{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "ae0b03a4-389f-4227-955b-cf873d3d21ae", "code": "M01AX21", "comments": "ATC|MUSCULO-SKELETAL SYSTEM|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS, NON-STEROIDS|Other antiinflammatory and antirheumatic agents, non-steroids|diacerein", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=M01AX21&showdescription=yes", "code_system": "WHO-ATC", "references": [ "6f455b7e-9779-4723-984f-556aa0172441" ] }, { "uuid": "4a91b7f7-e4dc-4c2d-a345-ce902a7e8219", "code": "QM01AX21", "comments": "VATC|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS, NON-STEROIDS|Other antiinflammatory and antirheumatic agents, non-steroids|diacerein", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QM01AX21&showdescription=yes", "code_system": "WHO-VATC", "references": [ "6f455b7e-9779-4723-984f-556aa0172441" ] }, { "uuid": "11332d2d-ac5d-449b-ab15-16aad09ce2f1", "code": "13739-02-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=13739-02-1", "code_system": "CAS", "references": [ "6f455b7e-9779-4723-984f-556aa0172441", "e0a5e1ba-576e-43af-8710-ddea7a9c9aaa" ] }, { "uuid": "f1f36e9e-66cf-4eaf-80b5-a9821fde83a8", "code": "C025292", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67025292", "code_system": "MESH", "references": [ "6f455b7e-9779-4723-984f-556aa0172441" ] }, { "uuid": "b6b6612e-78db-4f3d-b81a-d199d91b3c36", "code": "DIACEREIN", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Diacerein", "code_system": "WIKIPEDIA", "references": [ "6f455b7e-9779-4723-984f-556aa0172441" ] }, { "uuid": "a8cb0d36-5e61-442b-a7a9-7c0faf894d02", "code": "SUB07060MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "6f455b7e-9779-4723-984f-556aa0172441" ] }, { "uuid": "00ff8d9b-d774-4a2d-8086-cf9e2c424be9", "code": "5371", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=5371", "code_system": "INN", "references": [ "6f455b7e-9779-4723-984f-556aa0172441" ] }, { "uuid": "610b70f0-b92e-4591-aa69-45cf1974d6bb", "code": "22759", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/22759/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "6f455b7e-9779-4723-984f-556aa0172441" ] }, { "uuid": "5c68ef3c-cd69-431e-9834-b93bb4e4475a", "code": "m4233", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m4233?q=authorize", "code_system": "MERCK INDEX", "references": [ "6f455b7e-9779-4723-984f-556aa0172441" ] }, { "uuid": "4e358279-1811-4c60-95da-a1036074a8e4", "code": "CHEMBL41286", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL41286", "code_system": "ChEMBL", "references": [ "6f455b7e-9779-4723-984f-556aa0172441" ] }, { "uuid": "89340192-b227-47a6-bd2c-7117e33b37f9", "code": "237-310-2", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.033.904", "code_system": "ECHA (EC/EINECS)", "references": [ "6f455b7e-9779-4723-984f-556aa0172441" ] }, { "uuid": "9bb6dff6-37d3-4bb4-aa90-c13e242cc24c", "code": "26248", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/26248", "code_system": "PUBCHEM", "references": [ "6f455b7e-9779-4723-984f-556aa0172441" ] }, { "uuid": "af2fe8ab-d29c-865d-518a-265108240591", "code": "DTXSID4045636", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4045636", "code_system": "EPA CompTox", "references": [ "7251eae0-af32-fc92-132f-f5c213760025" ] }, { "uuid": "dc63432b-fa0e-3db3-cd83-52b34a3c931a", "code": "448614", "comments": "ORPHAN DRUG|Designated|Treatment of epidermolysis bullosa", "type": "PRIMARY", "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=448614", "code_system": "FDA ORPHAN DRUG" }, { "uuid": "68c270c4-8205-4c06-8998-b82c23983f4d", "code": "m9569", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m9569", "code_system": "MERCK INDEX", "references": [ "5e36dceb-b4d7-58cb-c49d-03590075265e" ] }, { "uuid": "1aa98029-225b-03ba-498a-59074b9a1a0c", "code": "660318", "comments": "ORPHAN DRUG|Designated|Treatment of epidermolysis bullosa", "type": "PRIMARY", "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=660318", "code_system": "FDA ORPHAN DRUG", "references": [ "11a0e5f2-d426-4b9e-4db7-2a5dc83ebd27" ] }, { "uuid": "449a3db7-7787-ec84-be9d-632f04edfb97", "code": "EMA/OD/0000001223", "comments": "EU ORPHAN DRUG|Negative|Treatment of epidermolysis bullosa", "type": "PRIMARY", "url": "https://www.ema.europa.eu/en/medicines/human/orphan-designations/emaod0000001223", "code_system": "EU-Orphan Drug", "references": [ "11a0e5f2-d426-4b9e-4db7-2a5dc83ebd27" ] }, { "uuid": "2cf19776-255a-34e8-82ff-31f8a3d2544c", "code": "C166759", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C166759", "code_system": "NCI_THESAURUS", "references": [ "92b7028a-f5ca-8fad-f087-b095363c7db7" ] }, { "uuid": "33dc45a8-17c9-4f3a-bb88-29d5d1651773", "code": "4HU6J11EL5", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "99cea0b8-ed58-eb44-cf04-77de28b07a02", "code": "849", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/849", "code_system": "DRUG CENTRAL", "references": [ "11a0e5f2-d426-4b9e-4db7-2a5dc83ebd27" ] }, { "uuid": "05c1bae0-4f61-8441-ccc9-ced48616e37f", "code": "DB11994", "type": "PRIMARY", "url": "https://go.drugbank.com/drugs/DB11994", "code_system": "DRUG BANK", "references": [ "11a0e5f2-d426-4b9e-4db7-2a5dc83ebd27" ] }, { "uuid": "a11f41f1-a66f-280d-2847-62c53cba473e", "code": "100000090475", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "866b4345-9206-7de5-8380-34e7981a2b5f" ] }, { "uuid": "2445acd8-f787-fd48-7109-44ef25eaeae5", "code": "FG-184", "type": "PRIMARY", "url": "https://searchusan.ama-assn.org/finder/usan/search/FG-184/relevant/1/", "code_system": "USAN", "references": [ "578c9b4a-14f5-63fc-56bf-9ef5a793c39f" ] }, { "uuid": "81233822-e632-76c2-9c52-8b8cd6933a9b", "code": "758147", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=758147", "code_system": "NSC", "references": [ "a8fabffa-496e-6940-da29-7bee4667cc4f" ] } ], "substance_class": "chemical", "references": [ { "uuid": "becaa337-d75b-49a2-976f-4945c1e196a5", "citation": "USP DICTIONARY 2009", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "2e4a3ae1-7e2b-419b-bc48-7113c933230c", "citation": "MERCK", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "dbc68079-a942-4483-b9b4-3223c01914a3", "citation": "MERCK INDEX", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4bc3155a-2cd3-46b3-890a-23af0bbb4fc9", "citation": "USP DICTIONARY 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "448954be-1c28-4459-a3e1-9afb9087584a", "citation": "INN Proposed List 50", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL50.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "b9719652-d32c-4768-8d19-aea149a082d1", "citation": "MARTINDALE 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7747b8f1-06d8-49a1-bc15-10f1f794dcd5", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f2ef05ea-06ee-4f9a-ad82-e29860e272cc", "citation": "KEGG 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e442c94a-9879-446f-a79d-817323de80d2", "citation": "D07270", "doc_type": "KEGG", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4596f591-07e1-414b-aa35-b94a73193f89", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "df333a9d-f330-4420-a4a9-2f7f53094069", "citation": "http://en.wikipedia.org/wiki/Diacerein", "url": "http://en.wikipedia.org/wiki/Diacerein", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "845ee127-b0da-4859-9cc9-e614fc340661", "citation": "Annual Reports in Medicinal Chemistry, Volume 47\\", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6f455b7e-9779-4723-984f-556aa0172441", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390846000, "tags": [ "NOMEN" ] }, { "uuid": "f29fd099-ad89-4b38-af4a-dd7e2ff84c58", "citation": "DRUGS [1997, 53(1):98-106", "doc_type": "JOURNAL ARTICLE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a5f786ab-ef0e-4e17-9d87-b2ffc2287a79", "citation": "SRS import [4HU6J11EL5]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4HU6J11EL5", "doc_type": "SRS", "public_domain": true, "document_date": 1493390846000, "tags": [ "NOMEN" ] }, { "uuid": "9c078e10-a5cb-4785-8cfa-c1f5d7dcb954", "citation": "DIACEREIN [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "af22e5f2-b827-448b-a69e-c7a41f1ae250", "citation": "DIACEREIN [MART.]