{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9f0834e3-88e6-4f74-bf86-3b2525a14297",
          "code": "6422-86-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6422-86-2",
          "code_system": "CAS",
          "references": [
            "8bb9ba43-2582-457a-831a-05785e7078ee",
            "a4e62892-65a1-45f9-b53c-c16fb6503515"
          ]
        },
        {
          "uuid": "1d350d64-4473-444d-8808-80af35847f25",
          "code": "C053316",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67053316",
          "code_system": "MESH",
          "references": [
            "8bb9ba43-2582-457a-831a-05785e7078ee"
          ]
        },
        {
          "uuid": "179124fd-c796-4fc8-83ef-6db9a1ef3bda",
          "code": "FCN NO. 1056",
          "comments": "FCN|PLASTICIZER|VINYL CHLORIDE POLYMERS",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=1056",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "8bb9ba43-2582-457a-831a-05785e7078ee"
          ]
        },
        {
          "uuid": "1799d3b7-2207-4d4b-82a0-870bc309d45e",
          "code": "FCN NO. 770",
          "comments": "FCN|COMPONENT|VARIOUS CONTAINERS AND ADHESIVES",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=770",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "8bb9ba43-2582-457a-831a-05785e7078ee"
          ]
        },
        {
          "uuid": "46f84047-ca27-497e-a3aa-1408a96cb9a9",
          "code": "229-176-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.026.524",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8bb9ba43-2582-457a-831a-05785e7078ee"
          ]
        },
        {
          "uuid": "5e5fa0db-a339-4c9f-a547-e9bc791784ef",
          "code": "22932",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/22932",
          "code_system": "PUBCHEM",
          "references": [
            "8bb9ba43-2582-457a-831a-05785e7078ee"
          ]
        },
        {
          "uuid": "a88dfbbc-847a-79bb-4111-5207204affb8",
          "code": "DTXSID7027625",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7027625",
          "code_system": "EPA CompTox",
          "references": [
            "e4131ed1-8d2c-3d70-9eea-559b34a0ec98"
          ]
        },
        {
          "uuid": "44e328a9-4d14-23ed-007c-fa617ce896c0",
          "code": "6150",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6150",
          "code_system": "HSDB",
          "references": [
            "0484d198-efcb-cc66-e717-50b1aa379c78"
          ]
        },
        {
          "uuid": "b4de7aeb-6c95-465c-a3e5-2224a45fc62c",
          "code": "4VS908W98L",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "548da569-e31a-48d2-b312-c339a288e8a7",
          "name": "(±)-Bis(2-ethylhexyl) terephthalate",
          "stdName": "(+/-)-BIS(2-ETHYLHEXYL) TEREPHTHALATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2df615b9-dd22-4ce9-8bfa-2619549ce41e",
            "0b441053-5cdf-4aeb-a389-7b0699b7515c"
          ],
          "display_name": false
        },
        {
          "uuid": "06f89b60-2101-4360-b89d-c94f30b23b22",
          "name": "1,4-Benzenedicarboxylic acid, 1,4-bis(2-ethylhexyl) ester",
          "stdName": "1,4-BENZENEDICARBOXYLIC ACID, 1,4-BIS(2-ETHYLHEXYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1c7833c-01af-4593-81ca-a15c238b908c",
            "0b441053-5cdf-4aeb-a389-7b0699b7515c"
          ],
          "display_name": false
        },
        {
          "uuid": "77482367-8697-4fee-83e1-d4ec6fe3bae8",
          "name": "1,4-Benzenedicarboxylic acid, bis(2-ethylhexyl) ester",
          "stdName": "1,4-BENZENEDICARBOXYLIC ACID, BIS(2-ETHYLHEXYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1c7833c-01af-4593-81ca-a15c238b908c",
            "0b441053-5cdf-4aeb-a389-7b0699b7515c"
          ],
          "display_name": false
        },
        {
          "uuid": "e43dc240-896e-401a-9744-851eb698f0ea",
          "name": "Bis(2-ethylhexyl) terephthalate",
          "stdName": "BIS(2-ETHYLHEXYL) TEREPHTHALATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f972274e-56a4-4fc9-a696-a575c65a98e7",
            "0b441053-5cdf-4aeb-a389-7b0699b7515c",
            "5fa05005-cf60-4528-86c4-b8ebbef11c80",
            "06223b5c-29b4-4196-b48f-c26000b2a731"
          ],
          "display_name": false
        },
        {
          "uuid": "0f44ff9b-1236-4c60-ad39-89cac60afe7b",
          "name": "Bis(2-ethylhexyl) terephthalate [HSDB]",
          "stdName": "BIS(2-ETHYLHEXYL) TEREPHTHALATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0b441053-5cdf-4aeb-a389-7b0699b7515c",
            "5fa05005-cf60-4528-86c4-b8ebbef11c80"
          ],
          "display_name": false
        },
        {
          "uuid": "2ed1ba61-7c43-4d67-9d61-0ef44272fca5",
          "name": "Di(2-ethylhexyl) terephthalate",
          "stdName": "DI(2-ETHYLHEXYL) TEREPHTHALATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1c7833c-01af-4593-81ca-a15c238b908c",
            "0b441053-5cdf-4aeb-a389-7b0699b7515c"
          ],
          "display_name": false
        },
        {
          "uuid": "3c7cb2ee-7475-4f0e-b990-66dc3bcc3fa7",
          "name": "Diethylhexyl terephthalate",
          "stdName": "DIETHYLHEXYL TEREPHTHALATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "17569016-a585-4c2e-9ba5-4d90491836f1",
            "0b441053-5cdf-4aeb-a389-7b0699b7515c",
            "c86ce1f9-b1c6-467c-adba-fef0c50f175e"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "d14f9a8c-9a7d-4b65-bf5e-895bf6e3833b",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "64708f48-6739-48f2-97fd-90102b2d3628",
          "name": "EASTMAN 168 PLASTICIZER",
          "stdName": "EASTMAN 168 PLASTICIZER",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "17569016-a585-4c2e-9ba5-4d90491836f1",
            "0b441053-5cdf-4aeb-a389-7b0699b7515c"
          ],
          "display_name": false
        },
        {
          "uuid": "85425be9-0052-4c24-ae2b-f6b27cd151ba",
          "name": "KODAFLEX DOTP",
          "stdName": "KODAFLEX DOTP",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1c7833c-01af-4593-81ca-a15c238b908c",
            "0b441053-5cdf-4aeb-a389-7b0699b7515c"
          ],
          "display_name": false
        },
        {
          "uuid": "a15b6ede-9018-4219-9239-34a208a105c8",
          "name": "Terephthalic acid, bis(2-ethylhexyl) ester",
          "stdName": "TEREPHTHALIC ACID, BIS(2-ETHYLHEXYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f972274e-56a4-4fc9-a696-a575c65a98e7",
