{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8f0d5619-08e9-4c3c-8115-7f680637736f",
          "code": "3380-34-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3380-34-5",
          "code_system": "CAS",
          "references": [
            "950a6445-e0d9-41ca-b3d0-275f76ac876e",
            "3fc42ffc-11c5-4218-8fbb-30e69ce37ffb"
          ]
        },
        {
          "uuid": "c0354385-687f-4f43-a437-b7a3977f4d25",
          "code": "C61986",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C61986",
          "code_system": "NCI_THESAURUS",
          "references": [
            "950a6445-e0d9-41ca-b3d0-275f76ac876e"
          ]
        },
        {
          "uuid": "5c6ec9c4-3bce-4a28-801f-ce114f93cf09",
          "code": "C112022",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67112022",
          "code_system": "MESH",
          "references": [
            "950a6445-e0d9-41ca-b3d0-275f76ac876e"
          ]
        },
        {
          "uuid": "b069cd4c-4b05-43d5-b162-867bc900d29c",
          "code": "D014260",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68014260",
          "code_system": "MESH",
          "references": [
            "950a6445-e0d9-41ca-b3d0-275f76ac876e"
          ]
        },
        {
          "uuid": "c1a1c0db-31ea-4d4f-b2ea-8de2ca1f7e37",
          "code": "TRICLOSAN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Triclosan",
          "code_system": "WIKIPEDIA",
          "references": [
            "950a6445-e0d9-41ca-b3d0-275f76ac876e"
          ]
        },
        {
          "uuid": "549fc9d6-1814-42a8-b0d2-3e7a4df2ac2d",
          "code": "21 CFR 310.531",
          "comments": "PART 310 -- NEW DRUGS|Subpart E--Requirements for Specific New Drugs or Devices|Sec. 310.531 Drug products containing active ingredients offered over-the-counter (OTC) for the treatment of boils.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=310.531",
          "code_system": "CFR",
          "references": [
            "950a6445-e0d9-41ca-b3d0-275f76ac876e"
          ]
        },
        {
          "uuid": "a67d2122-2039-47ab-b611-fbfb536c2258",
          "code": "SUB11277MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "950a6445-e0d9-41ca-b3d0-275f76ac876e"
          ]
        },
        {
          "uuid": "69459354-e782-45f0-8ffd-6118d09b5922",
          "code": "54901",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:4124",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "950a6445-e0d9-41ca-b3d0-275f76ac876e"
          ]
        },
        {
          "uuid": "53c28440-8555-45e5-8585-be0a4c9b145c",
          "code": "2988",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2988",
          "code_system": "INN",
          "references": [
            "950a6445-e0d9-41ca-b3d0-275f76ac876e"
          ]
        },
        {
          "uuid": "620090d4-bb66-4ed2-a15a-ba75a244f2ab",
          "code": "10795",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/10795/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "950a6445-e0d9-41ca-b3d0-275f76ac876e"
          ]
        },
        {
          "uuid": "a8cc8036-9297-401b-8cb4-914985bca0c3",
          "code": "m11092",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11092?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "950a6445-e0d9-41ca-b3d0-275f76ac876e"
          ]
        },
        {
          "uuid": "77e5013e-4d7e-4224-8cd3-6b8c7d995d9f",
          "code": "DB08604",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB08604",
          "code_system": "DRUG BANK",
          "references": [
            "950a6445-e0d9-41ca-b3d0-275f76ac876e"
          ]
        },
        {
          "uuid": "66aa49e5-8601-46a5-80b8-003c33017ea2",
          "code": "CHEMBL849",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL849",
          "code_system": "ChEMBL",
          "references": [
            "950a6445-e0d9-41ca-b3d0-275f76ac876e"
          ]
        },
        {
          "uuid": "eee06982-5cfe-4666-a188-f82a3e8105c7",
          "code": "5564",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5564",
          "code_system": "PUBCHEM",
          "references": [
            "950a6445-e0d9-41ca-b3d0-275f76ac876e"
          ]
        },
        {
