{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "135d14b3-8b62-4bf4-8a80-11c7f2b16024",
          "code": "7379-27-3",
          "type": "NON-SPECIFIC STOICHIOMETRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7379-27-3",
          "code_system": "CAS",
          "references": [
            "6eec33c2-7563-4241-8d07-ee8ef52c6078",
            "5ce7f089-b7f5-4dd0-8fa9-c385fcfe8989"
          ]
        },
        {
          "uuid": "64864a40-40ba-49bb-834f-4451a2e0b312",
          "code": "5964-35-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5964-35-2",
          "code_system": "CAS",
          "references": [
            "6eec33c2-7563-4241-8d07-ee8ef52c6078",
            "5aa9e86e-73fd-4488-9483-ea1782c2b090"
          ]
        },
        {
          "uuid": "8617b7cd-017c-426e-996b-8d024d868238",
          "code": "39118",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2465",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "6eec33c2-7563-4241-8d07-ee8ef52c6078"
          ]
        },
        {
          "uuid": "7e9bbd4d-387e-4262-b9f9-4895db80e730",
          "code": "39111",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3522",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "6eec33c2-7563-4241-8d07-ee8ef52c6078"
          ]
        },
        {
          "uuid": "2a2fcc52-b7bd-4aa2-b451-181d61bc87c9",
          "code": "227-743-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.025.221",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "6eec33c2-7563-4241-8d07-ee8ef52c6078"
          ]
        },
        {
          "uuid": "263e6104-50fb-435d-8e38-54521252363f",
          "code": "230-943-5",
          "type": "ALTERNATIVE",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.028.130",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "6eec33c2-7563-4241-8d07-ee8ef52c6078"
          ]
        },
        {
          "uuid": "1de2fa63-8ddb-4e38-a4a4-da0cdfc6f1fb",
          "code": "62595",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/62595",
          "code_system": "PUBCHEM",
          "references": [
            "6eec33c2-7563-4241-8d07-ee8ef52c6078"
          ]
        },
        {
          "uuid": "3e24be80-ec17-7364-d4f1-88e63886bca1",
          "code": "DTXSID3036442",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3036442",
          "code_system": "EPA CompTox",
          "references": [
            "495f5520-dbd7-d586-c5f0-e49a3b0aac73"
          ]
        },
        {
          "uuid": "7333cd40-6f59-4fae-9831-d51b8a95525e",
          "code": "4TTL387KW9",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "1abbd88d-6d60-4a74-ab0d-8a37b89b3afd",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "b7e12fd6-7c12-42a5-a777-19f43541e435",
            "refuuid": "4daf125d-b81a-4a47-ae79-9ff0fbeca136",
            "name": "Edetic Acid",
            "unii": "9G34HU7RV0",
            "linking_id": "9G34HU7RV0",
            "ref_pname": "Edetic Acid",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "01161eb6-36ef-4a99-80c3-124f2e28d65e",
          "name": "EDETATE TETRAPOTASSIUM",
          "stdName": "EDETATE TETRAPOTASSIUM",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "454319f9-ef18-4301-b45e-cd4f192840dd"
          ],
          "display_name": true
        },
        {
          "uuid": "1509fb70-6fb8-443a-83b2-9a51974c9167",
          "name": "EDTA, TETRAPOTASSIUM",
          "stdName": "EDTA, TETRAPOTASSIUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10cc787c-8a54-41a2-8f84-0f4eef77d9f7"
          ],
          "display_name": false
        },
        {
          "uuid": "9b9bf574-4aa0-4332-bf5f-654239f4edcd",
          "name": "GLYCINE, N,N'-1,2-ETHANEDIYLBIS(N-(CARBOXYMETHYL)-, POTASSIUM SALT",
          "stdName": "GLYCINE, N,N'-1,2-ETHANEDIYLBIS(N-(CARBOXYMETHYL)-, POTASSIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f8c3e0f-551e-4560-982f-9eada8d0356f"
          ],
          "display_name": false
        },
        {
          "uuid": "5baa7e8c-da59-4fe5-a029-e5dc510ed6c8",
          "name": "GLYCINE, N,N'-1,2-ETHANEDIYLBIS(N-(CARBOXYMETHYL)-, POTASSIUM SALT (1:4)",
          "stdName": "GLYCINE, N,N'-1,2-ETHANEDIYLBIS(N-(CARBOXYMETHYL)-, POTASSIUM SALT (1:4)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f63e0786-dc05-4154-b9ea-0556dbec4e34"
          ],
          "display_name": false
        },
        {
          "uuid": "3a170bcb-e09d-4210-ab45-475823760603",
          "name": "N,N'-ETHYLENEBIS(N-(CARBOXYMETHYL)AMINOACETIC) ACID, POTASSIUM SALT",
          "stdName": "N,N'-ETHYLENEBIS(N-(CARBOXYMETHYL)AMINOACETIC) ACID, POTASSIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f8c3e0f-551e-4560-982f-9eada8d0356f"
          ],
          "display_name": false
        },
        {
          "uuid": "4d890c56-f00e-4769-9844-48cbbfdfb5f1",
          "name": "POTASSIUM ETHYLENEDIAMINETETRAACETATE",
          "stdName": "POTASSIUM ETHYLENEDIAMINETETRAACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4a181c57-dc46-4f56-b4e3-49aa33bc76e0"
          ],
          "display_name": false
        },
        {
          "uuid": "f9a24b7c-4528-4b60-b833-649f7137a17c",
          "name": "TETRAPOTASSIUM ETHYLENEDIAMINETETRAACETATE",
          "stdName": "TETRAPOTASSIUM ETHYLENEDIAMINETETRAACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab4d5be1-6107-4658-9454-eb284fc02c29"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4a181c57-dc46-4f56-b4e3-49aa33bc76e0",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ab4d5be1-6107-4658-9454-eb284fc02c29",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3f8c3e0f-551e-4560-982f-9eada8d0356f",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10cc787c-8a54-41a2-8f84-0f4eef77d9f7",
          "citation": "CEDI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "454319f9-ef18-4301-b45e-cd4f192840dd",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f63e0786-dc05-4154-b9ea-0556dbec4e34",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6eec33c2-7563-4241-8d07-ee8ef52c6078",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391091000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cec2fa67-51d5-4c7c-b982-0bdc7f592e60",
