{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e3d9cca3-5637-42f7-9e13-6cfc0ab62e80",
          "code": "36393-20-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=36393-20-1",
          "code_system": "CAS",
          "references": [
            "9542307a-1c7b-4b00-acab-162139e5bed8",
            "93f20e6e-0f81-456e-a641-509a23856beb"
          ]
        },
        {
          "uuid": "7f7b5860-fb81-4e38-89ea-486676937d56",
          "code": "C87349",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C87349",
          "code_system": "NCI_THESAURUS",
          "references": [
            "9542307a-1c7b-4b00-acab-162139e5bed8"
          ]
        },
        {
          "uuid": "c5985448-b549-40eb-a6c6-948c788db4c7",
          "code": "253-012-5",
          "type": "PRIMARY",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "9542307a-1c7b-4b00-acab-162139e5bed8"
          ]
        },
        {
          "uuid": "3d512652-5ffd-4065-9d46-a4a887a378e7",
          "code": "236142",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/236142/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "9542307a-1c7b-4b00-acab-162139e5bed8"
          ]
        },
        {
          "uuid": "1dba2a79-bc76-4f63-875e-59f12fed6457",
          "code": "SUB12952MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "9542307a-1c7b-4b00-acab-162139e5bed8"
          ]
        },
        {
          "uuid": "a2ed1143-e603-4372-8a09-58ab688f3060",
          "code": "56841018",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/56841018",
          "code_system": "PUBCHEM",
          "references": [
            "9542307a-1c7b-4b00-acab-162139e5bed8"
          ]
        },
        {
          "uuid": "e2ab9f54-fa54-f545-01ff-350fb7782616",
          "code": "Zinc aspartate",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Zinc_aspartate",
          "code_system": "WIKIPEDIA",
          "references": [
            "1818ce6c-fb33-2af7-4eae-0f68789523b7"
          ]
        },
        {
          "uuid": "fad308ba-0c2c-38c8-d200-f01355e0aa6e",
          "code": "C1505",
          "comments": "Dietary Supplement",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1505",
          "code_system": "NCI_THESAURUS",
          "references": [
            "1b0ad0a2-1f49-a9f9-5003-9042f4551dca"
          ]
        },
        {
          "uuid": "76e11c34-b705-44e6-407b-e574b8e95eb5",
          "code": "137 (Number of products:9660)",
          "comments": "Dietary Supplement Label Database|Mineral|Zinc",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=137&item=Zinc",
          "code_system": "DSLD",
          "references": [
            "1b0ad0a2-1f49-a9f9-5003-9042f4551dca"
          ]
        },
        {
          "uuid": "3bd29365-cea1-4bff-96a2-3201400586e6",
          "code": "4OC7QTI23H",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5421973a-774d-1674-1ce4-2350032baa5c",
          "code": "4OC7QTI23H",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=4OC7QTI23H",
          "code_system": "DAILYMED",
          "references": [
            "b3194e9d-bbd5-eb83-ac69-df52e5acc60f"
          ]
        },
        {
          "uuid": "ff084dee-a9ef-b29d-0687-91cca5637e0b",
          "code": "100000089091",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "7690e586-b58c-a1fd-83a9-a222b0942520"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "ef95fc71-b151-4608-92c4-7e8d053cb0c9",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "b927b0eb-dc0c-4bee-a454-777e0b5fb78e",
            "refuuid": "a8521c7c-75bd-4430-9468-dbd72574b575",
            "name": "ASPARTIC ACID",
            "unii": "30KYC7MIAI",
            "linking_id": "30KYC7MIAI",
            "ref_pname": "ASPARTIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c10b133a-47e0-4f54-b4bd-32a2b530392e",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "bf882a86-5f4a-48fc-8595-dd8c11b70adb",
            "refuuid": "a0cf59d1-0ce6-46d2-a53c-21c4b202ec9c",
            "name": "ZINC CATION",
            "unii": "13S1S8SF37",
            "linking_id": "13S1S8SF37",
            "ref_pname": "ZINC CATION",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b231f20b-35cb-4ef9-8bb7-ab8628a65008",
          "name": "ASPARTATE ZINC",
          "stdName": "ASPARTATE ZINC",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa86a103-dc61-46c0-afbb-733f7c0f5b48",
            "251cfc1a-ed36-49fa-92c3-6b2d5ba6561b",
            "18adb7bc-1562-4994-9b82-ed0446ca40c9"
          ],
          "display_name": false
        },
        {
          "uuid": "2e8796e1-448d-9dc9-df41-ac157292ae40",
          "name": "Aspartate zinc [WHO-DD]",
