{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ac992fb7-4d38-421d-8b8f-c8e3fa52ee95",
          "code": "DIBUTYL SEBACATE",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=4026",
          "code_system": "JECFA EVALUATION",
          "references": [
            "7a52ae67-ebee-4696-813a-6e1805edb8c0"
          ]
        },
        {
          "uuid": "61303f31-479b-4abb-bd42-7eedc869a2ce",
          "code": "109-43-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=109-43-3",
          "code_system": "CAS",
          "references": [
            "7a52ae67-ebee-4696-813a-6e1805edb8c0",
            "f28376f3-607b-4dc0-b316-2274197eec9c"
          ]
        },
        {
          "uuid": "c3ed7bd4-a6de-496e-ba25-2d386c4e191e",
          "code": "C76705",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76705",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7a52ae67-ebee-4696-813a-6e1805edb8c0"
          ]
        },
        {
          "uuid": "c53446ae-2282-40a0-8950-d2b0f271af6f",
          "code": "C055481",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67055481",
          "code_system": "MESH",
          "references": [
            "7a52ae67-ebee-4696-813a-6e1805edb8c0"
          ]
        },
        {
          "uuid": "b8b4de7d-eb8b-410a-96cd-e8d6cee84c5a",
          "code": "21 CFR 172.515",
          "comments": "PART 172 -- FOOD ADDITIVES PERMITTED FOR DIRECT ADDITION TO FOOD FOR HUMAN CONSUMPTION|Subpart F--Flavoring Agents and Related Substances|Sec. 172.515 Synthetic flavoring substances and adjuvants.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=172.515",
          "code_system": "CFR",
          "references": [
            "7a52ae67-ebee-4696-813a-6e1805edb8c0"
          ]
        },
        {
          "uuid": "d2cf868c-a496-495b-8ce3-836ec1a64a52",
          "code": "21 CFR 175.320",
          "comments": "PART 175 -- INDIRECT FOOD ADDITIVES: ADHESIVES AND COMPONENTS OF COATINGS|Subpart C--Substances for Use as Components of Coatings|Sec. 175.320 Resinous and polymeric coatings for polyolefin films.|(ii) Plasticizers",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=175.320",
          "code_system": "CFR",
          "references": [
            "7a52ae67-ebee-4696-813a-6e1805edb8c0"
          ]
        },
        {
          "uuid": "21539f98-40b9-4f23-875b-94bdbe961fb5",
          "code": "DIBUTYL SEBACATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Dibutyl_sebacate",
          "code_system": "WIKIPEDIA",
          "references": [
            "7a52ae67-ebee-4696-813a-6e1805edb8c0"
          ]
        },
        {
          "uuid": "869f801c-c5f6-49a2-9efd-eac5e00d54c9",
          "code": "FCN NO. 370",
          "comments": "FCN|PIGMENT DISPERSANT|POLYMER COLORANTS",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=370",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "7a52ae67-ebee-4696-813a-6e1805edb8c0"
          ]
        },
        {
          "uuid": "1c670140-a65b-4fd4-a46e-e40fdfd03cd8",
          "code": "21 CFR 176.170",
          "comments": "PART 176 -- INDIRECT FOOD ADDITIVES: PAPER AND PAPERBOARD COMPONENTS|Subpart B--Substances for Use Only as Components of Paper and Paperboard|Sec. 176.170 Components of paper and paperboard in contact with aqueous and fatty foods.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=176.170",
          "code_system": "CFR",
          "references": [
            "7a52ae67-ebee-4696-813a-6e1805edb8c0"
          ]
        },
        {
          "uuid": "05a88602-d1cc-4de6-a52a-2485b3271514",
          "code": "203-672-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.003.339",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7a52ae67-ebee-4696-813a-6e1805edb8c0"
          ]
        },
        {
          "uuid": "95582cee-1d1f-4c5a-968f-6cf9b2c25557",
          "code": "1363700",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1363700/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "7a52ae67-ebee-4696-813a-6e1805edb8c0"
          ]
        },
        {
          "uuid": "e5828eb3-d0d1-4540-b7cb-e92daaafddbd",
          "code": "SUB21232",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "7a52ae67-ebee-4696-813a-6e1805edb8c0"
          ]
        },
        {
          "uuid": "3b600a4a-42cb-42b2-bf72-731cbc21c189",
          "code": "CHEMBL2106225",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2106225",
          "code_system": "ChEMBL",
          "references": [
            "7a52ae67-ebee-4696-813a-6e1805edb8c0"
          ]
        },
        {
          "uuid": "761c0bd0-6b5c-4e90-a7b3-088b9517454a",
          "code": "7986",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7986",
          "code_system": "PUBCHEM",
          "references": [
            "7a52ae67-ebee-4696-813a-6e1805edb8c0"
          ]
        },
        {
          "uuid": "f29011dd-fc54-bf42-a462-d3eebc16b062",