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "a9d6775b-ec94-4c6f-8b87-706abc9f4166", "citation": "DIACEREIN [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "cc634472-f7e2-40bb-9e71-5fba628fcad9", "citation": "DIACEREIN [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "7251eae0-af32-fc92-132f-f5c213760025", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=13739-02-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "5e36dceb-b4d7-58cb-c49d-03590075265e", "citation": "MI", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "866b4345-9206-7de5-8380-34e7981a2b5f", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "ade948fc-81cd-3b17-0e4f-10fa102f230b", "citation": "USAN COUN 2018", "doc_type": "USANCOUN", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "11a0e5f2-d426-4b9e-4db7-2a5dc83ebd27", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "e0a5e1ba-576e-43af-8710-ddea7a9c9aaa", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "578c9b4a-14f5-63fc-56bf-9ef5a793c39f", "citation": "USAD COUN", "doc_type": "USANCOUN", "public_domain": true }, { "uuid": "92b7028a-f5ca-8fad-f087-b095363c7db7", "citation": "NCIT", "doc_type": "NCI THESAURUS", "public_domain": true }, { "uuid": "2fd0f578-e57c-297e-0333-e84d2914c617", "citation": "EP 10.5", "doc_type": "EP", "public_domain": true }, { "uuid": "a8fabffa-496e-6940-da29-7bee4667cc4f", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "9eda7e73-c2e3-45b9-b11a-ca6f87db2dac", "citation": "https://epidermolysisbullosanews.com/2018/03/08/twi-biotech-launches-phase-2-trial-ac-203-to-treat-eb-patients/", "url": "https://epidermolysisbullosanews.com/2018/03/08/twi-biotech-launches-phase-2-trial-ac-203-to-treat-eb-patients/", "doc_type": "WEB PAGE", "public_domain": true }, { "uuid": "3b32826b-1d6d-0cfe-c157-f422f6b49bf2", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "274cc98b-8f89-f251-11a7-0c42aa5459e1", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "c6f0612b-f65c-4f65-bebb-f27570e1daed", "id": "c6f0612b-f65c-4f65-bebb-f27570e1daed", "molfile": "\n Marvin 01132110172D \n\n 27 29 0 0 0 0 999 V2000\n -2.8272 -10.0952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8272 -10.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5424 -11.3345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1120 -11.3345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1120 -12.1581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8272 -12.5738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8272 -13.3896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1120 -13.8053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3994 -13.3896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6868 -13.8053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6868 -14.6289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0258 -13.3896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7436 -13.8053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4562 -13.3896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4562 -12.5738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7436 -12.1581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7436 -11.3345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4562 -10.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1714 -11.3345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4562 -10.0952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0258 -12.5738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6868 -12.1581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6868 -11.3345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3994 -12.5738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1714 -13.8053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8840 -13.3974 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1714 -14.6289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 2 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 1 0 0 0 0\n 5 24 2 0 0 0 0\n 7 6 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 9 24 1 0 0 0 0\n 11 10 2 0 0 0 0\n 