{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1872e5ee-9c67-44cc-90f1-9751ba2229a1",
          "code": "20662-53-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=20662-53-7",
          "code_system": "CAS",
          "references": [
            "85dd6ecd-0482-4fd4-8c5e-28a69c88a61d",
            "2e3aa31d-0fc4-4717-aa91-20991b243f51"
          ]
        },
        {
          "uuid": "4a720726-2f37-4205-b580-f66f3aa0b3f5",
          "code": "243-950-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.039.940",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "85dd6ecd-0482-4fd4-8c5e-28a69c88a61d"
          ]
        },
        {
          "uuid": "c0dd68f8-4a33-41de-9f8e-6fa8248dbcbe",
          "code": "88638",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/88638",
          "code_system": "PUBCHEM",
          "references": [
            "85dd6ecd-0482-4fd4-8c5e-28a69c88a61d"
          ]
        },
        {
          "uuid": "6b42bf8f-71fb-96e7-4d3f-7b4cf85b20b4",
          "code": "DTXSID0057679",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0057679",
          "code_system": "EPA CompTox",
          "references": [
            "90e940c2-6d65-2c9a-56b8-77a3c79217a3"
          ]
        },
        {
          "uuid": "0220b833-a922-47d1-ae94-0cf376974506",
          "code": "4RP0AED2PC",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "81d20ea8-df35-4daa-b5c5-d6d055b0e9d8",
          "name": "1-(4-PIPERIDINYL)-2-BENZIMIDAZOLONE",
          "stdName": "1-(4-PIPERIDINYL)-2-BENZIMIDAZOLONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8bb725eb-a587-42ba-aea5-b9db413aff3e",
            "258504b6-2dfe-4e6b-a9a5-29dc76ee82a1"
          ],
          "display_name": false
        },
        {
          "uuid": "d8a89747-3354-41bb-b6ef-36d35222ecbe",
          "name": "1-(PIPERIDIN-4-YL)-1,3-DIHYDRO-2H-BENZIMIDAZOL-2-ONE",
          "stdName": "1-(PIPERIDIN-4-YL)-1,3-DIHYDRO-2H-BENZIMIDAZOL-2-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "258504b6-2dfe-4e6b-a9a5-29dc76ee82a1",
            "6571d39c-933b-4e0c-85fc-0bbddfc3f93d"
          ],
          "display_name": false
        },
        {
          "uuid": "9a363e04-d964-41b8-b18f-df62648ac8aa",
          "name": "2H-BENZIMIDAZOL-2-ONE, 1,3-DIHYDRO-1-(4-PIPERIDINYL)-",
          "stdName": "2H-BENZIMIDAZOL-2-ONE, 1,3-DIHYDRO-1-(4-PIPERIDINYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8bb725eb-a587-42ba-aea5-b9db413aff3e",
            "258504b6-2dfe-4e6b-a9a5-29dc76ee82a1"
          ],
          "display_name": false
        },
        {
          "uuid": "8dc0e36b-d9ab-4781-8875-5c3327ec6d9c",
          "name": "4-(2-KETO-1-BENZIMIDAZOLINYL)PIPERIDINE",
          "stdName": "4-(2-KETO-1-BENZIMIDAZOLINYL)PIPERIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "258504b6-2dfe-4e6b-a9a5-29dc76ee82a1",
            "e8d56a19-d1bb-4c36-9798-4e96ef44540b"
          ],
          "display_name": true
        },
        {
          "uuid": "f959921d-bb92-4614-9f51-2fce74b48d0c",
          "name": "4-(2-OXO-1,3-DIHYDRO-2H-BENZIMIDAZOL-1-YL)PIPERIDINE",
          "stdName": "4-(2-OXO-1,3-DIHYDRO-2H-BENZIMIDAZOL-1-YL)PIPERIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8bb725eb-a587-42ba-aea5-b9db413aff3e",
            "258504b6-2dfe-4e6b-a9a5-29dc76ee82a1"
          ],
          "display_name": false
        },
        {
          "uuid": "07d1eaf2-f090-4402-9f3c-c6182e7fd362",
          "name": "4-(2-OXO-1,3-DIHYDROBENZIMIDAZOL-1-YL)PIPERIDINE",
          "stdName": "4-(2-OXO-1,3-DIHYDROBENZIMIDAZOL-1-YL)PIPERIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8bb725eb-a587-42ba-aea5-b9db413aff3e",
            "258504b6-2dfe-4e6b-a9a5-29dc76ee82a1"
          ],
          "display_name": false
        },
        {
          "uuid": "669c4fca-3fb8-43d2-8439-e9e2a109ed08",
          "name": "4-(2-OXO-1-BENZIMIDAZOLINYL)PIPERIDINE",
          "stdName": "4-(2-OXO-1-BENZIMIDAZOLINYL)PIPERIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8bb725eb-a587-42ba-aea5-b9db413aff3e",
            "258504b6-2dfe-4e6b-a9a5-29dc76ee82a1"
          ],
          "display_name": false
        },
        {
          "uuid": "f06c0f0d-cf5d-424f-a537-13534d88ab5e",
          "name": "4-(2-OXO-1-BENZIMIDAZOLY)PIPERIDINE",
          "stdName": "4-(2-OXO-1-BENZIMIDAZOLY)PIPERIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8bb725eb-a587-42ba-aea5-b9db413aff3e",
            "258504b6-2dfe-4e6b-a9a5-29dc76ee82a1"
          ],
          "display_name": false
        },
        {
          "uuid": "dd628bd6-fdab-6e46-93f4-1efd05f2dc03",
          "name": "PIMOZIDE IMPURITY A [EP IMPURITY]",
          "stdName": "PIMOZIDE IMPURITY A [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11738894-8e19-968e-46af-606829e0342b"
          ],
          "display_name": false
        },
        {
          "uuid": "33af269b-7b6d-405e-b4ad-5bf01a0b9a4d",
          "name": "R-30507",
          "stdName": "R-30507",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8bb725eb-a587-42ba-aea5-b9db413aff3e",