          "code": "309",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/309",
          "code_system": "HSDB",
          "references": [
            "cec31aff-b2de-0978-2ca9-86942f3c5c3e"
          ]
        },
        {
          "uuid": "e4883d36-97b3-09fc-e011-355f1983dd43",
          "code": "DTXSID1041847",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1041847",
          "code_system": "EPA CompTox",
          "references": [
            "282fe043-c4a8-58bd-81cb-cfa1e11f3ffa"
          ]
        },
        {
          "uuid": "514951ad-22d9-c1d9-1875-57985e40e145",
          "code": "C45678",
          "comments": "Industrial Aid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45678",
          "code_system": "NCI_THESAURUS",
          "references": [
            "cee8642f-af73-2aa6-baa8-ce143133e912"
          ]
        },
        {
          "uuid": "b610f392-14f6-40b5-9730-42c50d1f4d70",
          "code": "4W5IH7FLNY",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9533e6ed-5006-5435-2b09-165432b30e30",
          "code": "1187091",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1187091",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "cee8642f-af73-2aa6-baa8-ce143133e912"
          ]
        },
        {
          "uuid": "682ab612-fd7f-98d8-0934-d63b7e9e6b07",
          "code": "100000084747",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "c3e08b7f-5f89-aead-f08b-dd653ea5cdb2"
          ]
        },
        {
          "uuid": "3f43682a-4725-746f-8147-74fd6266fb48",
          "code": "3893",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=3893",
          "code_system": "NSC",
          "references": [
            "140d3f3b-e7e3-55f5-4f5f-8890da4364c9"
          ]
        },
        {
          "uuid": "359be9d6-86da-e2a8-6e55-2419b8cc241c",
          "code": "4W5IH7FLNY",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=4W5IH7FLNY",
          "code_system": "DAILYMED",
          "references": [
            "06626c57-0bfa-2ccb-6c5e-18dd52457394"
          ]
        },
        {
          "uuid": "27a172cf-496b-c0c3-8771-9b08b8c3d36d",
          "code": "1118",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1118/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "e7720f85-d28b-d6a0-81ce-8b419a1df6ac"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "db86d8c3-9189-4541-be4c-16c9723814c2",
          "name": "DECANEDIOIC ACID, DIBUTYL ESTER",
          "stdName": "DECANEDIOIC ACID, DIBUTYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc012c3b-0a56-4ec7-b7d4-13648bfb0fd5",
            "bb345dfe-3f25-4ba6-9ff7-05b763233874"
          ],
          "display_name": false
        },
        {
          "uuid": "08b99ef7-38cf-46e0-a1d7-e4a41404445c",
          "name": "DIBUTYL 1,8-OCTANEDICARBOXYLATE",
          "stdName": "DIBUTYL 1,8-OCTANEDICARBOXYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc012c3b-0a56-4ec7-b7d4-13648bfb0fd5",
            "bb345dfe-3f25-4ba6-9ff7-05b763233874"
          ],
          "display_name": false
        },
        {
          "uuid": "4bdbc567-cbe5-4ed5-9b7e-9dec69c40f09",
          "name": "DIBUTYL DECANEDIOATE",
          "stdName": "DIBUTYL DECANEDIOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc012c3b-0a56-4ec7-b7d4-13648bfb0fd5",
            "bb345dfe-3f25-4ba6-9ff7-05b763233874"
          ],
          "display_name": false
        },
        {
          "uuid": "27565358-1870-4fbc-9ee6-b2729eb225da",
          "name": "DIBUTYL SEBACATE",
          "stdName": "DIBUTYL SEBACATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c5b7c5dd-6de1-4e5d-8afa-41324746bc85",
            "b01f8a7b-5cb3-4704-a61f-17783c0f046b",
            "df9fc782-3b9a-403a-a4c1-a945d1f6b3fa",
            "0f27a82b-01c3-41da-a30a-db18975528a9",
            "57e8591b-ba1f-4386-8b7e-90a4f3f23147",
            "55a5be5d-ad2c-4a13-8793-66880132004e",
            "f8282ad5-9b41-4054-8494-4029d96d23a1",
            "a9025486-0abc-4d63-802a-bcfd3495651a",
            "171a64a1-67fa-421e-acbd-5d95bc62e011",
            "656f3c20-0bfc-4f1b-9aee-682b0a70dfad",
            "6a08960e-2360-4ede-9edb-14e325833642",
            "c4eebbfe-1fde-4476-85c7-f29bb5c03fa4",
            "bb345dfe-3f25-4ba6-9ff7-05b763233874",
            "5d056c76-3938-44a6-937f-e51d5a7183e9"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ba96606c-e1dd-42e5-8c74-81136c6993c5",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "cee821fd-78dd-4fdc-a396-800af745d122",
          "name": "DIBUTYL SEBACATE [FHFI]",
          "stdName": "DIBUTYL SEBACATE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a08960e-2360-4ede-9edb-14e325833642",
            "df9fc782-3b9a-403a-a4c1-a945d1f6b3fa"
          ],
          "display_name": false
        },
        {
          "uuid": "59246c9d-0ff5-4da6-9fcb-f5d021740ae8",
          "name": "DIBUTYL SEBACATE [HSDB]",
