{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1b0d505e-b5f9-4a47-b449-11d6c8ec0b65",
          "code": "7681-57-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7681-57-4",
          "code_system": "CAS",
          "references": [
            "b54a165d-8ad0-4e6e-9aac-8f1443c78304",
            "ab2a7502-14a6-41d5-9ec7-4daeb7e4a4d2"
          ]
        },
        {
          "uuid": "20b6bf99-5e68-471f-9456-8bbd64b0a1eb",
          "code": "C77498",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C77498",
          "code_system": "NCI_THESAURUS",
          "references": [
            "b54a165d-8ad0-4e6e-9aac-8f1443c78304"
          ]
        },
        {
          "uuid": "1f2d31f4-1039-4e14-bca1-6a3a6c50b50b",
          "code": "C005200",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67005200",
          "code_system": "MESH",
          "references": [
            "b54a165d-8ad0-4e6e-9aac-8f1443c78304"
          ]
        },
        {
          "uuid": "57965a95-f2f0-46bf-9661-f44c2bbcff91",
          "code": "SODIUM METABISULFITE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Sodium_metabisulfite",
          "code_system": "WIKIPEDIA",
          "references": [
            "b54a165d-8ad0-4e6e-9aac-8f1443c78304"
          ]
        },
        {
          "uuid": "95d90206-5a33-4a06-a41f-f5d68ce262f3",
          "code": "111409",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3870",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "b54a165d-8ad0-4e6e-9aac-8f1443c78304"
          ]
        },
        {
          "uuid": "8dde01bf-e141-46ac-8569-a591744ce0a7",
          "code": "INS-223",
          "comments": "JECFA|Functional Classification|Antioxidant|Flour treatment agent|Preservative",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=1824",
          "code_system": "JECFA EVALUATION",
          "references": [
            "b54a165d-8ad0-4e6e-9aac-8f1443c78304"
          ]
        },
        {
          "uuid": "5a28af58-5eb4-4d75-a20c-5cefe29b46e6",
          "code": "INS-223",
          "comments": "Codex Alimentarius|Functional Classification|Antioxidant|Bleaching agent|Flour treatment agent|Preservative",
          "type": "PRIMARY",
          "url": "http://www.fao.org/gsfaonline/additives/details.html?id=225",
          "code_system": "CODEX ALIMENTARIUS (GSFA)",
          "references": [
            "b54a165d-8ad0-4e6e-9aac-8f1443c78304"
          ]
        },
        {
          "uuid": "706b95bf-68b7-4c72-a7df-ffff372fdac1",
          "code": "231-673-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.028.794",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b54a165d-8ad0-4e6e-9aac-8f1443c78304"
          ]
        },
        {
          "uuid": "ebd35792-694b-428d-a095-26871326609e",
          "code": "36696",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/36696/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "b54a165d-8ad0-4e6e-9aac-8f1443c78304"
          ]
        },
        {
          "uuid": "521a9719-9552-4a19-af28-d37a7477578f",
          "code": "m10040",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10040?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "b54a165d-8ad0-4e6e-9aac-8f1443c78304"
          ]
        },
        {
          "uuid": "12f57dc8-8291-4994-b5cc-d7eb698f5f1b",
          "code": "SUB27286",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "b54a165d-8ad0-4e6e-9aac-8f1443c78304"
          ]
        },
        {
          "uuid": "18111afd-6d9b-4474-b2ec-b875402b22cb",
          "code": "SUB12299MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "b54a165d-8ad0-4e6e-9aac-8f1443c78304"
          ]
        },
        {
          "uuid": "c017e072-f1b7-4939-86d9-9227f7f3e9ac",
          "code": "CHEMBL2021714",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2021714",
          "code_system": "ChEMBL",
          "references": [
            "b54a165d-8ad0-4e6e-9aac-8f1443c78304"
          ]
        },
        {
          "uuid": "1a03a801-1baf-977d-2284-258979597394",
