{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "e0e4245e-91e5-42fd-865c-b6be0539d366", "code": "31127-54-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=31127-54-5", "code_system": "CAS", "references": [ "6ae50d18-2a78-4ec4-b7a8-562f09a4c7ba", "2135108b-1d45-4346-bb43-885c37e3c192" ] }, { "uuid": "f1b05c6d-2ec5-43e3-8000-1a17e2c62744", "code": "919792", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/919792", "code_system": "PUBCHEM", "references": [ "6ae50d18-2a78-4ec4-b7a8-562f09a4c7ba" ] }, { "uuid": "3a7bc36a-9942-8b50-cb82-7ab74d6f070e", "code": "DTXSID5047956", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5047956", "code_system": "EPA CompTox" }, { "uuid": "7e069fc5-e9e5-452e-94ff-8d9ed2a5bbc6", "code": "4LA53WCH2Y", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "91aaff6b-7468-4b3a-8901-21078d474d91", "name": "(4-Hydroxyphenyl)(2,3,4-trihydroxyphenyl)methanone", "stdName": "(4-HYDROXYPHENYL)(2,3,4-TRIHYDROXYPHENYL)METHANONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2135108b-1d45-4346-bb43-885c37e3c192" ], "display_name": false }, { "uuid": "8612df93-f482-4835-bcee-683a25598c20", "name": "2,3,4,4′-Tetrahydroxybenzophenone", "stdName": "2,3,4,4'-TETRAHYDROXYBENZOPHENONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "cc366344-434d-4856-8bd7-4788cdfd3dcb", "2135108b-1d45-4346-bb43-885c37e3c192" ], "display_name": true }, { "uuid": "88c4f521-d672-40c0-971f-a7f9f60d0d0e", "name": "Methanone, (4-hydroxyphenyl)(2,3,4-trihydroxyphenyl)-", "stdName": "METHANONE, (4-HYDROXYPHENYL)(2,3,4-TRIHYDROXYPHENYL)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2135108b-1d45-4346-bb43-885c37e3c192" ], "display_name": false } ], "references": [ { "uuid": "cc366344-434d-4856-8bd7-4788cdfd3dcb", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6ae50d18-2a78-4ec4-b7a8-562f09a4c7ba", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392138000, "tags": [ "NOMEN" ] }, { "uuid": "2135108b-1d45-4346-bb43-885c37e3c192", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "19e750b9-0bfb-40fb-bbf9-ee4c36d9a4b1", "id": "19e750b9-0bfb-40fb-bbf9-ee4c36d9a4b1", "molfile": "\n Marvin 01132101312D \n\n 18 19 0 0 0 0 999 V2000\n 0.0000 -2.4734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7173 -2.0659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4347 -2.4734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1520 -2.0659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1520 -1.2395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4347 -0.8321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7173 -1.2395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8694 -0.8321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8694 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5867 -1.2395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5867 -2.0659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3041 -2.4734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0214 -2.0659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7387 -2.4734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0214 -1.2395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7387 -0.8321 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3041 -0.8321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3041 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 7 2 0 0 0 0\n 4 3 2 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 2 0 0 0 0\n 8 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 9 2 0 0 0 0\n 10 8 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 17 2 0 0 0 0\n 12 11 2 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 13 2 0 0 0 0\n 15 16 1 0 0 0 0\n 17 15 1 0 0 0 0\n 17 18 1 0 0 0 0\nM END", "smiles": "c1cc(ccc1C(=O)c2ccc(c(c2O)O)O)O", "formula": "C13H10O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "74a98b4b-0170-450a-a6de-0ee7be628b6f" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "246.216", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "bcc9f546-7861-43af-8713-7641a105b0ef", "version": "7", "structure": { "id": "4d5ce12a-cb4a-4d67-8f39-46dedd416abb", "molfile": "\n Marvin 01132104022D \n\n 18 19 0 0 0 0 999 V2000\n 3.5867 -1.2395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3041 -0.8321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0214 -1.2395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0214 -2.0659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3041 -2.4734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5867 -2.0659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8694 -0.8321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8694 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1520 -1.2395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1520 -2.0659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4347 -2.4734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7173 -2.0659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7173 -1.2395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4347 -0.8321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3041 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7387 -0.8321 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7387 -2.4734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.4734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 7 1 0 0 0 0\n 1 6 2 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 2 15 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 16 1 0 0 0 0\n 4 5 2 0 0 0 0\n 4 17 1 0 0 0 0\n 5 6 1 0 0 0 0\n 7 8 2 0 0 0 0\n 7 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 9 14 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 12 18 1 0 0 0 0\n 13 14 2 0 0 0 0\nM END", "smiles": "c1cc(ccc1C(=O)c2ccc(c(c2O)O)O)O", "formula": "C13H10O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "246.216", "optical_activity": "NONE", "references": [ "cc366344-434d-4856-8bd7-4788cdfd3dcb", "2135108b-1d45-4346-bb43-885c37e3c192" ], "stereo_centers": 0 }, "unii": "4LA53WCH2Y" } ] }