          "stdName": "DIBUTYL SEBACATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a08960e-2360-4ede-9edb-14e325833642",
            "5d056c76-3938-44a6-937f-e51d5a7183e9"
          ],
          "display_name": false
        },
        {
          "uuid": "cc000c1c-66aa-41fe-b4a1-9c3b38a7c030",
          "name": "DIBUTYL SEBACATE [II]",
          "stdName": "DIBUTYL SEBACATE [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57e8591b-ba1f-4386-8b7e-90a4f3f23147",
            "bb345dfe-3f25-4ba6-9ff7-05b763233874"
          ],
          "display_name": false
        },
        {
          "uuid": "4a525d6c-b119-4b9a-91bc-e7526903b0ed",
          "name": "DIBUTYL SEBACATE [MART.]",
          "stdName": "DIBUTYL SEBACATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a9025486-0abc-4d63-802a-bcfd3495651a"
          ],
          "display_name": false
        },
        {
          "uuid": "52d1438a-3d77-4387-9472-4109ff619633",
          "name": "DIBUTYL SEBACATE [USP-RS]",
          "stdName": "DIBUTYL SEBACATE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a08960e-2360-4ede-9edb-14e325833642",
            "0f27a82b-01c3-41da-a30a-db18975528a9"
          ],
          "display_name": false
        },
        {
          "uuid": "059a61ce-c944-4a9d-a20e-289bc7cc10e7",
          "name": "FEMA NO. 2373",
          "stdName": "FEMA NO. 2373",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fedc3032-f58b-49c0-9c43-538464cdcb09"
          ],
          "display_name": false
        },
        {
          "uuid": "58b68759-a9ec-48a7-a5cb-0da162248880",
          "name": "NSC-3893",
          "stdName": "NSC-3893",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc012c3b-0a56-4ec7-b7d4-13648bfb0fd5",
            "bb345dfe-3f25-4ba6-9ff7-05b763233874"
          ],
          "display_name": false
        },
        {
          "uuid": "2d20b08f-cd54-46e7-8044-fb6d5b33c07a",
          "name": "PX-404",
          "stdName": "PX-404",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc012c3b-0a56-4ec7-b7d4-13648bfb0fd5",
            "6a08960e-2360-4ede-9edb-14e325833642"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "cc012c3b-0a56-4ec7-b7d4-13648bfb0fd5",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "bb345dfe-3f25-4ba6-9ff7-05b763233874",
          "citation": "STN 2007",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "57e8591b-ba1f-4386-8b7e-90a4f3f23147",
          "citation": "USP Dictionary 2007",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fedc3032-f58b-49c0-9c43-538464cdcb09",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "df9fc782-3b9a-403a-a4c1-a945d1f6b3fa",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6a08960e-2360-4ede-9edb-14e325833642",
          "citation": "HANDBOOK OF FLAVOR INGREDIENTS",
          "doc_type": "HANDBOOK OF FLAVOR INGREDIENTS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a9025486-0abc-4d63-802a-bcfd3495651a",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "55a5be5d-ad2c-4a13-8793-66880132004e",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5d056c76-3938-44a6-937f-e51d5a7183e9",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0f27a82b-01c3-41da-a30a-db18975528a9",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a52ae67-ebee-4696-813a-6e1805edb8c0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389716000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "025816c3-d4b2-4fea-93cc-174d1c8c29a3",
          "citation": "SRS import [4W5IH7FLNY]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4W5IH7FLNY",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389716000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c4eebbfe-1fde-4476-85c7-f29bb5c03fa4",
          "citation": "DIBUTYL SEBACATE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "171a64a1-67fa-421e-acbd-5d95bc62e011",
          "citation": "DIBUTYL SEBACATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f8282ad5-9b41-4054-8494-4029d96d23a1",
          "citation": "DIBUTYL SEBACATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c5b7c5dd-6de1-4e5d-8afa-41324746bc85",
          "citation": "DIBUTYL SEBACATE [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "656f3c20-0bfc-4f1b-9aee-682b0a70dfad",
          "citation": "DIBUTYL SEBACATE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b01f8a7b-5cb3-4704-a61f-17783c0f046b",
          "citation": "DIBUTYL SEBACATE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cec31aff-b2de-0978-2ca9-86942f3c5c3e",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+109-43-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "282fe043-c4a8-58bd-81cb-cfa1e11f3ffa",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=109-43-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c3e08b7f-5f89-aead-f08b-dd653ea5cdb2",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "cee8642f-af73-2aa6-baa8-ce143133e912",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "f28376f3-607b-4dc0-b316-2274197eec9c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "140d3f3b-e7e3-55f5-4f5f-8890da4364c9",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "06626c57-0bfa-2ccb-6c5e-18dd52457394",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "e7720f85-d28b-d6a0-81ce-8b419a1df6ac",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "62ec07ca-e462-41e0-925e-ecc1d6f249f6",
