{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "5ff62aee-5498-4a89-9d0d-d394e024ae5b", "code": "32981-86-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=32981-86-5", "code_system": "CAS", "references": [ "317c755f-fe4b-4f2f-bc06-ca9e1d7b956e", "f560776a-31eb-4024-b23e-c6aa7c18e44f" ] }, { "uuid": "d510555e-7451-4838-b229-22bdf95df36e", "code": "154272", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/154272", "code_system": "PUBCHEM", "references": [ "317c755f-fe4b-4f2f-bc06-ca9e1d7b956e" ] }, { "uuid": "198c72c9-1bcd-b877-d1eb-76b9ef4b9cfa", "code": "10-Deacetylbaccatin III", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/10-Deacetylbaccatin_III", "code_system": "WIKIPEDIA", "references": [ "ba8709f6-ab37-c4be-12f4-69ed69ca8cee" ] }, { "uuid": "3cb4ff92-6f7d-308f-4b06-006eac1bacbd", "code": "18193", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:18193", "code_system": "CHEBI", "references": [ "aaf5b601-f5e7-8183-13d5-b8b5a63ea078" ] }, { "uuid": "5b0ecc60-358a-6d68-218c-7403aaac1609", "code": "DTXSID80865659", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80865659", "code_system": "EPA CompTox", "references": [ "aaf5b601-f5e7-8183-13d5-b8b5a63ea078" ] }, { "uuid": "fe2f6b6d-824b-439d-a4dc-c466146c0ce9", "code": "4K6EWW2Z45", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "71b97e7a-ada6-ba85-837e-f3d0a347574e", "code": "251677", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=251677", "code_system": "NSC", "references": [ "7e61b7a7-36b5-bac9-8d09-87df0270de7b" ] } ], "substance_class": "chemical", "names": [ { "uuid": "54526543-dfce-4da1-8f6e-9aae0dd1faef", "name": "10-DEACETYL BACCATIN III", "stdName": "10-DEACETYL BACCATIN III", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b30ff544-fd9b-4045-8299-12c802785012", "fd37f2a4-17b3-448e-9bb6-7a1a074a37f0" ], "display_name": false }, { "uuid": "f6ad7e45-ffc7-461b-be19-2df1e01dfbc7", "name": "10-DEACETYL-BACCATIN III", "stdName": "10-DEACETYL-BACCATIN III", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b30ff544-fd9b-4045-8299-12c802785012", "fd37f2a4-17b3-448e-9bb6-7a1a074a37f0" ], "display_name": false }, { "uuid": "2fcb6710-fc57-4647-9ee4-38fb724892ff", "name": "10-DEACETYLBACCATIN III", "stdName": "10-DEACETYLBACCATIN III", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f3d7d2b1-6c8d-493a-854a-0651484b6d5c", "fd37f2a4-17b3-448e-9bb6-7a1a074a37f0" ], "display_name": true }, { "uuid": "df717e91-80fe-49f1-9d9e-c0f416ea7024", "name": "10.BETA.-DEACETYLBACCATIN III", "stdName": "10.BETA.-DEACETYLBACCATIN III", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b30ff544-fd9b-4045-8299-12c802785012", "fd37f2a4-17b3-448e-9bb6-7a1a074a37f0" ], "display_name": false }, { "uuid": "8edf9a24-5fa6-4258-af3a-1226df539f85", "name": "7,11-METHANO-5H-CYCLODECA(3,4)BENZ(1,2-B)OXET-5-ONE, 12B-(ACETYLOXY)-12-(BENZOYLOXY)-1,2A,3,4,4A,6,9,10,11,12,12A,12B-DODECAHYDRO-4,6,9,11-TETRAHYDROXY-4A,8,13,13-TETRAMETHYL-, (2AR,4S,4AS,6R,9S,11S,12S,12AR,12BS)", "stdName": "7,11-METHANO-5H-CYCLODECA(3,4)BENZ(1,2-B)OXET-5-ONE, 12B-(ACETYLOXY)-12-(BENZOYLOXY)-1,2A,3,4,4A,6,9,10,11,12,12A,12B-DODECAHYDRO-4,6,9,11-TETRAHYDROXY-4A,8,13,13-TETRAMETHYL-, (2AR,4S,4AS,6R,9S,11S,12S,12AR,12BS)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "b30ff544-fd9b-4045-8299-12c802785012", "fd37f2a4-17b3-448e-9bb6-7a1a074a37f0" ], "display_name": false }, { "uuid": "31cf4ec3-3d3f-063f-04a4-5d83e1774ba3", "name": "NSC-251677", "stdName": "NSC-251677", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "7e61b7a7-36b5-bac9-8d09-87df0270de7b" ], "display_name": false } ], "references": [ { "uuid": "f3d7d2b1-6c8d-493a-854a-0651484b6d5c", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "fd37f2a4-17b3-448e-9bb6-7a1a074a37f0", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b30ff544-fd9b-4045-8299-12c802785012", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "317c755f-fe4b-4f2f-bc06-ca9e1d7b956e", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391852000, "tags": [ "NOMEN" ] }, { "uuid": "7a4a14ac-a739-4b8e-8119-8ccf89907f85", "citation": "SRS import [4K6EWW2Z45]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4K6EWW2Z45", "doc_type": "SRS", "public_domain": true, "document_date": 1493391852000, "tags": [ "NOMEN" ] }, { "uuid": "1da182ae-f741-411c-8c6e-d2ad90885cd0", "citation": "STN; DMF 25294", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ba8709f6-ab37-c4be-12f4-69ed69ca8cee", "citation": "WIKI", "url": "https://en.wikipedia.org/wiki/10-Deacetylbaccatin_III", "doc_type": "WIKI", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "f560776a-31eb-4024-b23e-c6aa7c18e44f", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "7e61b7a7-36b5-bac9-8d09-87df0270de7b", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "aaf5b601-f5e7-8183-13d5-b8b5a63ea078", "doc_type": "SYSTEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "fb73bcef-bd68-46d1-8aa2-c8ac15ff82fb", "id": "fb73bcef-bd68-46d1-8aa2-c8ac15ff82fb", "molfile": "\n Marvin 01132113022D \n\n 39 43 0 0 1 0 999 V2000\n 5.3803 -2.9669 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 5.3803 -2.2221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6221 -1.7151 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 4.6221 -1.0152 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9042 -2.2759 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 3.8505 -1.4908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9531 -1.7556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9531 -1.1678 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1545 -2.0562 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 1.6565 -1.5087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8539 -2.8906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1360 -3.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4586 -2.9669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1360 -4.1244 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 0.5215 -4.4967 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9122 -4.4340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6346 -4.1019 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 2.6346 -4.6493 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5722 -4.1019 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 4.2632 -4.8287 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7293 -5.6677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1061 -6.3138 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9890 -5.6677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5269 -5.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6923 -5.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3110 -5.7753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7732 -6.4080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6032 -6.4080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9042 -3.0880 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 4.6535 -3.3572 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 5.4521 -3.6668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0577 -3.3436 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6535 -4.2589 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3803 -4.5910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9994 -4.2410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3803 -5.3581 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6346 -3.3617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2313 -3.3617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9127 -2.6976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 30 1 1 0 0 0 0\n 1 32 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 1 0 0 0\n 5 3 1 0 0 0 0\n 5 6 1 1 0 0 0\n 5 7 1 0 0 0 0\n 29 5 1 0 0 0 0\n 8 7 2 0 0 0 0\n 9 7 1 0 0 0 0\n 9 10 1 1 0 0 0\n 11 9 1 0 0 0 0\n 11 12 2 0 0 0 0\n 37 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 12 1 0 0 0 0\n 14 15 1 6 0 0 0\n 14 16 1 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 1 1 0 0 0\n 19 17 1 0 0 0 0\n 17 37 1 0 0 0 0\n 19 20 1 0 0 0 0\n 29 19 1 1 0 0 0\n 21 20 1 0 0 0 0\n 22 21 2 0 0 0 0\n 23 21 1 0 0 0 0\n 24 23 1 0 0 0 0\n 28 23 2 0 0 0 0\n 25 24 2 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 2 0 0 0 0\n 27 28 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 30 33 1 6 0 0 0\n 32 31 1 0 0 0 0\n 34 33 1 0 0 0 0\n 35 34 1 0 0 0 0\n 36 34 2 0 0 0 0\n 38 37 1 0 0 0 0\n 39 37 1 0 0 0 0\nM END", "smiles": "CC1=C2[C@H](C(=O)[C@]3(C)[C@H](C[C@@H]4[C@@](CO4)([C@H]3C([C@](C[C@@H]1O)(C2(C)C)O)OC(=O)c5ccccc5)OC(=O)C)O)O", "formula": "C29H36O10", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "01a44d23-5aaa-49f6-918b-984f836a4986" }, "defined_stereo": 