          "code": "378",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/378",
          "code_system": "HSDB",
          "references": [
            "2f128f13-90d4-85a4-b5b2-bd298aee2ab9"
          ]
        },
        {
          "uuid": "91d9e91d-d95e-1030-fb22-6de06fb408e9",
          "code": "DTXSID0029684",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0029684",
          "code_system": "EPA CompTox",
          "references": [
            "a8e7bcce-de7a-16b3-26e5-c20afd27ac8a"
          ]
        },
        {
          "uuid": "8763d5ae-d5bb-b14f-42fd-e83cf4e32ff4",
          "code": "C45678",
          "comments": "Industrial Aid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45678",
          "code_system": "NCI_THESAURUS",
          "references": [
            "2be301fc-538e-6ee4-a35e-0ea161999ec7"
          ]
        },
        {
          "uuid": "7c47002f-e1b1-e310-e15f-0a14d096d9a2",
          "code": "656671",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/656671",
          "code_system": "PUBCHEM",
          "references": [
            "7427e307-ea5a-db71-d62f-e178a20f31cd"
          ]
        },
        {
          "uuid": "11488909-2a7f-49aa-928a-0db6050c27a4",
          "code": "4VON5FNS3C",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d8640412-38de-ec93-449d-42f087a2af67",
          "code": "1614396",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1614396",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "2be301fc-538e-6ee4-a35e-0ea161999ec7"
          ]
        },
        {
          "uuid": "fc340e40-7c55-abc5-2154-b94e82194640",
          "code": "4VON5FNS3C",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=4VON5FNS3C",
          "code_system": "DAILYMED",
          "references": [
            "84d01cfb-8312-837f-a4d2-fb38e541b910"
          ]
        },
        {
          "uuid": "d0762007-08b9-c306-3b74-d6a370742792",
          "code": "100000079339",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "24cedaf9-806f-1415-1092-34be102f21ee"
          ]
        },
        {
          "uuid": "f3e4c436-fa05-b3a4-3a33-b8f5d66d0861",
          "code": "158277",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=158277",
          "code_system": "NSC",
          "references": [
            "56d7d5f4-da45-7621-4c8a-0b75ce02b914"
          ]
        },
        {
          "uuid": "a2cb1906-46cb-2ec2-7445-f73499be12d7",
          "code": "227243",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=227243",
          "code_system": "NSC",
          "references": [
            "56d7d5f4-da45-7621-4c8a-0b75ce02b914"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "8628a5f3-c9eb-4b80-b9b4-50f0958cbb13",
          "amount": {
            "uuid": "537736bb-5e94-41aa-87a7-a7bb5abe019b"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "9325fa1d-5882-4046-b7b3-d86cfbbee6da",
            "refuuid": "213cfc83-8302-43bf-af66-84116318faee",
            "name": "BISULFITE ION",
            "unii": "OJ9787WBLU",
            "linking_id": "OJ9787WBLU",
            "ref_pname": "BISULFITE ION",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "70ece55f-7d03-4bc7-bd2e-5697fd3bbac3",
          "name": "DISODIUM PENTAOXODISULFATE",
          "stdName": "DISODIUM PENTAOXODISULFATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "406ff29f-3a10-4439-8059-38b6bcf63d48",
            "58853ac3-44d8-4eae-a4e0-dacce583a482"
          ],
          "display_name": false
        },
        {
          "uuid": "f5f86eb4-e226-4118-87bb-e45168be2a27",
          "name": "DISODIUM PYROSULPHITE",
          "stdName": "DISODIUM PYROSULPHITE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc8856db-8b6a-4f60-bbfb-a441f6aaa3f3"
          ],
          "display_name": false
        },
        {
          "uuid": "79d3ec18-05ae-4fc0-9ef8-f202fd95ba28",
          "name": "DISULFUROUS ACID, DISODIUM SALT",
          "stdName": "DISULFUROUS ACID, DISODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce30c58a-3352-4f76-8fcd-6335e2879121"