10 12 1 0 0 0 0\n 13 12 1 0 0 0 0\n 12 21 2 0 0 0 0\n 14 13 2 0 0 0 0\n 14 15 1 0 0 0 0\n 25 14 1 0 0 0 0\n 15 16 2 0 0 0 0\n 17 16 1 0 0 0 0\n 16 21 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 18 2 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 2 0 0 0 0\n 24 22 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 25 2 0 0 0 0\nM END", "smiles": "CC(=O)Oc1cccc2c1C(=O)c3c(cc(cc3OC(=O)C)C(=O)O)C2=O", "formula": "C19H12O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "2eb142a3-1266-4f7c-abcf-19f0466da637" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "368.2945", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "70046fe2-7cc5-45ce-bc48-4e0872481cf3", "version": "34", "structure": { "id": "470b574c-d539-4be5-b129-8aff16ce6b85", "molfile": "\n Marvin 01132103442D \n\n 27 29 0 0 0 0 999 V2000\n 15.6172 -4.2817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9046 -3.8659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1920 -4.2817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6172 -5.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9046 -5.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1920 -5.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3349 -3.8659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4794 -3.8659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3349 -5.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0475 -5.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7627 -5.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0475 -4.2817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3349 -3.0424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4794 -3.0424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7643 -2.6267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0475 -2.6267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9046 -3.0424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9046 -6.3367 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4752 -5.1052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0475 -1.8031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0491 -3.0424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7627 -6.3367 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4794 -5.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7643 -4.2817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7643 -5.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7643 -1.8031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7627 -3.0424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 1 2 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 1 1 0 0 0 0\n 8 3 1 0 0 0 0\n 9 4 1 0 0 0 0\n 10 12 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 7 2 0 0 0 0\n 13 7 1 0 0 0 0\n 14 8 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 13 1 0 0 0 0\n 17 2 2 0 0 0 0\n 18 5 2 0 0 0 0\n 19 11 2 0 0 0 0\n 20 16 2 0 0 0 0\n 21 15 2 0 0 0 0\n 22 11 1 0 0 0 0\n 23 6 1 0 0 0 0\n 24 8 2 0 0 0 0\n 25 23 2 0 0 0 0\n 26 15 1 0 0 0 0\n 27 16 1 0 0 0 0\n 10 9 2 0 0 0 0\n 6 3 2 0 0 0 0\n 25 24 1 0 0 0 0\nM END", "smiles": "CC(=O)Oc1cccc2c1C(=O)c3c(cc(cc3OC(=O)C)C(=O)O)C2=O", "formula": "C19H12O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "368.2945", "optical_activity": "NONE", "references": [ "a5f786ab-ef0e-4e17-9d87-b2ffc2287a79", "becaa337-d75b-49a2-976f-4945c1e196a5", "448954be-1c28-4459-a3e1-9afb9087584a" ], "stereo_centers": 0 }, "unii": "4HU6J11EL5", "relationships": [ { "uuid": "186913d7-9ea2-495b-bf87-c7d276c5bd5a", "amount": { "uuid": "3499e00d-2b2e-4cfa-8d59-b08c99a3431b" }, "type": "METABOLITE ACTIVE->PRODRUG", "references": [ "f29fd099-ad89-4b38-af4a-dd7e2ff84c58" ], "related_substance": { "uuid": "bcf2ca44-3d53-4435-9299-7da188aa4bcc", "refuuid": "a793913d-02c7-4241-8e04-3412ad723a47", "name": "RHEIN", "unii": "YM64C2P6UX", "linking_id": "YM64C2P6UX", "ref_pname": "RHEIN", "substance_class": "reference" } }, { "uuid": "e252ade1-de34-466a-bdaf-33296787d1e2", "amount": { "uuid": "25d1bdea-fcca-4943-b41a-175582f27352" }, "type": "METABOLITE