{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2a0ca2da-c5b2-49ef-851f-f2bda1d267d8",
          "code": "4097-22-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4097-22-7",
          "code_system": "CAS",
          "references": [
            "2241fffa-79cf-4c2d-bfe2-04747d17351f",
            "8d1f0f44-f71b-423a-97e7-d2d6033af79c"
          ]
        },
        {
          "uuid": "33825b4f-55e1-4679-ae2f-2163d1462596",
          "code": "C429",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C429",
          "code_system": "NCI_THESAURUS",
          "references": [
            "2241fffa-79cf-4c2d-bfe2-04747d17351f"
          ]
        },
        {
          "uuid": "0ad52a30-778c-4e5c-a784-d6afacd243d9",
          "code": "223-853-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.021.685",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "2241fffa-79cf-4c2d-bfe2-04747d17351f"
          ]
        },
        {
          "uuid": "dbc4b1ee-a107-40f0-8a8d-200dda7f5d3c",
          "code": "m4382",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4382?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "2241fffa-79cf-4c2d-bfe2-04747d17351f"
          ]
        },
        {
          "uuid": "563cb7ee-fe62-4d06-a4f7-20281abdc735",
          "code": "20039",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/20039",
          "code_system": "PUBCHEM",
          "references": [
            "2241fffa-79cf-4c2d-bfe2-04747d17351f"
          ]
        },
        {
          "uuid": "d8d39f19-41dd-8ad8-417c-ac0c5487761a",
          "code": "DTXSID2023771",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2023771",
          "code_system": "EPA CompTox",
          "references": [
            "8514dbb9-f9ed-72b1-b3d8-486d4ae38d98"
          ]
        },
        {
          "uuid": "0a9b81a6-e308-11c8-eab3-04e3971e0bfe",
          "code": "20587",
          "comments": "ORPHAN DRUG|Designated/Withdrawn|Treatment of aquired immunodeficiency syndrome.",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=20587",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "59dadc80-8e19-d811-7bca-ee696e4a69bb",
          "code": "C97452",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Antiviral Agent[C281]|Reverse Transcriptase Inhibitor[C1589]|Nucleoside Reverse Transcriptase Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C97452",
          "code_system": "NCI_THESAURUS",
          "references": [
            "0f280cac-ea6c-179a-e908-9aed0949386e"
          ]
        },
        {
          "uuid": "1b49f2e2-2f49-1a3a-c293-fca68405aec7",
          "code": "C707",
          "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Nucleic Acids, Nucleosides, and Nucleotides[C708]|Nucleoside",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C707",
          "code_system": "NCI_THESAURUS",
          "references": [
            "0f280cac-ea6c-179a-e908-9aed0949386e"
          ]
        },
        {
          "uuid": "5690daf7-f03d-4da6-b79e-d96293b66bac",
          "code": "4Q86AH641A",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4ef08833-0d5f-347d-c31e-94de227f5c2c",
          "code": "1191237",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1191237",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "0f280cac-ea6c-179a-e908-9aed0949386e"
          ]
        },
        {
          "uuid": "caaca233-3894-8385-5599-43546986ed41",
          "code": "91207",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:91207",
          "code_system": "CHEBI",
          "references": [
            "0f280cac-ea6c-179a-e908-9aed0949386e"
          ]
        },
        {
          "uuid": "cdde36e3-3520-0ee6-d180-48ee02c812ee",
          "code": "98700",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=98700",
          "code_system": "NSC",
          "references": [
            "2e118a86-b9e1-aa9e-4d6a-b7c5b5c636d0"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "74c68cf8-97d3-4119-b650-b729f889868a",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "d17e2ae7-a0fd-474f-913d-ceb3522ce25e",
            "refuuid": "4e795252-90f5-4f1c-9cd1-6a9d4741c3a9",
            "name": "DIDEOXYADENOSINE",
            "unii": "4Q86AH641A",
            "linking_id": "4Q86AH641A",
            "ref_pname": "DIDEOXYADENOSINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b5f0ab02-44b1-4707-b381-75366e886964",
          "amount": {
            "uuid": "9d183a7c-75d2-45dd-b9b5-0559332b1068",
            "type": "WEIGHT PERCENT",
            "units": "%",
            "high_limit": 0.2,
            "non_numeric_value": "peak value"
          },