          "uuid": "c6b8ca79-0b57-4999-aa0d-14b7e7a8c101",
          "code": "222-182-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.020.167",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "950a6445-e0d9-41ca-b3d0-275f76ac876e"
          ]
        },
        {
          "uuid": "230d1c46-e2a4-4909-a36a-b30c6c8e5272",
          "code": "D09AA06",
          "comments": "ATC|DERMATOLOGICALS|MEDICATED DRESSINGS|MEDICATED DRESSINGS|Medicated dressings with antiinfectives|triclosan",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=D09AA06&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "950a6445-e0d9-41ca-b3d0-275f76ac876e"
          ]
        },
        {
          "uuid": "b6b73cea-4e69-43c8-9207-d365ee1510ea",
          "code": "D08AE04",
          "comments": "ATC|DERMATOLOGICALS|ANTISEPTICS AND DISINFECTANTS|ANTISEPTICS AND DISINFECTANTS|Phenol and derivatives|triclosan",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=D08AE04&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "950a6445-e0d9-41ca-b3d0-275f76ac876e"
          ]
        },
        {
          "uuid": "2415c2e3-67b3-4370-90b9-65a798eee2d9",
          "code": "QD09AA06",
          "comments": "VATC|MEDICATED DRESSINGS|MEDICATED DRESSINGS|Medicated dressings with antiinfectives|triclosan",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QD09AA06&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "950a6445-e0d9-41ca-b3d0-275f76ac876e"
          ]
        },
        {
          "uuid": "b50a23ab-0bd1-4af0-b1e7-e16337a6be8c",
          "code": "QD08AE04",
          "comments": "VATC|ANTISEPTICS AND DISINFECTANTS|ANTISEPTICS AND DISINFECTANTS|Phenol and derivatives|triclosan",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QD08AE04&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "950a6445-e0d9-41ca-b3d0-275f76ac876e"
          ]
        },
        {
          "uuid": "0077ae1f-fdfc-dbb4-0eac-9ea335eba65f",
          "code": "7194",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7194",
          "code_system": "HSDB",
          "references": [
            "e32b5bb5-e5d6-37be-8af7-e923a8349850"
          ]
        },
        {
          "uuid": "40ab4191-8abf-d947-002f-8ed94bf936b9",
          "code": "DTXSID5032498",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5032498",
          "code_system": "EPA CompTox",
          "references": [
            "6accaff2-03fb-1a81-b05b-146fe88607d1"
          ]
        },
        {
          "uuid": "e0674587-6167-c9c0-3842-d310f419d2dd",
          "code": "C254",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C254",
          "code_system": "NCI_THESAURUS",
          "references": [
            "1a447732-0805-4330-5e31-9ae8ffaf270d"
          ]
        },
        {
          "uuid": "e369aec4-60bc-4adc-9e76-75bedc188ef4",
          "code": "4NM5039Y5X",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "15ce30f1-c72c-90ed-461b-3f930a7459c5",
          "code": "3631",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3631",
          "code_system": "DRUG CENTRAL",
          "references": [
            "1a447732-0805-4330-5e31-9ae8ffaf270d"
          ]
        },
        {
          "uuid": "ab57c5ae-69ea-0a06-25fe-03f6e30fb74f",
          "code": "164200",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:164200",
          "code_system": "CHEBI",
          "references": [
            "1a447732-0805-4330-5e31-9ae8ffaf270d"
          ]
        },
        {
          "uuid": "81be0ae8-6145-e6ca-2806-c82182bd7da6",
          "code": "1682206",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1682206",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "1a447732-0805-4330-5e31-9ae8ffaf270d"
          ]
        },
        {
          "uuid": "e703770b-c24e-9923-7549-3a15f47d8d86",
          "code": "4NM5039Y5X",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=4NM5039Y5X",
          "code_system": "DAILYMED",
          "references": [
            "6a4328ce-d594-17c7-a910-9feb47ca6d22"
          ]
        },
        {
          "uuid": "33a1ef89-c13c-f9b0-64a0-b3d60fd62099",
          "code": "100000077719",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "8f9cba72-22d4-ceaf-f528-5f3c38d8ea01"
          ]
        },
        {
