{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1ccf2252-f1a6-44a2-bb4c-7d5553bfed65",
          "code": "A11HA07",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|VITAMINS|OTHER PLAIN VITAMIN PREPARATIONS|Other plain vitamin preparations|inositol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A11HA07&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "e9c07e3b-9434-45b0-b153-8eebc803abe6"
          ]
        },
        {
          "uuid": "e3da35f0-d881-452f-a64d-cad06738fdd8",
          "code": "QA11HA07",
          "comments": "VATC|VITAMINS|OTHER PLAIN VITAMIN PREPARATIONS|Other plain vitamin preparations|inositol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA11HA07&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "e9c07e3b-9434-45b0-b153-8eebc803abe6"
          ]
        },
        {
          "uuid": "7bd56a6c-07b4-4330-8bd3-c6bccac1218d",
          "code": "87-89-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=87-89-8",
          "code_system": "CAS",
          "references": [
            "e9c07e3b-9434-45b0-b153-8eebc803abe6",
            "ad082d49-8a90-4682-9cb3-a8c74d13792d"
          ]
        },
        {
          "uuid": "a1cc9f1d-197d-4352-ad83-3b1b33046d4d",
          "code": "C28163",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28163",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e9c07e3b-9434-45b0-b153-8eebc803abe6"
          ]
        },
        {
          "uuid": "7e7352cc-e01f-401e-8cba-78c4f218878f",
          "code": "D007294",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68007294",
          "code_system": "MESH",
          "references": [
            "e9c07e3b-9434-45b0-b153-8eebc803abe6"
          ]
        },
        {
          "uuid": "4bd45bf7-7908-4989-8e7b-f0bff2efc849",
          "code": "INOSITOL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Inositol",
          "code_system": "WIKIPEDIA",
          "references": [
            "e9c07e3b-9434-45b0-b153-8eebc803abe6"
          ]
        },
        {
          "uuid": "79f1b92c-a21f-49f4-b154-725d9316909b",
          "code": "21 CFR 184.1370",
          "comments": "PART 184 -- DIRECT FOOD SUBSTANCES AFFIRMED AS GENERALLY RECOGNIZED AS SAFE|Subpart B--Listing of Specific Substances Affirmed as GRAS|Sec. 184.1370 Inositol",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=184.137",
          "code_system": "CFR",
          "references": [
            "e9c07e3b-9434-45b0-b153-8eebc803abe6"
          ]
        },
        {
          "uuid": "27f1d9d2-ca5a-421e-8343-4559b250f62e",
          "code": "230-024-9",
          "type": "ALTERNATIVE",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.027.295",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e9c07e3b-9434-45b0-b153-8eebc803abe6"
          ]
        },
        {
          "uuid": "ab160cec-2417-4186-946a-83566f73bb14",
          "code": "5833",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/5833/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "e9c07e3b-9434-45b0-b153-8eebc803abe6"
          ]
        },
        {
          "uuid": "54804033-3da8-4195-ae82-29ddb7369f66",
          "code": "m6291",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6291?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "e9c07e3b-9434-45b0-b153-8eebc803abe6"
          ]
        },
        {
          "uuid": "992f3009-4a26-4609-bef7-87fbbb855b85",
          "code": "10437",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=10437",
          "code_system": "INN",
          "references": [
            "e9c07e3b-9434-45b0-b153-8eebc803abe6"
          ]
        },
        {
          "uuid": "453d07f2-f2fe-4c3b-ad6f-2cc75b120658",
          "code": "SUB02688MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "e9c07e3b-9434-45b0-b153-8eebc803abe6"
          ]
        },
        {
          "uuid": "9a71c2b8-ab81-4e2f-b9bb-82143581f18e",
          "code": "SUB123686",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "e9c07e3b-9434-45b0-b153-8eebc803abe6"
          ]
        },
        {
          "uuid": "4eeac6bb-bdf2-4478-a658-6e91147d2052",
          "code": "6917-35-7",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6917-35-7",
          "code_system": "CAS",
          "references": [
