{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "13ff831a-47e4-4105-a536-ac1d19f5272a", "code": "4RW8NHT736", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "f08f9bba-71ca-bc65-b00c-cade93525adb", "code": "171390220", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/171390220", "code_system": "PUBCHEM", "references": [ "42d18628-25a1-2ce8-1ba5-8d268ca9eabd" ] } ], "substance_class": "chemical", "names": [ { "uuid": "9e4a6a52-23b3-433a-8b9e-c3961d8bfac2", "name": "Ac-Arg-Ala-Ahx", "stdName": "AC-ARG-ALA-AHX", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a83f8899-dc0c-483b-bcad-11fef771dd98" ], "display_name": false }, { "uuid": "e776394b-9e47-427c-841b-e7c927efd02c", "name": "Acetyl Dipeptide-3 Aminohexanoate", "stdName": "ACETYL DIPEPTIDE-3 AMINOHEXANOATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "3b7dae0b-5509-4590-90e6-8cfeaceb02b2" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "784f97ec-70e1-4a62-adbc-adb9740ac4b6", "name_org": "INCI" } ] }, { "uuid": "0eb40386-e0a0-493c-b4c4-51ec8ccc27dd", "name": "Bodyfensine", "stdName": "BODYFENSINE", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "a83f8899-dc0c-483b-bcad-11fef771dd98" ], "display_name": false } ], "references": [ { "uuid": "42d18628-25a1-2ce8-1ba5-8d268ca9eabd", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "2e6903c0-51f9-49e5-a417-591af71009c8", "citation": "https://www.creative-peptides.com/product/acetyl-dipeptide-aminohexanoate-item-cpc1622-127.html", "url": "https://www.creative-peptides.com/product/acetyl-dipeptide-aminohexanoate-item-cpc1622-127.html", "doc_type": "MANUFACTURER PRODUCT DESCRIPTION", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "a83f8899-dc0c-483b-bcad-11fef771dd98", "citation": "https://inci.guide/peptides/acetyl-dipeptide-3-aminohexanoate", "url": "https://inci.guide/peptides/acetyl-dipeptide-3-aminohexanoate", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "3b7dae0b-5509-4590-90e6-8cfeaceb02b2", "citation": "PCPC", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "dc5b13ff-0426-43fc-a8c7-aa9c6bdfc05f", "id": "dc5b13ff-0426-43fc-a8c7-aa9c6bdfc05f", "molfile": "N2-Acetyl-L-arginyl-L-alanine\n CDK 12042312582D\n110998-90-8 Copyright (C) 2023 ACS\n 28 27 0 0 1 0 0 0 0 0999 V2000\n 11.4811 -6.5347 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 10.8905 -5.5119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7094 -5.5119 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1188 -4.4890 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.9377 -4.4890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3472 -3.4662 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3472 -5.5119 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7094 -3.4661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4811 -4.4890 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6622 -6.5347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2528 -5.5119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4339 -5.5119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0244 -4.4890 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2055 -4.4890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7961 -3.4661 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7961 -5.5119 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8906 -7.5576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4811 -8.5805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8906 -9.6033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6622 -8.5805 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1661 -3.4662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5755 -4.4890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3944 -4.4890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8039 -5.5119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6228 -5.5119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0322 -6.5348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6228 -7.5576 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8511 -6.5348 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 7 2 0 0 0 0\n 4 8 1 6 0 0 0\n 2 9 2 0 0 0 0\n 1 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 14 16 1 0 0 0 0\n 1 17 1 6 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 2 0 0 0 0\n 6 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 2 0 0 0 0\n 26 28 1 0 0 0 0\nM END", "smiles": "C[C@@H](C(=O)NCCCCCC(=O)O)NC(=O)[C@H](CCCNC(=N)N)NC(=O)C", "formula": "C17H32N6O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "aa2a1141-4f70-4a45-b42c-9acf1b818750" }, "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "400.4739", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "55ce8b81-cedb-4e3f-9f49-8ef4a9d4c950", "version": "5", "structure": { "id": "84f9ba1e-8819-4a22-b5f1-eb41032fd3a2", "molfile": "N2-Acetyl-L-arginyl-L-alanine\n JSDraw212042312582D\n\n 28 27 0 0 1 0 0 V2000\n 28.6780 -7.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8980 -6.3451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.3380 -6.3451 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 25.5579 -4.9940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.9979 -4.9940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.2180 -3.6431 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 23.2180 -6.3451 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.3380 -3.6430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6780 -4.9940 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2380 -7.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.0181 -6.3451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.5781 -6.3451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.3580 -4.9940 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 34.9180 -4.9940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.6981 -3.6430 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 35.6981 -6.3451 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8981 -9.0470 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6780 -10.3981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8981 -11.7490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2380 -10.3981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6580 -3.6431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.8779 -4.9940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.3179 -4.9940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.5380 -6.3451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9780 -6.3451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1979 -7.6961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9780 -9.0470 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6379 -7.6961 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 7 2 0 0 0 0\n 4 8 1 6 0 0 0\n 2 9 2 0 0 0 0\n 1 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 14 16 1 0 0 0 0\n 1 17 1 6 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 2 0 0 0 0\n 6 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 2 0 0 0 0\n 26 28 1 0 0 0 0\nM END", "smiles": "C[C@@H](C(=O)NCCCCCC(=O)O)NC(=O)[C@H](CCCNC(=N)N)NC(=O)C", "formula": "C17H32N6O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "400.4739", "optical_activity": "UNSPECIFIED", "references": [ "2e6903c0-51f9-49e5-a417-591af71009c8" ], "stereo_centers": 2 }, "unii": "4RW8NHT736" } ] }