{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b7171ee3-edac-47bc-a6ca-bccce7ed0ffb",
          "code": "439685-79-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=439685-79-7",
          "code_system": "CAS",
          "references": [
            "e690b24e-754e-4866-963c-3e287827f944",
            "1959dbf8-5927-46db-90fd-103f07e65bac"
          ]
        },
        {
          "uuid": "f223e14d-9819-4be7-8937-04963bd7d1b1",
          "code": "1747475",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1747475/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "e690b24e-754e-4866-963c-3e287827f944"
          ]
        },
        {
          "uuid": "a920c29e-3881-4693-aab0-77a7175da04f",
          "code": "16666733",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16666733",
          "code_system": "PUBCHEM",
          "references": [
            "e690b24e-754e-4866-963c-3e287827f944"
          ]
        },
        {
          "uuid": "28a9e7a8-24cb-827f-e886-58b791986d35",
          "code": "DTXSID10196004",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10196004",
          "code_system": "EPA CompTox",
          "references": [
            "b4051d5e-a169-aebb-79d0-2568fa5d40f1"
          ]
        },
        {
          "uuid": "8e2b83ac-c7eb-329f-dee9-925bc60c8305",
          "code": "DB13121",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB13121",
          "code_system": "DRUG BANK",
          "references": [
            "229ae269-10eb-a7c3-39ff-521b67b8e71a"
          ]
        },
        {
          "uuid": "68419d65-46e0-4342-bd4d-71cffc07f302",
          "code": "4U3GMG1OT1",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9f4097f8-efef-098e-37e9-6d3742f1b8c9",
          "code": "4U3GMG1OT1",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=4U3GMG1OT1",
          "code_system": "DAILYMED",
          "references": [
            "fcc606a3-0f1c-8891-ea7a-af943ed8a4c5"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1bc7197b-cd75-4a2d-acea-2a2921c5042c",
          "name": "ER-4017",
          "stdName": "ER-4017",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09084079-d143-4ae0-8ad7-c310a666fe13",
            "02a9a7d4-06d9-4869-ad56-12080d445bf3"
          ],
          "display_name": false
        },
        {
          "uuid": "a04f04f1-51cb-4d47-8980-b960197459b3",
          "name": "ER4017",
          "stdName": "ER4017",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09084079-d143-4ae0-8ad7-c310a666fe13",
            "02a9a7d4-06d9-4869-ad56-12080d445bf3"
          ],
          "display_name": false
        },
        {
          "uuid": "97a4a101-b272-4004-addd-40b23ba38413",
          "name": "HYDROXYPROPYL TETRAHYDROPYRANTRIOL",
          "stdName": "HYDROXYPROPYL TETRAHYDROPYRANTRIOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b47ede37-2e65-418a-9bb7-2d2f8f57c7a1",
            "5e32efb2-6471-449b-974f-1f14f23a9465",
            "02a9a7d4-06d9-4869-ad56-12080d445bf3"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "6f5e6a60-0c13-400f-ab82-30ef874c7be8",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "e80e2409-0edd-422e-9692-5476c63f76fa",
          "name": "L-GLUCO-OCTITOL, 1,5-ANHYDRO-6,8-DIDEOXY-, (7.XI.)-",
          "stdName": "L-GLUCO-OCTITOL, 1,5-ANHYDRO-6,8-DIDEOXY-, (7.XI.)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "02a9a7d4-06d9-4869-ad56-12080d445bf3",
            "a41c1a25-dca1-48cf-98d6-fe925f61f5d0"
          ],
          "display_name": false
        },
        {
          "uuid": "ade436af-a59f-4bc6-b576-bcef6e3c2307",
          "name": "MEXORYL SBB",
          "stdName": "MEXORYL SBB",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e32efb2-6471-449b-974f-1f14f23a9465",
            "02a9a7d4-06d9-4869-ad56-12080d445bf3"
          ],
          "display_name": false
        },
        {
          "uuid": "bd6419b2-6c81-4484-8754-82c427725dba",
          "name": "PRO-XYLANE",
          "stdName": "PRO-XYLANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "02a9a7d4-06d9-4869-ad56-12080d445bf3",
            "a41c1a25-dca1-48cf-98d6-fe925f61f5d0"
          ],
          "display_name": false
        },
        {
          "uuid": "96aa05f1-ab9f-4e04-aa21-4cc1112349ed",
          "name": "PRO-XYLANE (PHARMACEUTICAL)",
          "stdName": "PRO-XYLANE (PHARMACEUTICAL)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "02a9a7d4-06d9-4869-ad56-12080d445bf3",
            "a41c1a25-dca1-48cf-98d6-fe925f61f5d0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5e32efb2-6471-449b-974f-1f14f23a9465",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "02a9a7d4-06d9-4869-ad56-12080d445bf3",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a41c1a25-dca1-48cf-98d6-fe925f61f5d0",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "09084079-d143-4ae0-8ad7-c310a666fe13",