            "e9c07e3b-9434-45b0-b153-8eebc803abe6",
            "11f66977-2936-4bdd-8d62-0f4106d13fd2"
          ]
        },
        {
          "uuid": "bded8823-c885-4edd-b328-e6ced85a06c0",
          "code": "CHEMBL1222251",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1222251",
          "code_system": "ChEMBL",
          "references": [
            "e9c07e3b-9434-45b0-b153-8eebc803abe6"
          ]
        },
        {
          "uuid": "f7168693-ba0b-4494-999f-23ee03a93810",
          "code": "201-781-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.620",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e9c07e3b-9434-45b0-b153-8eebc803abe6"
          ]
        },
        {
          "uuid": "3f486029-1b58-c697-8cd9-6493d1793715",
          "code": "DTXSID7023146",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7023146",
          "code_system": "EPA CompTox",
          "references": [
            "9f1757a9-4a80-b9c4-c6a8-268f9fe3d7b6"
          ]
        },
        {
          "uuid": "62a9ac06-25c5-0825-ddb4-a148b56e8597",
          "code": "202105",
          "comments": "ORPHAN DRUG|Designated|Prevention of retinopathy of prematurity in preterm infants at risk for developing retinopathy of prematurity",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=202105",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "5034f30b-37d5-db5b-0a0a-2c07ebc1a195",
          "code": "C1903",
          "comments": "Physiology-Regulatory Factor[C1899]|Signaling Molecule[C1929]|Intracellular Second Messenger",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1903",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a8b2ed46-f383-1f7d-7efa-a703ccc5f07f"
          ]
        },
        {
          "uuid": "0b974a36-19f8-476d-a547-a51c5701e589",
          "code": "4L6452S749",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a8d0d382-0884-1c1b-0b1c-df3c8a4f0157",
          "code": "1444",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1444",
          "code_system": "DRUG CENTRAL",
          "references": [
            "2967526f-9d2c-0f1d-fe31-785b5068d2bf"
          ]
        },
        {
          "uuid": "23d9f44f-c028-7ac3-17e0-03738837eefc",
          "code": "85 (Number of products:3724)",
          "comments": "Dietary Supplement Label Database|Vitamin|Inositol",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=85&item=Inositol",
          "code_system": "DSLD",
          "references": [
            "2967526f-9d2c-0f1d-fe31-785b5068d2bf"
          ]
        },
        {
          "uuid": "f9d5ffd9-4552-10af-68f8-1d9f69906dbf",
          "code": "DB13178",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB13178",
          "code_system": "DRUG BANK",
          "references": [
            "2967526f-9d2c-0f1d-fe31-785b5068d2bf"
          ]
        },
        {
          "uuid": "68c663b0-4467-ea04-446f-424b54e54170",
          "code": "1340960",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1340960",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "2967526f-9d2c-0f1d-fe31-785b5068d2bf"
          ]
        },
        {
          "uuid": "504c9cc1-d510-0f03-c698-b3ae7b827bf8",
          "code": "24848",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:24848",
          "code_system": "CHEBI",
          "references": [
            "2967526f-9d2c-0f1d-fe31-785b5068d2bf"
          ]
        },
        {
          "uuid": "6be33e85-908d-156c-2d52-deea4e0eadba",
          "code": "17268",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:17268",
          "code_system": "CHEBI",
          "references": [
            "2967526f-9d2c-0f1d-fe31-785b5068d2bf"
          ]
        },
        {
          "uuid": "2133f617-fe21-c1d2-bad5-3170d65201a7",
          "code": "55551",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=55551",
          "code_system": "NSC",
          "references": [
            "6c504ce5-b964-1763-0f75-badfa3009a08"
          ]
        },
        {
          "uuid": "94e4c457-e52f-e3c4-d1c3-073b348f0541",
          "code": "100000086407",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "a23a8e91-989a-ab9b-5945-49367e36444c"
          ]
        },
        {
          "uuid": "966d87b4-cac3-f620-9f78-eb2638bda140",
