{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a5af0bb3-164a-454b-a43c-b24254c7e0e1",
          "code": "869743-37-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=869743-37-3",
          "code_system": "CAS",
          "references": [
            "57b28a63-6453-41b8-9d07-07e5fc650188",
            "92b6e6e8-70a0-4969-b93b-35e72759fc79"
          ]
        },
        {
          "uuid": "90f0d859-5d05-d265-6f16-c1ebf78c8743",
          "code": "11594628",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11594628",
          "code_system": "PUBCHEM",
          "references": [
            "08a94548-4e47-5f56-4bcc-3309b06997f4"
          ]
        },
        {
          "uuid": "6262d22a-1b15-7dec-ca4e-0f58b51997a3",
          "code": "1988686",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1988686/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "3d25eecc-a466-38d6-d3b0-c5c630f0b894"
          ]
        },
        {
          "uuid": "496b2c00-2771-4e0c-ae7a-f5b8d5bdbe3c",
          "code": "4OD5GIH1UK",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "cc301fb7-40a1-1906-62ab-8d99ba4a516e",
          "code": "DTXSID201021215",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID201021215",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "ed4b07f0-a97b-0647-ecdf-8a5e735956e7",
          "code": "4OD5GIH1UK",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=4OD5GIH1UK",
          "code_system": "DAILYMED",
          "references": [
            "a0beaeb2-b912-2420-50f1-5db7da0c7f4c"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "94dce5e2-3b4f-433e-960e-6b88eb5febde",
          "name": "1,3-BENZENEDIOL, 4-(3-(2,4-DIMETHOXY-3-METHYLPHENYL)PROPYL)-",
          "stdName": "1,3-BENZENEDIOL, 4-(3-(2,4-DIMETHOXY-3-METHYLPHENYL)PROPYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "62a4fff6-66c1-4c0d-be5e-a301ee8d23b0",
            "fa18cb2c-799c-4a73-b77b-43f20996a76c"
          ],
          "display_name": false
        },
        {
          "uuid": "5e15a1a9-7a60-412c-82a2-02ba9512a51a",
          "name": "DIMETHOXYTOLYL PROPYLRESORCINOL",
          "stdName": "DIMETHOXYTOLYL PROPYLRESORCINOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "62a4fff6-66c1-4c0d-be5e-a301ee8d23b0",
            "b675342f-7ec4-4075-8b81-6ce71293f43b",
            "6c307904-1ee7-44b1-ad6c-677d5edddcda"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "91feaebd-9fdd-4913-8782-0fec9c54b98b",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "d333c84e-4e34-484d-9dfb-b00544ed3dc0",
          "name": "NIVITOL",
          "stdName": "NIVITOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01925149-314c-49e9-99e1-00ed2a5b637d",
            "62a4fff6-66c1-4c0d-be5e-a301ee8d23b0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6c307904-1ee7-44b1-ad6c-677d5edddcda",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "62a4fff6-66c1-4c0d-be5e-a301ee8d23b0",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "01925149-314c-49e9-99e1-00ed2a5b637d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fa18cb2c-799c-4a73-b77b-43f20996a76c",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "57b28a63-6453-41b8-9d07-07e5fc650188",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392157000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "04b60a97-8aa6-4306-b70a-e90b20b93c7f",
          "citation": "SRS import [4OD5GIH1UK]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4OD5GIH1UK",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392157000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b675342f-7ec4-4075-8b81-6ce71293f43b",
          "citation": "DIMETHOXYTOLYL PROPYLRESORCINOL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "08a94548-4e47-5f56-4bcc-3309b06997f4",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "3d25eecc-a466-38d6-d3b0-c5c630f0b894",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "92b6e6e8-70a0-4969-b93b-35e72759fc79",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a0beaeb2-b912-2420-50f1-5db7da0c7f4c",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0d3c721c-c6a6-4c2e-8235-c98f78ba9569",
          "id": "0d3c721c-c6a6-4c2e-8235-c98f78ba9569",
          "molfile": "\n  Marvin  01132100562D          \n\n 22 23  0  0  0  0            999 V2000\n    0.0000   -3.7051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.8818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7151   -2.4701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4300   -2.8818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1378   -2.4701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1378   -1.6468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8529   -1.2351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5679   -1.6468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2830   -1.2351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0847   -1.6179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0847   -2.4412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7924   -2.8529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5075   -2.4412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2226   -2.8529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5075   -1.6179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7924   -1.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7924   -0.3828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4300   -1.2351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4300   -0.4116    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1378    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7151   -1.6468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n 21  3  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n 18  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 16  2  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  2  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 21  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 22  1  0  0  0  0\nM  END",
          "smiles": "Cc1c(ccc(CCCc2ccc(cc2O)O)c1OC)OC",
          "formula": "C18H22O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8c3cd338-1704-4708-954b-dadbc41f783b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "302.3656",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "86c62dbe-da08-4111-bd8c-43bd356ac795",
      "version": "10",
      "structure": {
        "id": "3dc9d0e9-1a6d-4613-97d6-d206352b7e6f",
        "molfile": "\n  Marvin  01132103162D          \n\n 22 23  0  0  0  0            999 V2000\n    1.4300   -1.2351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7151   -1.6468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7151   -2.4701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4300   -2.8818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1378   -2.4701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1378   -1.6468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8529   -1.2351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5679   -1.6468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2830   -1.2351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0847   -1.6179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7924   -1.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0847   -2.4412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7924   -2.8529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5075   -2.4412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5075   -1.6179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4300   -0.4116    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.8818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7924   -0.3828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2226   -2.8529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.7051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1378    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  6  1  0  0  0  0\n  1 16  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2 17  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3 18  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 11 15  1  0  0  0  0\n 11 19  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 20  1  0  0  0  0\n 16 22  1  0  0  0  0\n 18 21  1  0  0  0  0\nM  END",
        "smiles": "Cc1c(ccc(CCCc2ccc(cc2O)O)c1OC)OC",
        "formula": "C18H22O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "302.3656",
        "optical_activity": "NONE",
        "references": [
          "fa18cb2c-799c-4a73-b77b-43f20996a76c",
          "04b60a97-8aa6-4306-b70a-e90b20b93c7f"
        ],
        "stereo_centers": 0
      },
      "unii": "4OD5GIH1UK"
    }
  ]
}