          "stdName": "ASPARTATE ZINC [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "be0b7051-9571-0dfc-d025-338d2e34e935"
          ],
          "display_name": false
        },
        {
          "uuid": "d02f7642-bd51-4b00-8f11-3bcc3ea3542f",
          "name": "DIHYDROGEN BIS(L-ASPARTATO(2-)-N,O1)ZINCATE(2-)",
          "stdName": "DIHYDROGEN BIS(L-ASPARTATO(2-)-N,O1)ZINCATE(2-)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e65c842b-95ef-4afe-a7b1-5d807e9f539a",
            "251cfc1a-ed36-49fa-92c3-6b2d5ba6561b"
          ],
          "display_name": false
        },
        {
          "uuid": "326d5235-0ca9-4a90-a937-d3ad7a1e7d48",
          "name": "ZINC ASPARTATE",
          "stdName": "ZINC ASPARTATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3dcbc699-605b-4c01-a784-706a2d7da3b4",
            "251cfc1a-ed36-49fa-92c3-6b2d5ba6561b",
            "4463ddca-a001-4918-9e11-20eadc875efe",
            "e388a928-5906-41e8-a4dc-0d9b4b752bf4"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ec1f1514-0aa2-4e85-aca9-8b866463f19c",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "467c7e3e-cd0d-49b4-b7db-6316deddeb20",
          "name": "ZINCATE(2-), BIS(L-ASPARTATO(2-)-.KAPPA.N,.KAPPA.O1)-, HYDROGEN (1:2), (T-4)-",
          "stdName": "ZINCATE(2-), BIS(L-ASPARTATO(2-)-.KAPPA.N,.KAPPA.O1)-, HYDROGEN (1:2), (T-4)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "251cfc1a-ed36-49fa-92c3-6b2d5ba6561b",
            "0bdbdc07-813e-4d51-b154-ade814b9c7c0"
          ],
          "display_name": false
        },
        {
          "uuid": "69522789-0b67-4a0a-8d40-0734fe5ba485",
          "name": "ZINCATE(2-), BIS(L-ASPARTATO(2-)-N,O(SUP 1))-, DIHYDROGEN, (T-4)-",
          "stdName": "ZINCATE(2-), BIS(L-ASPARTATO(2-)-N,O(SUP 1))-, DIHYDROGEN, (T-4)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "251cfc1a-ed36-49fa-92c3-6b2d5ba6561b",
            "e388a928-5906-41e8-a4dc-0d9b4b752bf4"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e388a928-5906-41e8-a4dc-0d9b4b752bf4",
          "citation": "chemid",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "251cfc1a-ed36-49fa-92c3-6b2d5ba6561b",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e65c842b-95ef-4afe-a7b1-5d807e9f539a",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4463ddca-a001-4918-9e11-20eadc875efe",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0bdbdc07-813e-4d51-b154-ade814b9c7c0",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "18adb7bc-1562-4994-9b82-ed0446ca40c9",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9542307a-1c7b-4b00-acab-162139e5bed8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390749000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "74532f92-b03f-4bb6-bdd0-a16ff55cfaeb",
          "citation": "SRS import [4OC7QTI23H]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4OC7QTI23H",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390749000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "13430306-c110-41bc-8e40-1ea05bbe0ba7",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3dcbc699-605b-4c01-a784-706a2d7da3b4",
          "citation": "ZINC ASPARTATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "aa86a103-dc61-46c0-afbb-733f7c0f5b48",
          "citation": "ASPARTATE ZINC [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1818ce6c-fb33-2af7-4eae-0f68789523b7",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Zinc_aspartate",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7690e586-b58c-a1fd-83a9-a222b0942520",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "1b0ad0a2-1f49-a9f9-5003-9042f4551dca",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "93f20e6e-0f81-456e-a641-509a23856beb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b3194e9d-bbd5-eb83-ac69-df52e5acc60f",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "be0b7051-9571-0dfc-d025-338d2e34e935",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c47d3258-2bde-487e-acbb-70d3c5b4ab15",
          "id": "c47d3258-2bde-487e-acbb-70d3c5b4ab15",
          "molfile": "\n  Marvin  01132110092D          \n\n  1  0  0  0  1  0            999 V2000\n   15.1590   -7.3992    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Zn+2]",
          "formula": "Zn",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "61431272-f2de-4ca6-a290-c37b01d05096"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "65.3956",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "711845b5-4e51-405f-aeea-bfcdd4eaca38",
          "id": "711845b5-4e51-405f-aeea-bfcdd4eaca38",
          "molfile": "\n  Marvin  01132105522D          \n\n  1  0  0  0  1  0            999 V2000\n   17.8198   -4.6650    0.0000 H   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "formula": "H",
