{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ebdb1cc6-3b0d-4461-82da-57a12dfd9869",
          "code": "90-20-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=90-20-0",
          "code_system": "CAS",
          "references": [
            "4a932ae1-bfe2-4e58-ae4e-511fd6599332",
            "0628b80c-97d5-4e63-8ae2-c6b214062472"
          ]
        },
        {
          "uuid": "9d37735b-dd16-4f43-b0e9-fdf6dbef846e",
          "code": "201-975-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.796",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4a932ae1-bfe2-4e58-ae4e-511fd6599332"
          ]
        },
        {
          "uuid": "662d6e9a-b6fa-45f1-8f44-f3f71d439ec7",
          "code": "m7740",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7740?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "4a932ae1-bfe2-4e58-ae4e-511fd6599332"
          ]
        },
        {
          "uuid": "755a1696-723d-449f-abce-af38333a26be",
          "code": "7009",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7009",
          "code_system": "PUBCHEM",
          "references": [
            "4a932ae1-bfe2-4e58-ae4e-511fd6599332"
          ]
        },
        {
          "uuid": "380d8800-f2c7-75bf-0c88-11d8a40e56cb",
          "code": "DTXSID0046981",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0046981",
          "code_system": "EPA CompTox",
          "references": [
            "c2ffbdf2-a619-433f-5b8e-4d556306d66e"
          ]
        },
        {
          "uuid": "8a96a16b-a681-4299-9699-3c7182ff7e76",
          "code": "4WUM31ES4U",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "2da91209-3b6f-b69a-98a2-29e9bd71c43d",
          "code": "190492",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=190492",
          "code_system": "NSC",
          "references": [
            "3452d992-f475-9e5a-3a4e-bd67bd9fd959"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e8233444-569d-40f8-9cfa-472abdc7a465",
          "name": "1-NAPHTHOL-8-AMINO-3,6-DISULFONIC ACID",
          "stdName": "1-NAPHTHOL-8-AMINO-3,6-DISULFONIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "62bba7ea-64b8-419d-8cd3-cb8ef5ba0ee7",
            "2c95e08c-6fc0-4378-b0b4-0deaf367f610",
            "9533c497-95e0-4f89-8f09-12a071fd9ef1"
          ],
          "display_name": true
        },
        {
          "uuid": "bc431ef0-4c26-46f0-ac29-7e317656305f",
          "name": "1-NAPHTHOL-8-AMINO-3,6-DISULFONIC ACID [MI]",
          "stdName": "1-NAPHTHOL-8-AMINO-3,6-DISULFONIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "62bba7ea-64b8-419d-8cd3-cb8ef5ba0ee7",
            "2c95e08c-6fc0-4378-b0b4-0deaf367f610"
          ],
          "display_name": false
        },
        {
          "uuid": "85e2213c-a49d-46d6-9254-65453bdda595",
          "name": "2,7-NAPHTHALENEDISULFONIC ACID, 4-AMINO-5-HYDROXY-",
          "stdName": "2,7-NAPHTHALENEDISULFONIC ACID, 4-AMINO-5-HYDROXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c95e08c-6fc0-4378-b0b4-0deaf367f610",
            "44590cec-615f-4808-90df-17226158737f"
          ],
          "display_name": false
        },
        {
          "uuid": "edab0ed6-8c98-4beb-8c03-d1d48fe34708",
          "name": "4-AMINO-5-HYDROXY-2,7-NAPHTHALENEDISULFONIC ACID",
          "stdName": "4-AMINO-5-HYDROXY-2,7-NAPHTHALENEDISULFONIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c95e08c-6fc0-4378-b0b4-0deaf367f610",
            "44590cec-615f-4808-90df-17226158737f"
          ],
          "display_name": false
        },
        {
          "uuid": "d5d65ba7-1664-48e1-98b9-755dd223c9a6",
          "name": "8-HYDROXY-3,6-DISULFO-1-NAPHTHYLAMINE",
          "stdName": "8-HYDROXY-3,6-DISULFO-1-NAPHTHYLAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c95e08c-6fc0-4378-b0b4-0deaf367f610",
            "44590cec-615f-4808-90df-17226158737f"
          ],
          "display_name": false
        },
        {
          "uuid": "2c5c3e32-650e-4dd6-9c8f-bb720b5a452c",
          "name": "C.I. 35570",
          "stdName": "C.I. 35570",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c95e08c-6fc0-4378-b0b4-0deaf367f610",
            "44590cec-615f-4808-90df-17226158737f"
          ],
          "display_name": false
        },
        {
          "uuid": "ba2ca627-0179-442a-a335-023367903446",
          "name": "H ACID",
          "stdName": "H ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ac474f4-8fc2-4add-b154-6930b382f23b"
          ],
          "display_name": false
        },
        {
          "uuid": "1250529f-97ca-4bc9-89e0-417bf1f73a1c",
          "name": "NSC-190492",
          "stdName": "NSC-190492",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c95e08c-6fc0-4378-b0b4-0deaf367f610",
            "44590cec-615f-4808-90df-17226158737f"
          ],
          "display_name": false
        },
        {
          "uuid": "3e27a426-f24a-4f50-9e77-63971f995417",
          "name": "SULFONPHTHOL",
          "stdName": "SULFONPHTHOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c95e08c-6fc0-4378-b0b4-0deaf367f610",
            "44590cec-615f-4808-90df-17226158737f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6ac474f4-8fc2-4add-b154-6930b382f23b",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "62bba7ea-64b8-419d-8cd3-cb8ef5ba0ee7",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2c95e08c-6fc0-4378-b0b4-0deaf367f610",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "44590cec-615f-4808-90df-17226158737f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a932ae1-bfe2-4e58-ae4e-511fd6599332",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390961000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2f0d6120-14e9-4712-b31e-0b8b645e4c26",
