{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "89279bcb-0116-450d-9aa4-2cdb686b9fd3", "code": "19870-74-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=19870-74-7", "code_system": "CAS", "references": [ "beafc4d5-7368-1129-eae6-6bafe1fc42fb" ] }, { "uuid": "4cbe58f8-54b2-c763-b148-5e848d37d1c7", "code": "88288", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/88288", "code_system": "PUBCHEM", "references": [ "27c15641-d47d-d5db-52b3-2ffd50114da0" ] }, { "uuid": "2b735307-59db-4dbf-aed1-5b7d03fc5d4a", "code": "4V8VL42TUG", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "3e1b3a90-9165-8f5c-c168-3e88fa6605a7", "code": "DTXSID3051838", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3051838", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "d3dc1012-fbaf-b874-582e-b67dc989520e", "name": "(3R,3AS,6S,7R,8AS)-OCTAHYDRO-6-METHOXY-3,6,8,8-TETRAMETHYL-1H-3A,7-METHANOAZULENE", "stdName": "(3R,3AS,6S,7R,8AS)-OCTAHYDRO-6-METHOXY-3,6,8,8-TETRAMETHYL-1H-3A,7-METHANOAZULENE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "beafc4d5-7368-1129-eae6-6bafe1fc42fb" ], "display_name": false }, { "uuid": "c9b371ba-5870-dd3e-7d23-77b587344f71", "name": "1H-3A,7-METHANOAZULENE, OCTAHYDRO-6-METHOXY-3,6,8,8-TETRAMETHYL-, (3R,3AS,6S,7R,8AS)-", "stdName": "1H-3A,7-METHANOAZULENE, OCTAHYDRO-6-METHOXY-3,6,8,8-TETRAMETHYL-, (3R,3AS,6S,7R,8AS)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "beafc4d5-7368-1129-eae6-6bafe1fc42fb" ], "display_name": false }, { "uuid": "52f4bfe9-a840-931d-1494-3564f47ad2ec", "name": "8-METHOXYCEDRANE", "stdName": "8-METHOXYCEDRANE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "beafc4d5-7368-1129-eae6-6bafe1fc42fb" ], "display_name": true }, { "uuid": "4d994160-c6ae-d0d0-b622-12ccd9acebc4", "name": "CEDRANE, 8-METHOXY-", "stdName": "CEDRANE, 8-METHOXY-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "beafc4d5-7368-1129-eae6-6bafe1fc42fb" ], "display_name": false }, { "uuid": "112f1165-df5d-dc94-6479-f77c094c67df", "name": "CEDROL METHYL ETHER", "stdName": "CEDROL METHYL ETHER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "beafc4d5-7368-1129-eae6-6bafe1fc42fb" ], "display_name": false } ], "references": [ { "uuid": "27c15641-d47d-d5db-52b3-2ffd50114da0", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "beafc4d5-7368-1129-eae6-6bafe1fc42fb", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "76d627a7-0119-fb85-89ad-6e8f9b4c7322", "id": "76d627a7-0119-fb85-89ad-6e8f9b4c7322", "molfile": "\n Marvin 01132106102D \n\n 18 20 0 0 1 0 999 V2000\n 17.5420 -5.3073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0721 -4.6292 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 16.2473 -4.6107 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 16.0099 -3.8206 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 16.6880 -3.3507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3445 -3.8504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2441 -3.5136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5266 -3.9208 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 15.1878 -4.7624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3977 -4.7357 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.9544 -5.3446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7775 -5.2890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6319 -4.4286 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9831 -4.9382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9280 -5.4138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6875 -2.9048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3865 -2.7262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0920 -2.9790 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 1 0 0 0\n 2 3 1 0 0 0 0\n 2 6 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 9 1 0 0 0 0\n 3 12 1 1 0 0 0\n 4 5 1 0 0 0 0\n 4 7 1 0 0 0 0\n 4 18 1 1 0 0 0\n 6 5 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 16 1 0 0 0 0\n 7 17 1 0 0 0 0\n 8 9 1 6 0 0 0\n 8 10 1 0 0 0 0\n 11 10 1 0 0 0 0\n 10 13 1 6 0 0 0\n 10 15 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 14 1 0 0 0 0\nM END", "smiles": "C[C@@H]1CC[C@@]2([H])C(C)(C)[C@H]3C[C@@]12CC[C@]3(C)OC", "formula": "C16H28O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "3c980033-acf0-4399-ab24-ed5f2b98a0e6" }, "defined_stereo": 5, "ez_centers": 0, "molecular_weight": "236.3935", "optical_activity": "UNSPECIFIED", "stereo_centers": 5 } ], "definition_level": "COMPLETE", "uuid": "e7feceae-cc3a-4d7f-8238-3c2cecfab1f6", "version": "7", "structure": { "id": "9411f955-4744-3d26-68de-603473f0388f", "molfile": "1H-3a,7-Methanoazulene, octahydro-6-methoxy-3,6,8,8-tetramethyl-, (3R,3aS,6S,...\n Marvin 01132107412D \n\n 18 20 0 0 1 0 999 V2000\n 17.5420 -5.3073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0721 -4.6292 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 16.2473 -4.6107 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 16.0099 -3.8206 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 16.6880 -3.3507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3445 -3.8504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2441 -3.5136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5266 -3.9208 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 15.1878 -4.7624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3977 -4.7357 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.9544 -5.3446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7775 -5.2890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6319 -4.4286 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9831 -4.9382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9280 -5.4138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6875 -2.9048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3865 -2.7262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0920 -2.9790 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 1 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 1 0 0 0 0\n 2 6 1 0 0 0 0\n 4 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 6 0 0 0\n 3 9 1 0 0 0 0\n 8 10 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 3 12 1 1 0 0 0\n 10 13 1 6 0 0 0\n 13 14 1 0 0 0 0\n 10 15 1 0 0 0 0\n 7 16 1 0 0 0 0\n 7 17 1 0 0 0 0\n 4 18 1 1 0 0 0\nM END", "smiles": "C[C@@H]1CC[C@@]2([H])C(C)(C)[C@H]3C[C@@]12CC[C@]3(C)OC", "formula": "C16H28O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 5, "ez_centers": 0, "molecular_weight": "236.3935", "optical_activity": "UNSPECIFIED", "references": [ "beafc4d5-7368-1129-eae6-6bafe1fc42fb" ], "stereo_centers": 5 }, "unii": "4V8VL42TUG" } ] }