          ],
          "display_name": false
        },
        {
          "uuid": "06c1ca03-af04-45ab-b253-6a4bd3efb197",
          "name": "Disodium pyrosulfite",
          "stdName": "DISODIUM PYROSULFITE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce30c58a-3352-4f76-8fcd-6335e2879121"
          ],
          "display_name": false
        },
        {
          "uuid": "6aa16951-affb-49b9-b178-948117892387",
          "name": "E-223",
          "stdName": "E-223",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "58853ac3-44d8-4eae-a4e0-dacce583a482",
            "aae20222-6a53-4a0a-a510-20bdd5e845fd"
          ],
          "display_name": false
        },
        {
          "uuid": "07e0eeef-e2db-4894-8db4-977e52dd2bba",
          "name": "INS NO.223",
          "stdName": "INS NO.223",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "58853ac3-44d8-4eae-a4e0-dacce583a482",
            "aae20222-6a53-4a0a-a510-20bdd5e845fd"
          ],
          "display_name": false
        },
        {
          "uuid": "045990b2-4777-4634-95a8-6378f918b31a",
          "name": "INS-223",
          "stdName": "INS-223",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "58853ac3-44d8-4eae-a4e0-dacce583a482",
            "aae20222-6a53-4a0a-a510-20bdd5e845fd"
          ],
          "display_name": false
        },
        {
          "uuid": "bf61bde7-1445-4297-bbb7-5f6555e7a8e5",
          "name": "NSC-158277",
          "stdName": "NSC-158277",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "58853ac3-44d8-4eae-a4e0-dacce583a482",
            "28a494c2-cae3-4bee-9bf5-594400f45349"
          ],
          "display_name": false
        },
        {
          "uuid": "975d4a30-477d-41e1-b5d5-9bed5d5da03c",
          "name": "NSC-227243",
          "stdName": "NSC-227243",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "58853ac3-44d8-4eae-a4e0-dacce583a482",
            "28a494c2-cae3-4bee-9bf5-594400f45349"
          ],
          "display_name": false
        },
        {
          "uuid": "fa919470-14b3-471c-a9a2-02176baba5b5",
          "name": "SODIUM METABISULFITE",
          "stdName": "SODIUM METABISULFITE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0a40e619-21f5-4159-a18f-b209b1ea9c40",
            "8feb0ff2-5654-4685-ad17-45dd2ac45567",
            "8611cf4d-3020-46f6-a37e-a910bf246564",
            "2b992980-3ecd-48fb-b066-ef824ca1ccf1",
            "58853ac3-44d8-4eae-a4e0-dacce583a482",
            "a9157d3b-8f96-4cc1-b27d-099c6ba3a9c8",
            "6c4d8fef-30c9-4fc1-b568-ca0554cab854",
            "45c3eac8-0292-4236-a4b3-69c1003a2a3c",
            "25e11a21-dbd5-4876-88e8-1c8c2febcbd0",
            "f009dc7a-76c3-4567-8af0-31f4b926a6f3",
            "384ec037-9e00-4299-80da-b89404961c03",
            "9e4f5f4a-5452-4e5c-b056-fd24944afd76",
            "28e51ca0-aeeb-4a8c-8dd0-578645b8c2d7",
            "ed7a5302-ed09-43b2-a5ea-a0b348e34bc2",
            "e38cd190-9a94-43c3-a0a2-88de70062204",
            "73de2673-3671-40ac-9e7d-9b669b1de304",
            "f84a9911-ba13-42e5-a1f8-9dce0bbbeee1",
            "4d65454e-5699-4b3d-88ec-4bf22ec23f5e",
            "4c629902-4af8-40e0-aa5f-2e251e7322b5",
            "a390b67e-a8fb-4866-8da4-d0eca04370de",
            "df09e973-a642-4e86-b988-200c6ebbbc5d"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "500a32af-68df-4c98-9fd3-66ce949b2cc3",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "eac9b5a5-4cab-4524-9182-f80624cb5e81",
          "name": "SODIUM METABISULFITE (E 223)",
          "stdName": "SODIUM METABISULFITE (E 223)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acb7870b-7f04-4f4c-967c-d4b34d6907c9",
            "58853ac3-44d8-4eae-a4e0-dacce583a482"
          ],
          "display_name": false
        },
        {
          "uuid": "d3184835-f066-9325-62cc-8d5c2920cf6b",
          "name": "SODIUM METABISULFITE [EP MONOGRAPH]",
          "stdName": "SODIUM METABISULFITE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f013b933-a612-0af3-1a3b-9fbcd5c88903"
          ],