            "258504b6-2dfe-4e6b-a9a5-29dc76ee82a1"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8bb725eb-a587-42ba-aea5-b9db413aff3e",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "258504b6-2dfe-4e6b-a9a5-29dc76ee82a1",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e8d56a19-d1bb-4c36-9798-4e96ef44540b",
          "citation": "SIGMA-ALDRICH",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6571d39c-933b-4e0c-85fc-0bbddfc3f93d",
          "citation": "EP 7.8",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "85dd6ecd-0482-4fd4-8c5e-28a69c88a61d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391980000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "112baae5-50c2-4ca4-a75b-7216e207662e",
          "citation": "SRS import [4RP0AED2PC]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4RP0AED2PC",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391980000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "90e940c2-6d65-2c9a-56b8-77a3c79217a3",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=20662-53-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2e3aa31d-0fc4-4717-aa91-20991b243f51",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "11738894-8e19-968e-46af-606829e0342b",
          "citation": "EP 10.6",
          "doc_type": "EP",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "479daf78-613f-4df1-ad56-1166d124d534",
          "id": "479daf78-613f-4df1-ad56-1166d124d534",
          "molfile": "\n  Marvin  01132103452D          \n\n 16 18  0  0  0  0            999 V2000\n    9.1867   -6.0119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3617   -6.0119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8767   -6.6793    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0921   -6.4245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3777   -6.8369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6632   -6.4245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6632   -5.5995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3777   -5.1869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0921   -5.5994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8767   -5.3445    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1317   -4.5599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5796   -3.9468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8346   -3.1622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6416   -2.9907    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1936   -3.6037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9386   -4.3884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  2  3  1  0  0  0  0\n  2 10  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  9  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 16 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)[nH]c(=O)n2C3CCNCC3",
          "formula": "C12H15N3O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "dcf5381e-648c-41d9-9623-1a70d23e380a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "217.2675",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "390dfa89-9c94-41f4-87cf-ae22982e22c9",
      "version": "6",
      "structure": {
        "id": "42d56038-8c18-4f49-9036-f7c0565dc9b2",
        "molfile": "\n  Marvin  01132103312D          \n\n 16 18  0  0  0  0            999 V2000\n    8.3617   -6.0119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1867   -6.0119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8767   -5.3445    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1317   -4.5599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5796   -3.9468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8346   -3.1622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6416   -2.9907    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1936   -3.6037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9386   -4.3884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0921   -5.5994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3777   -5.1869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6632   -5.5995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6632   -6.4245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3777   -6.8369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0921   -6.4245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8767   -6.6793    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9  4  1  0  0  0  0\n 10  3  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 15 10  1  0  0  0  0\n 16 15  1  0  0  0  0\n  1 16  1  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)[nH]c(=O)n2C3CCNCC3",
        "formula": "C12H15N3O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "217.2675",
        "optical_activity": "NONE",
        "references": [
          "112baae5-50c2-4ca4-a75b-7216e207662e",
          "6571d39c-933b-4e0c-85fc-0bbddfc3f93d"
        ],
        "stereo_centers": 0
      },
      "unii": "4RP0AED2PC"
    }
  ]
}