          "uuid": "1479d274-047a-27d9-1cd3-99da744bdc19",
          "code": "759151",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=759151",
          "code_system": "NSC",
          "references": [
            "b872d0a9-5cbf-2de5-9978-63e918c6ce54"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "0d0d0fea-d9e1-4015-a0a8-3239f80915b6",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "e236c400-943c-47c3-a304-835c00978060",
            "refuuid": "f672e370-5008-448d-ae32-a280727f9e20",
            "name": "TRICLOSAN",
            "unii": "4NM5039Y5X",
            "linking_id": "4NM5039Y5X",
            "ref_pname": "TRICLOSAN",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "27e33df1-73dc-4556-bf0e-8b0b08bcc636",
          "name": "2,4,4'-TRICHLORO-2'-HYDROXYDIPHENYL ETHER",
          "stdName": "2,4,4'-TRICHLORO-2'-HYDROXYDIPHENYL ETHER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b2b3853-fe48-45c5-bd64-aca1a6a5a743"
          ],
          "display_name": false
        },
        {
          "uuid": "d77c7af1-b9d3-48ff-8ca9-3fd123516186",
          "name": "CH 3565",
          "stdName": "CH 3565",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cb829335-11d5-48a2-b72d-246e60968812",
            "a2329491-fae1-464e-be16-24606b23d9ac"
          ],
          "display_name": false
        },
        {
          "uuid": "a444bc24-5ffa-43cc-b73c-f1fb1edc4b60",
          "name": "CH-3565",
          "stdName": "CH-3565",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b2b3853-fe48-45c5-bd64-aca1a6a5a743"
          ],
          "display_name": false
        },
        {
          "uuid": "9594581a-79f1-418e-ac15-82a3c2636ba2",
          "name": "COLGATE TOTAL COMPONENT TRICLOSAN",
          "stdName": "COLGATE TOTAL COMPONENT TRICLOSAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9387e424-d07d-4c62-b515-0aa355eff02e",
            "63f6b37c-8af1-42fb-a253-24eb64fdb7a2"
          ],
          "display_name": false
        },
        {
          "uuid": "61b2641d-0609-458d-b3af-e2f3fb851a79",
          "name": "DNDI1246774",
          "stdName": "DNDI1246774",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "42db9f61-3dcb-488a-a5f8-316d5f1006a8",
            "a2329491-fae1-464e-be16-24606b23d9ac"
          ],
          "display_name": false
        },
        {
          "uuid": "0f310b54-2a49-9a1c-77b6-16c2aa1a1a3d",
          "name": "NSC-759151",
          "stdName": "NSC-759151",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b872d0a9-5cbf-2de5-9978-63e918c6ce54"
          ],
          "display_name": false
        },
        {
          "uuid": "a14ac2d5-0fb4-4b95-af2b-a2ca05cf1246",
          "name": "PHENOL, 5-CHLORO-2-(2,4-DICHLOROPHENOXY)-",
          "stdName": "PHENOL, 5-CHLORO-2-(2,4-DICHLOROPHENOXY)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b2b3853-fe48-45c5-bd64-aca1a6a5a743"
          ],
          "display_name": false
        },
        {
          "uuid": "3b999351-7091-417b-98e0-fde0b0dd445c",
          "name": "STRI-DEX CLEANSING BAR",
          "stdName": "STRI-DEX CLEANSING BAR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bf80ccdc-b358-482d-8058-06c43d17bb8e",
            "f89f15e3-5f57-472a-8685-231298ea5671"
          ],
          "display_name": false
        },
        {
          "uuid": "3c95a798-bf8b-4858-bdb0-05f318323fde",
          "name": "TRICLOSAN",
          "stdName": "TRICLOSAN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "badb0efe-f6fa-4ff0-98ee-08afbeb0e1a2",
            "d7ec6727-1b2f-455d-8651-43c1f0d426a2",
            "b96d6372-d02c-463f-947c-93ea6889e301",
            "cb57e3da-c2a5-409d-9852-cb6a1b2444b8",
            "b31a7e53-ac31-4f1a-b8bb-aebab6a809c8",
            "b056de8f-ca61-43b0-97fc-0d867cdb55ff",
            "dc48de32-c12a-45ee-b38e-ea8005c1604d",
            "a2329491-fae1-464e-be16-24606b23d9ac",
            "35e2bd66-5040-4d17-8da3-dea525d3b908",
            "c8ff09e6-a84e-4dad-852b-1a261f56723b",
            "e7835aea-dba7-495c-80cc-fec7f9a5b61d",
            "a8d5cba3-b2e3-450f-8d17-8ed0d8bce2d7",
            "58f74277-8189-432e-8427-6e36773a7452",
            "6e4736ac-f4b6-472b-a289-1d9f5de8b0cf",
            "0056f353-6920-4838-af99-9d3f0f66f68d",
            "c9c371f6-62db-459e-9223-00a11c123eff",
