{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bd6e3b42-0b93-4538-a97a-e445f58450ab",
          "code": "1195-79-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1195-79-5",
          "code_system": "CAS",
          "references": [
            "15c1dfbb-bc38-4bbe-a294-de3edc5a4c7b",
            "a892a7d8-faed-4825-aa56-e0485717fd6b"
          ]
        },
        {
          "uuid": "993a551e-5499-42fe-861c-046a28c493eb",
          "code": "214-804-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.013.458",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "15c1dfbb-bc38-4bbe-a294-de3edc5a4c7b"
          ]
        },
        {
          "uuid": "e93dac41-b97c-25aa-e8aa-a4ba7e4688cf",
          "code": "Fenchone",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Fenchone",
          "code_system": "WIKIPEDIA",
          "references": [
            "6fc5b03c-3bbb-ff8d-9d27-55f891e82e5d"
          ]
        },
        {
          "uuid": "c04fb97c-d580-8816-c54d-45c1820334af",
          "code": "DTXSID9025324",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9025324",
          "code_system": "EPA CompTox",
          "references": [
            "fb241a2c-e57d-a20e-3d24-91459ca8e1c1"
          ]
        },
        {
          "uuid": "451f22c0-fda4-4aa6-8878-38517f76f660",
          "code": "4Q6W8568TG",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "50570188-aac7-db4a-d829-30390722cf5c",
          "code": "4999",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:4999",
          "code_system": "CHEBI",
          "references": [
            "8045b46f-8307-00e1-1e9c-97730dd0ef7b"
          ]
        },
        {
          "uuid": "77010075-1463-892c-a307-7fef7945e8d9",
          "code": "122687",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=122687",
          "code_system": "NSC",
          "references": [
            "a10fc9d4-bfdc-8af4-ae03-0765f2159078"
          ]
        },
        {
          "uuid": "09a17e15-2ae2-d06c-6473-fa18cd69eb9a",
          "code": "8896",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=8896",
          "code_system": "NSC",
          "references": [
            "a10fc9d4-bfdc-8af4-ae03-0765f2159078"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "e40c3596-30eb-4d43-94a8-e55534baac87",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "ff4e478a-325f-45a9-85c0-6b9f5b0f37ac"
          ],
          "related_substance": {
            "uuid": "43383a01-db96-408b-9a85-2f8fb996fc79",
            "refuuid": "085dbad0-1b5b-421d-bedf-1d20157ee494",
            "name": "PEUMUS BOLDUS LEAF",
            "unii": "Q4EWM09M3O",
            "linking_id": "Q4EWM09M3O",
            "ref_pname": "PEUMUS BOLDUS LEAF",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6bd36196-1f7f-4eb4-873c-1b8877abec0c",
          "comments": "Monoterpene Class",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "6bb01198-730f-443d-89ac-8afbd7fc39ba"
          ],
          "related_substance": {
            "uuid": "229c9164-c391-490a-af5f-f349e82dd5bd",
            "refuuid": "8e61faef-71bb-4cbd-8b70-716ea0fd1d02",
            "name": "CANNABIS SATIVA SUBSP. INDICA TOP",
            "unii": "FTS5RM302N",
            "linking_id": "FTS5RM302N",
            "ref_pname": "CANNABIS SATIVA SUBSP. INDICA TOP",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2612b4f3-c391-4c2b-b874-a4cb22a6e935",
          "name": "(±)-FENCHONE",
          "stdName": "(+/-)-FENCHONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee06c0e7-0888-4f09-8075-cb54011c758c",
            "d79b28cb-e1bc-4f6a-bd3c-97b3822ee806"
          ],
          "display_name": false
        },
        {
          "uuid": "5f8924b4-c7dc-4e43-9380-efc2ba85be48",
          "name": "1,3,3-TRIMETHYL-2-NORBORNANONE",
          "stdName": "1,3,3-TRIMETHYL-2-NORBORNANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22bf026b-1da1-40f1-b208-ddf4654e1f68",
            "d79b28cb-e1bc-4f6a-bd3c-97b3822ee806"
          ],
          "display_name": false
        },
        {
          "uuid": "9c992a1d-a0d5-4d5e-a45b-a602eb2ba9e3",
          "name": "1,3,3-TRIMETHYL-2-NORCAMPHANONE",
          "stdName": "1,3,3-TRIMETHYL-2-NORCAMPHANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22bf026b-1da1-40f1-b208-ddf4654e1f68",
