{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "cd5bd91e-5eb9-4a18-9a85-6497ed8866e1",
          "code": "1235-74-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1235-74-1",
          "code_system": "CAS",
          "references": [
            "cdfed7d1-792c-4ca9-8711-0647c09fc71c",
            "5ece9291-f3cd-47ed-9b4a-ef036719217c"
          ]
        },
        {
          "uuid": "86b97d6d-1736-43e8-8622-ef88e86f0b86",
          "code": "14697",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/14697",
          "code_system": "PUBCHEM",
          "references": [
            "cdfed7d1-792c-4ca9-8711-0647c09fc71c"
          ]
        },
        {
          "uuid": "67e7cd27-5c4c-47f6-9fec-b65596053dd0",
          "code": "4P47O55S2W",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8c24e50b-8d3a-e8f4-72f8-8fd6a9e6d28a",
          "code": "DTXSID10880714",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10880714",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "d9bdf4e0-a78c-95bf-ec59-80545c3d351d",
          "code": "81596",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=81596",
          "code_system": "NSC",
          "references": [
            "2d955d54-21fe-2434-8b7f-f58900e8bca8"
          ]
        },
        {
          "uuid": "0d3f83cc-01c3-b8af-9459-195f9f0d67a7",
          "code": "146198",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=146198",
          "code_system": "NSC",
          "references": [
            "2d955d54-21fe-2434-8b7f-f58900e8bca8"
          ]
        },
        {
          "uuid": "cf2528df-32a6-7416-7e5d-c9303a6dc9eb",
          "code": "4P47O55S2W",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=(4P47O55S2W)",
          "code_system": "DAILYMED",
          "references": [
            "14ed75b2-c932-2378-b21a-51ec418b8a0a"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e8e8fa43-1a9f-4a69-a1d0-1b1d6d1dc719",
          "name": "(1R,4AS,10AR)-1,2,3,4,4A,9,10,10A-OCTAHYDRO-1,4A-DIMETHYL-7-(1-METHYLETHYL)-1-PHENANTHRENECARBOXYLIC ACID METHYL ESTER",
          "stdName": "(1R,4AS,10AR)-1,2,3,4,4A,9,10,10A-OCTAHYDRO-1,4A-DIMETHYL-7-(1-METHYLETHYL)-1-PHENANTHRENECARBOXYLIC ACID METHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "19cadf74-5d5e-43a7-86a4-c4dade6aeeb2",
            "461898d0-aca8-4243-9eb9-a6a705c36105"
          ],
          "display_name": false
        },
        {
          "uuid": "34291fb3-8aba-422e-8420-b65402b9de86",
          "name": "METHYL DEHYDROABIETATE",
          "stdName": "METHYL DEHYDROABIETATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "19cadf74-5d5e-43a7-86a4-c4dade6aeeb2",
            "461898d0-aca8-4243-9eb9-a6a705c36105",
            "ae168717-b9bf-4c59-b6b6-5fa5b0894586",
            "3e4cdf8c-e920-4fa7-915d-37ce4372f4d7"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "cceff0cb-fa1f-4850-a0c0-82282acde1be",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "409c415c-9a11-46dd-b159-9fe7b6019279",
          "name": "NSC-146198",
          "stdName": "NSC-146198",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "461898d0-aca8-4243-9eb9-a6a705c36105",
            "471d4e00-1bfd-4c3c-8ee1-08654fa1d414"
          ],
          "display_name": false
        },
        {
          "uuid": "292c66b6-f8c7-4208-80bd-a8b89a58ddc4",
          "name": "NSC-81596",
          "stdName": "NSC-81596",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "461898d0-aca8-4243-9eb9-a6a705c36105",
            "471d4e00-1bfd-4c3c-8ee1-08654fa1d414"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "19cadf74-5d5e-43a7-86a4-c4dade6aeeb2",
          "citation": "http://www.chemicalbook.com/ProductChemicalPropertiesCB0962285_EN.htm",
          "url": "http://www.chemicalbook.com/ProductChemicalPropertiesCB0962285_EN.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "461898d0-aca8-4243-9eb9-a6a705c36105",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e4cdf8c-e920-4fa7-915d-37ce4372f4d7",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "471d4e00-1bfd-4c3c-8ee1-08654fa1d414",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cdfed7d1-792c-4ca9-8711-0647c09fc71c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391028000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "62ac357e-d4c1-422f-80a9-5a3f41a9c699",
          "citation": "SRS import [4P47O55S2W]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4P47O55S2W",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391028000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "72745813-56a5-49b0-88ff-1e4206845f39",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae168717-b9bf-4c59-b6b6-5fa5b0894586",
          "citation": "METHYL DEHYDROABIETATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5ece9291-f3cd-47ed-9b4a-ef036719217c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2d955d54-21fe-2434-8b7f-f58900e8bca8",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "14ed75b2-c932-2378-b21a-51ec418b8a0a",
          "citation": "DAILYMED",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5101f2ef-3fe6-4d90-9f5d-00c6934b506d",