ACTIVE->PRODRUG", "related_substance": { "uuid": "004d3984-ca0b-4388-ac9f-c9a0e84195cf", "refuuid": "a793913d-02c7-4241-8e04-3412ad723a47", "name": "RHEIN", "unii": "YM64C2P6UX", "linking_id": "YM64C2P6UX", "ref_pname": "RHEIN", "substance_class": "reference" } }, { "uuid": "e34bfe82-0156-44f6-89c3-ac07a4ae44cd", "amount": { "uuid": "89e71c69-a909-406b-b931-7eb9b91d35b7" }, "type": "ACTIVE MOIETY", "related_substance": { "uuid": "3b471dd6-433b-4f2a-acdf-107e64ab6da9", "refuuid": "a793913d-02c7-4241-8e04-3412ad723a47", "name": "RHEIN", "unii": "YM64C2P6UX", "linking_id": "YM64C2P6UX", "ref_pname": "RHEIN", "substance_class": "reference" } } ], "names": [ { "uuid": "efed4cd8-9301-458d-9734-a4348c2472d7", "name": "1,8-DIACETOXY-3-CARBOXYANTHRAQUINONE", "stdName": "1,8-DIACETOXY-3-CARBOXYANTHRAQUINONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "2e4a3ae1-7e2b-419b-bc48-7113c933230c", "dbc68079-a942-4483-b9b4-3223c01914a3" ], "display_name": false }, { "uuid": "484b5b46-13da-56a8-75cc-480c4a4dd683", "name": "2-ANTHRACENECARBOXYLIC ACID, 4,5-BIS(ACETYLOXY)-9,10-DIHYDRO-9,10-DIOXO-", "stdName": "2-ANTHRACENECARBOXYLIC ACID, 4,5-BIS(ACETYLOXY)-9,10-DIHYDRO-9,10-DIOXO-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ade948fc-81cd-3b17-0e4f-10fa102f230b" ], "display_name": false }, { "uuid": "f136c83a-591e-49fd-bdca-50ceb66c76e5", "name": "4,5-BIS(ACETYLOXY)-9,10-DIHYDRO-9,10-DIOXO-2-ANTHRACENECARBOXYLIC ACID", "stdName": "4,5-BIS(ACETYLOXY)-9,10-DIHYDRO-9,10-DIOXO-2-ANTHRACENECARBOXYLIC ACID", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "2e4a3ae1-7e2b-419b-bc48-7113c933230c", "dbc68079-a942-4483-b9b4-3223c01914a3" ], "display_name": false }, { "uuid": "0093ac72-0064-490b-8a0c-9eec9975d21b", "name": "4,5-DIACETOXYANTHRAQUINONE-2-CARBOXYLIC ACID", "stdName": "4,5-DIACETOXYANTHRAQUINONE-2-CARBOXYLIC ACID", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "2e4a3ae1-7e2b-419b-bc48-7113c933230c", "dbc68079-a942-4483-b9b4-3223c01914a3" ], "display_name": false }, { "uuid": "5f66bd09-3e97-4b30-b38b-24be2fa87ba1", "name": "9,10-DIHYDRO-4,5-DIHYDROXY-9,10-DIOXO-2-ANTHROIC ACID, DIACETATE", "stdName": "9,10-DIHYDRO-4,5-DIHYDROXY-9,10-DIOXO-2-ANTHROIC ACID, DIACETATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4bc3155a-2cd3-46b3-890a-23af0bbb4fc9" ], "display_name": false }, { "uuid": "9a55a968-c397-45c9-935d-0ad929e1f298", "name": "AC-201", "stdName": "AC-201", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "dbc68079-a942-4483-b9b4-3223c01914a3", "845ee127-b0da-4859-9cc9-e614fc340661" ], "display_name": false }, { "uuid": "45f51e96-4e18-4288-a1c6-70f250fc9b97", "name": "AC-203", "stdName": "AC-203", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "9eda7e73-c2e3-45b9-b11a-ca6f87db2dac" ], "display_name": false }, { "uuid": "58cf98d9-5a49-4557-a364-ef9be89a9a1b", "name": "ARTRODAR", "stdName": "ARTRODAR", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "2e4a3ae1-7e2b-419b-bc48-7113c933230c", "dbc68079-a942-4483-b9b4-3223c01914a3" ], "display_name": false }, { "uuid": "72a9b0bb-d9b4-4537-88d7-4072a5281fa2", "name": "DAR", "stdName": "DAR", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2e4a3ae1-7e2b-419b-bc48-7113c933230c", "dbc68079-a942-4483-b9b4-3223c01914a3" ], "display_name": false }, { "uuid": "61f82532-50a1-42cc-8dda-2787234cb996", "name": "DIACEREIN", "stdName": "DIACEREIN", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "becaa337-d75b-49a2-976f-4945c1e196a5", "448954be-1c28-4459-a3e1-9afb9087584a", "cc634472-f7e2-40bb-9e71-5fba628fcad9", "af22e5f2-b827-448b-a69e-c7a41f1ae250", "7747b8f1-06d8-49a1-bc15-10f1f794dcd5", "b9719652-d32c-4768-8d19-aea149a082d1", "4596f591-07e1-414b-aa35-b94a73193f89", "dbc68079-a942-4483-b9b4-3223c01914a3", "9c078e10-a5cb-4785-8cfa-c1f5d7dcb954", "a9d6775b-ec94-4c6f-8b87-706abc9f4166" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "fe0cb9ba-0efd-4819-b1fa-14172913a5be", "name_org": "USAN" }, { "uuid": "6e4d255c-1721-4b4d-9a93-75c7049b9600", "name_org": "INN" } ] }, { "uuid": "3ec88b8f-63f3-96c0-dbad-e86a6f875ca5", "name": "DIACEREIN [EP MONOGRAPH]", "stdName": "DIACEREIN [EP MONOGRAPH]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2fd0f578-e57c-297e-0333-e84d2914c617" ], "display_name": false }, { "uuid": "416632ad-0420-4a04-8d23-4aad5c233593", "name": "DIACEREIN [MART.]", "stdName": "DIACEREIN [MART.]