{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "35a14f26-46b8-4ea5-bfb4-63fa8341b702",
          "code": "217798-39-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=217798-39-5",
          "code_system": "CAS",
          "references": [
            "ff2970bf-9a9c-41c0-a05f-8c6de45ca578",
            "fa4fbd3c-ce03-43f9-85ec-876ebc5bbb7a"
          ]
        },
        {
          "uuid": "5d86bd59-4dbc-024d-ae2f-55ac3bafa432",
          "code": "C471",
          "comments": "Pharmacologic Substance[C1909]|Enzyme Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C471",
          "code_system": "NCI_THESAURUS",
          "references": [
            "63df4828-96b7-90d0-58cb-abd31ae38da8"
          ]
        },
        {
          "uuid": "5c277055-58de-f66f-04ae-6ebbe880a4f0",
          "code": "C116713",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C116713",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f81ef94b-bb1f-b358-9048-9fa26c56062a"
          ]
        },
        {
          "uuid": "b1217f74-7942-4d53-6cb6-994be71d2eb5",
          "code": "10387485",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10387485",
          "code_system": "PUBCHEM",
          "references": [
            "457fda26-bf05-3b72-dc0f-9d5e0b14b340"
          ]
        },
        {
          "uuid": "fade67d4-d45b-ca9c-e05a-b5c21895a545",
          "code": "DB15051",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB15051",
          "code_system": "DRUG BANK",
          "references": [
            "91899791-32ac-c0ca-56e0-f340eba1ec10"
          ]
        },
        {
          "uuid": "9142e17a-7e65-41b4-8fb1-31deae359cae",
          "code": "4Q2EZS1IWG",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "dfdc5332-b6f5-43d1-96bd-867388882947",
          "comments": "Mammalian thioredoxin reductase 1 (TrxR1) is considered to be an important anticancer drug target and to be involved in both carcinogenesis and cancer progression. Ethaselen was found to be a potent inhibitor rather than an efficient substrate of mammalian TrxR1. It effectively inhibits wild-type mammalian TrxR1 at submicromolar concentrations with an initial mixed-type inhibition pattern. By using recombinant human TrxR1 variants and human glutathione reductase, we prove that ethaselen specifically targets the C-terminal but not the N-terminal active site of mammalian TrxR1. In A549 human lung cancer cells, ethaselen significantly suppresses cell viability in parallel with direct inhibition of TrxR1 activity.",
          "type": "ACTIVE MOIETY",
          "references": [
            "ad8d7edd-9450-4acc-b3b5-024164ba39a3"
          ],
          "related_substance": {
            "uuid": "5127ec01-4e05-4b1e-bd44-8be6c7a3f10e",
            "refuuid": "101061a6-01a8-4170-8c29-4db8cadf8653",
            "name": "ETHASELEN",
            "unii": "4Q2EZS1IWG",
            "linking_id": "4Q2EZS1IWG",
            "ref_pname": "ETHASELEN",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f57d6f88-b944-4a87-ac14-dbea85d73de4",
          "name": "1,2-BENZISOSELENAZOL-3(2H)-ONE, 2,2'-(1,2-ETHANEDIYL)BIS-",
          "stdName": "1,2-BENZISOSELENAZOL-3(2H)-ONE, 2,2'-(1,2-ETHANEDIYL)BIS-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d0f9e39-f45c-4722-aad2-692d93fcd0e8",
            "4f2efc0f-bd33-4f37-b294-611705825216"
          ],
          "display_name": false
        },
        {
          "uuid": "0cb3f42b-7a30-4096-889f-d1d7fc229914",
          "name": "2,2'-(1,2-ETHANEDIYL)BIS(1,2-BENZISOSELENAZOL-3(2H)-ONE)",
          "stdName": "2,2'-(1,2-ETHANEDIYL)BIS(1,2-BENZISOSELENAZOL-3(2H)-ONE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d0f9e39-f45c-4722-aad2-692d93fcd0e8",
            "4f2efc0f-bd33-4f37-b294-611705825216"
          ],
          "display_name": false
        },
        {
          "uuid": "83ab9e10-f226-4047-a497-8a4312cef170",
          "name": "BBSKE",
          "stdName": "BBSKE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f2efc0f-bd33-4f37-b294-611705825216",
            "12cfaeeb-8f8a-488d-ae6e-bf8b14ce3fdd"
          ],
          "display_name": false
        },
        {
          "uuid": "45aa967f-26c0-4e54-9242-b0fc998f778e",
          "name": "COMPOUND EB",
          "stdName": "COMPOUND EB",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f2efc0f-bd33-4f37-b294-611705825216",
            "12cfaeeb-8f8a-488d-ae6e-bf8b14ce3fdd"
          ],
          "display_name": false
        },
        {
          "uuid": "db29a076-f50d-4f3f-bb9c-5a8d600534d6",
          "name": "EB",
          "stdName": "EB",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d0f9e39-f45c-4722-aad2-692d93fcd0e8",
            "4f2efc0f-bd33-4f37-b294-611705825216"
          ],
          "display_name": false
        },
        {
          "uuid": "7740a484-e801-4246-8e21-3bd0eb3ecbac",
          "name": "ETHASELEN",
          "stdName": "ETHASELEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f2efc0f-bd33-4f37-b294-611705825216",
            "12cfaeeb-8f8a-488d-ae6e-bf8b14ce3fdd"
          ],
          "display_name": true
        },
        {
          "uuid": "85b39776-73ac-49cb-8632-922603349ace",
          "name": "ETHASELEN-1",
          "stdName": "ETHASELEN-1",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f2efc0f-bd33-4f37-b294-611705825216",
            "12cfaeeb-8f8a-488d-ae6e-bf8b14ce3fdd"
          ],
          "display_name": false
        },
        {
          "uuid": "e507da28-3a9e-4720-9f04-6bbca2e238e2",
          "name": "SHUANG-XI-ZUO-WAN-1",
          "stdName": "SHUANG-XI-ZUO-WAN-1",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f2efc0f-bd33-4f37-b294-611705825216",
            "12cfaeeb-8f8a-488d-ae6e-bf8b14ce3fdd"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "12cfaeeb-8f8a-488d-ae6e-bf8b14ce3fdd",