          "comments": "In the chromatogram obtained with solution (2), the following peaks are eluted at the following relative retention with reference to didanosine (retention time about 13-15 min): impurity G about 1.6.\nThe area of any individual peak corresponding to impurity G is not greater than 0.2 times the area of the principal peak obtained with solution (4) (0.2%).",
          "qualification": "EP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "322c22f8-7232-4631-94b4-96e114bbcad0"
          ],
          "related_substance": {
            "uuid": "b03b2f73-6d9c-4d13-bfa1-9fd75d446380",
            "refuuid": "24c2491a-b47f-429f-b9e0-96eaa7c23c4b",
            "name": "DIDANOSINE",
            "unii": "K3GDH6OH08",
            "linking_id": "K3GDH6OH08",
            "ref_pname": "DIDANOSINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a474a1b6-c66a-4a9f-ba6c-35c70e1c9e0d",
          "name": "2',3'-DIDEOXYADENOSINE",
          "stdName": "2',3'-DIDEOXYADENOSINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7f60ccac-78f3-451e-b4fb-42d7982ed2c2",
            "f52a8dee-c734-4775-a8b5-8d45ea87cb52",
            "ad128eb6-f346-4da2-aec4-101ba5e3256d",
            "35a51fc3-2ca6-4158-844a-86f1fcaa0b53"
          ],
          "display_name": false
        },
        {
          "uuid": "5c8c9f9d-e861-44c3-bc43-773d1c43a7e3",
          "name": "2',3'-DIDEOXYADENOSINE [WHO-IP]",
          "stdName": "2',3'-DIDEOXYADENOSINE [WHO-IP]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f52a8dee-c734-4775-a8b5-8d45ea87cb52",
            "ad128eb6-f346-4da2-aec4-101ba5e3256d"
          ],
          "display_name": false
        },
        {
          "uuid": "18eede48-fd95-4199-8ac0-b66b85aa798f",
          "name": "2'-3'-DIDEOXYADENOSINE",
          "stdName": "2'-3'-DIDEOXYADENOSINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad128eb6-f346-4da2-aec4-101ba5e3256d",
            "0ab5a5d6-4c91-4de5-a1e1-0f01b87414b5"
          ],
          "display_name": false
        },
        {
          "uuid": "82dc0996-e88f-4af7-a2d5-999dcd0ec268",
          "name": "6-AMINO-9-(2',3'-DIDEOXY-.BETA.-D-GLYCERO-PENTOFURANOSYL)PURINE",
          "stdName": "6-AMINO-9-(2',3'-DIDEOXY-.BETA.-D-GLYCERO-PENTOFURANOSYL)PURINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7f60ccac-78f3-451e-b4fb-42d7982ed2c2",
            "ad128eb6-f346-4da2-aec4-101ba5e3256d"
          ],
          "display_name": false
        },
        {
          "uuid": "c7bddbcb-3ae1-49c8-a603-782eaf635fd1",
          "name": "9-(2,3-DIDEOXY-.BETA.-D-GLYCERO-PENTOFURANOSYL)-9H-PURIN-6-AMINE [WHO-IP]",
          "stdName": "9-(2,3-DIDEOXY-.BETA.-D-GLYCERO-PENTOFURANOSYL)-9H-PURIN-6-AMINE [WHO-IP]",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f52a8dee-c734-4775-a8b5-8d45ea87cb52",
            "ad128eb6-f346-4da2-aec4-101ba5e3256d"
          ],
          "display_name": false
        },
        {
          "uuid": "fec4bdfd-ba8e-42f8-8c5e-4b013ed09a6e",
          "name": "DDA",
          "stdName": "DDA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7f60ccac-78f3-451e-b4fb-42d7982ed2c2",
            "ad128eb6-f346-4da2-aec4-101ba5e3256d"
          ],
          "display_name": false
        },
        {
          "uuid": "0a2fbef1-270e-4738-8a0d-66d25669812e",
          "name": "DIDANOSINE IMPURITY G",
          "stdName": "DIDANOSINE IMPURITY G",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f52a8dee-c734-4775-a8b5-8d45ea87cb52",
            "ad128eb6-f346-4da2-aec4-101ba5e3256d",
            "d21ddec0-5498-48d6-92c0-dd01f28c5f14",
            "82b68847-cdf8-429f-9db4-36c8704de7c9",
            "33fcf870-0a7f-4367-9f6a-9c87ed8635c9"
          ],
          "display_name": false
        },
        {
          "uuid": "45677a06-e6b7-e037-d555-d30f69d65862",
          "name": "DIDANOSINE IMPURITY G [EP IMPURITY]",
          "stdName": "DIDANOSINE IMPURITY G [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e73eed81-fa66-2f6c-e206-a74befd90cee",
            "ad128eb6-f346-4da2-aec4-101ba5e3256d",
            "33fcf870-0a7f-4367-9f6a-9c87ed8635c9"
          ],
          "display_name": false
        },
        {
          "uuid": "f14a7cf2-2576-4058-a290-2959829fa986",
          "name": "DIDANOSINE IMPURITY G [WHO-IP]",
          "stdName": "DIDANOSINE IMPURITY G [WHO-IP]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f52a8dee-c734-4775-a8b5-8d45ea87cb52",
            "ad128eb6-f346-4da2-aec4-101ba5e3256d"
          ],
          "display_name": false
        },
        {
          "uuid": "e49d286f-1a25-4c25-8c8e-0285ab66b327",
          "name": "DIDANOSINE RELATED COMPOUND B",
          "stdName": "DIDANOSINE RELATED COMPOUND B",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b540e53-7205-4714-894c-c21804de1b0f",
            "ad128eb6-f346-4da2-aec4-101ba5e3256d",
            "d63d17af-1767-438d-8f84-60a63558735e",
            "e29b9540-a5d2-467e-beb5-4c2489330fdb"
          ],
