            "93d3c34b-1772-44e9-98f9-9af9c68c9fdb"
          ],
          "display_name": false
        },
        {
          "uuid": "525ee7e0-3a18-4368-b85b-1a619b3516c8",
          "name": ".BETA.-D-GLUCOSE 1-(3,4,5-TRIHYDROXYBENZOATE)",
          "stdName": ".BETA.-D-GLUCOSE 1-(3,4,5-TRIHYDROXYBENZOATE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a811d06f-1358-4114-9adf-07488790fb6b",
            "614b0240-b3f1-4776-a5d9-f8109c0120df"
          ],
          "display_name": false
        },
        {
          "uuid": "50a7fdab-c3a6-44b0-89e7-4c757afc13f6",
          "name": ".BETA.-GLUCOGALLIN",
          "stdName": ".BETA.-GLUCOGALLIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a811d06f-1358-4114-9adf-07488790fb6b",
            "ac257123-25f7-4301-84d8-c602f411b41d",
            "614b0240-b3f1-4776-a5d9-f8109c0120df"
          ],
          "display_name": true
        },
        {
          "uuid": "43ce9864-9293-4dbe-8818-fbfa446fb93f",
          "name": ".BETA.-GLUCOGALLIN [MI]",
          "stdName": ".BETA.-GLUCOGALLIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a811d06f-1358-4114-9adf-07488790fb6b",
            "614b0240-b3f1-4776-a5d9-f8109c0120df"
          ],
          "display_name": false
        },
        {
          "uuid": "6c79f992-0ef5-46fc-8c0b-1d48f8696391",
          "name": ".BETA.-GLUCOGALLIN, (-)-",
          "stdName": ".BETA.-GLUCOGALLIN, (-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff6add77-5f3f-4c02-a4e1-2eb558dcd5fe",
            "614b0240-b3f1-4776-a5d9-f8109c0120df"
          ],
          "display_name": false
        },
        {
          "uuid": "d618120e-f2b6-425f-8545-0362ff3427d9",
          "name": "1(.BETA.)-O-GALLOYLGLUCOSE",
          "stdName": "1(.BETA.)-O-GALLOYLGLUCOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "614b0240-b3f1-4776-a5d9-f8109c0120df",
            "93d3c34b-1772-44e9-98f9-9af9c68c9fdb"
          ],
          "display_name": false
        },
        {
          "uuid": "704042e8-ba9e-4a9d-8593-9983fdead34f",
          "name": "1-GALLOYL-.BETA.-GLUCOSE",
          "stdName": "1-GALLOYL-.BETA.-GLUCOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "614b0240-b3f1-4776-a5d9-f8109c0120df",
            "93d3c34b-1772-44e9-98f9-9af9c68c9fdb"
          ],
          "display_name": false
        },
        {
          "uuid": "01890d96-ddd1-4b17-84c2-eeb1a51890ca",
          "name": "BETA-GLUCOGALLIN",
          "stdName": "BETA-GLUCOGALLIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "614b0240-b3f1-4776-a5d9-f8109c0120df",
            "1b131e0d-e137-44e0-a51d-cf19e7dc1168"
          ],
          "display_name": false
        },
        {
          "uuid": "9abe4866-d862-4139-a432-811209e9a01c",
          "name": "GALLIC GLUCOSIDE",
          "stdName": "GALLIC GLUCOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "614b0240-b3f1-4776-a5d9-f8109c0120df",
            "93d3c34b-1772-44e9-98f9-9af9c68c9fdb"
          ],
          "display_name": false
        },
        {
          "uuid": "d6b0fd2e-a5bd-4f1c-a8b4-4312565e61c6",
          "name": "GALLOTANNIN 1",
          "stdName": "GALLOTANNIN 1",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "614b0240-b3f1-4776-a5d9-f8109c0120df",
            "93d3c34b-1772-44e9-98f9-9af9c68c9fdb"
          ],
          "display_name": false
        },
        {
          "uuid": "bc528a77-406a-4fba-986b-3350fa0042a9",
          "name": "GALLYL GLUCOSIDE, .BETA.-",
          "stdName": "GALLYL GLUCOSIDE, .BETA.-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff6add77-5f3f-4c02-a4e1-2eb558dcd5fe",
            "614b0240-b3f1-4776-a5d9-f8109c0120df"
          ],
          "display_name": false
        },
        {
          "uuid": "0c21dfa3-3a9c-40af-8fc3-65f8f1dd29b2",
          "name": "GLUCOGALLIN",
          "stdName": "GLUCOGALLIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "614b0240-b3f1-4776-a5d9-f8109c0120df",
            "c4a513d3-b707-4fc0-a919-a260338b5514"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ff6add77-5f3f-4c02-a4e1-2eb558dcd5fe",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "614b0240-b3f1-4776-a5d9-f8109c0120df",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1b131e0d-e137-44e0-a51d-cf19e7dc1168",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a811d06f-1358-4114-9adf-07488790fb6b",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "93d3c34b-1772-44e9-98f9-9af9c68c9fdb",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c4a513d3-b707-4fc0-a919-a260338b5514",
          "citation": "https://en.wikipedia.org/wiki/Glucogallin",
          "url": "https://en.wikipedia.org/wiki/Glucogallin",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9e0e8c34-007e-4dfd-b943-af53330d1b9e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392032000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02bd6464-0be7-4590-b3e6-6119d22d7110",
          "citation": "SRS import [4X7JGS9BFY]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4X7JGS9BFY",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392032000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ac257123-25f7-4301-84d8-c602f411b41d",
          "citation": ".BETA.-GLUCOGALLIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "97b5c4c5-4bc9-7956-8e47-a89acf0693a1",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "de6627d2-d6a8-439c-af0a-e9d3e8e1b4a6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5f78ee50-1afd-4f42-93bd-62cb54693e88",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "528d137c-4ba5-28b1-e275-aaf9a881778a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "321c4259-1cf4-b0cc-0468-fd750008cafc",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "47fcf7cf-54cd-e9e4-11f3-299d9b543bba",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "94b7351e-77c7-4835-a93b-092ce4c226d0",
