{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "349edda6-3cc2-40a8-8a0c-144874ede405",
          "code": "133-37-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=133-37-9",
          "code_system": "CAS",
          "references": [
            "acf978dd-be70-40a6-8cfa-a8df48faa598",
            "f4bee1d4-6224-4446-b45f-42922dd8e1bc"
          ]
        },
        {
          "uuid": "77922dea-a124-4a19-b013-f06dcabbbfb9",
          "code": "21 CFR 331.11",
          "comments": "PART 331 -- ANTACID PRODUCTS FOR OVER-THE-COUNTER (OTC) HUMAN USE|Subpart B--Active Ingredients|Sec. 331.11 Listing of specific active ingredients.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=331.11",
          "code_system": "CFR",
          "references": [
            "acf978dd-be70-40a6-8cfa-a8df48faa598"
          ]
        },
        {
          "uuid": "26ca6b47-f3de-467b-8497-39181f91626f",
          "code": "21 CFR 331.15",
          "comments": "PART 331 -- ANTACID PRODUCTS FOR OVER-THE-COUNTER (OTC) HUMAN USE|Subpart B--Active Ingredients|Sec. 331.15 Combination with nonantacid active ingredients.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=331.15",
          "code_system": "CFR",
          "references": [
            "acf978dd-be70-40a6-8cfa-a8df48faa598"
          ]
        },
        {
          "uuid": "957b6075-1c59-4d01-8796-7dd2c03d19b2",
          "code": "DL-TARTARIC ACID",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=5161",
          "code_system": "JECFA EVALUATION",
          "references": [
            "acf978dd-be70-40a6-8cfa-a8df48faa598"
          ]
        },
        {
          "uuid": "9a43c915-39bc-4755-8efe-be7d003672e6",
          "code": "205-105-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.642",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "acf978dd-be70-40a6-8cfa-a8df48faa598"
          ]
        },
        {
          "uuid": "a212a42a-b0bc-45a9-a314-ddadc95b8993",
          "code": "m10474",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10474?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "acf978dd-be70-40a6-8cfa-a8df48faa598"
          ]
        },
        {
          "uuid": "f6d45c8a-a06c-8f03-c49e-0c24bae50e24",
          "code": "DTXSID5046986",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5046986",
          "code_system": "EPA CompTox",
          "references": [
            "8dbcee75-1871-201f-eeb7-1b347cb679b9"
          ]
        },
        {
          "uuid": "d8f29f66-5940-9cf7-2b08-779abc02d868",
          "code": "1803725",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1803725/allProperties.xml?prop=all",
          "code_system": "RXCUI"
        },
        {
          "uuid": "6a0f63dd-a251-4c9a-84c0-17dc3d4b305a",
          "code": "4J4Z8788N8",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "22f2a565-83ca-f4f2-8e5c-764985e15dac",
          "code": "26849",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:26849",
          "code_system": "CHEBI",
          "references": [
            "98257030-92a7-e3b1-11f6-2045cd44d53c"
          ]
        },
        {
          "uuid": "b3dbc6ef-0a63-3af6-ea43-8d71c8f65551",
          "code": "148314",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=148314",
          "code_system": "NSC",
          "references": [
            "09625fdd-3a49-6c0b-8ccb-a303ecf6b7da"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "6103e2d6-8f1c-4c24-bf94-b9b8c70091a3",
          "amount": {
            "uuid": "cd59ae1b-e9b9-4e8c-87f3-5b4d4f8a7314"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "24ab0d7e-8439-4025-8ef4-1ec5f6489de3",
            "refuuid": "483ed44e-12aa-4eff-936a-7ecaca3087df",
            "name": "DISODIUM (±)-TARTRATE",
            "unii": "WDT27AD907",
            "linking_id": "WDT27AD907",
            "ref_pname": "DISODIUM (±)-TARTRATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f658bfbc-3bc8-4dbb-b847-64f5a32bc84d",
          "name": "(±)-TARTARIC ACID",
          "stdName": "(+/-)-TARTARIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96ac3b48-57f9-4526-ac68-b8110c4d8b94",
            "aa16d741-dd19-4dae-9e27-d652aea6e7c3"
          ],
          "display_name": false
        },
        {
          "uuid": "e629ca66-fb0e-4e9e-97e3-4007b348b71f",
          "name": "BUTANEDIOIC ACID, 2,3-DIHYDROXY-, (2R,3R)-REL-",
          "stdName": "BUTANEDIOIC ACID, 2,3-DIHYDROXY-, (2R,3R)-REL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96ac3b48-57f9-4526-ac68-b8110c4d8b94",
            "aa16d741-dd19-4dae-9e27-d652aea6e7c3"
          ],
          "display_name": false
        },
        {
          "uuid": "6c7a53c8-e337-40ac-8aeb-1bc44dcba3ca",
          "name": "DL-TARTARIC ACID",