          "display_name": false
        },
        {
          "uuid": "90433b21-8421-8dd6-cc1e-eed3a1bf030a",
          "name": "DIDANOSINE RELATED COMPOUND B [USP IMPURITY]",
          "stdName": "DIDANOSINE RELATED COMPOUND B [USP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad128eb6-f346-4da2-aec4-101ba5e3256d",
            "e29b9540-a5d2-467e-beb5-4c2489330fdb"
          ],
          "display_name": false
        },
        {
          "uuid": "75a68198-9cbf-47b5-a7bd-ee44c0aea89e",
          "name": "DIDANOSINE RELATED COMPOUND B [USP-RS]",
          "stdName": "DIDANOSINE RELATED COMPOUND B [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad128eb6-f346-4da2-aec4-101ba5e3256d",
            "e29b9540-a5d2-467e-beb5-4c2489330fdb"
          ],
          "display_name": false
        },
        {
          "uuid": "e11b83ca-0316-421f-89f1-a2b126688d4f",
          "name": "DIDEOXYADENOSINE",
          "stdName": "DIDEOXYADENOSINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7f60ccac-78f3-451e-b4fb-42d7982ed2c2",
            "23622c28-e79d-4dc9-a806-715806db9be9",
            "ad128eb6-f346-4da2-aec4-101ba5e3256d",
            "284b8027-4059-4053-bc92-bdd20c9361c4",
            "c02e2620-2b7f-462f-86a7-a39677491237",
            "5fed566d-ba2a-4c5c-9feb-c61199d80432"
          ],
          "display_name": true
        },
        {
          "uuid": "3e9a996e-2797-4b5b-999c-5f624e45eda0",
          "name": "DIDEOXYADENOSINE [MART.]",
          "stdName": "DIDEOXYADENOSINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5fed566d-ba2a-4c5c-9feb-c61199d80432"
          ],
          "display_name": false
        },
        {
          "uuid": "a5a6bd69-4acd-4cae-96c0-03e74deb0dcb",
          "name": "DIDEOXYADENOSINE [MI]",
          "stdName": "DIDEOXYADENOSINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad128eb6-f346-4da2-aec4-101ba5e3256d",
            "284b8027-4059-4053-bc92-bdd20c9361c4"
          ],
          "display_name": false
        },
        {
          "uuid": "a3d97490-3add-40ce-8b6d-a3f81c19f2f8",
          "name": "NSC-98700",
          "stdName": "NSC-98700",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2849d8ab-c75b-4e91-9088-fcf32a897b76",
            "ad128eb6-f346-4da2-aec4-101ba5e3256d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2849d8ab-c75b-4e91-9088-fcf32a897b76",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad128eb6-f346-4da2-aec4-101ba5e3256d",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5fed566d-ba2a-4c5c-9feb-c61199d80432",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "284b8027-4059-4053-bc92-bdd20c9361c4",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e29b9540-a5d2-467e-beb5-4c2489330fdb",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ab5a5d6-4c91-4de5-a1e1-0f01b87414b5",
          "citation": "ORPHAN DRUG",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33fcf870-0a7f-4367-9f6a-9c87ed8635c9",
          "citation": "EP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f52a8dee-c734-4775-a8b5-8d45ea87cb52",
          "citation": "WHO-IP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2241fffa-79cf-4c2d-bfe2-04747d17351f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391742000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "322c22f8-7232-4631-94b4-96e114bbcad0",
          "citation": "THE INTERNATIONAL PHARMACOPOEIA FIFTH EDITION",
          "url": "http://apps.who.int/phint/en/p/docf/",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d76ea872-9766-499b-9817-e43dafd62554",
          "citation": "SRS import [4Q86AH641A]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4Q86AH641A",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391742000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b1bc3e70-c229-4b47-bcf9-adf6d88542e6",
          "citation": "martindale",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c02e2620-2b7f-462f-86a7-a39677491237",
          "citation": "DIDEOXYADENOSINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "23622c28-e79d-4dc9-a806-715806db9be9",
          "citation": "DIDEOXYADENOSINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2b540e53-7205-4714-894c-c21804de1b0f",
          "citation": "DIDANOSINE RELATED COMPOUND B [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "82b68847-cdf8-429f-9db4-36c8704de7c9",
          "citation": "DIDANOSINE IMPURITY G [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d63d17af-1767-438d-8f84-60a63558735e",
          "citation": "DIDANOSINE RELATED COMPOUND B [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "35a51fc3-2ca6-4158-844a-86f1fcaa0b53",
          "citation": "2',3'-DIDEOXYADENOSINE [WHO-IP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d21ddec0-5498-48d6-92c0-dd01f28c5f14",
