{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0a81da85-dd7d-4c84-88ad-f2328ebb6520",
          "code": "118-60-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=118-60-5",
          "code_system": "CAS",
          "references": [
            "7ea4b255-3192-4fe3-af50-10f6141c4232",
            "e3794841-b958-428b-a199-4d8adeaace48"
          ]
        },
        {
          "uuid": "64b22c9e-8a37-44ea-94ba-5cbeda92ff73",
          "code": "C77134",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C77134",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7ea4b255-3192-4fe3-af50-10f6141c4232"
          ]
        },
        {
          "uuid": "d476c197-6fec-4a59-9d4b-1ef64864f2f5",
          "code": "21 CFR 352.10",
          "comments": "PART 352 -- SUNSCREEN DRUG PRODUCTS FOR OVER-THE-COUNTER HUMAN USE [STAYED INDEFINITELY]|Subpart B--Active Ingredients|Sec. 352.10 Sunscreen active ingredients.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=352.10",
          "code_system": "CFR",
          "references": [
            "7ea4b255-3192-4fe3-af50-10f6141c4232"
          ]
        },
        {
          "uuid": "5b42b52d-0650-4c6a-89f1-cfd0dd56a1de",
          "code": "21 CFR 352.20",
          "comments": "PART 352 -- SUNSCREEN DRUG PRODUCTS FOR OVER-THE-COUNTER HUMAN USE [STAYED INDEFINITELY]|Subpart B--Active Ingredients|Sec. 352.20 Permitted combinations of active ingredients.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=352.20",
          "code_system": "CFR",
          "references": [
            "7ea4b255-3192-4fe3-af50-10f6141c4232"
          ]
        },
        {
          "uuid": "011d2b40-2545-4922-ab09-7ccdc162e1c8",
          "code": "OCTYL SALICYLATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Octyl_salicylate",
          "code_system": "WIKIPEDIA",
          "references": [
            "7ea4b255-3192-4fe3-af50-10f6141c4232"
          ]
        },
        {
          "uuid": "edb27427-d3b8-47ca-aab5-4573b11aaa3b",
          "code": "SUB03486MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "7ea4b255-3192-4fe3-af50-10f6141c4232"
          ]
        },
        {
          "uuid": "426ade9f-2127-45f4-bd24-4b9303ab856f",
          "code": "11276",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1516",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "7ea4b255-3192-4fe3-af50-10f6141c4232"
          ]
        },
        {
          "uuid": "3dc51a07-e4ef-4e9b-9eeb-bf16b38e79bd",
          "code": "7940",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=7940",
          "code_system": "INN",
          "references": [
            "7ea4b255-3192-4fe3-af50-10f6141c4232"
          ]
        },
        {
          "uuid": "b261987d-e940-40da-88ac-25fbdd60ffd9",
          "code": "204-263-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.003.877",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7ea4b255-3192-4fe3-af50-10f6141c4232"
          ]
        },
        {
          "uuid": "31639212-264b-4e8c-aea3-fb0f23f611ff",
          "code": "m8130",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8130?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "7ea4b255-3192-4fe3-af50-10f6141c4232"
          ]
        },
        {
          "uuid": "322df3a7-ce74-4081-88c5-6b669d7f0de6",
          "code": "236880",
          "type": "ALTERNATIVE",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/236880/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "7ea4b255-3192-4fe3-af50-10f6141c4232"
          ]
        },
        {
          "uuid": "0fa0a47e-3ca9-4d98-a971-9aa5fb418751",
          "code": "91327",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/91327/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "7ea4b255-3192-4fe3-af50-10f6141c4232"
          ]
        },
        {
          "uuid": "95f7d9c5-76c6-406d-a894-d71355e2bab0",
          "code": "CHEMBL1329203",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1329203",
          "code_system": "ChEMBL",
          "references": [
            "7ea4b255-3192-4fe3-af50-10f6141c4232"
          ]
        },
        {
          "uuid": "a7e4949c-8036-40aa-b5f2-063c1e58899e",
          "code": "8364",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/8364",
          "code_system": "PUBCHEM",
          "references": [
            "7ea4b255-3192-4fe3-af50-10f6141c4232"
          ]
        },
        {
          "uuid": "6ce8466f-b987-229f-3b9a-491ea1507cdb",
          "code": "DTXSID7040734",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7040734",
          "code_system": "EPA CompTox",
          "references": [
            "1c439582-4f08-d675-ad06-896c6c857360"
          ]
        },
        {
          "uuid": "c07bf746-af96-a076-92de-bca7030f04e6",