          "display_name": false
        },
        {
          "uuid": "d7e26009-8f5b-4b2a-9c52-dc2ad1c4f5e8",
          "name": "SODIUM METABISULFITE [FCC]",
          "stdName": "SODIUM METABISULFITE [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "45c3eac8-0292-4236-a4b3-69c1003a2a3c",
            "58853ac3-44d8-4eae-a4e0-dacce583a482"
          ],
          "display_name": false
        },
        {
          "uuid": "84cd6668-9444-4eab-b308-a9032f313710",
          "name": "SODIUM METABISULFITE [HSDB]",
          "stdName": "SODIUM METABISULFITE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25e11a21-dbd5-4876-88e8-1c8c2febcbd0",
            "58853ac3-44d8-4eae-a4e0-dacce583a482"
          ],
          "display_name": false
        },
        {
          "uuid": "1fc9bf22-91ca-4c9d-bdd3-4198cd604935",
          "name": "SODIUM METABISULFITE [II]",
          "stdName": "SODIUM METABISULFITE [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "73de2673-3671-40ac-9e7d-9b669b1de304"
          ],
          "display_name": false
        },
        {
          "uuid": "6268a06c-76c9-4664-a494-29e03a957a19",
          "name": "SODIUM METABISULFITE [MART.]",
          "stdName": "SODIUM METABISULFITE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b992980-3ecd-48fb-b066-ef824ca1ccf1"
          ],
          "display_name": false
        },
        {
          "uuid": "84065286-6640-4fa2-a306-46b61014f47f",
          "name": "SODIUM METABISULFITE [MI]",
          "stdName": "SODIUM METABISULFITE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8611cf4d-3020-46f6-a37e-a910bf246564",
            "58853ac3-44d8-4eae-a4e0-dacce583a482"
          ],
          "display_name": false
        },
        {
          "uuid": "c0e31185-ce92-4fea-9b5a-b1fcdcd6f9f4",
          "name": "SODIUM METABISULFITE [USP-RS]",
          "stdName": "SODIUM METABISULFITE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8feb0ff2-5654-4685-ad17-45dd2ac45567",
            "58853ac3-44d8-4eae-a4e0-dacce583a482"
          ],
          "display_name": false
        },
        {
          "uuid": "67f3df73-4ca6-4a12-8212-6eca0d3f6a3e",
          "name": "SODIUM METABISULFITE [VANDF]",
          "stdName": "SODIUM METABISULFITE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "58853ac3-44d8-4eae-a4e0-dacce583a482",
            "df09e973-a642-4e86-b988-200c6ebbbc5d"
          ],
          "display_name": false
        },
        {
          "uuid": "2ab68a75-80d0-425d-9c8e-2e8f671b38a0",
          "name": "SODIUM METABISULPHITE",
          "stdName": "SODIUM METABISULPHITE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd1cbb15-e15f-488e-8715-dead1085cc96",
            "58853ac3-44d8-4eae-a4e0-dacce583a482"
          ],
          "display_name": false
        },
        {
          "uuid": "62c2ea8d-4564-4ab0-8f22-45b1d8af5245",
          "name": "SODIUM PYROSULFITE",
          "stdName": "SODIUM PYROSULFITE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc8856db-8b6a-4f60-bbfb-a441f6aaa3f3"
          ],
          "display_name": false
        },
        {
          "uuid": "4b8f4c51-7267-4b36-abb4-dfbe9fc6b825",
          "name": "SODIUM PYROSULFITE [JAN]",
          "stdName": "SODIUM PYROSULFITE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b16dffb-765c-39cc-336e-4d326a7599dc"
          ],
          "display_name": false
        },
        {
          "uuid": "4c8a0c20-7924-41d0-b0fd-454e76cf4e0d",
          "name": "SODIUM PYROSULPHITE",
          "stdName": "SODIUM PYROSULPHITE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc8856db-8b6a-4f60-bbfb-a441f6aaa3f3"
          ],
          "display_name": false
        },
        {
          "uuid": "06972c26-f4d1-8ca8-0580-235280775d76",
          "name": "Sodium metabisulfite [WHO-DD]",