          "id": "5101f2ef-3fe6-4d90-9f5d-00c6934b506d",
          "molfile": "\n  Marvin  01132104132D          \n\n 23 25  0  0  1  0            999 V2000\n    8.0040   -4.9004    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.5669   -4.2118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7556   -4.2118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3328   -4.9196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5116   -4.9196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0963   -5.6467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5190   -6.3809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3521   -6.3809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7556   -5.6540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5669   -5.6540    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.1732   -6.3568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0137   -6.3349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8373   -6.3349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2551   -5.6103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8373   -4.9004    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    9.5981   -4.6638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8373   -4.0888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0985   -3.6566    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5473   -3.6686    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1679   -3.6686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2556   -5.6467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8066   -4.9510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8330   -6.4221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1 10  1  0  0  0  0\n  1 15  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  9  4  2  0  0  0  0\n  5  6  2  0  0  0  0\n  7  6  1  0  0  0  0\n  6 21  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  1  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  1  0  0  0\n 15 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  1  0  0  0  0\nM  END",
          "smiles": "CC(C)c1ccc2c(CC[C@@H]3[C@]2(C)CCC[C@@]3(C)C(=O)OC)c1",
          "formula": "C21H30O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5f1ff6b1-0426-49f9-b943-9b310d4851c9"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "314.4625",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2fa52330-dc17-41f3-a404-a50ce72b0e91",
      "version": "7",
      "structure": {
        "id": "34b85582-5142-4e70-8a2b-ae0d86d31653",
        "molfile": "\n  Marvin  01132102492D          \n\n 24 26  0  0  1  0            999 V2000\n    8.0064   -4.9019    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.5692   -5.6557    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.7576   -5.6557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3347   -4.9211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5133   -4.9211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0978   -5.6484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2569   -5.6484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8077   -4.9525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8342   -6.4240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5207   -6.3828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3540   -6.3828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7576   -4.2131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5692   -4.2131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0161   -6.3368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8400   -6.3368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2579   -5.6120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8400   -4.9019    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.8400   -4.0900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5502   -3.6697    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1710   -3.6697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1009   -3.6577    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6010   -4.6652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1754   -6.3587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3279   -4.1432    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n 10  6  1  0  0  0  0\n 11 10  2  0  0  0  0\n  3 11  1  0  0  0  0\n 12  4  1  0  0  0  0\n 13 12  1  0  0  0  0\n  1 13  1  0  0  0  0\n  2 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n  1 17  1  0  0  0  0\n 17 18  1  6  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 18 21  2  0  0  0  0\n 17 22  1  1  0  0  0\n  2 23  1  1  0  0  0\n  1 24  1  6  0  0  0\nM  END",
        "smiles": "CC(C)c1ccc2c(CC[C@]3([H])[C@]2(C)CCC[C@@]3(C)C(=O)OC)c1",
        "formula": "C21H30O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "314.4625",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "72745813-56a5-49b0-88ff-1e4206845f39",
          "62ac357e-d4c1-422f-80a9-5a3f41a9c699"
        ],
        "stereo_centers": 3
      },
      "unii": "4P47O55S2W"
    }
  ]
}