{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4493d27d-542b-40db-9003-0329ec4eee16",
          "code": "(+)-CARVONE",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=4742",
          "code_system": "JECFA EVALUATION",
          "references": [
            "3d292565-3ce3-4868-8843-9d12ab4ab905"
          ]
        },
        {
          "uuid": "dc1c76cd-d55b-48fc-a93b-e0c919f596ec",
          "code": "2244-16-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2244-16-8",
          "code_system": "CAS",
          "references": [
            "3d292565-3ce3-4868-8843-9d12ab4ab905",
            "48ca2894-0932-40f7-ae0e-cea708b675b3"
          ]
        },
        {
          "uuid": "98cbc6c4-2a29-4409-a361-414142cd0808",
          "code": "218-827-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.017.117",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "3d292565-3ce3-4868-8843-9d12ab4ab905"
          ]
        },
        {
          "uuid": "c051b80a-ee07-447a-9cc3-15d0a1886458",
          "code": "m3144",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3144?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "3d292565-3ce3-4868-8843-9d12ab4ab905"
          ]
        },
        {
          "uuid": "6f2fc791-f91e-4d72-b072-cbf3cae0941e",
          "code": "1747726",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1747726/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "3d292565-3ce3-4868-8843-9d12ab4ab905"
          ]
        },
        {
          "uuid": "00743c02-b06e-4153-a3fa-47b9b56ff363",
          "code": "16724",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16724",
          "code_system": "PUBCHEM",
          "references": [
            "3d292565-3ce3-4868-8843-9d12ab4ab905"
          ]
        },
        {
          "uuid": "2ec83e95-3cdb-a119-bb00-4e8c95c3674d",
          "code": "DTXSID8020256",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8020256",
          "code_system": "EPA CompTox",
          "references": [
            "b26d42d7-f500-263e-f8e6-5bdd99fed7ac"
          ]
        },
        {
          "uuid": "1f283a6d-213d-4cb2-a749-e45757e11954",
          "code": "4RWC1CMS3X",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "646732f9-e259-841f-85eb-2277f0321fbe",
          "code": "15399",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:15399",
          "code_system": "CHEBI",
          "references": [
            "0757b37f-b47f-a851-afef-ac8fec0b62ca"
          ]
        },
        {
          "uuid": "1a0caa44-0dd8-ed2d-7cc2-79ad972a40c5",
          "code": "348",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/348/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "1f3ecd19-3294-7f69-00d5-a26c88c6572e"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "dd1d149e-be3b-49b7-b793-020a77306868",
          "name": "(+)-CARVONE",
          "stdName": "(+)-CARVONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce0a1815-5b11-4c5d-b834-105b8463ed39",
            "e86330bc-a810-495d-86fa-30c6d7600df7",
            "b1f04654-0a36-4c67-adcc-076a2cd03afb"
          ],
          "display_name": false
        },
        {
          "uuid": "ad9b41d7-2be4-4716-8fea-b9ccb4879e2d",
          "name": "(+)-CARVONE [FCC]",
          "stdName": "(+)-CARVONE [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce0a1815-5b11-4c5d-b834-105b8463ed39",
            "b1f04654-0a36-4c67-adcc-076a2cd03afb"
          ],
          "display_name": false
        },
        {
          "uuid": "9d2ff373-1a0e-430d-8232-f953148b1003",
          "name": "(S)-(+)-CARVONE",
          "stdName": "(S)-(+)-CARVONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1cb83c9f-fe5f-438b-8cdb-e30117a65cc2",
            "b1f04654-0a36-4c67-adcc-076a2cd03afb"
          ],
          "display_name": false
        },
        {
          "uuid": "3a799e12-6411-42de-bba7-c3e94efaf4cf",
          "name": "(S)-(+)-P-MENTHA-6,8-DIEN-2-ONE",
          "stdName": "(S)-(+)-P-MENTHA-6,8-DIEN-2-ONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5b914932-1bac-4280-aa45-08033fe5061d",
            "b1f04654-0a36-4c67-adcc-076a2cd03afb"
          ],
          "display_name": false
        },
        {
          "uuid": "f23ee2a4-0bc9-41fc-9e09-d90f12140f3d",
          "name": "(S)-2-METHYL-5-(1-METHYLVINYL)CYCLOHEX-2-EN-1-ONE",
          "stdName": "(S)-2-METHYL-5-(1-METHYLVINYL)CYCLOHEX-2-EN-1-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5b914932-1bac-4280-aa45-08033fe5061d",
            "b1f04654-0a36-4c67-adcc-076a2cd03afb"
          ],
          "display_name": false
        },
        {
          "uuid": "ed0b91f7-ac72-45aa-9f5b-b31e34f06ff1",
          "name": "(S)-CARVONE",
          "stdName": "(S)-CARVONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9a106bc9-690f-4ec1-a3ef-17d240603ce8",