            "36f272bb-8214-4e9e-a30b-14489cde31e5",
            "2f4021f5-3160-49e9-a244-845a5b64a9c1",
            "a3d8cd3c-0e03-4b0d-b1f3-cfbcb9e2c3e9",
            "10664dee-101d-443b-803f-86d6c92b361c",
            "2aec52dc-5abf-414e-a21f-9d0e4b3406dc",
            "835cf720-3769-4296-8656-bd5209401570",
            "90451df9-26c9-4286-a7a9-017c463f1f9a",
            "96318f3d-6a13-4232-b4bc-e35a37882ae2",
            "08b976da-e8f6-47ef-9cff-8769d8af6ee3"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "58faf23f-9e1c-48c1-9851-0a1b7414f5b3",
              "name_org": "INN"
            },
            {
              "uuid": "6b68c839-afa2-44e7-8ed5-da8682f79a85",
              "name_org": "USAN"
            },
            {
              "uuid": "5d83d95b-2f70-441a-8414-09fc193ad64b",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "c3e04f4c-b4ac-4dc7-931c-83d78e7ea4cc",
          "name": "TRICLOSAN [HSDB]",
          "stdName": "TRICLOSAN [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10664dee-101d-443b-803f-86d6c92b361c",
            "a2329491-fae1-464e-be16-24606b23d9ac"
          ],
          "display_name": false
        },
        {
          "uuid": "b0ddca75-8645-4789-be3e-12e72b5b72cb",
          "name": "TRICLOSAN [MART.]",
          "stdName": "TRICLOSAN [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08b976da-e8f6-47ef-9cff-8769d8af6ee3"
          ],
          "display_name": false
        },
        {
          "uuid": "16acb8ae-013f-4970-952d-a4b7b1551a68",
          "name": "TRICLOSAN [MI]",
          "stdName": "TRICLOSAN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a2329491-fae1-464e-be16-24606b23d9ac",
            "c8ff09e6-a84e-4dad-852b-1a261f56723b"
          ],
          "display_name": false
        },
        {
          "uuid": "de7bb3a5-5440-443f-92d5-7d34d2741226",
          "name": "TRICLOSAN [ORANGE BOOK]",
          "stdName": "TRICLOSAN [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2aec52dc-5abf-414e-a21f-9d0e4b3406dc"
          ],
          "display_name": false
        },
        {
          "uuid": "a4bb3953-7848-49d2-80f1-64608daf6384",
          "name": "TRICLOSAN [USAN]",
          "stdName": "TRICLOSAN [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90451df9-26c9-4286-a7a9-017c463f1f9a"
          ],
          "display_name": false
        },
        {
          "uuid": "2d99df02-aff5-a3ce-1a9f-0259f8912b47",
          "name": "TRICLOSAN [USP MONOGRAPH]",
          "stdName": "TRICLOSAN [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f334fb9f-ac3e-aa48-b558-2897d8bf5e7e"
          ],
          "display_name": false
        },
        {
          "uuid": "768b7641-90a0-4a31-be0a-7376ad83d40d",
          "name": "TRICLOSAN [USP-RS]",
          "stdName": "TRICLOSAN [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a2329491-fae1-464e-be16-24606b23d9ac",
            "35e2bd66-5040-4d17-8da3-dea525d3b908"
          ],
          "display_name": false
        },
        {
          "uuid": "ad323144-6fee-4071-834e-afbe503687d6",
          "name": "TRICLOSAN [VANDF]",
          "stdName": "TRICLOSAN [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a2329491-fae1-464e-be16-24606b23d9ac",
            "cb57e3da-c2a5-409d-9852-cb6a1b2444b8"
          ],
          "display_name": false
        },
        {
          "uuid": "f2a2e373-424d-c4e5-3f61-517d9657c521",
          "name": "Triclosan [WHO-DD]",
          "stdName": "TRICLOSAN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d6fde29-60d9-56de-dd85-c4b2cdc48db7"
          ],
          "display_name": false
        },
        {
          "uuid": "24c31df8-ce99-4cd2-ac3a-7c7dfe7276f7",
          "name": "triclosan [INN]",
          "stdName": "TRICLOSAN [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a8d5cba3-b2e3-450f-8d17-8ed0d8bce2d7"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c9c371f6-62db-459e-9223-00a11c123eff",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3b2b3853-fe48-45c5-bd64-aca1a6a5a743",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a8d5cba3-b2e3-450f-8d17-8ed0d8bce2d7",