          "code": "CD-74",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/CD-74/relevant/1/",
          "code_system": "USAN",
          "references": [
            "0d47e19b-b9cf-8f4d-9373-79fc1874d241"
          ]
        },
        {
          "uuid": "c2eeb40d-7fa6-31de-a5d5-d9d6660ba6dc",
          "code": "25142",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=25142",
          "code_system": "NSC",
          "references": [
            "6c504ce5-b964-1763-0f75-badfa3009a08"
          ]
        },
        {
          "uuid": "07e9f31d-c04e-151a-7ef3-26b509b35170",
          "code": "8101",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=8101",
          "code_system": "NSC",
          "references": [
            "6c504ce5-b964-1763-0f75-badfa3009a08"
          ]
        },
        {
          "uuid": "8b4982f8-edb6-3226-ffb3-b5f558e7aae9",
          "code": "4L6452S749",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=4L6452S749",
          "code_system": "DAILYMED",
          "references": [
            "f3db3438-7731-e875-b620-c038d9faf1cd"
          ]
        },
        {
          "uuid": "58bd0ae0-3edd-03b2-3702-1c634f15d40c",
          "code": "404118",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=404118",
          "code_system": "NSC",
          "references": [
            "6c504ce5-b964-1763-0f75-badfa3009a08"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "4c51fcb1-6f16-421d-8398-f1068221866d",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "07ad68a9-e64e-43a5-aa6b-28406f8f00b9",
            "refuuid": "1e60fb00-f3aa-4169-aab9-c7ded883b059",
            "name": "INOSITOL",
            "unii": "4L6452S749",
            "linking_id": "4L6452S749",
            "ref_pname": "INOSITOL",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6495f12c-806b-48d2-a44f-f8746783bb7a",
          "name": "1,2,3,5-TRANS-4,6-CYCLOHEXANEHEXOL, CIS-",
          "stdName": "1,2,3,5-TRANS-4,6-CYCLOHEXANEHEXOL, CIS-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a97f0da4-3efd-45bf-8df6-cf49261c458f",
            "e1dd3193-56cf-4c7a-9292-4c1248677168"
          ],
          "display_name": false
        },
        {
          "uuid": "9ab3313a-8ed2-42d3-be07-a2c1f99a49fc",
          "name": "CIS-1,2,3,5-TRANS-4,6-CYCLOHEXANEHEXOL",
          "stdName": "CIS-1,2,3,5-TRANS-4,6-CYCLOHEXANEHEXOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a97f0da4-3efd-45bf-8df6-cf49261c458f",
            "9d08a133-109b-4038-863f-bf78a9eeae78"
          ],
          "display_name": false
        },
        {
          "uuid": "604d8d7a-8511-2d34-ee6d-e6f3a2fb9f54",
          "name": "I-INOSITOL",
          "stdName": "I-INOSITOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "038e96c3-67c5-76db-0267-3fe18899bb03"
          ],
          "display_name": false
        },
        {
          "uuid": "e2ac051b-eee7-4b60-8d0b-a495bf15ad23",
          "name": "INOSITOL",
          "stdName": "INOSITOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c0c65f07-f41a-4289-9e2c-bb6685b8002e",
            "1d4c7320-8a3d-44b9-8ddf-d3f046101dfa",
            "3937b309-3067-4ca4-9e04-81cb27f008d3",
            "bbb31e28-2a6e-4e49-9529-afec9ace0211",
            "f956aa91-73af-49b7-8a04-150cd0df7f11",
            "5d348d13-dc80-444e-ae8c-e1040751398f",
            "63f2b019-1c55-4605-ad1c-39314329a9e3",
            "4482ce06-2aad-498f-beeb-8ec3c10005d7",
            "f22fb676-f527-44b4-8584-9c05f23a93b1",
            "9d08a133-109b-4038-863f-bf78a9eeae78",
            "e2c97909-e37a-4fc7-9c94-f3c8f4ef191e",
            "1f23a6c8-f745-4b65-9581-bd9da26828ac",
            "ab2ef21d-cc14-47d0-86e4-27b2ad9b1f08",
            "fd0b951c-ca1d-4fbe-9bab-c5cff796ecc7",
            "ef8ea8f4-0105-478f-9f0f-b56c4e86f276",
            "7d94ccf7-2f06-49b5-9fdd-9be82fef295f",
            "2d2c4c0c-68b8-485d-a655-2e2cc48cd257",
            "45563486-8d3b-43aa-b991-a94860625809",
            "8eb4623a-fb9d-4d09-bebe-5ea59279f0c5"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "a8471aa8-21df-410f-bb1d-5d5da48210e6",
              "name_org": "INCI"
            },
            {
              "uuid": "fab547d1-57e3-4f89-a77c-3f3f5c633ebc",
              "name_org": "USAN"
            },
            {