            "d79b28cb-e1bc-4f6a-bd3c-97b3822ee806"
          ],
          "display_name": false
        },
        {
          "uuid": "8d8af12f-20b8-4e4a-aaf4-02395ac025d1",
          "name": "1,3,3-TRIMETHYLBICYCLO(2.2.1)HEPTAN-2-ONE",
          "stdName": "1,3,3-TRIMETHYLBICYCLO(2.2.1)HEPTAN-2-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22bf026b-1da1-40f1-b208-ddf4654e1f68",
            "d79b28cb-e1bc-4f6a-bd3c-97b3822ee806"
          ],
          "display_name": false
        },
        {
          "uuid": "237d2db7-8991-4093-b547-f2d59ead9ea7",
          "name": "1,3,3-TRIMETHYLNORCAMPHOR",
          "stdName": "1,3,3-TRIMETHYLNORCAMPHOR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22bf026b-1da1-40f1-b208-ddf4654e1f68",
            "d79b28cb-e1bc-4f6a-bd3c-97b3822ee806"
          ],
          "display_name": false
        },
        {
          "uuid": "115c42fa-5005-4588-a818-c6592e1b683c",
          "name": "2-NORBORNANONE, 1,3,3-TRIMETHYL-",
          "stdName": "2-NORBORNANONE, 1,3,3-TRIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22bf026b-1da1-40f1-b208-ddf4654e1f68",
            "d79b28cb-e1bc-4f6a-bd3c-97b3822ee806"
          ],
          "display_name": false
        },
        {
          "uuid": "38d07f30-773d-448a-92b6-f14ff24c307a",
          "name": "3,3-DIMETHYL-8,9-DINORBORNAN-2-ONE",
          "stdName": "3,3-DIMETHYL-8,9-DINORBORNAN-2-ONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22bf026b-1da1-40f1-b208-ddf4654e1f68",
            "d79b28cb-e1bc-4f6a-bd3c-97b3822ee806"
          ],
          "display_name": false
        },
        {
          "uuid": "ae6b765f-4a1e-4d5e-a090-a85852749f26",
          "name": "BICYCLO(2.2.1)HEPTAN-2-ONE, 1,3,3-TRIMETHYL-",
          "stdName": "BICYCLO(2.2.1)HEPTAN-2-ONE, 1,3,3-TRIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22bf026b-1da1-40f1-b208-ddf4654e1f68",
            "d79b28cb-e1bc-4f6a-bd3c-97b3822ee806"
          ],
          "display_name": false
        },
        {
          "uuid": "656a522e-a550-4ca7-b746-6b1164d916ab",
          "name": "DL-FENCHONE",
          "stdName": "DL-FENCHONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22bf026b-1da1-40f1-b208-ddf4654e1f68",
            "d79b28cb-e1bc-4f6a-bd3c-97b3822ee806"
          ],
          "display_name": false
        },
        {
          "uuid": "55369b45-0f3d-4334-8d7e-e4def1b64006",
          "name": "FENCHON",
          "stdName": "FENCHON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22bf026b-1da1-40f1-b208-ddf4654e1f68",
            "d79b28cb-e1bc-4f6a-bd3c-97b3822ee806"
          ],
          "display_name": false
        },
        {
          "uuid": "2dd63612-bde6-45b2-91ef-36fea3d860b8",
          "name": "FENCHONE, (±)-",
          "stdName": "FENCHONE, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2e4f98d8-4088-4688-8c18-0638e0a93b5a",
            "d79b28cb-e1bc-4f6a-bd3c-97b3822ee806"
          ],
          "display_name": true
        },
        {
          "uuid": "bc95cac6-0eca-4cad-ac1a-aeec16215e5c",
          "name": "NSC-122687",
          "stdName": "NSC-122687",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee06c0e7-0888-4f09-8075-cb54011c758c",
            "d79b28cb-e1bc-4f6a-bd3c-97b3822ee806"
          ],
          "display_name": false
        },
        {
          "uuid": "f753d3a0-d5f5-4545-a1a0-bba95e2455e9",
          "name": "NSC-8896",
          "stdName": "NSC-8896",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee06c0e7-0888-4f09-8075-cb54011c758c",
            "d79b28cb-e1bc-4f6a-bd3c-97b3822ee806"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2e4f98d8-4088-4688-8c18-0638e0a93b5a",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d79b28cb-e1bc-4f6a-bd3c-97b3822ee806",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee06c0e7-0888-4f09-8075-cb54011c758c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22bf026b-1da1-40f1-b208-ddf4654e1f68",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "15c1dfbb-bc38-4bbe-a294-de3edc5a4c7b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391912000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff4e478a-325f-45a9-85c0-6b9f5b0f37ac",
          "citation": "HERBAL MEDICINES 4TH ED 2013",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6bb01198-730f-443d-89ac-8afbd7fc39ba",