          "code": "C851",
          "comments": "Pharmacologic Substance[C1909]|Chemopreventive Agent[C1892]|Sunscreen",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C851",
          "code_system": "NCI_THESAURUS",
          "references": [
            "8dde684e-1d3a-a2d9-804f-5bb24e584b0e"
          ]
        },
        {
          "uuid": "10c8478a-a58f-487c-bfc0-0fe1d4936d30",
          "code": "4X49Y0596W",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1a9b23f6-1405-349e-dc10-22b29156e432",
          "code": "DB11062",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11062",
          "code_system": "DRUG BANK",
          "references": [
            "8dde684e-1d3a-a2d9-804f-5bb24e584b0e"
          ]
        },
        {
          "uuid": "53318b07-c841-8cb3-4ae0-84dc4d000291",
          "code": "4241",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/4241",
          "code_system": "DRUG CENTRAL",
          "references": [
            "8dde684e-1d3a-a2d9-804f-5bb24e584b0e"
          ]
        },
        {
          "uuid": "5dfb66b0-d106-a563-8bab-15593bc3fb24",
          "code": "KK-120",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/KK-120/relevant/1/",
          "code_system": "USAN",
          "references": [
            "14adedb1-87a6-615e-202a-6834c09ada52"
          ]
        },
        {
          "uuid": "ca4e2efa-637f-d304-94c8-0b0a0787d7fd",
          "code": "1477943",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1477943",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "8dde684e-1d3a-a2d9-804f-5bb24e584b0e"
          ]
        },
        {
          "uuid": "83de2663-2b34-5927-47a0-a10f1ebf3198",
          "code": "4X49Y0596W",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=4X49Y0596W",
          "code_system": "DAILYMED",
          "references": [
            "4f4d489f-6b47-87ce-f1bf-eaa4bd8953d2"
          ]
        },
        {
          "uuid": "2c9e458b-e495-9372-e915-f438073615e5",
          "code": "100000085914",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "067b7034-d1f1-6b3c-cb5b-8b011882c4e6"
          ]
        },
        {
          "uuid": "01e5b076-feea-f980-3c33-a80325d36f45",
          "code": "46151",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=46151",
          "code_system": "NSC",
          "references": [
            "4b6bb9e7-4db0-b691-c6b7-0adb819a2bb2"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "0ec40824-4322-45a3-a076-4e5198481522",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "b926a324-d7af-4103-bf99-61dcaa76f587",
            "refuuid": "aa0a3090-0cc8-418b-911e-7693d93adf07",
            "name": "OCTISALATE",
            "unii": "4X49Y0596W",
            "linking_id": "4X49Y0596W",
            "ref_pname": "OCTISALATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2b2a3bf5-d98e-41a2-8e14-e4ae0b10ccb3",
          "name": "2-Ethylhexyl salicylate",
          "stdName": "2-ETHYLHEXYL SALICYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1da55d32-c4f8-4fee-8ae0-b8cc73f6801a"
          ],
          "display_name": false
        },
        {
          "uuid": "737168f7-ac74-4d82-aa0a-5e4b6868f08e",
          "name": "BENZOIC ACID, 2-HYDROXY-, 2-ETHYLHEXYL ESTER",
          "stdName": "BENZOIC ACID, 2-HYDROXY-, 2-ETHYLHEXYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09db1b6d-cc7e-4207-9f93-46afe7a1fa95"
          ],
          "display_name": false
        },
        {
          "uuid": "6e2d8fc3-70ef-4282-9b89-f2706e85b49c",
          "name": "ESCALOL",
          "stdName": "ESCALOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09db1b6d-cc7e-4207-9f93-46afe7a1fa95"
          ],
          "display_name": false
        },
        {
          "uuid": "ebdb8635-c58d-4342-be59-eff3331df7d7",
          "name": "ETHYL HEXYL SALICYLATE",
          "stdName": "ETHYL HEXYL SALICYLATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "12c4515d-689e-4914-8e8a-9f50132f6921"
          ],
          "display_name": false
        },
        {
          "uuid": "fdbc8f82-69b3-45b4-b0df-b7c8d903b066",
          "name": "ETHYLHEXYL SALICYLATE",
          "stdName": "ETHYLHEXYL SALICYLATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "b7f188d2-9b28-4793-8f49-f6fa4554968b",
            "8b076e92-95cd-464a-a407-3e4fd75c2edd",
            "b7fc3295-afe6-4ecd-b853-ad5ad41c982c",
            "bd0eef7e-a099-4fbc-a37d-9d618158ae8e"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "8af82642-7e5a-45c5-bb8d-a6c0d67eedd7",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "c8763c4b-4c2f-489f-91f5-e82ec3e3055d",
          "name": "ETHYLHEXYL SALICYLATE [VANDF]",
          "stdName": "ETHYLHEXYL SALICYLATE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd0eef7e-a099-4fbc-a37d-9d618158ae8e"
