{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "1f0fd6ed-86b6-4494-8525-43d28f422429", "code": "68480-17-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=68480-17-1", "code_system": "CAS", "references": [ "ddbc4e84-62b6-4a9c-aec2-aa431aaa5172", "4f821ee5-61b7-47f2-b76f-edadbe5a6051" ] }, { "uuid": "8c57ddd9-f8d1-4f7e-9606-96a3b3e0cccb", "code": "270-894-7", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.064.429", "code_system": "ECHA (EC/EINECS)", "references": [ "ddbc4e84-62b6-4a9c-aec2-aa431aaa5172" ] }, { "uuid": "c8df5272-be0c-4345-ad5f-9b9e0b30f306", "code": "109420", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/109420", "code_system": "PUBCHEM", "references": [ "ddbc4e84-62b6-4a9c-aec2-aa431aaa5172" ] }, { "uuid": "a49d4960-3c51-47ca-b0fb-19601e7ba216", "code": "4PH8D3YJET", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "17cb9e2f-88c5-352c-346a-90fef3d16692", "code": "DTXSID80867698", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80867698", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "51aef169-928e-45cf-8600-ae297c8c02aa", "name": "1-(2,6,6-TRIMETHYL-2-CYCLOHEXEN-1-YL)-3-PENTANONE", "stdName": "1-(2,6,6-TRIMETHYL-2-CYCLOHEXEN-1-YL)-3-PENTANONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "49ad2849-507c-45b6-a864-e6de1443fed8" ], "display_name": false }, { "uuid": "64ab7b86-6167-4aad-b6fe-6d6909551887", "name": "3-PENTANONE, 1-(2,6,6-TRIMETHYL-2-CYCLOHEXEN-1-YL)-", "stdName": "3-PENTANONE, 1-(2,6,6-TRIMETHYL-2-CYCLOHEXEN-1-YL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "49ad2849-507c-45b6-a864-e6de1443fed8" ], "display_name": false }, { "uuid": "3c7c3509-efd6-4056-9e90-3112a886386d", "name": "DIHYDROMETHYL-.ALPHA.-IONONE", "stdName": "DIHYDROMETHYL-.ALPHA.-IONONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "49ad2849-507c-45b6-a864-e6de1443fed8" ], "display_name": true }, { "uuid": "86fdeabf-b5d5-4d59-9301-146ac89c27c5", "name": "DIHYDROMETHYL-ALPHA-IONONE", "stdName": "DIHYDROMETHYL-ALPHA-IONONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "49171605-e8d5-45d1-a4a8-a4340c87d11f" ], "display_name": false } ], "references": [ { "uuid": "49171605-e8d5-45d1-a4a8-a4340c87d11f", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "49ad2849-507c-45b6-a864-e6de1443fed8", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ddbc4e84-62b6-4a9c-aec2-aa431aaa5172", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392562000, "tags": [ "NOMEN" ] }, { "uuid": "e61e1c2a-d2ad-4a78-9af5-8efb11861ef4", "citation": "SRS import [4PH8D3YJET]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4PH8D3YJET", "doc_type": "SRS", "public_domain": true, "document_date": 1493392562000, "tags": [ "NOMEN" ] }, { "uuid": "4f821ee5-61b7-47f2-b76f-edadbe5a6051", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "16461c61-5354-4442-b9a5-e39d39adaa46", "id": "16461c61-5354-4442-b9a5-e39d39adaa46", "molfile": "\n Marvin 01132101212D \n\n 15 15 0 0 0 0 999 V2000\n 11.6706 -5.1231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9561 -5.5356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2416 -5.1231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2416 -4.2981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5271 -5.5356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8126 -5.1231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0982 -5.5356 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 8.0982 -6.3606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8126 -6.7731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3837 -6.7731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6693 -6.3606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6693 -5.5356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3837 -5.1231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9140 -4.4912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8534 -4.4912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 2 0 0 0 0\n 5 3 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 7 13 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 8 2 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\nM END", "smiles": "CCC(=O)CCC1C(=CCCC1(C)C)C", "formula": "C14H24O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "7f7dfd93-13f1-41cb-bd8e-4e51238269ce" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "208.3403", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "fdeb81db-0277-4e92-82e4-05b7273fcd04", "version": "3", "structure": { "id": "9416fa33-f9c2-43c8-b1d3-9494be4096a3", "molfile": "\n Marvin 01132107412D \n\n 15 15 0 0 0 0 999 V2000\n 6.6693 -5.5356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3837 -5.1231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9140 -4.4912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8534 -4.4912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0982 -5.5356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8126 -5.1231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5271 -5.5356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2416 -5.1231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9561 -5.5356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6706 -5.1231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2416 -4.2981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0982 -6.3606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8126 -6.7731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3837 -6.7731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6693 -6.3606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 5 2 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 8 11 2 0 0 0 0\n 12 5 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 12 2 0 0 0 0\n 15 14 1 0 0 0 0\n 1 15 1 0 0 0 0\nM END", "smiles": "CCC(=O)CCC1C(=CCCC1(C)C)C", "formula": "C14H24O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "208.3403", "optical_activity": "( + / - )", "references": [ "e61e1c2a-d2ad-4a78-9af5-8efb11861ef4", "49171605-e8d5-45d1-a4a8-a4340c87d11f" ], "stereo_centers": 1 }, "unii": "4PH8D3YJET" } ] }