{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "89c1bc09-1e7e-47be-9ba2-f8ec36c9983a",
          "code": "41438-38-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=41438-38-4",
          "code_system": "CAS",
          "references": [
            "a66e4a7d-f65c-4a66-9059-7294a923576e",
            "4dac9df2-1d97-4d32-be13-2a729af315b7"
          ]
        },
        {
          "uuid": "dc6a0d05-00f6-4bd5-a32f-4f8906d51542",
          "code": "170509",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/170509",
          "code_system": "PUBCHEM",
          "references": [
            "a66e4a7d-f65c-4a66-9059-7294a923576e"
          ]
        },
        {
          "uuid": "62c200c0-b10a-488b-8518-64ee1972f383",
          "code": "SUB194992",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "2a5e163f-5956-c3e2-3aa9-ecb24d9e7cc5"
          ]
        },
        {
          "uuid": "80b7b6ea-20b3-4930-8264-d8f8531c155d",
          "code": "4SN4572M5S",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ea8ca607-54ac-d85f-3456-242004543ea0",
          "code": "DTXSID00961682",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00961682",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "33de94b9-2543-8048-79af-3fdd495a4b81",
          "code": "Diethyl lutidinate",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Diethyl_lutidinate",
          "code_system": "WIKIPEDIA",
          "references": [
            "10987f42-0a98-f7b5-f857-fc96ed856042"
          ]
        },
        {
          "uuid": "acd1846c-4cf7-b041-22d2-f4afcc2d92c9",
          "code": "100000181375",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "14856935-ea69-0962-386f-fb46722b61fc"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c81c49a9-537a-4c2d-9b5d-9f5ed6c0d243",
          "name": "2,4-PYRIDINEDICARBOXYLIC ACID, 2,4-DIETHYL ESTER",
          "stdName": "2,4-PYRIDINEDICARBOXYLIC ACID, 2,4-DIETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "538d36f7-76d6-4b54-9fba-0489cec7689d",
            "dc84061d-8c3e-4f89-8731-4472b2a7f309"
          ],
          "display_name": false
        },
        {
          "uuid": "acddcb0c-6a6a-4a50-a030-6561b46b6883",
          "name": "2,4-PYRIDINEDICARBOXYLIC ACID, DIETHYL ESTER",
          "stdName": "2,4-PYRIDINEDICARBOXYLIC ACID, DIETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "538d36f7-76d6-4b54-9fba-0489cec7689d",
            "dc84061d-8c3e-4f89-8731-4472b2a7f309"
          ],
          "display_name": false
        },
        {
          "uuid": "cb7ab37e-ec9b-451d-afbb-d49474762684",
          "name": "DIETHYL 2,4-PYRIDINEDICARBOXYLATE",
          "stdName": "DIETHYL 2,4-PYRIDINEDICARBOXYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "538d36f7-76d6-4b54-9fba-0489cec7689d",
            "dc84061d-8c3e-4f89-8731-4472b2a7f309"
          ],
          "display_name": false
        },
        {
          "uuid": "dd90ca80-732b-401e-8490-909f0eb5b3bf",
          "name": "DIETHYL LUTIDINATE",
          "stdName": "DIETHYL LUTIDINATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "538d36f7-76d6-4b54-9fba-0489cec7689d",
            "dc84061d-8c3e-4f89-8731-4472b2a7f309"
          ],
          "display_name": true
        },
        {
          "uuid": "9447bf15-0b6d-4513-9318-92c4369139dd",
          "name": "DIETHYLLUTIDINATE",
          "stdName": "DIETHYLLUTIDINATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "6942383e-f3ce-4bfc-8954-69f9104085d4",
            "03a4d085-4bad-4d20-82a1-9b786a7cc554",
            "538d36f7-76d6-4b54-9fba-0489cec7689d",
            "cb0d352f-b494-4f0d-b89f-5ad60cf57414"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "eef972e0-b5d3-4051-a2b9-680b56da8742",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "88a02896-8b55-4087-88ca-4778c7d25784",
          "name": "MEXORYL SBU",
          "stdName": "MEXORYL SBU",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "03a4d085-4bad-4d20-82a1-9b786a7cc554",
            "538d36f7-76d6-4b54-9fba-0489cec7689d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "dc84061d-8c3e-4f89-8731-4472b2a7f309",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "538d36f7-76d6-4b54-9fba-0489cec7689d",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "03a4d085-4bad-4d20-82a1-9b786a7cc554",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb0d352f-b494-4f0d-b89f-5ad60cf57414",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a66e4a7d-f65c-4a66-9059-7294a923576e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391493000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4798b32b-f1a8-464b-91a0-0740b59c946c",
