{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "59e7807f-b4cf-437d-91f2-f09b0a329a44",
          "code": "C61629",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C61629",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d677ff43-e802-4888-b1fb-50bb6b51594a"
          ]
        },
        {
          "uuid": "b6d7bdf2-bdec-442b-9f15-ed20cfc2bbfc",
          "code": ".ALPHA.-D-GLUCOPYRANOSE MONOHYDRATE",
          "comments": "Description: Colourless crystals or a white, crystalline or granular powder; odourless. Solubility: Soluble in about 1 part of water; slightly soluble in ethanol (~750 g/l) TS; more soluble in boiling water and boilingethanol (~750 g/l) TS.Category: Nutrient; fluid replenisher. Storage: Glucose should be kept in a well-closed container. Labelling: The designation on the container of Glucose should state whether the substance is the monohydrate or is in the anhydrous form. If the material is not intended for parenteral use a designation \"for oral use only\" should be added. Additional information: Glucose has a sweet taste. Definition: Glucose contains not less than 99.0% and not more than 101.5% of C6H12O6, calculated with reference to the anhydrous substance.",
          "type": "PRIMARY",
          "url": "http://apps.who.int/phint/pdf/b/Jb.6.1.193.pdf",
          "code_system": "WHO INTERNATIONAL PHARMACOPEIA",
          "references": [
            "d677ff43-e802-4888-b1fb-50bb6b51594a"
          ]
        },
        {
          "uuid": "cde0d561-9a17-4d9e-a071-da87683694f4",
          "code": "66370",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/66370",
          "code_system": "PUBCHEM",
          "references": [
            "d677ff43-e802-4888-b1fb-50bb6b51594a"
          ]
        },
        {
          "uuid": "93a6a366-1f2a-498a-acd9-f4b744f0b0e9",
          "code": "14431-43-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=14431-43-7",
          "code_system": "CAS",
          "references": [
            "d677ff43-e802-4888-b1fb-50bb6b51594a",
            "32cb28a1-887d-44eb-96ac-d444cf3f2bbb"
          ]
        },
        {
          "uuid": "ec31623b-e1bd-5aef-7e46-96f936dbbd32",
          "code": "5996-10-1",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5996-10-1",
          "code_system": "CAS",
          "references": [
            "32cb28a1-887d-44eb-96ac-d444cf3f2bbb"
          ]
        },
        {
          "uuid": "d939e580-e757-4168-be0a-2b0e0238356d",
          "code": "4L3WC4P6GF",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "87897ab6-0486-b4f7-29bb-d591f6f044d9",
          "code": "DTXSID30881263",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30881263",
          "code_system": "EPA CompTox"
        }
      ],
      "relationships": [
        {
          "uuid": "b0f163d9-f89d-4916-8eab-633a960508ab",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "39a41cec-c071-4ec5-9e3b-2ec8780b8adc",
            "refuuid": "674114ca-018b-42e4-9b4c-b88b50d795af",
            "name": ".ALPHA.-D-GLUCOPYRANOSE",
            "unii": "5J5I9EB41E",
            "linking_id": "5J5I9EB41E",
            "ref_pname": ".ALPHA.-D-GLUCOPYRANOSE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "10b97686-0d90-defc-6d81-a1e73d90fa6c",
          "type": "ANHYDROUS->SOLVATE",
          "references": [
            "32cb28a1-887d-44eb-96ac-d444cf3f2bbb"
          ],
          "related_substance": {
            "uuid": "e030247f-209a-402c-abbc-f045609863f8",
            "refuuid": "674114ca-018b-42e4-9b4c-b88b50d795af",
            "name": ".ALPHA.-D-GLUCOPYRANOSE",
            "unii": "5J5I9EB41E",
            "linking_id": "5J5I9EB41E",
            "ref_pname": ".ALPHA.-D-GLUCOPYRANOSE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b0c08415-0bf1-4c74-a59f-be4620e5b59f",
          "name": ".ALPHA.-D-GLUCOPYRANOSE MONOHYDRATE",
          "stdName": ".ALPHA.-D-GLUCOPYRANOSE MONOHYDRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "60c2f5dc-afd3-4440-b3d9-681041a36978",
            "96e04944-5ab5-446b-bafd-81c0b801e279"
          ],
          "display_name": true
        },
        {
          "uuid": "937aed20-a73d-4483-b079-28683bd6f453",
          "name": ".ALPHA.-D-GLUCOPYRANOSE, HYDRATE (1:1)",
          "stdName": ".ALPHA.-D-GLUCOPYRANOSE, HYDRATE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4eb8a4fd-92ac-49e1-a8d0-aec55e488d53",
            "60c2f5dc-afd3-4440-b3d9-681041a36978"
          ],
          "display_name": false
        },
        {
          "uuid": "2ebe4869-c915-409c-ba64-1d69cb8ca070",
          "name": ".ALPHA.-D-GLUCOPYRANOSE, MONOHYDRATE",
          "stdName": ".ALPHA.-D-GLUCOPYRANOSE, MONOHYDRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4eb8a4fd-92ac-49e1-a8d0-aec55e488d53"
          ],
          "display_name": false
        },
        {
          "uuid": "d39c2a86-17ae-4139-924c-29f0b8f72ef5",
          "name": ".ALPHA.-D-GLUCOSE MONOHYDRATE",
          "stdName": ".ALPHA.-D-GLUCOSE MONOHYDRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4eb8a4fd-92ac-49e1-a8d0-aec55e488d53",
            "60c2f5dc-afd3-4440-b3d9-681041a36978"
          ],
          "display_name": false
        },
        {
          "uuid": "0404b360-d0be-4915-a1f1-9459e0dd687a",
          "name": "GLUCOSE MONOHYDRATE [WHO-IP]",