          ],
          "display_name": false
        },
        {
          "uuid": "5305b8ac-562b-4aef-86d5-8393b6d46c75",
          "name": "NEO HELIOPAN",
          "stdName": "NEO HELIOPAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09db1b6d-cc7e-4207-9f93-46afe7a1fa95"
          ],
          "display_name": false
        },
        {
          "uuid": "12b32272-b46d-4d99-889a-7efb960f49ea",
          "name": "NSC-46151",
          "stdName": "NSC-46151",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "86337253-e281-4a53-9261-aedde6c99658",
            "a5a9ba46-5e5c-4d31-8049-d6fd4856ebad"
          ],
          "display_name": false
        },
        {
          "uuid": "c081be6a-073d-43f4-8754-d91dc63e95fa",
          "name": "OCTISALATE",
          "stdName": "OCTISALATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "edb733ee-fb19-4e6b-9a94-4d4e04b79775",
            "4fd00da9-6417-4136-ac14-8d83e84ef523",
            "16fa5dde-6ab0-435b-94be-a8f1b6aa2d05",
            "362959c9-cedd-4aca-9d18-18e76eb068ee",
            "fc7b1819-4108-447b-97d6-280e6033e935",
            "db3a4eb8-4738-4bd0-9002-f4d7c420165a",
            "bd0eef7e-a099-4fbc-a37d-9d618158ae8e",
            "aef922c1-c83a-4089-9bf7-081673733970",
            "42ad6d1b-3fcc-46f9-8a1a-e945e5fb5068",
            "013b76fb-fc34-45ec-a36d-c65db2a58bb9",
            "204ba5ee-e451-4935-8e13-7a874890db51",
            "678d311e-49b3-4596-9c5c-fc64f4abc2ae",
            "4c8c7bae-e1dc-4541-bedc-436f2460a730",
            "a29ae9b5-dc02-4b62-8e85-23c8b8bd87fa",
            "171c6741-6b5a-4cb2-8100-230169bd5403",
            "bb0a2211-6337-48c0-ba10-648099bfc33e"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "da06a261-133f-4433-b28b-83739eb2552a",
              "name_org": "USAN"
            },
            {
              "uuid": "b58879bf-220f-42b3-b441-c2d8f2594368",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "d246edb4-3e8c-483e-b934-50e847233f87",
          "name": "OCTISALATE [II]",
          "stdName": "OCTISALATE [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "171c6741-6b5a-4cb2-8100-230169bd5403"
          ],
          "display_name": false
        },
        {
          "uuid": "69e4c584-5f58-484d-8c9c-2cd8962f1a82",
          "name": "OCTISALATE [MART.]",
          "stdName": "OCTISALATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4fd00da9-6417-4136-ac14-8d83e84ef523"
          ],
          "display_name": false
        },
        {
          "uuid": "a97779e6-6a22-4f74-8b2e-2cef1c7a7e52",
          "name": "OCTISALATE [USAN]",
          "stdName": "OCTISALATE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "42ad6d1b-3fcc-46f9-8a1a-e945e5fb5068"
          ],
          "display_name": false
        },
        {
          "uuid": "37dd2fa8-0c96-8cff-6433-7f1ad03b594a",
          "name": "OCTISALATE [USP MONOGRAPH]",
          "stdName": "OCTISALATE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c693e36-f950-84aa-2b93-eaa5d7cdfe05"
          ],
          "display_name": false
        },
        {
          "uuid": "41618b8a-ea74-4e12-a510-627e81df1318",
          "name": "OCTISALATE [USP-RS]",
          "stdName": "OCTISALATE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "013b76fb-fc34-45ec-a36d-c65db2a58bb9"
          ],
          "display_name": false
        },
        {
          "uuid": "45426a37-5bed-4d1c-aa5d-22eec08c0a1b",
          "name": "OCTISALATE [VANDF]",
          "stdName": "OCTISALATE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd0eef7e-a099-4fbc-a37d-9d618158ae8e"
          ],
          "display_name": false
        },
        {
          "uuid": "ef61ee74-ea99-4dcf-9d35-a57e9c3399c1",
          "name": "OCTYL SALICYLATE",
          "stdName": "OCTYL SALICYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "171f423f-7140-481e-abd4-2c50d3dfeb25",
            "00f1670d-e685-4030-bd23-4b411c93ee81",
            "bd0eef7e-a099-4fbc-a37d-9d618158ae8e",
            "e23ad569-4923-4a48-9e12-532f484e7f76",
            "171c6741-6b5a-4cb2-8100-230169bd5403"
          ],
          "display_name": false
        },
        {
          "uuid": "b3196c82-4e58-4562-b5ce-90d930693904",
          "name": "OCTYL SALICYLATE [MI]",
          "stdName": "OCTYL SALICYLATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "00f1670d-e685-4030-bd23-4b411c93ee81"
          ],
          "display_name": false
        },
        {
          "uuid": "019369cb-25eb-4403-a230-5d41e1b12a4e",
          "name": "OCTYL SALICYLATE [VANDF]",
          "stdName": "OCTYL SALICYLATE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd0eef7e-a099-4fbc-a37d-9d618158ae8e"
          ],
          "display_name": false
        },
        {
