{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "105ae315-3ec8-4cac-b286-df61fa61fdc3",
          "code": "3609-96-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3609-96-9",
          "code_system": "CAS",
          "references": [
            "0c051983-b1da-4b49-8511-e75f6d52a59f",
            "b134b882-a056-49b9-9887-49897a98accd"
          ]
        },
        {
          "uuid": "bc207c24-bd3b-4a47-899a-634b73007c7d",
          "code": "7778-49-6",
          "type": "NON-SPECIFIC STOICHIOMETRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7778-49-6",
          "code_system": "CAS",
          "references": [
            "0c051983-b1da-4b49-8511-e75f6d52a59f",
            "f942b246-dfa8-485a-a13a-9af0bbe4e5a6"
          ]
        },
        {
          "uuid": "145472fb-c377-4847-87c2-98d37a686387",
          "code": "SUB91629",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "0c051983-b1da-4b49-8511-e75f6d52a59f"
          ]
        },
        {
          "uuid": "4e487eaf-3414-4642-b288-cad727d49271",
          "code": "222-775-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.020.705",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "0c051983-b1da-4b49-8511-e75f6d52a59f"
          ]
        },
        {
          "uuid": "1ece6261-413d-1198-0e1b-c4718d91a17f",
          "code": "145702",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/145702",
          "code_system": "PUBCHEM",
          "references": [
            "58662006-5e0e-b34a-58bf-6c8ba6eeaadb"
          ]
        },
        {
          "uuid": "52057410-ada4-4494-b182-c01beef15ff1",
          "code": "4UQD42S065",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ecb69f69-2b25-fd54-fd66-cdf3678f59d3",
          "code": "100000141349",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "ef550f1b-895f-480d-16f0-82cf05282baa"
          ]
        },
        {
          "uuid": "99688f76-761b-20d5-8e5d-5fec958e6ff7",
          "code": "DTXSID5041221",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5041221",
          "code_system": "EPA CompTox",
          "references": [
            "961941d9-7475-eb7f-16dc-c5277fe2b8cd"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "92bbb715-132b-4895-a171-77a14eff8227",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "ba06288f-0abb-4e80-b647-db936fe81e14",
            "refuuid": "7495c063-0afe-4404-b6dc-1327ce06fa4e",
            "name": "Anhydrous citric acid",
            "unii": "XF417D3PSL",
            "linking_id": "XF417D3PSL",
            "ref_pname": "Anhydrous citric acid",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c201b8c7-00a2-46d1-8fe9-eb2bce8ecdf5",
          "name": "1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, DIPOTASSIUM SALT",
          "stdName": "1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, DIPOTASSIUM SALT",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f97fe96b-60f7-4d9f-a503-87687285d1e9"
          ],
          "display_name": false
        },
        {
          "uuid": "54c95dd1-6d59-42d7-9ee2-73e748a8c4d6",
          "name": "1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, POTASSIUM SALT (1:2)",
          "stdName": "1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, POTASSIUM SALT (1:2)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f97fe96b-60f7-4d9f-a503-87687285d1e9"
          ],
          "display_name": false
        },
        {
          "uuid": "0cfa2600-fcaa-4ef1-a606-a63c10acf4f3",
          "name": "ANHYDROUS DIPOTASSIUM CITRATE",
          "stdName": "ANHYDROUS DIPOTASSIUM CITRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9dfb5cea-db3d-40ba-8ba9-63f36d75fccd"
          ],
          "display_name": false
        },
        {
          "uuid": "a85c4133-6e84-4a62-8395-5f5303c11a11",
          "name": "DIPOTASSIUM CITRATE",
          "stdName": "DIPOTASSIUM CITRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6b6b9dd-7e37-445f-b522-e46ddf2c329b"
          ],
          "display_name": false
        },
        {
          "uuid": "51983f9f-1634-492a-bde3-45dc3b094eec",
          "name": "DIPOTASSIUM HYDROGEN CITRATE",
          "stdName": "DIPOTASSIUM HYDROGEN CITRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2187b5d-938b-43f0-a65f-2674f1326083"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "e6b6b9dd-7e37-445f-b522-e46ddf2c329b",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c2187b5d-938b-43f0-a65f-2674f1326083",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f97fe96b-60f7-4d9f-a503-87687285d1e9",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9dfb5cea-db3d-40ba-8ba9-63f36d75fccd",
          "citation": "EVMPD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0c051983-b1da-4b49-8511-e75f6d52a59f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391083000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cce448f0-6603-4d89-bbb3-ec451411144c",
          "citation": "SRS import [4UQD42S065]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4UQD42S065",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391083000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "edcb9a94-65a0-4420-9c82-0a1bf75356f6",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dc6cbef7-f4e3-e2f5-441b-34c71090e838",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=7778-49-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ef550f1b-895f-480d-16f0-82cf05282baa",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "58662006-5e0e-b34a-58bf-6c8ba6eeaadb",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "b134b882-a056-49b9-9887-49897a98accd",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f942b246-dfa8-485a-a13a-9af0bbe4e5a6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "961941d9-7475-eb7f-16dc-c5277fe2b8cd",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "92637171-cf30-45c7-b9ab-542bee848a25",