              "uuid": "d4b52cdc-71ba-4a5e-b037-9bf9c2ed5bb1",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "1e457c23-673d-43e4-b050-ad606340a8e0",
          "name": "INOSITOL [FCC]",
          "stdName": "INOSITOL [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f956aa91-73af-49b7-8a04-150cd0df7f11"
          ],
          "display_name": false
        },
        {
          "uuid": "b481d883-0225-41e5-b038-fe4ae41995da",
          "name": "INOSITOL [MART.]",
          "stdName": "INOSITOL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d4c7320-8a3d-44b9-8ddf-d3f046101dfa"
          ],
          "display_name": false
        },
        {
          "uuid": "43c8f1ed-16be-42f0-93d4-af6748d335c8",
          "name": "INOSITOL [MI]",
          "stdName": "INOSITOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab2ef21d-cc14-47d0-86e4-27b2ad9b1f08"
          ],
          "display_name": false
        },
        {
          "uuid": "69a5a0d9-9e81-4e06-80ec-68e8f032a143",
          "name": "INOSITOL [USAN]",
          "stdName": "INOSITOL [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d2c4c0c-68b8-485d-a655-2e2cc48cd257"
          ],
          "display_name": false
        },
        {
          "uuid": "be4c5b91-4a76-4429-bfea-368240668500",
          "name": "INOSITOL [USP-RS]",
          "stdName": "INOSITOL [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f22fb676-f527-44b4-8584-9c05f23a93b1"
          ],
          "display_name": false
        },
        {
          "uuid": "3ec30bde-ecf5-414f-9c8d-72c35249e829",
          "name": "INOSITOL [VANDF]",
          "stdName": "INOSITOL [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3937b309-3067-4ca4-9e04-81cb27f008d3"
          ],
          "display_name": false
        },
        {
          "uuid": "c411fe31-cfd3-4f63-b421-df3ccf00b749",
          "name": "INOSITOL, MYO",
          "stdName": "INOSITOL, MYO",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d973cdbf-1cbc-4183-9c7f-99b256b221ea"
          ],
          "display_name": false
        },
        {
          "uuid": "6c815752-0a2f-4d4a-aa4d-ba40a7eb9d36",
          "name": "INOSITOL, MYO-",
          "stdName": "INOSITOL, MYO-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d2c4c0c-68b8-485d-a655-2e2cc48cd257"
          ],
          "display_name": false
        },
        {
          "uuid": "3e9740a3-909c-3120-1588-b1b47ebc57ee",
          "name": "Inositol [WHO-DD]",
          "stdName": "INOSITOL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a20e79b-4fa0-3148-6b32-e8c10e14c93d"
          ],
          "display_name": false
        },
        {
          "uuid": "78abcee0-8cb6-5359-1285-c42cd0ce3dba",
          "name": "MYO-INOSITOL [EP MONOGRAPH]",
          "stdName": "MYO-INOSITOL [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "257bc60c-1085-f5c3-80df-9bf9b08a83d9"
          ],
          "display_name": false
        },
        {
          "uuid": "650b91da-a94f-4f7a-ac49-125f378365b5",
          "name": "NSC-25142",
          "stdName": "NSC-25142",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e1dd3193-56cf-4c7a-9292-4c1248677168"
          ],
          "display_name": false
        },
        {
          "uuid": "6e94e3a9-383b-40a8-a1a9-261368a31b82",
          "name": "NSC-404118",
          "stdName": "NSC-404118",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22f64eb3-61ed-4aaa-bd0b-6b6ae76becbe"
          ],
          "display_name": false
        },
        {
          "uuid": "68efe036-42ec-4c7e-bcb7-6405937d8fd1",
          "name": "NSC-55551",
          "stdName": "NSC-55551",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e1dd3193-56cf-4c7a-9292-4c1248677168"
          ],
          "display_name": false
        },
        {
          "uuid": "a81f5e6a-0453-4f90-8628-dbe84910d360",
          "name": "NSC-8101",
          "stdName": "NSC-8101",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a97f0da4-3efd-45bf-8df6-cf49261c458f",
            "e1dd3193-56cf-4c7a-9292-4c1248677168"
          ],
          "display_name": false
        },
        {
          "uuid": "5199f0b3-e929-45ad-ac12-82465a383a5c",
          "name": "inositol [INN]",
          "stdName": "INOSITOL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1f23a6c8-f745-4b65-9581-bd9da26828ac",