          "citation": "SRS import [4SN4572M5S]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4SN4572M5S",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391493000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6942383e-f3ce-4bfc-8954-69f9104085d4",
          "citation": "DIETHYLLUTIDINATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "14856935-ea69-0962-386f-fb46722b61fc",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "2a5e163f-5956-c3e2-3aa9-ecb24d9e7cc5",
          "citation": "EVMPD",
          "doc_type": "EVMPD",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4dac9df2-1d97-4d32-be13-2a729af315b7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "10987f42-0a98-f7b5-f857-fc96ed856042",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "60347896-b884-4bf7-8896-cfc8b5b84ee3",
          "id": "60347896-b884-4bf7-8896-cfc8b5b84ee3",
          "molfile": "\n  Marvin  01132104592D          \n\n 16 16  0  0  0  0            999 V2000\n   12.4868   -3.6503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7709   -4.0656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7709   -4.8866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0648   -5.2996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3586   -4.8866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0648   -6.1132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3586   -6.5212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3586   -7.3495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0648   -7.7625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7660   -7.3495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7660   -6.5212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4868   -7.7698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4868   -8.5908    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2003   -7.3569    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2003   -6.5432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9138   -6.1278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 11  2  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\nM  END",
          "smiles": "CCOC(=O)c1ccnc(c1)C(=O)OCC",
          "formula": "C11H13NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f5998bf2-9639-49e2-b0a9-ffb3fc100292"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "223.2256",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "bf3b10d0-cd18-454e-b795-4dcbbdd86587",
      "version": "7",
      "structure": {
        "id": "7d322b41-1ab3-4f14-a649-02b89e4509ce",
        "molfile": "\n  Marvin  01132106302D          \n\n 16 16  0  0  0  0            999 V2000\n   13.9138   -6.1278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2003   -6.5432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4868   -3.6503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4868   -8.5908    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2003   -7.3569    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7709   -4.0656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0648   -7.7625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4868   -7.7698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3586   -7.3495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3586   -4.8866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7709   -4.8866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7660   -7.3495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3586   -6.5212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0648   -5.2996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7660   -6.5212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0648   -6.1132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  9  7  2  0  0  0  0\n  2  1  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  3  1  0  0  0  0\n  8  4  2  0  0  0  0\n  8  5  1  0  0  0  0\n 11  6  1  0  0  0  0\n 12  7  1  0  0  0  0\n 12  8  1  0  0  0  0\n 13  9  1  0  0  0  0\n 14 10  2  0  0  0  0\n 14 11  1  0  0  0  0\n 15 12  2  0  0  0  0\n 16 13  2  0  0  0  0\n 16 14  1  0  0  0  0\n 16 15  1  0  0  0  0\nM  END",
        "smiles": "CCOC(=O)c1ccnc(c1)C(=O)OCC",
        "formula": "C11H13NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "223.2256",
        "optical_activity": "NONE",
        "references": [
          "dc84061d-8c3e-4f89-8731-4472b2a7f309",
          "4798b32b-f1a8-464b-91a0-0740b59c946c"
        ],
        "stereo_centers": 0
      },
      "unii": "4SN4572M5S"
    }
  ]
}