{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "592f033e-8291-4cc5-9506-11c602179f7e", "code": "23847-08-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=23847-08-7", "code_system": "CAS", "references": [ "616350db-9642-43bd-ba32-d76a84ffebd2", "df22ca44-0d47-4497-ad13-830baaf30d5a" ] }, { "uuid": "b5322f91-3b35-4964-8b7f-1ecd62b4dc05", "code": "245-910-0", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.041.722", "code_system": "ECHA (EC/EINECS)", "references": [ "616350db-9642-43bd-ba32-d76a84ffebd2" ] }, { "uuid": "a2c8b534-ecaf-404e-909f-d7dae14e2a01", "code": "90282", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/90282", "code_system": "PUBCHEM", "references": [ "616350db-9642-43bd-ba32-d76a84ffebd2" ] }, { "uuid": "2954203a-90ed-87c3-e938-fb4cec1980e7", "code": "DTXSID1044481", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1044481", "code_system": "EPA CompTox", "references": [ "75ceeb05-9183-0e8e-c4d7-65ae2777034a" ] }, { "uuid": "ca130e98-df7b-4bed-a5c8-b1fa64b6c33b", "code": "4R1UA4H6WN", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "5427daf3-1574-4909-8483-ff47e395286c", "name": "1,1'-DISULFANEDIYLDIAZEPAN-2-ONE", "stdName": "1,1'-DISULFANEDIYLDIAZEPAN-2-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "1a3d2ff2-0cf3-46df-8d4f-bb47f3d4b063", "c2ae550d-002c-4b62-8626-e0f2956a2644" ], "display_name": true }, { "uuid": "f0f55753-418e-47a3-9714-50685b4e10cb", "name": "2H-AZEPIN-2-ONE, 1,1'-DITHIOBIS(HEXAHYDRO-", "stdName": "2H-AZEPIN-2-ONE, 1,1'-DITHIOBIS(HEXAHYDRO-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ffe25d30-53cc-48b1-8ac5-7d8fb3dff0b4", "1a3d2ff2-0cf3-46df-8d4f-bb47f3d4b063" ], "display_name": false } ], "references": [ { "uuid": "ffe25d30-53cc-48b1-8ac5-7d8fb3dff0b4", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "1a3d2ff2-0cf3-46df-8d4f-bb47f3d4b063", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c2ae550d-002c-4b62-8626-e0f2956a2644", "citation": "tox21", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "616350db-9642-43bd-ba32-d76a84ffebd2", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391658000, "tags": [ "NOMEN" ] }, { "uuid": "7b9ff92b-7b2a-46d6-92c1-49e533ac5b7a", "citation": "SRS import [4R1UA4H6WN]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4R1UA4H6WN", "doc_type": "SRS", "public_domain": true, "document_date": 1493391658000, "tags": [ "NOMEN" ] }, { "uuid": "05366bbb-022b-45cc-bfb8-42ac1e789550", "citation": "CHEMID RECORD 23847-08-7", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "75ceeb05-9183-0e8e-c4d7-65ae2777034a", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=23847-08-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "df22ca44-0d47-4497-ad13-830baaf30d5a", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "fb182fd0-3099-4f57-9cff-fd2b2f76aa71", "id": "fb182fd0-3099-4f57-9cff-fd2b2f76aa71", "molfile": "\n Marvin 01132113002D \n\n 18 19 0 0 0 0 999 V2000\n 3.9390 -6.8075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5811 -6.0653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7571 -6.0653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2383 -5.4230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4277 -4.6237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1688 -4.2613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9105 -4.6237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0917 -5.4230 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9049 -5.4277 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9074 -6.4347 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7074 -6.4223 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2213 -5.7783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0475 -5.7737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5535 -6.4207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3741 -7.2260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6285 -7.5790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8907 -7.2221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2466 -7.7352 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 3 2 1 0 0 0 0\n 2 8 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 11 1 0 0 0 0\n 11 17 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 2 0 0 0 0\nM END", "smiles": "C1CCC(=O)N(CC1)SSN2CCCCCC2=O", "formula": "C12H20N2O2S2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "6604d469-e531-44d2-b6d0-82510e85841a" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "288.432", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "70824f52-74fe-466d-aff7-fd03f66abd61", "version": "3", "structure": { "id": "dc1ef3bb-ce77-47df-b3fe-f0b7801739e6", "molfile": "\n Marvin 01132111252D \n\n 18 19 0 0 0 0 999 V2000\n 3.9387 -6.8070 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5808 -6.0649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0914 -5.4226 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9102 -4.6234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1686 -4.2610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4275 -4.6234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2381 -5.4226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7569 -6.0649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9046 -5.4273 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9071 -6.4342 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7070 -6.4218 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8903 -7.2216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2462 -7.7347 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6280 -7.5785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3736 -7.2255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5530 -6.4202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0470 -5.7733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2209 -5.7779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 2 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 12 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 11 1 0 0 0 0\n 9 3 1 0 0 0 0\nM END", "smiles": "C1CCC(=O)N(CC1)SSN2CCCCCC2=O", "formula": "C12H20N2O2S2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "288.432", "optical_activity": "NONE", "references": [ "05366bbb-022b-45cc-bfb8-42ac1e789550", "7b9ff92b-7b2a-46d6-92c1-49e533ac5b7a" ], "stereo_centers": 0 }, "unii": "4R1UA4H6WN" } ] }