            "0b441053-5cdf-4aeb-a389-7b0699b7515c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f972274e-56a4-4fc9-a696-a575c65a98e7",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0b441053-5cdf-4aeb-a389-7b0699b7515c",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "17569016-a585-4c2e-9ba5-4d90491836f1",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d1c7833c-01af-4593-81ca-a15c238b908c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2df615b9-dd22-4ce9-8bfa-2619549ce41e",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5fa05005-cf60-4528-86c4-b8ebbef11c80",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8bb9ba43-2582-457a-831a-05785e7078ee",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391492000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "53cc902b-4a81-403c-b456-f2bcec951679",
          "citation": "SRS import [4VS908W98L]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4VS908W98L",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391492000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c86ce1f9-b1c6-467c-adba-fef0c50f175e",
          "citation": "DIETHYLHEXYL TEREPHTHALATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "06223b5c-29b4-4196-b48f-c26000b2a731",
          "citation": "BIS(2-ETHYLHEXYL) TEREPHTHALATE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0484d198-efcb-cc66-e717-50b1aa379c78",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+6422-86-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e4131ed1-8d2c-3d70-9eea-559b34a0ec98",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6422-86-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a4e62892-65a1-45f9-b53c-c16fb6503515",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d91d0d37-568d-4acd-ab2e-6172376f595a",
          "id": "d91d0d37-568d-4acd-ab2e-6172376f595a",
          "molfile": "\n  Marvin  01132111152D          \n\n 28 28  0  0  0  0            999 V2000\n   11.2258   -7.7691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5139   -7.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7371   -7.7691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9571   -7.3234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2453   -7.6608    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    8.2979   -8.4810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6324   -8.9328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4838   -7.2274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7503   -7.6391    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0353   -7.2367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3452   -7.6298    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0353   -6.4166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3110   -6.0080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3110   -5.1816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0353   -4.7700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7503   -5.1816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7503   -6.0080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0353   -3.9466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3452   -3.5381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7503   -3.5722    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4281   -4.0116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2545   -3.6248    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    8.3535   -2.8045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0964   -2.4826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9881   -4.0364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7030   -3.6464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3932   -4.0116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1268   -3.6341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  8  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 17 12  2  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 18  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 25  1  0  0  0  0\n 23 24  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(CC)COC(=O)c1ccc(cc1)C(=O)OCC(CC)CCCC",
          "formula": "C24H38O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6e575644-e694-490d-8c48-c2ff186c1dc7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "390.557",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4de9b4e5-fe1b-4367-a0fa-75463f524ce1",
      "version": "8",
      "structure": {
        "id": "fc327a38-5c9c-4ce8-8f6c-9cd4b93e9021",
        "molfile": "\n   JSDraw201082417352D\n\n 28 28  0  0  0  0              0 V2000\n    9.5760   -6.9142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9272   -6.1344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2780   -6.9148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6291   -6.1350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9800   -6.9152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9797   -8.4752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6286   -9.2550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3311   -6.1354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6820   -6.9156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.0331   -6.1358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.0334   -4.5758    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.3840   -6.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7360   -6.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.0880   -6.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.0880   -8.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7360   -9.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.3840   -8.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4389   -9.2562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4386  -10.8162    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   25.7900   -8.4764    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.1409   -9.2566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.4920   -8.4768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.4923   -6.9168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.8434   -6.1370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.8429   -9.2570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.1940   -8.4772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   32.5448   -9.2576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   33.8960   -8.4778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  5  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 12 17  1  0  0  0  0\n 15 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 22 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\nM  END",
        "smiles": "CCCCC(CC)COC(=O)c1ccc(cc1)C(=O)OCC(CC)CCCC",
        "formula": "C24H38O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "390.557",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "d1c7833c-01af-4593-81ca-a15c238b908c",
          "53cc902b-4a81-403c-b456-f2bcec951679"
        ],
        "stereo_centers": 2
      },
      "unii": "4VS908W98L"
    }
  ]
}