            "b1f04654-0a36-4c67-adcc-076a2cd03afb"
          ],
          "display_name": false
        },
        {
          "uuid": "601c34ee-2c49-4dfb-8f08-f7785827f013",
          "name": "(S)-D-P-MENTHA-6,8,(9)-DIEN-2-ONE",
          "stdName": "(S)-D-P-MENTHA-6,8,(9)-DIEN-2-ONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5b914932-1bac-4280-aa45-08033fe5061d",
            "b1f04654-0a36-4c67-adcc-076a2cd03afb"
          ],
          "display_name": false
        },
        {
          "uuid": "290aaca6-58a9-4dc2-a1c1-36d5f51440a7",
          "name": "2-CYCLOHEXEN-1-ONE, 2-METHYL-5-(1-METHYLETHENYL)-, (5S)-",
          "stdName": "2-CYCLOHEXEN-1-ONE, 2-METHYL-5-(1-METHYLETHENYL)-, (5S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5b914932-1bac-4280-aa45-08033fe5061d",
            "b1f04654-0a36-4c67-adcc-076a2cd03afb"
          ],
          "display_name": false
        },
        {
          "uuid": "48652682-47a6-404c-bce0-7af2086c5d60",
          "name": "2-CYCLOHEXEN-1-ONE, 2-METHYL-5-(1-METHYLETHENYL)-, (S)-",
          "stdName": "2-CYCLOHEXEN-1-ONE, 2-METHYL-5-(1-METHYLETHENYL)-, (S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d07ca5c4-8f3d-4af0-aedd-ef84b556d95d",
            "b1f04654-0a36-4c67-adcc-076a2cd03afb"
          ],
          "display_name": false
        },
        {
          "uuid": "41e63afb-9419-469c-9676-6a44f9e42058",
          "name": "CARVONE D-",
          "stdName": "CARVONE D-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cea6908b-e0d1-4edc-92b0-58a0435faafc",
            "ed496b14-732e-43bf-9b4b-4ccc8268c844"
          ],
          "display_name": false
        },
        {
          "uuid": "2d6f4872-b8e1-47bd-8c6b-d96efa466b60",
          "name": "CARVONE D-FORM [MI]",
          "stdName": "CARVONE D-FORM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ed496b14-732e-43bf-9b4b-4ccc8268c844",
            "b1f04654-0a36-4c67-adcc-076a2cd03afb"
          ],
          "display_name": false
        },
        {
          "uuid": "9c8bc1f4-f188-43e9-b813-c8c1702bed39",
          "name": "CARVONE, (+)-",
          "stdName": "CARVONE, (+)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5b914932-1bac-4280-aa45-08033fe5061d",
            "b1f04654-0a36-4c67-adcc-076a2cd03afb"
          ],
          "display_name": true
        },
        {
          "uuid": "e3d32396-96ac-4602-8c81-8335133d6776",
          "name": "CARVONE, D-",
          "stdName": "CARVONE, D-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5b914932-1bac-4280-aa45-08033fe5061d",
            "b1f04654-0a36-4c67-adcc-076a2cd03afb"
          ],
          "display_name": false
        },
        {
          "uuid": "8c6774de-0a91-466c-82d1-03dc661b0b9f",
          "name": "D-CARVONE",
          "stdName": "D-CARVONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ed496b14-732e-43bf-9b4b-4ccc8268c844",
            "b1f04654-0a36-4c67-adcc-076a2cd03afb"
          ],
          "display_name": false
        },
        {
          "uuid": "90f44f15-6780-4675-ad2d-7cd20e99f32d",
          "name": "FEMA NO. 2249, (+)-",
          "stdName": "FEMA NO. 2249, (+)-",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d5162d12-61e0-4a30-8bcf-b31d4bb037a1",
            "b1f04654-0a36-4c67-adcc-076a2cd03afb"
          ],
          "display_name": false
        },
        {
          "uuid": "dfc950a3-5436-4a0f-92c0-cf8bf407ead0",
          "name": "P-MENTHA-6,8-DIEN-2-ONE, (S)-(+)-",
          "stdName": "P-MENTHA-6,8-DIEN-2-ONE, (S)-(+)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5b914932-1bac-4280-aa45-08033fe5061d",
            "b1f04654-0a36-4c67-adcc-076a2cd03afb"
          ],
          "display_name": false
        },
        {
          "uuid": "442a7ae6-ff3c-4aec-96c8-a1d8b9734f6e",
          "name": "S-(+)-CARVONE",
          "stdName": "S-(+)-CARVONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "37f1b6ff-c6a4-4b1b-8ed0-4bc03a31309c",
            "b1f04654-0a36-4c67-adcc-076a2cd03afb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ed496b14-732e-43bf-9b4b-4ccc8268c844",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "cea6908b-e0d1-4edc-92b0-58a0435faafc",
          "citation": "NDA 19518",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5b914932-1bac-4280-aa45-08033fe5061d",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b1f04654-0a36-4c67-adcc-076a2cd03afb",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a106bc9-690f-4ec1-a3ef-17d240603ce8",
          "citation": "WIKEPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d07ca5c4-8f3d-4af0-aedd-ef84b556d95d",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d5162d12-61e0-4a30-8bcf-b31d4bb037a1",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "37f1b6ff-c6a4-4b1b-8ed0-4bc03a31309c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1cb83c9f-fe5f-438b-8cdb-e30117a65cc2",