          "stdName": "GLUCOSE MONOHYDRATE [WHO-IP]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a5de19f8-e6ff-46d2-a139-acc2f164359e",
            "60c2f5dc-afd3-4440-b3d9-681041a36978"
          ],
          "display_name": false
        },
        {
          "uuid": "50880c5a-1739-4f43-8928-b60a803bfd33",
          "name": "GLUCOSUM MONOHYDRATE [WHO-IP LATIN]",
          "stdName": "GLUCOSUM MONOHYDRATE [WHO-IP LATIN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a5de19f8-e6ff-46d2-a139-acc2f164359e",
            "60c2f5dc-afd3-4440-b3d9-681041a36978"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4eb8a4fd-92ac-49e1-a8d0-aec55e488d53",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "60c2f5dc-afd3-4440-b3d9-681041a36978",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "96e04944-5ab5-446b-bafd-81c0b801e279",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a5de19f8-e6ff-46d2-a139-acc2f164359e",
          "citation": "WHO-IP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d677ff43-e802-4888-b1fb-50bb6b51594a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390176000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "54ef38f9-a7e5-4c24-8255-a498689a976b",
          "citation": "SRS import [4L3WC4P6GF]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4L3WC4P6GF",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390176000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "32cb28a1-887d-44eb-96ac-d444cf3f2bbb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f308035d-0d38-49ee-8ec1-9263dae9f574",
          "id": "f308035d-0d38-49ee-8ec1-9263dae9f574",
          "molfile": "\n  Marvin  01132112362D          \n\n  1  0  0  0  1  0            999 V2000\n    8.2398   -5.1645    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "O",
          "formula": "H2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "248a3235-672d-4668-9b28-eca22f631530"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "18.0153",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "67793869-a1d8-4f3a-a2a1-4ef5d56c98bb",
          "id": "67793869-a1d8-4f3a-a2a1-4ef5d56c98bb",
          "molfile": "\n  Marvin  01132105232D          \n\n 12 12  0  0  1  0            999 V2000\n    5.9967   -5.1520    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.8248   -5.1645    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5931   -4.4237    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7691   -4.4154    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.3737   -3.6913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6205   -3.6372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3446   -5.1228    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.5206   -5.1062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7399   -5.8428    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.3196   -6.5503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5722   -5.8594    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.9717   -6.5835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 11  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n  7  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  8  1  6  0  0  0\n  9  7  1  0  0  0  0\n  9 10  1  1  0  0  0\n 11  9  1  0  0  0  0\n 11 12  1  6  0  0  0\nM  END",
          "smiles": "C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O)O1)O)O)O)O",
          "formula": "C6H12O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "31f6154b-b62b-4d1d-aa89-47c2980e6d30"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "180.1561",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3112399c-0b1a-4e4b-9e3e-9adb13be9fc9",
      "version": "9",
      "structure": {
        "id": "e68b2d16-cd5d-470e-bd1b-120cfba3e099",
        "molfile": "\n  Marvin  01132111562D          \n\n 13 12  0  0  1  0            999 V2000\n    5.5722   -5.8594    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.7399   -5.8428    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.5931   -4.4237    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9967   -5.1520    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.3446   -5.1228    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.7691   -4.4154    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.9717   -6.5835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3196   -6.5503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5206   -5.1062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8248   -5.1645    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3737   -3.6913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6205   -3.6372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2398   -5.1645    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  1  7  1  6  0  0  0\n  2  8  1  1  0  0  0\n  5  9  1  6  0  0  0\n  4 10  1  6  0  0  0\n  6 11  1  1  0  0  0\n 12 11  1  0  0  0  0\n  3  6  1  0  0  0  0\nM  END",
        "smiles": "C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O)O1)O)O)O)O.O",
        "formula": "C6H12O6.H2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "198.1714",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "4eb8a4fd-92ac-49e1-a8d0-aec55e488d53",
          "54ef38f9-a7e5-4c24-8255-a498689a976b"
        ],
        "stereo_centers": 5
      },
      "unii": "4L3WC4P6GF"
    }
  ]
}