          "citation": "NCATSLIST",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4f2efc0f-bd33-4f37-b294-611705825216",
          "citation": "NCATS List",
          "doc_type": "NCATS List",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6d0f9e39-f45c-4722-aad2-692d93fcd0e8",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff2970bf-9a9c-41c0-a05f-8c6de45ca578",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393485000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad8d7edd-9450-4acc-b3b5-024164ba39a3",
          "citation": "FREE RADICAL BIOLOGY AND MEDICINE\\\\nVOLUME 52, ISSUE 5, 1 MARCH 2012, PAGES 898?908",
          "url": "http://www.sciencedirect.com/science/article/pii/S0891584911012214",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "63df4828-96b7-90d0-58cb-abd31ae38da8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "457fda26-bf05-3b72-dc0f-9d5e0b14b340",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "fa4fbd3c-ce03-43f9-85ec-876ebc5bbb7a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "91899791-32ac-c0ca-56e0-f340eba1ec10",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "f81ef94b-bb1f-b358-9048-9fa26c56062a",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "35f1a869-cd41-475c-904d-c0f47f552640",
          "id": "35f1a869-cd41-475c-904d-c0f47f552640",
          "molfile": "\n  Marvin  01132102522D          \n\n 22 25  0  0  0  0            999 V2000\n   13.0294  -16.2341    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7745  -15.4495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2594  -14.7821    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0844  -14.7821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4969  -14.0677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3219  -14.0677    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8068  -14.7351    0.0000 Se  0  0  0  0  0  0  0  0  0  0  0  0\n   16.5915  -14.4801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3060  -14.8927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.0204  -14.4801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.0204  -13.6551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3060  -13.2427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5915  -13.6551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8068  -13.4002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5519  -12.6155    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7745  -14.1147    0.0000 Se  0  0  0  0  0  0  0  0  0  0  0  0\n   11.9898  -14.3696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2754  -13.9571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5610  -14.3696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5610  -15.1946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2754  -15.6071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9898  -15.1947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  2 22  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3 16  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 14  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 13  2  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 22  2  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)c(=O)n(CCn3c(=O)c4ccccc4[se]3)[se]2",
          "formula": "C16H12N2O2Se2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "70d57729-7c29-4fa5-a85c-0f4e1b47e606"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "422.1981",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "101061a6-01a8-4170-8c29-4db8cadf8653",
      "version": "8",
      "structure": {
        "id": "eb1ec0c3-8fb3-43c5-899f-a52a17af90a6",
        "molfile": "\n  Marvin  01132112102D          \n\n 22 25  0  0  0  0            999 V2000\n   14.0153   -5.8794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7603   -5.0948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2452   -4.4274    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0702   -4.4274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4828   -3.7129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3078   -3.7129    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7928   -4.3803    0.0000 Se  0  0  0  0  0  0  0  0  0  0  0  0\n   17.5774   -4.1254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.2920   -4.5379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.0064   -4.1254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.0064   -3.3003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.2920   -2.8879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.5774   -3.3003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7928   -3.0454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5378   -2.2608    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7603   -3.7600    0.0000 Se  0  0  0  0  0  0  0  0  0  0  0  0\n   12.9757   -4.0148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2612   -3.6024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5468   -4.0148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5468   -4.8398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2612   -5.2524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9757   -4.8400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n  8 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n  6 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n  3 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 17 22  1  0  0  0  0\n  2 22  1  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)c(=O)n(CCn3c(=O)c4ccccc4[se]3)[se]2",
        "formula": "C16H12N2O2Se2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "422.1981",
        "optical_activity": "NONE",
        "references": [
          "12cfaeeb-8f8a-488d-ae6e-bf8b14ce3fdd",
          "63df4828-96b7-90d0-58cb-abd31ae38da8"
        ],
        "stereo_centers": 0
      },
      "unii": "4Q2EZS1IWG"
    }
  ]
}