          "citation": "INN Proposed List 32",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL32.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "90451df9-26c9-4286-a7a9-017c463f1f9a",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2f4021f5-3160-49e9-a244-845a5b64a9c1",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9387e424-d07d-4c62-b515-0aa355eff02e",
          "citation": "Drugs@FDA 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "63f6b37c-8af1-42fb-a253-24eb64fdb7a2",
          "citation": "Drugs@FDA 2012",
          "doc_type": "DRUGS@FDA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2aec52dc-5abf-414e-a21f-9d0e4b3406dc",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "08b976da-e8f6-47ef-9cff-8769d8af6ee3",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8ff09e6-a84e-4dad-852b-1a261f56723b",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a2329491-fae1-464e-be16-24606b23d9ac",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf80ccdc-b358-482d-8058-06c43d17bb8e",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f89f15e3-5f57-472a-8685-231298ea5671",
          "citation": "D06226",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "96318f3d-6a13-4232-b4bc-e35a37882ae2",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10664dee-101d-443b-803f-86d6c92b361c",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35e2bd66-5040-4d17-8da3-dea525d3b908",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b96d6372-d02c-463f-947c-93ea6889e301",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb57e3da-c2a5-409d-9852-cb6a1b2444b8",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb829335-11d5-48a2-b72d-246e60968812",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "42db9f61-3dcb-488a-a5f8-316d5f1006a8",
          "citation": "CHEMBL",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "950a6445-e0d9-41ca-b3d0-275f76ac876e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390554000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6bf8c925-801c-4e04-95ea-70407c0be623",
          "citation": "SRS import [4NM5039Y5X]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4NM5039Y5X",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390554000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0056f353-6920-4838-af99-9d3f0f66f68d",
          "citation": "TRICLOSAN [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e7835aea-dba7-495c-80cc-fec7f9a5b61d",
          "citation": "TRICLOSAN [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b31a7e53-ac31-4f1a-b8bb-aebab6a809c8",
          "citation": "TRICLOSAN [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "36f272bb-8214-4e9e-a30b-14489cde31e5",
          "citation": "TRICLOSAN [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b056de8f-ca61-43b0-97fc-0d867cdb55ff",
          "citation": "TRICLOSAN [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "badb0efe-f6fa-4ff0-98ee-08afbeb0e1a2",
          "citation": "TRICLOSAN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a3d8cd3c-0e03-4b0d-b1f3-cfbcb9e2c3e9",
          "citation": "TRICLOSAN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "58f74277-8189-432e-8427-6e36773a7452",
          "citation": "TRICLOSAN [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6e4736ac-f4b6-472b-a289-1d9f5de8b0cf",
          "citation": "TRICLOSAN [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "835cf720-3769-4296-8656-bd5209401570",
          "citation": "TRICLOSAN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dc48de32-c12a-45ee-b38e-ea8005c1604d",
          "citation": "TRICLOSAN [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d7ec6727-1b2f-455d-8651-43c1f0d426a2",
          "citation": "TRICLOSAN [DASH]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e32b5bb5-e5d6-37be-8af7-e923a8349850",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+3380-34-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6accaff2-03fb-1a81-b05b-146fe88607d1",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3380-34-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8f9cba72-22d4-ceaf-f528-5f3c38d8ea01",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "1a447732-0805-4330-5e31-9ae8ffaf270d",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "3fc42ffc-11c5-4218-8fbb-30e69ce37ffb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f334fb9f-ac3e-aa48-b558-2897d8bf5e7e",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "b872d0a9-5cbf-2de5-9978-63e918c6ce54",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "1d6fde29-60d9-56de-dd85-c4b2cdc48db7",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6a4328ce-d594-17c7-a910-9feb47ca6d22",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3f48152c-1f57-4b55-97ca-85ac62f86e15",