          "stdName": "DL-TARTARIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa16d741-dd19-4dae-9e27-d652aea6e7c3",
            "b817674f-72d2-472f-a108-f9bab6eb44b2",
            "bde04fd5-f1ff-49ad-8d8b-f9072ec55762",
            "4b2a8f3e-8df6-4f2d-ae3c-7a51f917c854"
          ],
          "display_name": false
        },
        {
          "uuid": "4cf0e63d-058f-483b-8f9a-c2c4604ef114",
          "name": "DL-TARTARIC ACID [MI]",
          "stdName": "DL-TARTARIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa16d741-dd19-4dae-9e27-d652aea6e7c3",
            "bde04fd5-f1ff-49ad-8d8b-f9072ec55762"
          ],
          "display_name": false
        },
        {
          "uuid": "d320be38-4a10-4343-99db-162a13aeb3b1",
          "name": "NSC-148314",
          "stdName": "NSC-148314",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa16d741-dd19-4dae-9e27-d652aea6e7c3",
            "dcea0573-af23-446b-8068-e88f187dc4e1"
          ],
          "display_name": false
        },
        {
          "uuid": "831e3105-fd68-47fb-88a7-919be03a78bc",
          "name": "RACEMIC ACID",
          "stdName": "RACEMIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa16d741-dd19-4dae-9e27-d652aea6e7c3",
            "a362887d-d298-4899-94c5-ca620cdd6b70"
          ],
          "display_name": false
        },
        {
          "uuid": "a6a28d3b-56cf-4d32-af7f-2f9d3b0352f0",
          "name": "RACEMIC TARTARIC ACID",
          "stdName": "RACEMIC TARTARIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa16d741-dd19-4dae-9e27-d652aea6e7c3",
            "a362887d-d298-4899-94c5-ca620cdd6b70"
          ],
          "display_name": false
        },
        {
          "uuid": "4e832a9f-8812-4b7e-afb0-7a7ca6b5d7be",
          "name": "REL-(2R,3R)-2,3-DIHYDROXYBUTANEDIOIC ACID",
          "stdName": "REL-(2R,3R)-2,3-DIHYDROXYBUTANEDIOIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa16d741-dd19-4dae-9e27-d652aea6e7c3",
            "a362887d-d298-4899-94c5-ca620cdd6b70"
          ],
          "display_name": false
        },
        {
          "uuid": "9f5f74b8-c52b-40df-adb1-8923ddd70469",
          "name": "RESOLVABLE TARTARIC ACID",
          "stdName": "RESOLVABLE TARTARIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa16d741-dd19-4dae-9e27-d652aea6e7c3",
            "a362887d-d298-4899-94c5-ca620cdd6b70"
          ],
          "display_name": false
        },
        {
          "uuid": "399085c0-8ffa-4319-90b9-ec118423c3ef",
          "name": "TARTARIC ACID, (±)-",
          "stdName": "TARTARIC ACID, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a954fc3f-876f-46f6-a19f-62a8cafbc71c",
            "aa16d741-dd19-4dae-9e27-d652aea6e7c3"
          ],
          "display_name": false
        },
        {
          "uuid": "cc8b0ec9-64bc-40ec-a3f6-0b0f29789981",
          "name": "TARTARIC ACID, DL-",
          "stdName": "TARTARIC ACID, DL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9e1ba4b5-eebe-419a-a286-ba8635c30736",
            "96ac3b48-57f9-4526-ac68-b8110c4d8b94",
            "8c767381-c154-4949-90ca-30f2547e4474"
          ],
          "display_name": true
        },
        {
          "uuid": "4b38a42e-6c9d-4681-aa20-e241ce44a6cc",
          "name": "TARTARIC ACID, DL- [II]",
          "stdName": "TARTARIC ACID, DL- [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9e1ba4b5-eebe-419a-a286-ba8635c30736",
            "96ac3b48-57f9-4526-ac68-b8110c4d8b94"
          ],
          "display_name": false
        },
        {
          "uuid": "9f6fe202-185e-4364-b5a2-1de6b737f7c0",
          "name": "TARTARIC ACID,DL-",
          "stdName": "TARTARIC ACID,DL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b9925867-ae99-4d44-9acd-45f6a1b30aad",
            "aa16d741-dd19-4dae-9e27-d652aea6e7c3",
            "608fde70-4b25-4e1b-999f-6ef4b8e657e3"
          ],
          "display_name": false
        },
        {
          "uuid": "2cd1527b-5aab-431a-b83b-722a88755ca2",
          "name": "TARTARIC ACID,DL- [VANDF]",
          "stdName": "TARTARIC ACID,DL- [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa16d741-dd19-4dae-9e27-d652aea6e7c3",
            "608fde70-4b25-4e1b-999f-6ef4b8e657e3"
          ],
          "display_name": false
        },
        {
          "uuid": "b567680d-3ffa-43ef-94f1-b580123f4475",
          "name": "UVIC ACID",
          "stdName": "UVIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa16d741-dd19-4dae-9e27-d652aea6e7c3",
            "a362887d-d298-4899-94c5-ca620cdd6b70"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "96ac3b48-57f9-4526-ac68-b8110c4d8b94",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9e1ba4b5-eebe-419a-a286-ba8635c30736",