          "citation": "DIDANOSINE IMPURITY G [WHO-IP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7f60ccac-78f3-451e-b4fb-42d7982ed2c2",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8514dbb9-f9ed-72b1-b3d8-486d4ae38d98",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4097-22-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e73eed81-fa66-2f6c-e206-a74befd90cee",
          "citation": "EP",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0f280cac-ea6c-179a-e908-9aed0949386e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "8d1f0f44-f71b-423a-97e7-d2d6033af79c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2e118a86-b9e1-aa9e-4d6a-b7c5b5c636d0",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2f78da8e-fadf-4535-a227-1795ad748bef",
          "id": "2f78da8e-fadf-4535-a227-1795ad748bef",
          "molfile": "\n  Marvin  01132102332D          \n\n 17 19  0  0  1  0            999 V2000\n    8.0867   -2.5786    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.3918   -2.2435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6217   -2.2435    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3467   -3.3485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1717   -3.3485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4068   -2.5885    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.7418   -2.0986    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8668   -0.8936    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8668   -0.0436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2618    0.4214    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6618   -0.0286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9168    0.4014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9168    1.2764    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1618   -0.0286    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1618   -0.8936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9168   -1.3236    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6618   -0.8936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  4  1  1  0  0  0  0\n  1  7  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  6  0  0  0\n  6  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 17  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 17  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
          "smiles": "C1C[C@H](n2cnc3c(N)ncnc32)O[C@@H]1CO",
          "formula": "C10H13N5O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c0a73739-9ce1-49a9-b5dc-68fb553832de"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "235.2429",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4e795252-90f5-4f1c-9cd1-6a9d4741c3a9",
      "version": "16",
      "structure": {
        "id": "be1f3713-ea99-4cf4-bce1-569a5fea1adc",
        "molfile": "\n  Marvin  01132109502D          \n\n 17 19  0  0  1  0            999 V2000\n    9.8668   -0.8936    0.0000 N   0  0  2  0  0  0  0  0  0  0  0  0\n    8.6618   -0.8936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6618   -0.0286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9168    0.4014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1618   -0.0286    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1618   -0.8936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9168   -1.3236    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9168    1.2764    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2618    0.4214    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8668   -0.0436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4068   -2.5885    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.7418   -2.0986    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0867   -2.5786    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.3918   -2.2435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6217   -2.2435    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3467   -3.3485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1717   -3.3485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  2  1  0  0  0  0\n  8  4  1  0  0  0  0\n  9  3  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10  1  1  0  0  0  0\n 11  1  1  1  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  1  0  0  0\n 15 14  1  0  0  0  0\n 16 13  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 11  1  0  0  0  0\nM  END",
        "smiles": "C1C[C@H](n2cnc3c(N)ncnc32)O[C@@H]1CO",
        "formula": "C10H13N5O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "235.2429",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b1bc3e70-c229-4b47-bcf9-adf6d88542e6",
          "d76ea872-9766-499b-9817-e43dafd62554"
        ],
        "stereo_centers": 2
      },
      "unii": "4Q86AH641A"
    }
  ]
}