          "citation": "CHAPTER 2 : CHEMISTRY AND ANALYSIS OF PHYTOCANNABINOIDS AND OTHER CANNABIS CONSTITUENTS BY RUDOLF BRENNEISEN; PAGES 17-49",
          "url": "http://www.medicinalgenomics.com/wp-content/uploads/2011/12/Chemical-constituents-of-cannabis.pdf",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eed21e1b-9702-41c6-b7a0-20a494cfc9ac",
          "citation": "SRS import [4Q6W8568TG]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4Q6W8568TG",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391912000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6fc5b03c-3bbb-ff8d-9d27-55f891e82e5d",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Fenchone",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fb241a2c-e57d-a20e-3d24-91459ca8e1c1",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1195-79-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a892a7d8-faed-4825-aa56-e0485717fd6b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "8045b46f-8307-00e1-1e9c-97730dd0ef7b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a10fc9d4-bfdc-8af4-ae03-0765f2159078",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "1234e982-804e-4a49-8438-51b42409eaeb",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ecc2afda-5d04-4bbe-95d2-257ea0757e8f",
          "id": "ecc2afda-5d04-4bbe-95d2-257ea0757e8f",
          "molfile": "\n  Marvin  01132112152D          \n\n 11 12  0  0  0  0            999 V2000\n    7.6088   -5.5332    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.8018   -5.6789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3320   -6.3582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1438   -6.2075    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.0734   -7.0321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2586   -4.7912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9159   -6.4863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1649   -7.2736    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3857   -5.8119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1004   -6.2182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7279   -5.0612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  6  1  1  0  0  0\n  1  9  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n  4  6  1  0  0  0  0\n  7  4  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  7  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\nM  END",
          "smiles": "CC1(C)[C@H]2CC[C@](C)(C2)C1=O",
          "formula": "C10H16O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "693fb635-ab53-4471-8b8c-18c4c8112029"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "152.2338",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2266125a-3987-4cda-b319-dabefe16d6fc",
      "version": "11",
      "structure": {
        "id": "db050dcf-8f20-467c-8404-78e246a90655",
        "molfile": "\n  Marvin  01132111222D          \n\n 11 12  0  0  0  0            999 V2000\n    7.6088   -5.5332    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.3857   -5.8119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1004   -6.2182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7279   -5.0612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9159   -6.4863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1438   -6.2075    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.0734   -7.0321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3320   -6.3582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8018   -5.6789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2586   -4.7912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1649   -7.2736    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  1  9  1  0  0  0  0\n  6 10  1  1  0  0  0\n  1 10  1  1  0  0  0\n  5 11  2  0  0  0  0\nM  END",
        "smiles": "CC1(C)[C@H]2CC[C@](C)(C2)C1=O",
        "formula": "C10H16O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "152.2338",
        "optical_activity": "( + / - )",
        "references": [
          "22bf026b-1da1-40f1-b208-ddf4654e1f68",
          "eed21e1b-9702-41c6-b7a0-20a494cfc9ac"
        ],
        "stereo_centers": 2
      },
      "unii": "4Q6W8568TG"
    }
  ]
}