          "atropisomerism": "No",
          "charge": 1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "64453812-4ae1-4945-a5f0-e2ad33239d10"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "1.0079",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "b0cb2423-c197-411a-8ba1-79df436e1a94",
          "id": "b0cb2423-c197-411a-8ba1-79df436e1a94",
          "molfile": "\n  Marvin  01132109102D          \n\n  9  8  0  0  1  0            999 V2000\n   11.7975   -6.3354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7975   -7.1642    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.4926   -7.6061    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0678   -7.5434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3704   -7.1027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3704   -6.2748    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6385   -7.4852    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   12.5660   -5.9511    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   11.1448   -5.8948    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n  8  1  1  0  0  0  0\n  1  9  2  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  7  1  0  0  0  0\nM  CHG  2   7  -1   8  -1\nM  END",
          "smiles": "C([C@@H](C(=O)[O-])N)C(=O)[O-]",
          "formula": "C4H5NO4",
          "atropisomerism": "No",
          "charge": -2,
          "count": 2,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "e22ce84a-d914-4441-9809-d966bf748912"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "131.087",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5749179b-338c-48f0-a3b8-18959138df71",
      "version": "12",
      "structure": {
        "id": "1d895879-6632-4e54-8c94-8e6adaf373d3",
        "molfile": "\n  Marvin  01132101422D          \n\n 21 16  0  0  1  0            999 V2000\n   15.1590   -7.3992    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\n   17.8198   -4.6650    0.0000 H   0  3  0  0  0  0  0  0  0  0  0  0\n   11.7975   -6.3354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7975   -7.1642    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.4926   -7.6061    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0678   -7.5434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3704   -7.1027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3704   -6.2748    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6385   -7.4852    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   12.5660   -5.9511    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   11.1448   -5.8948    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.8198   -4.6650    0.0000 H   0  3  0  0  0  0  0  0  0  0  0  0\n   11.7975   -6.3354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7975   -7.1642    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.4926   -7.6061    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0678   -7.5434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3704   -7.1027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3704   -6.2748    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6385   -7.4852    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   12.5660   -5.9511    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   11.1448   -5.8948    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  4  3  1  1  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n 10  3  1  0  0  0  0\n  3 11  2  0  0  0  0\n 14 13  1  1  0  0  0\n 20 13  1  0  0  0  0\n 13 21  2  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\nM  CHG  7   1   2   2   1   9  -1  10  -1  12   1  19  -1  20  -1\nM  STY  2   1 MUL   2 MUL\nM  SCN  1   1 HT \nM  SAL   1  2   2  12\nM  SPA   1  1   2\nM  SDI   1  4   17.3998   -5.0850   17.3998   -4.2450\nM  SDI   1  4   18.2398   -4.2450   18.2398   -5.0850\nM  SMT   1 2\nM  SCN  1   2 HT \nM  SAL   2 15   3   4   5   6   7   8   9  10  11  13  14  15  16  17  18\nM  SAL   2  3  19  20  21\nM  SPA   2  9   3   4   5   6   7   8   9  10  11\nM  SDI   2  4    9.2185   -8.0261    9.2185   -5.4748\nM  SDI   2  4   12.9860   -5.4748   12.9860   -8.0261\nM  SMT   2 2\nM  END",
        "smiles": "C([C@@H](C(=O)[O-])N)C(=O)[O-].C([C@@H](C(=O)[O-])N)C(=O)[O-].[Zn+2].[H+].[H+]",
        "formula": "2C4H5NO4.Zn.2H",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "329.5854",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "74532f92-b03f-4bb6-bdd0-a16ff55cfaeb",
          "13430306-c110-41bc-8e40-1ea05bbe0ba7"
        ],
        "stereo_centers": 2
      },
      "unii": "4OC7QTI23H"
    }
  ]
}