{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "29c26b5d-4e65-404e-bb7c-a2d07a61836a",
          "code": "479-81-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=479-81-2",
          "code_system": "CAS",
          "references": [
            "7fb13f84-99d9-4b01-9b74-9ccfcc44762b",
            "55327bfe-ca30-4db7-a988-7881cdf13053"
          ]
        },
        {
          "uuid": "c2441578-bf29-409d-8000-7889cbcf3299",
          "code": "C79555",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C79555",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7fb13f84-99d9-4b01-9b74-9ccfcc44762b"
          ]
        },
        {
          "uuid": "ce46421f-b963-4f44-b116-db08d9afa199",
          "code": "C005680",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67005680",
          "code_system": "MESH",
          "references": [
            "7fb13f84-99d9-4b01-9b74-9ccfcc44762b"
          ]
        },
        {
          "uuid": "f05a7ab3-bee0-4aef-8ff1-0bea1681b163",
          "code": "SUB05825MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "7fb13f84-99d9-4b01-9b74-9ccfcc44762b"
          ]
        },
        {
          "uuid": "d5c603c1-b2a6-421a-8ab4-f51e0bd7de1b",
          "code": "669",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=669",
          "code_system": "INN",
          "references": [
            "7fb13f84-99d9-4b01-9b74-9ccfcc44762b"
          ]
        },
        {
          "uuid": "19b83c83-1245-47f2-8f62-4684abc55750",
          "code": "207-538-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.854",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7fb13f84-99d9-4b01-9b74-9ccfcc44762b"
          ]
        },
        {
          "uuid": "a7ce1402-fe20-4bee-9673-c7080bb30b20",
          "code": "m2479",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2479?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "7fb13f84-99d9-4b01-9b74-9ccfcc44762b"
          ]
        },
        {
          "uuid": "eab98abd-5c8d-4149-81ab-ac64450c81c8",
          "code": "CHEMBL2110892",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2110892",
          "code_system": "ChEMBL",
          "references": [
            "7fb13f84-99d9-4b01-9b74-9ccfcc44762b"
          ]
        },
        {
          "uuid": "30216dd6-8097-4397-8102-0a0a60ddcf71",
          "code": "72064",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/72064",
          "code_system": "PUBCHEM",
          "references": [
            "7fb13f84-99d9-4b01-9b74-9ccfcc44762b"
          ]
        },
        {
          "uuid": "2766a12c-080d-ee66-0b38-adf5f0688599",
          "code": "C29698",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Antispasmodic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29698",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d99ad8af-4980-5e4e-50c1-7be77515cc91"
          ]
        },
        {
          "uuid": "b28a5cfb-a9d6-4702-946b-ad6d4cf333c2",
          "code": "4MGI916O6Y",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5164cbf5-a229-2a07-0eaf-2269302fa00d",
          "code": "3025",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3025",
          "code_system": "DRUG CENTRAL",
          "references": [
            "d99ad8af-4980-5e4e-50c1-7be77515cc91"
          ]
        },
        {
          "uuid": "2846d3c3-6d82-4df9-1e61-312f62fb2171",
          "code": "DTXSID20861993",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20861993",
          "code_system": "EPA CompTox",
          "references": [
            "d99ad8af-4980-5e4e-50c1-7be77515cc91"
          ]
        },
        {
          "uuid": "269e48ca-3f2b-e683-1575-6956e62db43a",
          "code": "100000085882",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "53c2d6a2-f41a-129d-a0bb-40585eff10db"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "9d8dfb6e-cba7-48a5-b4a6-a8b7fcc41449",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "386e4f53-9fbc-42e1-a9b5-086e53b54c63",
            "refuuid": "fcbe248c-e93c-4cdf-bdd9-70827d1167d5",
            "name": "BIETAMIVERINE",
            "unii": "4MGI916O6Y",
            "linking_id": "4MGI916O6Y",
            "ref_pname": "BIETAMIVERINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "671e9992-ca44-4087-b463-4f9348d258ba",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "be692825-2662-4e87-a48a-5b01a54fdc11",
            "refuuid": "1bd68907-97c0-4ce4-a7a1-9acaf964df1d",
            "name": "BIETAMIVERINE HYDROCHLORIDE",
            "unii": "646WTQ0G3E",
            "linking_id": "646WTQ0G3E",
            "ref_pname": "BIETAMIVERINE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6a602e88-7fa2-4253-be62-4e244177dfd1",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "02de3223-7d23-4190-9851-e88752183a28",
            "refuuid": "7640eb85-32a0-456c-a8db-2415afd94f9f",
            "name": "BIETAMIVERINE, (S)-",
            "unii": "60H1Z03F05",
            "linking_id": "60H1Z03F05",