            "53d798c2-3b9d-44ac-a53e-fb09a95f25b0"
          ],
          "display_name": false
        },
        {
          "uuid": "d4b8fc81-0380-4c49-8359-8a4b04dbd4cd",
          "name": "myo-Inositol",
          "stdName": "MYO-INOSITOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1461c78-197a-4fbe-a86e-b7fd56b26746",
            "9d08a133-109b-4038-863f-bf78a9eeae78",
            "bd4c1ff7-c867-4f57-8fcb-56dbe2be8cdc"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9d08a133-109b-4038-863f-bf78a9eeae78",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e1dd3193-56cf-4c7a-9292-4c1248677168",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a97f0da4-3efd-45bf-8df6-cf49261c458f",
          "citation": "STN 2007",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bd4c1ff7-c867-4f57-8fcb-56dbe2be8cdc",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1d4c7320-8a3d-44b9-8ddf-d3f046101dfa",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab2ef21d-cc14-47d0-86e4-27b2ad9b1f08",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef8ea8f4-0105-478f-9f0f-b56c4e86f276",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f956aa91-73af-49b7-8a04-150cd0df7f11",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f22fb676-f527-44b4-8584-9c05f23a93b1",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "63f2b019-1c55-4605-ad1c-39314329a9e3",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3937b309-3067-4ca4-9e04-81cb27f008d3",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d973cdbf-1cbc-4183-9c7f-99b256b221ea",
          "citation": "evmpd",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2d2c4c0c-68b8-485d-a655-2e2cc48cd257",
          "citation": "USAN COUN 2016",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22f64eb3-61ed-4aaa-bd0b-6b6ae76becbe",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f23a6c8-f745-4b65-9581-bd9da26828ac",
          "citation": "INN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e9c07e3b-9434-45b0-b153-8eebc803abe6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389721000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3324c0c4-1800-4a55-9ccc-806db9020b19",
          "citation": "SRS import [4L6452S749]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4L6452S749",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389721000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f1461c78-197a-4fbe-a86e-b7fd56b26746",
          "citation": "MYO-INOSITOL [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4482ce06-2aad-498f-beeb-8ec3c10005d7",
          "citation": "INOSITOL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7d94ccf7-2f06-49b5-9fdd-9be82fef295f",
          "citation": "INOSITOL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e2c97909-e37a-4fc7-9c94-f3c8f4ef191e",
          "citation": "INOSITOL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8eb4623a-fb9d-4d09-bebe-5ea59279f0c5",
          "citation": "INOSITOL [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5d348d13-dc80-444e-ae8c-e1040751398f",
          "citation": "INOSITOL [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bbb31e28-2a6e-4e49-9529-afec9ace0211",
          "citation": "INOSITOL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c0c65f07-f41a-4289-9e2c-bb6685b8002e",
          "citation": "INOSITOL [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "45563486-8d3b-43aa-b991-a94860625809",
          "citation": "INOSITOL [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fd0b951c-ca1d-4fbe-9bab-c5cff796ecc7",
          "citation": "INOSITOL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9f1757a9-4a80-b9c4-c6a8-268f9fe3d7b6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=87-89-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a23a8e91-989a-ab9b-5945-49367e36444c",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "038e96c3-67c5-76db-0267-3fe18899bb03",
          "citation": "http://www.selleckchem.com/products/i-inositol.html",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "a8b2ed46-f383-1f7d-7efa-a703ccc5f07f",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "92ab8c07-3c28-015a-962d-87150355b66b",
          "citation": "USAN COUN 2016",