          "stdName": "SODIUM METABISULFITE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8fa07393-b08b-ac40-317e-c3a998de3ec4"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "73de2673-3671-40ac-9e7d-9b669b1de304",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ce30c58a-3352-4f76-8fcd-6335e2879121",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc8856db-8b6a-4f60-bbfb-a441f6aaa3f3",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bd1cbb15-e15f-488e-8715-dead1085cc96",
          "citation": "EMA LIST",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "58853ac3-44d8-4eae-a4e0-dacce583a482",
          "citation": "EMA LIST",
          "doc_type": "EMA LIST",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a390b67e-a8fb-4866-8da4-d0eca04370de",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2b992980-3ecd-48fb-b066-ef824ca1ccf1",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "28e51ca0-aeeb-4a8c-8dd0-578645b8c2d7",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "45c3eac8-0292-4236-a4b3-69c1003a2a3c",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "25e11a21-dbd5-4876-88e8-1c8c2febcbd0",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8feb0ff2-5654-4685-ad17-45dd2ac45567",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "384ec037-9e00-4299-80da-b89404961c03",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "df09e973-a642-4e86-b988-200c6ebbbc5d",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "acb7870b-7f04-4f4c-967c-d4b34d6907c9",
          "citation": "SWISS MEDIC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "28a494c2-cae3-4bee-9bf5-594400f45349",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aae20222-6a53-4a0a-a510-20bdd5e845fd",
          "citation": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=222",
          "url": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=222",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8611cf4d-3020-46f6-a37e-a910bf246564",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "406ff29f-3a10-4439-8059-38b6bcf63d48",
          "citation": "http://www.fao.org/ag/agn/jecfa-additives/specs/Monograph1/Additive-414.pdf",
          "url": "http://www.fao.org/ag/agn/jecfa-additives/specs/Monograph1/Additive-414.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b54a165d-8ad0-4e6e-9aac-8f1443c78304",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390721000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "481754d6-7a67-476a-99ee-933f76991f2a",
          "citation": "SRS import [4VON5FNS3C]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4VON5FNS3C",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390721000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe4c7589-2740-4d1e-9624-98fcdefe0d88",
          "citation": "ChemIDplus 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4c629902-4af8-40e0-aa5f-2e251e7322b5",
          "citation": "SODIUM METABISULFITE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9e4f5f4a-5452-4e5c-b056-fd24944afd76",
          "citation": "SODIUM METABISULFITE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6c4d8fef-30c9-4fc1-b568-ca0554cab854",
          "citation": "SODIUM METABISULFITE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0a40e619-21f5-4159-a18f-b209b1ea9c40",
          "citation": "SODIUM METABISULFITE [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4d65454e-5699-4b3d-88ec-4bf22ec23f5e",
          "citation": "SODIUM METABISULFITE [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a9157d3b-8f96-4cc1-b27d-099c6ba3a9c8",
          "citation": "SODIUM METABISULFITE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f009dc7a-76c3-4567-8af0-31f4b926a6f3",
          "citation": "SODIUM METABISULFITE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ed7a5302-ed09-43b2-a5ea-a0b348e34bc2",
          "citation": "SODIUM METABISULFITE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e38cd190-9a94-43c3-a0a2-88de70062204",
          "citation": "SODIUM METABISULFITE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f84a9911-ba13-42e5-a1f8-9dce0bbbeee1",