8, "ez_centers": 0, "molecular_weight": "544.5913", "optical_activity": "UNSPECIFIED", "stereo_centers": 9 } ], "definition_level": "COMPLETE", "uuid": "650437d3-d933-490f-9dde-c117635a6457", "version": "7", "structure": { "id": "21ef53a0-4c64-4b0a-8a02-c973753dba7a", "molfile": "\n Marvin 01132101552D \n\n 41 45 0 0 1 0 999 V2000\n 3.9663 -2.3121 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 3.9663 -3.1371 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 4.7275 -3.4106 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.5388 -3.7251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1540 -3.3968 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4659 -3.0141 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.4659 -2.2574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6956 -1.7424 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 4.6956 -1.0313 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1268 -2.6403 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7275 -4.3266 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4659 -4.6640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4659 -5.4433 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0948 -4.3084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6290 -4.1671 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 2.6765 -4.1671 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 1.9426 -4.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1541 -4.1900 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 0.5298 -4.5682 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1541 -3.4106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4659 -3.0141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8834 -2.9366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1888 -2.0889 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 3.0001 -1.7835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0001 -1.1864 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6828 -1.5327 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6765 -3.4152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2827 -3.4152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9590 -2.7405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6765 -4.7232 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3310 -4.9055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7886 -5.7578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1714 -6.4142 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0365 -5.7578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5671 -5.1106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7192 -5.1106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3319 -5.8672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8014 -6.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6446 -6.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6545 -2.6995 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9117 -1.5145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 1 1 0 0 0 0\n 8 9 1 1 0 0 0\n 6 10 1 6 0 0 0\n 6 3 1 0 0 0 0\n 3 11 1 6 0 0 0\n 12 11 1 0 0 0 0\n 13 12 2 0 0 0 0\n 14 12 1 0 0 0 0\n 15 2 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 1 6 0 0 0\n 18 20 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 20 2 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 1 1 0 0 0 0\n 25 24 2 0 0 0 0\n 23 26 1 1 0 0 0\n 27 22 1 0 0 0 0\n 28 27 1 0 0 0 0\n 29 27 1 0 0 0 0\n 27 16 1 0 0 0 0\n 16 30 1 1 0 0 0\n 15 31 1 6 0 0 0\n 32 31 1 0 0 0 0\n 33 32 2 0 0 0 0\n 34 32 1 0 0 0 0\n 35 34 1 0 0 0 0\n 36 35 2 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 2 0 0 0 0\n 38 39 1 0 0 0 0\n 39 34 2 0 0 0 0\n 2 40 1 6 0 0 0\n 1 41 1 1 0 0 0\nM END", "smiles": "CC1=C2[C@H](C(=O)[C@]3(C)[C@H](C[C@]4([H])[C@@](CO4)([C@@]3([H])[C@@H]([C@](C[C@@H]1O)(C2(C)C)O)OC(=O)c5ccccc5)OC(=O)C)O)O", "formula": "C29H36O10", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 9, "ez_centers": 0, "molecular_weight": "544.5913", "optical_activity": "UNSPECIFIED", "references": [ "7a4a14ac-a739-4b8e-8119-8ccf89907f85", "1da182ae-f741-411c-8c6e-d2ad90885cd0" ], "stereo_centers": 9 }, "unii": "4K6EWW2Z45" } ] }