          "citation": "SRS import [4TTL387KW9]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4TTL387KW9",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391091000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4d463486-0bc4-4687-9dd2-8f69b1ebc037",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "495f5520-dbd7-d586-c5f0-e49a3b0aac73",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=5964-35-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5aa9e86e-73fd-4488-9483-ea1782c2b090",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5ce7f089-b7f5-4dd0-8fa9-c385fcfe8989",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2c4f1cff-9c4c-4f21-ae21-36c0b66175d9",
          "id": "2c4f1cff-9c4c-4f21-ae21-36c0b66175d9",
          "molfile": "\n  Marvin  01132102232D          \n\n  1  0  0  0  0  0            999 V2000\n    6.6685   -6.4948    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[K+]",
          "formula": "K",
          "atropisomerism": "No",
          "charge": 1,
          "count": 4,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 4,
            "units": "MOL RATIO",
            "uuid": "b569f064-494a-453d-a650-5979caa9c4a8"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "39.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "e493a8ee-932c-4f6e-83fe-4c563305fd8b",
          "id": "e493a8ee-932c-4f6e-83fe-4c563305fd8b",
          "molfile": "\n  Marvin  01132111502D          \n\n 20 19  0  0  0  0            999 V2000\n   10.5099   -7.0587    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   10.5099   -7.8815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5318   -8.4508    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2250   -8.2977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9353   -7.8815    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9353   -7.0587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6504   -6.6473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6504   -5.8245    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3654   -5.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0805   -5.8245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7909   -5.4130    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   14.0805   -6.6473    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9353   -5.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9353   -4.5853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6504   -4.1740    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   11.2250   -4.1740    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6504   -8.2977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6504   -9.1206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6292   -9.6468    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   13.3654   -9.5320    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 17  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 13  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\nM  CHG  4   1  -1  11  -1  15  -1  19  -1\nM  END",
          "smiles": "C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)[O-])CC(=O)[O-]",
          "formula": "C10H12N2O8",
          "atropisomerism": "No",
          "charge": -4,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "43886181-d2be-4a80-a54b-105625b3933d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "288.2113",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8ea792b4-e245-4165-af18-34622084ec80",
      "version": "3",
      "structure": {
        "id": "73b7fda4-2912-4232-bef1-c65ed71eb04f",
        "molfile": "\n  Marvin  01132106002D          \n\n 24 19  0  0  0  0            999 V2000\n    6.6685   -6.4948    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n   12.6504   -5.8245    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6504   -6.6473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9353   -7.0587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9353   -7.8815    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2250   -8.2977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5099   -7.8815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5099   -7.0587    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5318   -8.4508    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   12.6504   -8.2977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6504   -9.1206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6292   -9.6468    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   13.3654   -9.5320    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3654   -5.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0805   -5.8245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7909   -5.4130    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   14.0805   -6.6473    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9353   -5.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9353   -4.5853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6504   -4.1740    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2250   -4.1740    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.6685   -6.4948    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n    6.6685   -6.4948    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n    6.6685   -6.4948    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  5 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\n  2 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\n  2 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 19 21  1  0  0  0  0\nM  CHG  8   1   1   9  -1  12  -1  16  -1  21  -1  22   1  23   1  24   1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  4   1  22  23  24\nM  SPA   1  1   1\nM  SDI   1  4    6.2485   -6.9148    6.2485   -6.0748\nM  SDI   1  4    7.0885   -6.0748    7.0885   -6.9148\nM  SMT   1 4\nM  END",
        "smiles": "C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[K+].[K+].[K+].[K+]",
        "formula": "C10H12N2O8.4K",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "444.6045",
        "optical_activity": "NONE",
        "references": [
          "4d463486-0bc4-4687-9dd2-8f69b1ebc037",
          "cec2fa67-51d5-4c7c-b982-0bdc7f592e60"
        ],
        "stereo_centers": 0
      },
      "unii": "4TTL387KW9"
    }
  ]
}