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b9719652-d32c-4768-8d19-aea149a082d1" ], "display_name": false }, { "uuid": "5d576c0d-eb4f-4244-95f9-e440d2242dcb", "name": "DIACEREIN [MI]", "stdName": "DIACEREIN [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7747b8f1-06d8-49a1-bc15-10f1f794dcd5", "dbc68079-a942-4483-b9b4-3223c01914a3" ], "display_name": false }, { "uuid": "f96ce55c-b3b7-b572-d0b7-5795a4abedee", "name": "DIACEREIN [USAN]", "stdName": "DIACEREIN [USAN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ade948fc-81cd-3b17-0e4f-10fa102f230b" ], "display_name": false, "domains": [ "drug" ], "name_orgs": [ { "uuid": "f9ba3352-9588-46d1-9f84-b1ea8165be2a", "name_org": "USAN" } ] }, { "uuid": "0d8974e6-f594-45dd-a2ec-5cfaf7051e9d", "name": "DIACERHEIN", "stdName": "DIACERHEIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2e4a3ae1-7e2b-419b-bc48-7113c933230c", "dbc68079-a942-4483-b9b4-3223c01914a3" ], "display_name": false }, { "uuid": "3c76827e-72b3-4dfb-a6af-d41183da2bcc", "name": "DIACETYLRHEIN", "stdName": "DIACETYLRHEIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2e4a3ae1-7e2b-419b-bc48-7113c933230c", "dbc68079-a942-4483-b9b4-3223c01914a3" ], "display_name": false }, { "uuid": "2ba2473f-9011-44e8-a74d-ebdf11a5e5fd", "name": "DIORA", "stdName": "DIORA", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "df333a9d-f330-4420-a4a9-2f7f53094069", "dbc68079-a942-4483-b9b4-3223c01914a3" ], "display_name": false }, { "uuid": "ed0530b8-40d5-8d0f-2dbe-cbcc0bcfc24d", "name": "Diacerein [WHO-DD]", "stdName": "DIACEREIN [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "274cc98b-8f89-f251-11a7-0c42aa5459e1" ], "display_name": false }, { "uuid": "7f37106f-ccda-4a51-8cbe-1ce6b0fe3c92", "name": "FISIODAR", "stdName": "FISIODAR", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "2e4a3ae1-7e2b-419b-bc48-7113c933230c", "dbc68079-a942-4483-b9b4-3223c01914a3" ], "display_name": false }, { "uuid": "318bce39-c307-4b37-03cc-7c5bf5a20568", "name": "M-01AX21", "stdName": "M-01AX21", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "ade948fc-81cd-3b17-0e4f-10fa102f230b" ], "display_name": false }, { "uuid": "b1df7995-2a4b-86c4-c0e8-34d8742c4a8b", "name": "M01AX21", "stdName": "M01AX21", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "ade948fc-81cd-3b17-0e4f-10fa102f230b" ], "display_name": false }, { "uuid": "410a51d9-67cb-8f20-58fd-72e00cd73fc6", "name": "NSC-758147", "stdName": "NSC-758147", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "a8fabffa-496e-6940-da29-7bee4667cc4f" ], "display_name": false }, { "uuid": "ad724ed5-6a18-8d88-8d02-c7399c7ba819", "name": "RHEIN DIACETATE [MI]", "stdName": "RHEIN DIACETATE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "5e36dceb-b4d7-58cb-c49d-03590075265e" ], "display_name": false }, { "uuid": "dc4de9d8-e9a9-4863-9416-ee7e8418eec4", "name": "SF-277", "stdName": "SF-277", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "2e4a3ae1-7e2b-419b-bc48-7113c933230c", "dbc68079-a942-4483-b9b4-3223c01914a3" ], "display_name": false }, { "uuid": "2e6a0a3a-15ca-499a-afe5-54397565e4e6", "name": "VERBORIL", "stdName": "VERBORIL", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "df333a9d-f330-4420-a4a9-2f7f53094069", "dbc68079-a942-4483-b9b4-3223c01914a3" ], "display_name": false }, { "uuid": "dca3fef4-bc4f-4980-9fa0-5de6386f9a54", "name": "ZONDAR", "stdName": "ZONDAR", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "e442c94a-9879-446f-a79d-817323de80d2", "f2ef05ea-06ee-4f9a-ad82-e29860e272cc" ], "display_name": false }, { "uuid": "0ed06928-6644-4912-8b65-bbc654552d7b", "name": "diacerein [INN]", "stdName": "DIACEREIN [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "448954be-1c28-4459-a3e1-9afb9087584a" ], "display_name": false } ], "modifications": { "uuid": "d31e21c5-aae0-4e4f-8251-8c7b2376616c" } } ] }