{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1b4e19e9-6ba3-474a-918d-f9a329906128",
          "code": "172201-58-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=172201-58-0",
          "code_system": "CAS",
          "references": [
            "35cdf71c-ad94-482c-9aef-7fcd4b59aa29",
            "ce01497a-a262-47fa-8b14-7f63a763ebcf"
          ]
        },
        {
          "uuid": "c95b141a-14fe-495a-adb3-d12940b2ad9a",
          "code": "71587572",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587572",
          "code_system": "PUBCHEM",
          "references": [
            "35cdf71c-ad94-482c-9aef-7fcd4b59aa29"
          ]
        },
        {
          "uuid": "4a8131f9-0728-4a6d-a0fb-a15509ff4bdc",
          "code": "4V5ZZL5UWI",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "67af51f5-dbca-abb7-f459-2c610909c5ae",
          "code": "DTXSID80938099",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80938099",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "acbe3aa8-da0c-404a-a572-ad39ce00623d",
          "name": "(2,2-DIMETHYL-1,3-DIOXOLAN-4-YL)METHYL 5-HYDROXYDECANOATE",
          "stdName": "(2,2-DIMETHYL-1,3-DIOXOLAN-4-YL)METHYL 5-HYDROXYDECANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ff07c4a-29a8-46b3-afc5-306136e74f52",
            "61a6dcae-a1bc-447b-84dc-9e3ce7e6a805"
          ],
          "display_name": true
        },
        {
          "uuid": "90e041a7-e0c5-4c07-9de7-17cea35daaf4",
          "name": "(2,2-DIMETHYL-1,3-DIOXOLAN-4-YL)METHYL 5-HYDROXYDECANOATE, (±)-",
          "stdName": "(2,2-DIMETHYL-1,3-DIOXOLAN-4-YL)METHYL 5-HYDROXYDECANOATE, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ff07c4a-29a8-46b3-afc5-306136e74f52",
            "61a6dcae-a1bc-447b-84dc-9e3ce7e6a805"
          ],
          "display_name": false
        },
        {
          "uuid": "1987433e-a2c2-43d3-bc2a-2fbcb1ba4e3c",
          "name": "(±)-2,2-DIMETHYL-1,3-DIOXOLAN-4-YL)METHYL 5-HYDROXYDECANOATE",
          "stdName": "(+/-)-2,2-DIMETHYL-1,3-DIOXOLAN-4-YL)METHYL 5-HYDROXYDECANOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ff07c4a-29a8-46b3-afc5-306136e74f52",
            "61a6dcae-a1bc-447b-84dc-9e3ce7e6a805"
          ],
          "display_name": false
        },
        {
          "uuid": "2ac12698-d93e-47c1-943b-4543918326cc",
          "name": "DECANOIC ACID, 5-HYDROXY-, (2,2-DIMETHYL-1,3-DIOXOLAN-4-YL)METHYL ESTER",
          "stdName": "DECANOIC ACID, 5-HYDROXY-, (2,2-DIMETHYL-1,3-DIOXOLAN-4-YL)METHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7047f7a-5700-40da-a44d-0a55f04f7fa9",
            "61a6dcae-a1bc-447b-84dc-9e3ce7e6a805"
          ],
          "display_name": false
        },
        {
          "uuid": "c5082842-149c-4de5-a2f2-85bd132a3133",
          "name": "FEMA NO. 4611, 2,2-DIMETHYL-1,3-DIOXOLAN-4-YL)METHYL 5-HYDROXYDECANOATE-",
          "stdName": "FEMA NO. 4611, 2,2-DIMETHYL-1,3-DIOXOLAN-4-YL)METHYL 5-HYDROXYDECANOATE-",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61a6dcae-a1bc-447b-84dc-9e3ce7e6a805",
            "36f35e15-d184-4f38-bda7-318a2740cb87"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6ff07c4a-29a8-46b3-afc5-306136e74f52",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "61a6dcae-a1bc-447b-84dc-9e3ce7e6a805",
          "citation": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "doc_type": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d7047f7a-5700-40da-a44d-0a55f04f7fa9",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "36f35e15-d184-4f38-bda7-318a2740cb87",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35cdf71c-ad94-482c-9aef-7fcd4b59aa29",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391425000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d82d920a-998c-42e1-a8e6-ce7126a17b59",
          "citation": "SRS import [4V5ZZL5UWI]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4V5ZZL5UWI",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391425000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce01497a-a262-47fa-8b14-7f63a763ebcf",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "315c785e-e693-49e0-8541-20165efcdc55",
          "id": "315c785e-e693-49e0-8541-20165efcdc55",
          "molfile": "\n  Marvin  01132102392D          \n\n 21 21  0  0  0  0            999 V2000\n   13.1418   -4.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4273   -4.4539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7128   -4.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9984   -4.4539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2839   -4.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5694   -4.4539    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    9.5694   -3.6289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8550   -4.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1406   -4.4539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4261   -4.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7117   -4.4539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7117   -3.6289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9972   -4.8664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2827   -4.4539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5683   -4.8664    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.4821   -5.6868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6751   -5.8584    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2627   -5.1439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7107   -4.5308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5952   -5.6288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8147   -4.5308    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 11  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 21 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 18 21  1  0  0  0  0\nM  END",
          "smiles": "CCCCCC(CCCC(=O)OCC1COC(C)(C)O1)O",
          "formula": "C16H30O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "14c79a3f-0f16-4077-9941-49302210cbf5"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "302.407",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0b23b14f-aec9-464f-9c8e-4c6537f8e069",
      "version": "3",
      "structure": {
        "id": "a2b6c3d1-2d6b-4855-b23b-750e9fd5c3d1",
        "molfile": "\n  Marvin  01132108272D          \n\n 21 21  0  0  0  0            999 V2000\n    3.6751   -5.8584    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2627   -5.1439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8147   -4.5308    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5683   -4.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4821   -5.6868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7107   -4.5308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5952   -5.6288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2827   -4.4539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9972   -4.8664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7117   -4.4539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4261   -4.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1406   -4.4539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8550   -4.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5694   -4.4539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2839   -4.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9984   -4.4539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7128   -4.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4273   -4.4539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1418   -4.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7117   -3.6289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5694   -3.6289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  1  1  0  0  0  0\n  2  6  1  0  0  0  0\n  2  7  1  0  0  0  0\n  4  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 10 20  2  0  0  0  0\n 14 21  1  0  0  0  0\nM  END",
        "smiles": "CCCCCC(CCCC(=O)OCC1COC(C)(C)O1)O",
        "formula": "C16H30O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "302.407",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "d7047f7a-5700-40da-a44d-0a55f04f7fa9",
          "d82d920a-998c-42e1-a8e6-ce7126a17b59"
        ],
        "stereo_centers": 2
      },
      "unii": "4V5ZZL5UWI"
    }
  ]
}