          "citation": "SA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce0a1815-5b11-4c5d-b834-105b8463ed39",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3d292565-3ce3-4868-8843-9d12ab4ab905",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391892000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "175daf05-a6b3-46b6-a55b-b8942b88acba",
          "citation": "AN OVERVIEW OF THE EFFECTS OF TOBACCO INGREDIENTS ON SMOKE CHEMISTRY AND TOXICITY; FOOD AND CHEMICAL TOXICOLOGY; BAKER, RR; 42(SUPPL):53-83, 2004",
          "url": "http://www.sciencedirect.com/science/article/pii/S0278691504000043",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "224e31a7-9ee1-4f21-b017-cb4371205008",
          "citation": "SRS import [4RWC1CMS3X]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4RWC1CMS3X",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391892000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "14b6c917-cb01-4ccb-a423-f16160113edf",
          "citation": "merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e86330bc-a810-495d-86fa-30c6d7600df7",
          "citation": "(+)-CARVONE [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b26d42d7-f500-263e-f8e6-5bdd99fed7ac",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2244-16-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0757b37f-b47f-a851-afef-ac8fec0b62ca",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "48ca2894-0932-40f7-ae0e-cea708b675b3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c91d9ff9-ccef-c2e8-abc5-1398c74fc73a",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "1f3ecd19-3294-7f69-00d5-a26c88c6572e",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "70a5714b-9f99-435c-b87a-4604dc890a00",
          "id": "70a5714b-9f99-435c-b87a-4604dc890a00",
          "molfile": "\n  Marvin  01132105512D          \n\n 11 11  0  0  1  0            999 V2000\n    7.7069   -9.1255    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.9690   -9.5334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2815   -9.1117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2815   -8.2867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5939   -7.8651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0194   -7.8972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0194   -7.0721    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7069   -8.3187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4219   -9.5610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1232   -9.1760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4219  -10.3905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  1  8  1  0  0  0  0\n  1  9  1  1  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  4  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  6  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  9  2  0  0  0  0\nM  END",
          "smiles": "C=C(C)[C@H]1CC=C(C)C(=O)C1",
          "formula": "C10H14O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "adcb2845-f920-4112-8751-b2a5b9074f48"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "150.2179",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "498b018d-6f75-4e65-97ec-7b5b0dded951",
      "version": "8",
      "structure": {
        "id": "d6406fac-aad1-4a76-8f1d-e395537d042e",
        "molfile": "\n  Marvin  01132111062D          \n\n 11 11  0  0  1  0            999 V2000\n    7.0194   -7.8972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2815   -8.2867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2815   -9.1117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9690   -9.5334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7069   -9.1255    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.7069   -8.3187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4219   -9.5610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4219  -10.3905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1232   -9.1760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5939   -7.8651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0194   -7.0721    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  1  1  0  0  0  0\n  5  7  1  1  0  0  0\n  8  7  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  2  1  0  0  0  0\n 11  1  2  0  0  0  0\nM  END",
        "smiles": "C=C(C)[C@H]1CC=C(C)C(=O)C1",
        "formula": "C10H14O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "150.2179",
        "optical_activity": "( + )",
        "references": [
          "224e31a7-9ee1-4f21-b017-cb4371205008",
          "14b6c917-cb01-4ccb-a423-f16160113edf"
        ],
        "stereo_centers": 1
      },
      "modifications": {
        "uuid": "9c694735-9d0b-4a6d-9b91-156d7a26cfe5"
      },
      "unii": "4RWC1CMS3X"
    }
  ]
}