          "citation": "CLINICAL TRIALS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e690b24e-754e-4866-963c-3e287827f944",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391648000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae8cc768-2380-493c-856f-1473168e6c4c",
          "citation": "SRS import [4U3GMG1OT1]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4U3GMG1OT1",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391648000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b47ede37-2e65-418a-9bb7-2d2f8f57c7a1",
          "citation": "HYDROXYPROPYL TETRAHYDROPYRANTRIOL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3c8e278e-35b7-9c30-d078-6a37b143f254",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=439685-79-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "229ae269-10eb-a7c3-39ff-521b67b8e71a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "1959dbf8-5927-46db-90fd-103f07e65bac",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "fcc606a3-0f1c-8891-ea7a-af943ed8a4c5",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "b4051d5e-a169-aebb-79d0-2568fa5d40f1",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ab597023-3fee-4cfb-ab93-d0875f63c6b2",
          "id": "ab597023-3fee-4cfb-ab93-d0875f63c6b2",
          "molfile": "\n  Marvin  01132108532D          \n\n 13 13  0  0  1  0            999 V2000\n    3.4547   -3.5602    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    2.7403   -3.1477    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1692   -3.1477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8836   -3.5602    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8836   -4.3852    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.5981   -4.7977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3125   -4.3852    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.0270   -4.7977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3125   -3.5603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1692   -4.7977    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.1692   -5.6227    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4547   -4.3852    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    2.7403   -4.7977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 12  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n 10  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n 10 11  1  6  0  0  0\n 12 10  1  0  0  0  0\n 12 13  1  1  0  0  0\nM  END",
          "smiles": "CC(C[C@H]1[C@@H]([C@H]([C@@H](CO1)O)O)O)O",
          "formula": "C8H16O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "EPIMERIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d23b6795-5782-45e6-90f8-baa6d83f604e"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "192.21",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d5ae5ba1-2005-4056-b723-5449085aac50",
      "version": "8",
      "structure": {
        "id": "9e5b74f9-e21a-48aa-b080-e2b6baf667ce",
        "molfile": "\n  Marvin  01132108142D          \n\n 13 13  0  0  1  0            999 V2000\n    3.4547   -3.5602    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.8836   -4.3852    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.1692   -4.7977    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.4547   -4.3852    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.1692   -3.1477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8836   -3.5602    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5981   -4.7977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3125   -4.3852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0270   -4.7977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3125   -3.5603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1692   -5.6227    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7403   -4.7977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7403   -3.1477    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  1  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  2  7  1  1  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  3 11  1  6  0  0  0\n  4 12  1  1  0  0  0\n  1 13  1  6  0  0  0\nM  END",
        "smiles": "CC(C[C@H]1[C@@H]([C@H]([C@@H](CO1)O)O)O)O",
        "formula": "C8H16O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "EPIMERIC",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "192.21",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "ae8cc768-2380-493c-856f-1473168e6c4c",
          "a41c1a25-dca1-48cf-98d6-fe925f61f5d0"
        ],
        "stereo_centers": 5
      },
      "unii": "4U3GMG1OT1"
    }
  ]
}