          "id": "62ec07ca-e462-41e0-925e-ecc1d6f249f6",
          "molfile": "\n  Marvin  01132105082D          \n\n 22 21  0  0  0  0            999 V2000\n   13.6327   -0.6791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9096   -1.1041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2021   -0.6946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4790   -1.1145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7714   -0.7179    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0483   -1.1430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0483   -1.9749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3252   -0.7335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6151   -1.1585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8946   -0.7620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1715   -1.1845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4613   -0.7724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7382   -1.1974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0177   -0.8035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3075   -1.2233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5844   -0.8268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5715    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8613   -1.2389    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1538   -0.8423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4307   -1.2674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7076   -0.8708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 16  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\nM  END",
          "smiles": "CCCCOC(=O)CCCCCCCCC(=O)OCCCC",
          "formula": "C18H34O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2a69f4ae-1301-47e8-8766-d01cae9f4721"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "314.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "952061ec-eac3-4996-8306-8489ad5d65b4",
      "version": "14",
      "structure": {
        "id": "e328a0fb-0ba8-4bfb-bf7c-d004c7100e9e",
        "molfile": "\n  Marvin  01132111452D          \n\n 22 21  0  0  0  0            999 V2000\n   10.0483   -1.1430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5844   -0.8268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5715    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0483   -1.9749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7714   -0.7179    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8613   -1.2389    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3075   -1.2233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3252   -0.7335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4790   -1.1145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1538   -0.8423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0177   -0.8035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6151   -1.1585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2021   -0.6946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4307   -1.2674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9096   -1.1041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7076   -0.8708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8946   -0.7620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1715   -1.1845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4613   -0.7724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7382   -1.1974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6327   -0.6791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  7  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  1  2  0  0  0  0\n  5  1  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7 11  1  0  0  0  0\n  8  1  1  0  0  0  0\n  9  5  1  0  0  0  0\n 10  6  1  0  0  0  0\n 11 20  1  0  0  0  0\n 12  8  1  0  0  0  0\n 13  9  1  0  0  0  0\n 14 10  1  0  0  0  0\n 15 13  1  0  0  0  0\n 16 14  1  0  0  0  0\n 17 12  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 15  1  0  0  0  0\n 22 16  1  0  0  0  0\nM  END",
        "smiles": "CCCCOC(=O)CCCCCCCCC(=O)OCCCC",
        "formula": "C18H34O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "314.4609",
        "optical_activity": "NONE",
        "references": [
          "57e8591b-ba1f-4386-8b7e-90a4f3f23147",
          "025816c3-d4b2-4fea-93cc-174d1c8c29a3"
        ],
        "stereo_centers": 0
      },
      "unii": "4W5IH7FLNY"
    }
  ]
}