          "id": "92637171-cf30-45c7-b9ab-542bee848a25",
          "molfile": "\n  Marvin  01132107352D          \n\n 13 12  0  0  0  0            999 V2000\n   -0.8206    0.1602    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8206   -0.6602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1101   -1.0772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6049   -0.6602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6049   -1.4852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3108   -1.9021    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -0.1192   -1.8930    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6049    0.1602    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3154   -1.0772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0303   -0.6602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0303    0.1602    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7408   -1.0772    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -1.5355   -1.0772    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  2  3  1  0  0  0  0\n 13  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  8  1  0  0  0  0\n  4  9  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\nM  CHG  3   6  -1  12  -1  13  -1\nM  END",
          "smiles": "C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O",
          "formula": "C6H5O7",
          "atropisomerism": "No",
          "charge": -3,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e6423272-d41e-40f6-ad21-ee8f48c360c3"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "189.1",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "3886c4b8-e4fa-4684-a85f-b9db28ebc55e",
          "id": "3886c4b8-e4fa-4684-a85f-b9db28ebc55e",
          "molfile": "\n  Marvin  01132103002D          \n\n  1  0  0  0  0  0            999 V2000\n    4.9243    0.6168    0.0000 H   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "formula": "H",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "488be3f0-ddef-4042-9138-ef4c2097ee66"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "1.0079",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "91154e82-5a3d-4e30-a3db-8ebb7160ba33",
          "id": "91154e82-5a3d-4e30-a3db-8ebb7160ba33",
          "molfile": "\n  Marvin  01132107312D          \n\n  1  0  0  0  0  0            999 V2000\n    7.4587   -5.3443    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[K+]",
          "formula": "K",
          "atropisomerism": "No",
          "charge": 1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "e8d750c5-481c-460c-8c86-591d1b056916"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "39.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "45901c1c-f8ad-47aa-9045-b2be5d85c52e",
      "version": "7",
      "structure": {
        "id": "478e0ed9-4d36-4ca8-9c1f-ceedbf9e4634",
        "molfile": "\n  Marvin  01132103452D          \n\n 16 12  0  0  0  0            999 V2000\n   -0.8206    0.1602    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8206   -0.6602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1101   -1.0772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6049   -0.6602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6049   -1.4852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3108   -1.9021    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -0.1192   -1.8930    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6049    0.1602    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3154   -1.0772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0303   -0.6602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0303    0.1602    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7408   -1.0772    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -1.5355   -1.0772    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.9243    0.6168    0.0000 H   0  3  0  0  0  0  0  0  0  0  0  0\n    7.4587   -5.3443    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n    7.4587   -5.3443    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  2  0  0  0  0\n  4  8  1  0  0  0  0\n  4  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 13  2  1  0  0  0  0\n  2  1  2  0  0  0  0\nM  CHG  6   6  -1  12  -1  13  -1  14   1  15   1  16   1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  2  15  16\nM  SPA   1  1  15\nM  SDI   1  4    7.0387   -5.7643    7.0387   -4.9243\nM  SDI   1  4    7.8787   -4.9243    7.8787   -5.7643\nM  SMT   1 2\nM  END",
        "smiles": "C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.[K+].[K+].[H+]",
        "formula": "C6H5O7.2K.H",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "268.3045",
        "optical_activity": "NONE",
        "references": [
          "cce448f0-6603-4d89-bbb3-ec451411144c",
          "edcb9a94-65a0-4420-9c82-0a1bf75356f6"
        ],
        "stereo_centers": 0
      },
      "unii": "4UQD42S065"
    }
  ]
}