          "doc_type": "USANCOUN",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "11f66977-2936-4bdd-8d62-0f4106d13fd2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ad082d49-8a90-4682-9cb3-a8c74d13792d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "0d47e19b-b9cf-8f4d-9373-79fc1874d241",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "53d798c2-3b9d-44ac-a53e-fb09a95f25b0",
          "citation": "INN Proposed List 116",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL116.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2967526f-9d2c-0f1d-fe31-785b5068d2bf",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "257bc60c-1085-f5c3-80df-9bf9b08a83d9",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "6c504ce5-b964-1763-0f75-badfa3009a08",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "5a20e79b-4fa0-3148-6b32-e8c10e14c93d",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "f3db3438-7731-e875-b620-c038d9faf1cd",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ad7bc8dd-3723-47d5-87ff-b54138fc5215",
          "id": "ad7bc8dd-3723-47d5-87ff-b54138fc5215",
          "molfile": "\n  Marvin  01132109002D          \n\n 12 12  0  0  0  0            999 V2000\n    9.0997   -4.9131    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2752   -4.9131    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.8700   -4.1945    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.2891   -3.4715    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0501   -4.1945    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.6357   -3.4670    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6356   -4.9085    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.8112   -4.9085    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0409   -5.6224    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.6219   -6.3363    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8700   -5.6224    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.2845   -6.3363    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n  2  3  1  0  0  0  0\n  2 11  1  0  0  0  0\n  3  4  1  1  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  6  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  1  0  0  0\n 11  9  1  0  0  0  0\n 11 12  1  6  0  0  0\nM  END",
          "smiles": "[C@@H]1([C@@H]([C@H]([C@@H]([C@H]([C@H]1O)O)O)O)O)O",
          "formula": "C6H12O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9b7a1dc3-9a93-4521-82d4-fae28801c6da"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "180.1561",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1e60fb00-f3aa-4169-aab9-c7ded883b059",
      "version": "36",
      "structure": {
        "id": "4e9ee5cb-9f2d-4cbd-b2b6-9892c705371c",
        "molfile": "\n  Marvin  01132104062D          \n\n 12 12  0  0  1  0            999 V2000\n    7.0409   -5.6224    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.8700   -5.6224    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.2752   -4.9131    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.0997   -4.9131    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8700   -4.1945    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.0501   -4.1945    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.6356   -4.9085    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.8112   -4.9085    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6357   -3.4670    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2891   -3.4715    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2845   -6.3363    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6219   -6.3363    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  1  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  1  1  0  0  0  0\n  7  8  1  6  0  0  0\n  6  9  1  1  0  0  0\n  5 10  1  1  0  0  0\n  2 11  1  6  0  0  0\n  1 12  1  1  0  0  0\nM  END",
        "smiles": "[C@@H]1([C@@H]([C@H]([C@@H]([C@H]([C@H]1O)O)O)O)O)O",
        "formula": "C6H12O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "180.1561",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "3324c0c4-1800-4a55-9ccc-806db9020b19",
          "9d08a133-109b-4038-863f-bf78a9eeae78",
          "53d798c2-3b9d-44ac-a53e-fb09a95f25b0"
        ],
        "stereo_centers": 0
      },
      "unii": "4L6452S749"
    }
  ]
}