          "citation": "SODIUM METABISULFITE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9b16dffb-765c-39cc-336e-4d326a7599dc",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2f128f13-90d4-85a4-b5b2-bd298aee2ab9",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+7681-57-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a8e7bcce-de7a-16b3-26e5-c20afd27ac8a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=7681-57-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "24cedaf9-806f-1415-1092-34be102f21ee",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "2be301fc-538e-6ee4-a35e-0ea161999ec7",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7427e307-ea5a-db71-d62f-e178a20f31cd",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "ab2a7502-14a6-41d5-9ec7-4daeb7e4a4d2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f013b933-a612-0af3-1a3b-9fbcd5c88903",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "56d7d5f4-da45-7621-4c8a-0b75ce02b914",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "8fa07393-b08b-ac40-317e-c3a998de3ec4",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "84d01cfb-8312-837f-a4d2-fb38e541b910",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e6c0c102-995b-46d5-b7a5-afa2729264c7",
          "id": "e6c0c102-995b-46d5-b7a5-afa2729264c7",
          "molfile": "\n  Marvin  01132111572D          \n\n  1  0  0  0  0  0            999 V2000\n    4.9474    0.2991    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "52ca310b-08be-44c1-9c70-ffd736016c16"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "31453c86-4c89-425d-a96d-b73ad088a6f2",
          "id": "31453c86-4c89-425d-a96d-b73ad088a6f2",
          "molfile": "\n  Marvin  01132102382D          \n\n  7  6  0  0  0  0            999 V2000\n    0.9267   -0.3716    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    1.4989    0.4388    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0987    1.1550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3186    0.4278    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1436    0.4193    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.3102   -0.3972    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3271    1.2527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  6  2  0  0  0  0\n  7  4  2  0  0  0  0\nM  CHG  2   1  -1   5  -1\nM  END",
          "smiles": "O=S([O-])S(=O)(=O)[O-]",
          "formula": "O5S2",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4adc568b-c961-4b4e-ac12-39087c83c9ad"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "144.1292",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a275e8f0-1e88-415a-85aa-388d28330046",
      "version": "26",
      "structure": {
        "id": "1b4e699a-ba8e-4173-b537-25369e165a98",
        "molfile": "\n  Marvin  01132101362D          \n\n  9  6  0  0  0  0            999 V2000\n    4.9474    0.2991    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n    1.4989    0.4388    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9267   -0.3716    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    1.0987    1.1550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3102   -0.3972    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3186    0.4278    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1436    0.4193    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.3271    1.2527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9474    0.2991    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  6  2  0  0  0  0\n  2  6  1  0  0  0  0\nM  CHG  4   1   1   3  -1   7  -1   9   1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  2   1   9\nM  SPA   1  1   1\nM  SDI   1  4    4.5274   -0.1209    4.5274    0.7191\nM  SDI   1  4    5.3674    0.7191    5.3674   -0.1209\nM  SMT   1 2\nM  END",
        "smiles": "[Na+].[Na+].O=S([O-])S(=O)(=O)[O-]",
        "formula": "2Na.O5S2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "190.1087",
        "optical_activity": "NONE",
        "references": [
          "fe4c7589-2740-4d1e-9624-98fcdefe0d88",
          "481754d6-7a67-476a-99ee-933f76991f2a"
        ],
        "stereo_centers": 0
      },
      "unii": "4VON5FNS3C"
    }
  ]
}