            "ref_pname": "BIETAMIVERINE, (S)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "13023209-f11d-4138-8bc6-48f496e491f8",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "f7540eb1-9e15-40d2-9a3c-35c959286a77",
            "refuuid": "63c25dae-b401-4baa-af39-6285e4819fc4",
            "name": "BIETAMIVERINE, (R)-",
            "unii": "FDJ32Q39YG",
            "linking_id": "FDJ32Q39YG",
            "ref_pname": "BIETAMIVERINE, (R)-",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4bcfa3f5-0cd0-4f27-9042-99a45dabe03c",
          "name": "2-DIETHYLAMINOETHYL .ALPHA.-PHENYL-1-PIPERIDINEACETATE",
          "stdName": "2-DIETHYLAMINOETHYL .ALPHA.-PHENYL-1-PIPERIDINEACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb51df8f-88f2-43b3-bbac-864e7c776b2a"
          ],
          "display_name": false
        },
        {
          "uuid": "470f1e25-4d03-4c26-9824-d612abc1a37d",
          "name": "BIETAMIVERINE",
          "stdName": "BIETAMIVERINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab1f353a-f77b-4995-b015-ec166d3cc67b",
            "bb51df8f-88f2-43b3-bbac-864e7c776b2a",
            "6ad7aea0-7973-4bc3-85f5-290b4914620d",
            "caa80c15-7e55-4669-b036-d0249da3d5a7",
            "a7dafb09-1084-46fb-b53e-8ca7ab8c8763",
            "6fbdc6c3-4566-4afd-9458-7b8bec90b894",
            "ae3fd69a-b596-4a3f-be5f-9ac6943eb98a",
            "6b378f31-32ed-4b0f-aa38-367df65b0c76",
            "3ad1cb5f-b82b-45d8-9533-f6a70d215b99",
            "d4021abd-2190-4e88-9dee-456f18048cbd"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "bbd0ea25-6e77-426a-bf23-ee49b37d65b2",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "65508d34-a052-432c-a669-63c8460acb33",
          "name": "BIETAMIVERINE [MART.]",
          "stdName": "BIETAMIVERINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae3fd69a-b596-4a3f-be5f-9ac6943eb98a"
          ],
          "display_name": false
        },
        {
          "uuid": "5bf40112-3a4a-4530-bade-e1bd13193569",
          "name": "BIETAMIVERINE [MI]",
          "stdName": "BIETAMIVERINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab1f353a-f77b-4995-b015-ec166d3cc67b",
            "3ad1cb5f-b82b-45d8-9533-f6a70d215b99"
          ],
          "display_name": false
        },
        {
          "uuid": "23b2b111-77ff-d7f5-05d2-b8c5e063d881",
          "name": "Bietamiverine [WHO-DD]",
          "stdName": "BIETAMIVERINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2e00405c-171e-eb10-fa54-56ecea839f55"
          ],
          "display_name": false
        },
        {
          "uuid": "cc7db89d-d7dd-45aa-a872-9c1ff928285c",
          "name": "bietamiverine [INN]",
          "stdName": "BIETAMIVERINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b378f31-32ed-4b0f-aa38-367df65b0c76"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "bb51df8f-88f2-43b3-bbac-864e7c776b2a",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6b378f31-32ed-4b0f-aa38-367df65b0c76",
          "citation": "INN Proposed List 6",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL06.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ae3fd69a-b596-4a3f-be5f-9ac6943eb98a",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab1f353a-f77b-4995-b015-ec166d3cc67b",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3ad1cb5f-b82b-45d8-9533-f6a70d215b99",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d4021abd-2190-4e88-9dee-456f18048cbd",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7fb13f84-99d9-4b01-9b74-9ccfcc44762b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390760000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3376cc0f-85cc-48dc-8ede-3a14f0dccf72",
          "citation": "SRS import [4MGI916O6Y]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4MGI916O6Y",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390760000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b626728e-8ee8-488e-ab15-503f322afd92",
          "citation": "USP DICTIONARY 2008; INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6fbdc6c3-4566-4afd-9458-7b8bec90b894",
          "citation": "BIETAMIVERINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a7dafb09-1084-46fb-b53e-8ca7ab8c8763",
          "citation": "BIETAMIVERINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6ad7aea0-7973-4bc3-85f5-290b4914620d",
          "citation": "BIETAMIVERINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "caa80c15-7e55-4669-b036-d0249da3d5a7",
          "citation": "BIETAMIVERINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "53c2d6a2-f41a-129d-a0bb-40585eff10db",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "d99ad8af-4980-5e4e-50c1-7be77515cc91",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "55327bfe-ca30-4db7-a988-7881cdf13053",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2e00405c-171e-eb10-fa54-56ecea839f55",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "33bb372d-191d-443d-95c9-542c2172a4e3",
          "id": "33bb372d-191d-443d-95c9-542c2172a4e3",