          "id": "94b7351e-77c7-4835-a93b-092ce4c226d0",
          "molfile": "\n  Marvin  01132107432D          \n\n 23 24  0  0  1  0            999 V2000\n    1.3510   -3.0718    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    0.6251   -2.6618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.1995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0635   -2.6618    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7827   -3.0718    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.5020   -2.6618    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5169   -2.6483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9404   -3.3675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7992   -2.0702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3690   -1.4721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6379   -0.8200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1002   -0.1277    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4042   -0.7394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8680    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8209   -1.3174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7216   -1.3107    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5185   -1.9627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7827   -3.9053    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    3.5020   -4.3220    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0635   -4.3220    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    2.0635   -5.1555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3510   -3.9053    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    0.6251   -4.3220    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  4  1  0  0  0  0\n 22  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n 18  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 17  2  0  0  0  0\n 11 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 13 11  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 18 19  1  6  0  0  0\n 20 18  1  0  0  0  0\n 20 21  1  1  0  0  0\n 22 20  1  0  0  0  0\n 22 23  1  6  0  0  0\nM  END",
          "smiles": "c1c(cc(c(c1O)O)O)C(=O)O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O",
          "formula": "C13H16O10",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b2ec811e-ce15-45e0-8725-edf16aaced09"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "332.2607",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "50394467-ca79-4145-9d05-f2a1c341eaa4",
      "version": "13",
      "structure": {
        "id": "332c199c-8c14-4a5f-a49c-71f4f5a377c0",
        "molfile": "\n  Marvin  01132102442D          \n\n 23 24  0  0  1  0            999 V2000\n    2.7827   -3.0718    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.7827   -3.9053    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.0635   -4.3220    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.0635   -2.6618    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3510   -3.9053    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.5020   -2.6618    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5169   -2.6483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3510   -3.0718    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.7992   -2.0702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4042   -0.7394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6379   -0.8200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8209   -1.3174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3690   -1.4721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5185   -1.9627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9404   -3.3675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5020   -4.3220    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0635   -5.1555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6251   -4.3220    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8680    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1002   -0.1277    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7216   -1.3107    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6251   -2.6618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.1995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  4  1  0  0  0  0\n  1  6  1  1  0  0  0\n  2  3  1  0  0  0  0\n  2 16  1  6  0  0  0\n  3 17  1  1  0  0  0\n  3  5  1  0  0  0  0\n  4  8  1  0  0  0  0\n  5  8  1  0  0  0  0\n  5 18  1  6  0  0  0\n  6  7  1  0  0  0  0\n  7  9  1  0  0  0  0\n  7 15  2  0  0  0  0\n  8 22  1  1  0  0  0\n  9 13  1  0  0  0  0\n  9 14  2  0  0  0  0\n 10 12  2  0  0  0  0\n 10 19  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 13  2  0  0  0  0\n 11 20  1  0  0  0  0\n 12 14  1  0  0  0  0\n 12 21  1  0  0  0  0\n 22 23  1  0  0  0  0\nM  END",
        "smiles": "c1c(cc(c(c1O)O)O)C(=O)O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O",
        "formula": "C13H16O10",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "332.2607",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "02bd6464-0be7-4590-b3e6-6119d22d7110",
          "1b131e0d-e137-44e0-a51d-cf19e7dc1168"
        ],
        "stereo_centers": 5
      },
      "unii": "4X7JGS9BFY"
    }
  ]
}