          "id": "3f48152c-1f57-4b55-97ca-85ac62f86e15",
          "molfile": "\n  Marvin  01132103212D          \n\n 17 18  0  0  0  0            999 V2000\n    1.4584    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4506   -0.8356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7240   -1.2456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7111   -2.0631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.4627    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.4351   -2.4835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1591   -2.0735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1591   -1.2534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8909   -0.8356    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5967   -1.2534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3156   -0.8486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0318   -1.2690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0240   -2.0890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7480   -2.5172    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.3052   -2.4939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5967   -2.0735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8727   -2.4939    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  8  2  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 16 10  2  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  1  0  0  0  0\nM  END",
          "smiles": "c1cc(c(cc1Cl)Cl)Oc2ccc(cc2O)Cl",
          "formula": "C12H7Cl3O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a4b3e067-f8e1-4a39-ab42-ade73e541883"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "289.542",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f672e370-5008-448d-ae32-a280727f9e20",
      "version": "31",
      "structure": {
        "id": "14ad9097-7b6b-4664-aaad-31c1fad8b3a9",
        "molfile": "\n  Marvin  01132101162D          \n\n 17 18  0  0  0  0            999 V2000\n    2.8909   -0.8356    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5967   -1.2534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1591   -1.2534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5967   -2.0735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4506   -0.8356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3052   -2.4939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7240   -1.2456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1591   -2.0735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3156   -0.8486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0240   -2.0890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7111   -2.0631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8727   -2.4939    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.4584    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0318   -1.2690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4351   -2.4835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.4627    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.7480   -2.5172    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  2  0  0  0  0\n  5  3  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  3  1  0  0  0  0\n  9  2  1  0  0  0  0\n 10 14  1  0  0  0  0\n 11 15  1  0  0  0  0\n 12  4  1  0  0  0  0\n 13  5  1  0  0  0  0\n 14  9  2  0  0  0  0\n 15  8  2  0  0  0  0\n 16 11  1  0  0  0  0\n 17 10  1  0  0  0  0\n  7 11  2  0  0  0  0\n  6 10  2  0  0  0  0\nM  END",
        "smiles": "c1cc(c(cc1Cl)Cl)Oc2ccc(cc2O)Cl",
        "formula": "C12H7Cl3O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "289.542",
        "optical_activity": "NONE",
        "references": [
          "6bf8c925-801c-4e04-95ea-70407c0be623",
          "c9c371f6-62db-459e-9223-00a11c123eff",
          "a8d5cba3-b2e3-450f-8d17-8ed0d8bce2d7"
        ],
        "stereo_centers": 0
      },
      "unii": "4NM5039Y5X"
    }
  ]
}