          "citation": "MERCK OTC",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa16d741-dd19-4dae-9e27-d652aea6e7c3",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "608fde70-4b25-4e1b-999f-6ef4b8e657e3",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bde04fd5-f1ff-49ad-8d8b-f9072ec55762",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a954fc3f-876f-46f6-a19f-62a8cafbc71c",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a362887d-d298-4899-94c5-ca620cdd6b70",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b2a8f3e-8df6-4f2d-ae3c-7a51f917c854",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dcea0573-af23-446b-8068-e88f187dc4e1",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "acf978dd-be70-40a6-8cfa-a8df48faa598",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390812000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5696e935-86ae-4217-b224-37f3fde34f08",
          "citation": "SRS import [4J4Z8788N8]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4J4Z8788N8",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390812000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b817674f-72d2-472f-a108-f9bab6eb44b2",
          "citation": "DL-TARTARIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8c767381-c154-4949-90ca-30f2547e4474",
          "citation": "TARTARIC ACID, DL- [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b9925867-ae99-4d44-9acd-45f6a1b30aad",
          "citation": "TARTARIC ACID,DL- [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8dbcee75-1871-201f-eeb7-1b347cb679b9",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=133-37-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f4bee1d4-6224-4446-b45f-42922dd8e1bc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "98257030-92a7-e3b1-11f6-2045cd44d53c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "09625fdd-3a49-6c0b-8ccb-a303ecf6b7da",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "42fe633b-540c-a3aa-6231-18f56c71f18e",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0a344547-eef3-4210-a696-863deb016829",
          "id": "0a344547-eef3-4210-a696-863deb016829",
          "molfile": "\n  Marvin  01132100472D          \n\n 10  9  0  0  0  0            999 V2000\n   -2.7873   -2.7841    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   -2.7873   -3.6307    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4907   -2.3640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4907   -1.5304    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.2168   -2.7743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0644   -2.3934    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   -2.0482   -1.5695    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3513   -2.8101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3513   -3.6502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6186   -2.4227    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  6  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  2  0  0  0  0\n  6  7  1  1  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\nM  END",
          "smiles": "[C@@H]([C@H](C(=O)O)O)(C(=O)O)O",
          "formula": "C4H6O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a923e86d-d982-4b98-bd57-fb70012d9f2b"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "150.087",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d6ce9ce9-9975-49b7-b5c1-2acc9f6b5fb9",
      "version": "15",
      "structure": {
        "id": "977bd8ac-4500-46c9-b9d2-859b1e6057a7",
        "molfile": "\n  Marvin  01132107522D          \n\n 10  9  0  0  0  0            999 V2000\n   -2.7873   -2.7841    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -2.0644   -2.3934    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -3.4907   -2.3640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3513   -2.8101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4907   -1.5304    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3513   -3.6502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0482   -1.5695    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7873   -3.6307    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.2168   -2.7743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6186   -2.4227    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  3  2  0  0  0  0\n  6  4  2  0  0  0  0\n  2  7  1  1  0  0  0\n  1  8  1  1  0  0  0\n  9  3  1  0  0  0  0\n 10  4  1  0  0  0  0\nM  END",
        "smiles": "[C@@H]([C@H](C(=O)O)O)(C(=O)O)O",
        "formula": "C4H6O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "150.087",
        "optical_activity": "( + / - )",
        "references": [
          "96ac3b48-57f9-4526-ac68-b8110c4d8b94",
          "5696e935-86ae-4217-b224-37f3fde34f08"
        ],
        "stereo_centers": 2
      },
      "unii": "4J4Z8788N8"
    }
  ]
}