          "uuid": "2292a4ce-f28a-31af-cb4f-06079b345d95",
          "name": "Octisalate [WHO-DD]",
          "stdName": "OCTISALATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1565cbac-dd58-fa84-061c-7aed36271bc5"
          ],
          "display_name": false
        },
        {
          "uuid": "fe89a814-395e-4946-b9ac-40d1d98c6005",
          "name": "UVINUL",
          "stdName": "UVINUL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8613839d-4d4a-4c0e-b75a-681bbbaaa3e2"
          ],
          "display_name": false
        },
        {
          "uuid": "bb324537-c9d7-4bcd-97ca-19746c7581cd",
          "name": "octisalate [INN]",
          "stdName": "OCTISALATE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a29ae9b5-dc02-4b62-8e85-23c8b8bd87fa"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1da55d32-c4f8-4fee-8ae0-b8cc73f6801a",
          "citation": "ChemIDplus 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "171c6741-6b5a-4cb2-8100-230169bd5403",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "09db1b6d-cc7e-4207-9f93-46afe7a1fa95",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8613839d-4d4a-4c0e-b75a-681bbbaaa3e2",
          "citation": "USP Dictionary 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a5a9ba46-5e5c-4d31-8049-d6fd4856ebad",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "86337253-e281-4a53-9261-aedde6c99658",
          "citation": "STN 2007",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bd0eef7e-a099-4fbc-a37d-9d618158ae8e",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "42ad6d1b-3fcc-46f9-8a1a-e945e5fb5068",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a29ae9b5-dc02-4b62-8e85-23c8b8bd87fa",
          "citation": "INN Proposed List 83",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL83.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4c8c7bae-e1dc-4541-bedc-436f2460a730",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4fd00da9-6417-4136-ac14-8d83e84ef523",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "00f1670d-e685-4030-bd23-4b411c93ee81",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8b076e92-95cd-464a-a407-3e4fd75c2edd",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "013b76fb-fc34-45ec-a36d-c65db2a58bb9",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "12c4515d-689e-4914-8e8a-9f50132f6921",
          "citation": "RXNORM",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc7b1819-4108-447b-97d6-280e6033e935",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7ea4b255-3192-4fe3-af50-10f6141c4232",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391875000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "783530db-3110-4993-8708-18b26c15a680",
          "citation": "SRS import [4X49Y0596W]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4X49Y0596W",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391875000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "362959c9-cedd-4aca-9d18-18e76eb068ee",
          "citation": "OCTISALATE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "db3a4eb8-4738-4bd0-9002-f4d7c420165a",
          "citation": "OCTISALATE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "edb733ee-fb19-4e6b-9a94-4d4e04b79775",
          "citation": "OCTISALATE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "16fa5dde-6ab0-435b-94be-a8f1b6aa2d05",
          "citation": "OCTISALATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e23ad569-4923-4a48-9e12-532f484e7f76",
          "citation": "OCTYL SALICYLATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b7f188d2-9b28-4793-8f49-f6fa4554968b",
          "citation": "ETHYLHEXYL SALICYLATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "aef922c1-c83a-4089-9bf7-081673733970",
          "citation": "OCTISALATE [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "204ba5ee-e451-4935-8e13-7a874890db51",
          "citation": "OCTISALATE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bb0a2211-6337-48c0-ba10-648099bfc33e",
          "citation": "OCTISALATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b7fc3295-afe6-4ecd-b853-ad5ad41c982c",
          "citation": "ETHYLHEXYL SALICYLATE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "678d311e-49b3-4596-9c5c-fc64f4abc2ae",
          "citation": "OCTISALATE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "171f423f-7140-481e-abd4-2c50d3dfeb25",
