{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8a86f4cc-fe21-432f-ba97-63bff39e9e88",
          "code": "1708-36-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1708-36-7",
          "code_system": "CAS",
          "references": [
            "f2287736-1081-4256-9fb8-acf8462d5a23",
            "8cd7efac-a8d5-4f22-960f-f9eb8f53962e"
          ]
        },
        {
          "uuid": "968ce419-4205-44aa-a034-2ff9b0260012",
          "code": "216-961-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.015.419",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f2287736-1081-4256-9fb8-acf8462d5a23"
          ]
        },
        {
          "uuid": "e80a4b2b-5e11-49fa-849c-be486f78bef3",
          "code": "74361",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/74361",
          "code_system": "PUBCHEM",
          "references": [
            "f2287736-1081-4256-9fb8-acf8462d5a23"
          ]
        },
        {
          "uuid": "a5b9a8da-fe29-a253-e273-b3ddf8bd9ee7",
          "code": "DTXSID8061898",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8061898",
          "code_system": "EPA CompTox",
          "references": [
            "d7398da1-a28b-d5a5-1378-1045a5eeb96b"
          ]
        },
        {
          "uuid": "ff1161ad-9df0-46d4-81ea-8e1238d2980a",
          "code": "4VH761HOSR",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c883ccaf-2184-4459-9d94-63d071ab8e54",
          "name": "1,3-DIOXAN-5-OL, 2-HEXYL-",
          "stdName": "1,3-DIOXAN-5-OL, 2-HEXYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1471ed27-e957-4e95-9fe0-f2b16bba4da4",
            "519eac3f-932e-4063-8e9b-e02c64a6b352"
          ],
          "display_name": false
        },
        {
          "uuid": "cbb56b55-f1cf-43dd-b29d-c0278b126727",
          "name": "FEMA NO. 2542, 1,3-ACETAL",
          "stdName": "FEMA NO. 2542, 1,3-ACETAL",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1471ed27-e957-4e95-9fe0-f2b16bba4da4",
            "75812043-fb1c-4be7-a99c-22e4f19be3f4"
          ],
          "display_name": false
        },
        {
          "uuid": "09cad966-69e4-45dc-839b-f7a60a65532c",
          "name": "HEPTANAL 1,3-GLYCERYL ACETAL",
          "stdName": "HEPTANAL 1,3-GLYCERYL ACETAL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f5f1e20-18c2-4505-8f2d-3867d7c1b42f"
          ],
          "display_name": true
        },
        {
          "uuid": "8caad554-84db-43d2-b8fd-92cd8504ceb0",
          "name": "HEPTANAL, CYCLIC 2-HYDROXYTRIMETHYLENE ACETAL",
          "stdName": "HEPTANAL, CYCLIC 2-HYDROXYTRIMETHYLENE ACETAL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1471ed27-e957-4e95-9fe0-f2b16bba4da4",
            "519eac3f-932e-4063-8e9b-e02c64a6b352"
          ],
          "display_name": false
        },
        {
          "uuid": "e60973c4-dcbc-4f75-a43f-d3c1cbbcba72",
          "name": "M-DIOXAN-5-OL, 2-HEXYL-",
          "stdName": "M-DIOXAN-5-OL, 2-HEXYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1471ed27-e957-4e95-9fe0-f2b16bba4da4",
            "519eac3f-932e-4063-8e9b-e02c64a6b352"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4f5f1e20-18c2-4505-8f2d-3867d7c1b42f",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "519eac3f-932e-4063-8e9b-e02c64a6b352",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1471ed27-e957-4e95-9fe0-f2b16bba4da4",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "75812043-fb1c-4be7-a99c-22e4f19be3f4",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f2287736-1081-4256-9fb8-acf8462d5a23",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391769000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "544dbc93-61bd-44c4-8d7a-63608cd2d0a8",
          "citation": "SRS import [4VH761HOSR]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4VH761HOSR",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391769000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a858c628-dae5-4d04-bdeb-67889107f3d2",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d7398da1-a28b-d5a5-1378-1045a5eeb96b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1708-36-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8cd7efac-a8d5-4f22-960f-f9eb8f53962e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "79f50181-6a31-4280-a0fe-4a12d4c962f2",
          "id": "79f50181-6a31-4280-a0fe-4a12d4c962f2",
          "molfile": "\n  Marvin  01132106202D          \n\n 13 13  0  0  0  0            999 V2000\n    9.3024   -4.2824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5915   -4.7009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8814   -4.2846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1654   -4.7029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4605   -4.2867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7490   -4.7051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0380   -4.2867    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.3214   -4.7041    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6170   -4.2867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6170   -3.4520    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.9043   -3.0361    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3214   -3.0345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0380   -3.4520    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  1  0  0  0\n  8  7  1  0  0  0  0\n  7 13  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  6  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\nM  END",
          "smiles": "CCCCCC[C@H]1OC[C@@H](CO1)O",
          "formula": "C10H20O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bcff5ec6-4819-49c8-b20f-8e3fe959cc51"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "188.2644",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "28cbfbbd-64a6-4b0e-8256-ee3d05bd8567",
      "version": "3",
      "structure": {
        "id": "19117b49-a071-42d9-bf37-56685420b3ff",
        "molfile": "\n  Marvin  01132101292D          \n\n 13 13  0  0  1  0            999 V2000\n    5.0380   -3.4520    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3214   -3.0345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6170   -3.4520    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.9043   -3.0361    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6170   -4.2867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3214   -4.7041    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0380   -4.2867    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.7490   -4.7051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4605   -4.2867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1654   -4.7029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8814   -4.2846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5915   -4.7009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3024   -4.2824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  6  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  1  1  0  0  0  0\n  7  8  1  1  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\nM  END",
        "smiles": "CCCCCC[C@H]1OC[C@@H](CO1)O",
        "formula": "C10H20O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "188.2644",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "a858c628-dae5-4d04-bdeb-67889107f3d2",
          "544dbc93-61bd-44c4-8d7a-63608cd2d0a8"
        ],
        "stereo_centers": 0
      },
      "unii": "4VH761HOSR"
    }
  ]
}