          "molfile": "\n  Marvin  01132102462D          \n\n 23 24  0  0  0  0            999 V2000\n    7.5746   -1.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8542   -1.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8834   -2.6166    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5983   -3.0283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5993   -3.8533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1709   -3.0291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4584   -2.6208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7459   -3.0333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0334   -2.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0316   -1.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3209   -3.0375    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.6059   -2.6258    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6094   -1.8006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8953   -1.3890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1803   -1.8024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1840   -2.6317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8987   -3.0395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3219   -3.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6051   -4.2731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6057   -5.0973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3212   -5.5098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0375   -5.0920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0334   -4.2692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  6  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11  9  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 18  1  0  0  0  0\n 12 13  1  0  0  0  0\n 17 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 23 18  2  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\nM  END",
          "smiles": "CCN(CC)CCOC(=O)C(c1ccccc1)N2CCCCC2",
          "formula": "C19H30N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0d3ee955-9884-4ad2-8c6a-03d52a5cc14e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "318.4544",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "fcbe248c-e93c-4cdf-bdd9-70827d1167d5",
      "version": "9",
      "structure": {
        "id": "2f03721d-41db-40f8-a9a6-d5fff78abf72",
        "molfile": "\n  Marvin  01132102322D          \n\n 23 24  0  0  0  0            999 V2000\n    3.3209   -3.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0334   -2.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7459   -3.0333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4584   -2.6208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1709   -3.0291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8834   -2.6166    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6059   -2.6258    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3219   -3.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6094   -1.8006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8953   -1.3890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1803   -1.8024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1840   -2.6317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8987   -3.0395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6051   -4.2731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6057   -5.0973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3212   -5.5098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0375   -5.0920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0334   -4.2692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0316   -1.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5983   -3.0283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8542   -1.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5746   -1.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5993   -3.8533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n 11 12  1  0  0  0  0\n  5  6  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13  7  1  0  0  0  0\n  2  3  1  0  0  0  0\n  8 14  2  0  0  0  0\n  1  7  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n  1  8  1  0  0  0  0\n 16 17  1  0  0  0  0\n  3  4  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  2 19  2  0  0  0  0\n  1  2  1  0  0  0  0\n  6 20  1  0  0  0  0\n  9 10  1  0  0  0  0\n  6 21  1  0  0  0  0\n  4  5  1  0  0  0  0\n 21 22  1  0  0  0  0\n 10 11  1  0  0  0  0\n 20 23  1  0  0  0  0\nM  END",
        "smiles": "CCN(CC)CCOC(=O)C(c1ccccc1)N2CCCCC2",
        "formula": "C19H30N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "318.4544",
        "optical_activity": "( + / - )",
        "references": [
          "3376cc0f-85cc-48dc-8ede-3a14f0dccf72",
          "b626728e-8ee8-488e-ab15-503f322afd92",
          "6b378f31-32ed-4b0f-aa38-367df65b0c76"
        ],
        "stereo_centers": 1
      },
      "unii": "4MGI916O6Y"
    }
  ]
}