          "citation": "OCTYL SALICYLATE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1c439582-4f08-d675-ad06-896c6c857360",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=118-60-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "067b7034-d1f1-6b3c-cb5b-8b011882c4e6",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "8dde684e-1d3a-a2d9-804f-5bb24e584b0e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "14adedb1-87a6-615e-202a-6834c09ada52",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "e3794841-b958-428b-a199-4d8adeaace48",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2c693e36-f950-84aa-2b93-eaa5d7cdfe05",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "4b6bb9e7-4db0-b691-c6b7-0adb819a2bb2",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "4f4d489f-6b47-87ce-f1bf-eaa4bd8953d2",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "1565cbac-dd58-fa84-061c-7aed36271bc5",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "52023d11-4143-4ff7-bc88-06ac3eb98a13",
          "id": "52023d11-4143-4ff7-bc88-06ac3eb98a13",
          "molfile": "\n  Marvin  01132104162D          \n\n 18 18  0  0  0  0            999 V2000\n    0.1081   -9.6378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8184   -9.2029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5390   -9.6275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2338   -9.2029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9647   -9.6198    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.9647  -10.4305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2493  -10.8423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6621   -9.2029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3801   -9.6275    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0878   -9.1901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0878   -8.3717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8007   -9.6044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7930  -10.4227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5548  -10.8242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2342  -10.4227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2342   -9.5966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4775   -9.1643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4775   -8.4231    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  8  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 10 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 17 12  2  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(CC)COC(=O)c1ccccc1O",
          "formula": "C15H22O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "209c22a4-eb24-4afe-947c-b3edcc39808e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "250.3339",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "aa0a3090-0cc8-418b-911e-7693d93adf07",
      "version": "24",
      "structure": {
        "id": "f1756c86-1b1e-427f-91e6-0f115b057c98",
        "molfile": "\n  Marvin  01132112322D          \n\n 18 18  0  0  0  0            999 V2000\n    5.8007   -9.6044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0878   -9.1901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3801   -9.6275    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4775   -9.1643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0878   -8.3717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6621   -9.2029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4775   -8.4231    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7930  -10.4227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2342   -9.5966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9647   -9.6198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9647  -10.4305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2338   -9.2029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8184   -9.2029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5390   -9.6275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5548  -10.8242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2493  -10.8423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1081   -9.6378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2342  -10.4227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  1  2  0  0  0  0\n  5  2  2  0  0  0  0\n  6  3  1  0  0  0  0\n  7  4  1  0  0  0  0\n  8  1  1  0  0  0  0\n  9  4  1  0  0  0  0\n 10  6  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 10  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 12  1  0  0  0  0\n 15  8  2  0  0  0  0\n 16 11  1  0  0  0  0\n 17 13  1  0  0  0  0\n 18 15  1  0  0  0  0\n 18  9  2  0  0  0  0\nM  END",
        "smiles": "CCCCC(CC)COC(=O)c1ccccc1O",
        "formula": "C15H22O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "250.3339",
        "optical_activity": "( + / - )",
        "references": [
          "783530db-3110-4993-8708-18b26c15a680",
          "1da55d32-c4f8-4fee-8ae0-b8cc73f6801a",
          "a29ae9b5-dc02-4b62-8e85-23c8b8bd87fa"
        ],
        "stereo_centers": 1
      },
      "unii": "4X49Y0596W"
    }
  ]
}