          "citation": "SRS import [4WUM31ES4U]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4WUM31ES4U",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390961000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "86996d01-13d4-4943-8326-68fb9d453f56",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9533c497-95e0-4f89-8f09-12a071fd9ef1",
          "citation": "1-NAPHTHOL-8-AMINO-3,6-DISULFONIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c2ffbdf2-a619-433f-5b8e-4d556306d66e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=90-20-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0628b80c-97d5-4e63-8ae2-c6b214062472",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3452d992-f475-9e5a-3a4e-bd67bd9fd959",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e304cc67-b005-42fe-b84e-aa3c0e2c5d52",
          "id": "e304cc67-b005-42fe-b84e-aa3c0e2c5d52",
          "molfile": "\n  Marvin  01132111452D          \n\n 20 21  0  0  0  0            999 V2000\n    7.7287   -6.7792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7287   -5.9431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4358   -5.5320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4358   -4.7178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7287   -4.2936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0118   -4.7023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3046   -4.2936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5877   -4.7178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5877   -5.5320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3046   -5.9431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3046   -6.7792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0118   -5.5320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8594   -4.3064    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2571   -3.5839    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4532   -5.0348    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1386   -3.9118    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1643   -4.3064    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5754   -5.0348    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7715   -3.5839    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8900   -3.9118    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 12  2  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  4 17  1  0  0  0  0\n  6  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  6 12  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  8 13  1  0  0  0  0\n 10  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 10  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  2  0  0  0  0\n 13 16  2  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  2  0  0  0  0\n 17 20  2  0  0  0  0\nM  END",
          "smiles": "c1c2cc(cc(c2c(cc1S(=O)(=O)O)N)O)S(=O)(=O)O",
          "formula": "C10H9NO7S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cb756681-5acb-4799-9bae-530117cba7b5"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "319.3135",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "13cede0b-fe65-4d94-b10c-9cbfbbf911e0",
      "version": "4",
      "structure": {
        "id": "0281a571-d171-4640-89f1-ac2a3cdacc27",
        "molfile": "\n  Marvin  01132100272D          \n\n 20 21  0  0  0  0            999 V2000\n    7.0118   -4.7023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0118   -5.5320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7287   -5.9431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4358   -5.5320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4358   -4.7178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7287   -4.2936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1643   -4.3064    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5754   -5.0348    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7715   -3.5839    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8900   -3.9118    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7287   -6.7792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3046   -5.9431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5877   -5.5320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5877   -4.7178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3046   -4.2936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8594   -4.3064    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4532   -5.0348    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1386   -3.9118    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2571   -3.5839    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3046   -6.7792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n  7 10  2  0  0  0  0\n  3 11  1  0  0  0  0\n  2 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n  1 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  2  0  0  0  0\n 16 19  1  0  0  0  0\n 12 20  1  0  0  0  0\nM  END",
        "smiles": "c1c2cc(cc(c2c(cc1S(=O)(=O)O)N)O)S(=O)(=O)O",
        "formula": "C10H9NO7S2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "319.3135",
        "optical_activity": "NONE",
        "references": [
          "86996d01-13d4-4943-8326-68fb9d453f56",
          "2f0d6120-14e9-4712-b31e-0b8b645e4c26"
        ],
        "stereo_centers": 0
      },
      "unii": "4WUM31ES4U"
    }
  ]
}